CA1066846A - Preparation of polyphenylene oxide using a manganese (ii) ortho-hydroxyareneoxime chelate reaction promoter - Google Patents
Preparation of polyphenylene oxide using a manganese (ii) ortho-hydroxyareneoxime chelate reaction promoterInfo
- Publication number
- CA1066846A CA1066846A CA230,753A CA230753A CA1066846A CA 1066846 A CA1066846 A CA 1066846A CA 230753 A CA230753 A CA 230753A CA 1066846 A CA1066846 A CA 1066846A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- group
- radicals
- chelate
- phenol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000013522 chelant Substances 0.000 title claims abstract description 24
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 title claims abstract description 13
- 238000006243 chemical reaction Methods 0.000 title claims description 14
- 239000004721 Polyphenylene oxide Substances 0.000 title abstract description 10
- 229920006380 polyphenylene oxide Polymers 0.000 title abstract description 9
- 238000002360 preparation method Methods 0.000 title abstract description 8
- 238000000034 method Methods 0.000 claims abstract description 25
- 150000001412 amines Chemical class 0.000 claims abstract description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 28
- 239000011572 manganese Substances 0.000 claims description 19
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000003446 ligand Substances 0.000 claims description 10
- -1 manganese chelate complex Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims description 7
- 239000012429 reaction media Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 239000000460 chlorine Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052740 iodine Chemical group 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 125000002950 monocyclic group Chemical group 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000007859 condensation product Substances 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000011630 iodine Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Polymers 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 3
- JXEHBRQVIPIGRN-UHFFFAOYSA-N 2-hydroxyimino-2-phenylethanol Chemical compound OCC(=NO)C1=CC=CC=C1 JXEHBRQVIPIGRN-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 150000001491 aromatic compounds Chemical class 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 239000012038 nucleophile Substances 0.000 claims 1
- ORIHZIZPTZTNCU-YVMONPNESA-N salicylaldoxime Chemical compound O\N=C/C1=CC=CC=C1O ORIHZIZPTZTNCU-YVMONPNESA-N 0.000 claims 1
- 239000003054 catalyst Substances 0.000 abstract description 4
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 229920005989 resin Polymers 0.000 abstract 1
- 239000011347 resin Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 150000002500 ions Chemical class 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 6
- 241000040710 Chela Species 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 150000002085 enols Chemical class 0.000 description 5
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 101100137177 Drosophila melanogaster polyph gene Proteins 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000042812 Divales Species 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 229920000265 Polyparaphenylene Polymers 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- GDBCGGFNFKMPAE-UHFFFAOYSA-N 1-decylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCC)=CC=CC2=C1 GDBCGGFNFKMPAE-UHFFFAOYSA-N 0.000 description 2
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical group C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 2
- 101150034533 ATIC gene Proteins 0.000 description 2
- 101100462138 Brassica napus OlnB1 gene Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 2
- 241000556720 Manga Species 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229920006389 polyphenyl polymer Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- JEFSTMHERNSDBC-UHFFFAOYSA-N 1,2-dimethylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC=CCC1(C)O JEFSTMHERNSDBC-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- GPWNWKWQOLEVEQ-UHFFFAOYSA-N 2,4-diaminopyrimidine-5-carbaldehyde Chemical compound NC1=NC=C(C=O)C(N)=N1 GPWNWKWQOLEVEQ-UHFFFAOYSA-N 0.000 description 1
- LBPCXYZANZSPPY-UHFFFAOYSA-N 2,6-bis(3-chloropropyl)phenol Chemical compound OC1=C(CCCCl)C=CC=C1CCCCl LBPCXYZANZSPPY-UHFFFAOYSA-N 0.000 description 1
- NAILKKRDWBJCNH-UHFFFAOYSA-N 2,6-dipropylphenol Chemical compound CCCC1=CC=CC(CCC)=C1O NAILKKRDWBJCNH-UHFFFAOYSA-N 0.000 description 1
