DE2525418C3 - Trisazoverbindungen, deren Herstellung und Verwendung - Google Patents
Trisazoverbindungen, deren Herstellung und VerwendungInfo
- Publication number
- DE2525418C3 DE2525418C3 DE2525418A DE2525418A DE2525418C3 DE 2525418 C3 DE2525418 C3 DE 2525418C3 DE 2525418 A DE2525418 A DE 2525418A DE 2525418 A DE2525418 A DE 2525418A DE 2525418 C3 DE2525418 C3 DE 2525418C3
- Authority
- DE
- Germany
- Prior art keywords
- formula
- hydrogen
- same
- compounds
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 35
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 23
- 230000008878 coupling Effects 0.000 claims description 22
- 238000010168 coupling process Methods 0.000 claims description 22
- 238000005859 coupling reaction Methods 0.000 claims description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000001412 amines Chemical class 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 6
- 150000008049 diazo compounds Chemical class 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 claims 1
- 239000000975 dye Substances 0.000 description 50
- 238000004043 dyeing Methods 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000010985 leather Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 13
- 239000002253 acid Substances 0.000 description 11
- -1 acylamino compound Chemical class 0.000 description 8
- 125000000129 anionic group Chemical group 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 238000004040 coloring Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002828 nitro derivatives Chemical class 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 239000004677 Nylon Substances 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 210000003746 feather Anatomy 0.000 description 2
- 239000002657 fibrous material Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229920001778 nylon Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000991 leather dye Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- NRZRRZAVMCAKEP-UHFFFAOYSA-N naphthionic acid Chemical compound C1=CC=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 NRZRRZAVMCAKEP-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 235000015139 viili Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/38—Trisazo dyes ot the type
- C09B35/44—Trisazo dyes ot the type the component K being a hydroxy amine
- C09B35/46—Trisazo dyes ot the type the component K being a hydroxy amine the component K being an amino naphthol
- C09B35/461—D being derived from diaminobenzene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH825274A CH588535A5 (enExample) | 1974-06-17 | 1974-06-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2525418A1 DE2525418A1 (de) | 1976-01-02 |
| DE2525418B2 DE2525418B2 (de) | 1979-01-11 |
| DE2525418C3 true DE2525418C3 (de) | 1979-09-13 |
Family
ID=4337496
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2525418A Expired DE2525418C3 (de) | 1974-06-17 | 1975-06-07 | Trisazoverbindungen, deren Herstellung und Verwendung |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4097476A (enExample) |
| JP (1) | JPS5726540B2 (enExample) |
| AR (1) | AR207865A1 (enExample) |
| BE (1) | BE830284A (enExample) |
| BR (1) | BR7503798A (enExample) |
| CA (1) | CA1052374