- PGJXFACHLLIKFG-UHFFFAOYSA-N 2-methyl-6-phenylphenol Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1O PGJXFACHLLIKFG-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000143476 Bidens Species 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- 241000320892 Clerodendrum phlomidis Species 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- 241000761389 Copa Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000448280 Elates Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- 101100536883 Legionella pneumophila subsp. pneumophila (strain Philadelphia 1 / ATCC 33152 / DSM 7513) thi5 gene Proteins 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 244000131360 Morinda citrifolia Species 0.000 description 1
- 101100001347 Mus musculus Akt1s1 gene Proteins 0.000 description 1
- 101100494762 Mus musculus Nedd9 gene Proteins 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 101150012195 PREB gene Proteins 0.000 description 1
- 241001387976 Pera Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 208000037062 Polyps Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000001537 Ribes X gardonianum Nutrition 0.000 description 1
- 235000001535 Ribes X utile Nutrition 0.000 description 1
- 235000016919 Ribes petraeum Nutrition 0.000 description 1
- 244000281247 Ribes rubrum Species 0.000 description 1
- 235000002355 Ribes spicatum Nutrition 0.000 description 1
- 101100240664 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nmt1 gene Proteins 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 241000610375 Sparisoma viride Species 0.000 description 1
- 241001582722 Xylena Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- GPUADMRJQVPIAS-QCVDVZFFSA-M cerivastatin sodium Chemical compound [Na+].COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 GPUADMRJQVPIAS-QCVDVZFFSA-M 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- POIZGMCHYSVWDU-UHFFFAOYSA-N icosane-1,20-diamine Chemical compound NCCCCCCCCCCCCCCCCCCCCN POIZGMCHYSVWDU-UHFFFAOYSA-N 0.000 description 1
- 230000008676 import Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- IFYDWYVPVAMGRO-UHFFFAOYSA-N n-[3-(dimethylamino)propyl]tetradecanamide Chemical compound CCCCCCCCCCCCCC(=O)NCCCN(C)C IFYDWYVPVAMGRO-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 235000017524 noni Nutrition 0.000 description 1
- 238000005691 oxidative coupling reaction Methods 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 241001233863 rosids Species 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 101150093007 ulaR gene Proteins 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Lubricants (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/491,475 US3972851A (en) | 1974-07-24 | 1974-07-24 | Preparation of polyphenylene oxide using a manganese(II) ortho-hydroxyarene-oxime chelate reaction promoter |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1066846A true CA1066846A (en) | 1979-11-20 |
Family
ID=23952395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA230,753A Expired CA1066846A (en) | 1974-07-24 | 1975-06-26 | Preparation of polyphenylene oxide using a manganese (ii) ortho-hydroxyareneoxime chelate reaction promoter |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3972851A (enExample) |
| JP (1) | JPS5921894B2 (enExample) |
| BE (1) | BE831664A (enExample) |
| CA (1) | CA1066846A (enExample) |
| DE (1) | DE2528045C2 (enExample) |
| DK (1) | DK336375A (enExample) |
| FR (1) | FR2279788A1 (enExample) |
| GB (1) | GB1518186A (enExample) |
| IT (1) | IT1039995B (enExample) |
| NL (1) | NL7508815A (enExample) |
| SE (1) | SE7508406L (enExample) |
| SU (1) | SU686626A3 (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4054553A (en) * | 1975-06-02 | 1977-10-18 | General Electric Company | Polyphenylene oxide process |
| US4097462A (en) * | 1976-01-23 | 1978-06-27 | General Electric Company | Process for making polyphenylene oxides |
| US4075174A (en) * | 1976-12-21 | 1978-02-21 | General Electric Company | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions |
| US4427594A (en) | 1976-12-21 | 1984-01-24 | General Electric Company | Oxidative coupling of phenolic monomers with manganese complexes of phenyl benzoin oxime catalysts |
| US4093598A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Oxidative coupling of phenolic monomers in the presence of manganese complexes of manganese phenyl benzoin oxime catalysts |
| US4093596A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Method for polymerization of polyphenylene oxides |
| US4093597A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Polymerization of 2,6-di-substituted phenols |
| US4098766A (en) * | 1977-04-14 | 1978-07-04 | Ici Americas Inc. | Method of oxidatively coupling alkyl phenols utilizing a tetravalent manganese-carbon catalyst |
| US4196278A (en) * | 1977-12-29 | 1980-04-01 | General Electric Company | Method for the controlled polymerization of polyphenylene oxide polymers |
| US4226951A (en) * | 1978-06-19 | 1980-10-07 | General Electric Company | Block polymers of polyphenylene oxide and polystyrene |
| US4335234A (en) * | 1979-10-24 | 1982-06-15 | General Electric Company | Use of manganese chelate to oxidatively couple phenolic compound in a self-precipitating system |
| US4385168A (en) * | 1981-03-06 | 1983-05-24 | Sumitomo Chemical Company, Limited | Process for producing polyphenylene oxide |
| JPS58114842A (ja) * | 1981-12-28 | 1983-07-08 | Yamazaki Mazak Corp | 数値制御工作機械に於ける工具寿命管理方法 |
| JPS59115124A (ja) * | 1982-12-22 | 1984-07-03 | Mitsubishi Electric Corp | 放電加工装置 |
| JPS59142046A (ja) * | 1983-02-04 | 1984-08-15 | Ikegai Corp | 工具寿命の管理方法及び装置 |
| JPS609638A (ja) * | 1983-06-30 | 1985-01-18 | Toyoda Mach Works Ltd | 工具寿命検出方法 |
| DE3504646A1 (de) | 1985-02-12 | 1986-08-14 | Basf Ag, 6700 Ludwigshafen | Halogenfreie, selbstverloeschende thermoplastische formmasse |
| JPS61249248A (ja) * | 1985-04-24 | 1986-11-06 | Hitachi Metals Ltd | 刃具寿命管理装置 |
| JPS63295157A (ja) * | 1987-05-26 | 1988-12-01 | Fanuc Ltd | 数値制御装置 |
| JPS6434636A (en) * | 1987-07-29 | 1989-02-06 | Fanuc Ltd | Tool life control system |
| JPH01146644A (ja) * | 1987-12-02 | 1989-06-08 | Fanuc Ltd | 加工セル工具の補修情報指示装置 |
| JPH033757A (ja) * | 1989-05-30 | 1991-01-09 | Fanuc Ltd | 切削負荷管理方式 |
| JPH03245949A (ja) * | 1990-02-26 | 1991-11-01 | Fanuc Ltd | 工具寿命管理方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1570458A1 (de) * | 1965-07-14 | 1969-09-18 | Dynamit Nobel Ag | Verfahren zur Herstellung von Polyphenylenoxyden |
| US3825521A (en) * | 1971-07-31 | 1974-07-23 | Asahi Dow Ltd | Manganese amine chelate catalyzed aromatic polyether formation |
-
1974
- 1974-07-24 US US05/491,475 patent/US3972851A/en not_active Expired - Lifetime
-
1975
- 1975-06-24 DE DE2528045A patent/DE2528045C2/de not_active Expired
- 1975-06-26 CA CA230,753A patent/CA1066846A/en not_active Expired
- 1975-07-08 GB GB28718/75A patent/GB1518186A/en not_active Expired
- 1975-07-23 BE BE158550A patent/BE831664A/xx unknown
- 1975-07-23 NL NL7508815A patent/NL7508815A/xx not_active Application Discontinuation
- 1975-07-23 SE SE7508406A patent/SE7508406L/xx unknown
- 1975-07-23 IT IT25662/75A patent/IT1039995B/it active
- 1975-07-24 SU SU752159082A patent/SU686626A3/ru active
- 1975-07-24 DK DK336375A patent/DK336375A/da not_active Application Discontinuation
- 1975-07-24 FR FR7523171A patent/FR2279788A1/fr active Granted
- 1975-07-24 JP JP50089689A patent/JPS5921894B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2279788A1 (fr) | 1976-02-20 |
| IT1039995B (it) | 1979-12-10 |
| JPS5921894B2 (ja) | 1984-05-23 |
| DK336375A (da) | 1976-01-25 |
| US3972851A (en) | 1976-08-03 |
| DE2528045A1 (de) | 1976-02-05 |
| BE831664A (fr) | 1975-11-17 |
| FR2279788B1 (enExample) | 1981-08-28 |
| GB1518186A (en) | 1978-07-19 |
| SU686626A3 (ru) | 1979-09-15 |
| SE7508406L (sv) | 1976-01-26 |
| JPS5134995A (enExample) | 1976-03-25 |
| DE2528045C2 (de) | 1984-07-12 |
| NL7508815A (nl) | 1976-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1066846A (en) | Preparation of polyphenylene oxide using a manganese (ii) ortho-hydroxyareneoxime chelate reaction promoter | |
| US3956242A (en) | Preparation of polyphenylene oxide using a manganese (II) ω-hydroxyoxime chelate reaction promoter | |
| Hay | Aromatic polyethers | |
| US3639656A (en) | Formation of polyphenylene ethers | |
| US4098846A (en) | Polyphenylene oxide polystyrene product-by-process | |
| US3661848A (en) | Formation of polyphenylene ethers | |
| US3970640A (en) | Process for the production of polyphenylene ethers having a desired polymerization degree | |
| US4092294A (en) | Method for preparing polyphenylene ethers | |
| US5861471A (en) | Polysulphone/polyether block copolycondensates | |
| US3962181A (en) | Process for preparation of polyphenylene oxides | |
| US3965069A (en) | Polyphenylene oxide is prepared using a mixture of manganese chelates as a catalyst | |
| CA2013340A1 (en) | Method for preparation of aryloxytriazine-capped polyphenylene ethers | |
| US3444133A (en) | Cobalt chelate catalysts in the production of polyphenylene oxides | |
| NL9201163A (nl) | Werkwijze voor de bereiding van gesubstitueerde cycloalkylideenbisfenolen. | |
| US4196278A (en) | Method for the controlled polymerization of polyphenylene oxide polymers | |
| US4075174A (en) | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions | |
| US4482697A (en) | Process, complex and catalyst for preparation of polyphenylene oxide | |
| JP3431560B2 (ja) | 結晶性ポリ(2,5−ジ置換−1,4−フェニレンオキサイド) | |
| US4093597A (en) | Polymerization of 2,6-di-substituted phenols | |
| EP0059958B1 (en) | Process for producing polyphenylene oxide | |
| CA1064193A (en) | Process for capping polyphenylene oxide | |
| CA1181897A (en) | Use of manganese chelate to oxidatively couple phenolic compound in a self-precipitating system | |
| US3544515A (en) | Diarylguanidines as rate promoters in oxidative polyphenylene ether formation | |
| US4340696A (en) | Formal-coupled polyphenylene oxides | |
| US4102865A (en) | Moderation of manganese chelate catalyzed polymerization of phenolic monomers with polyfunctional alkanolamines |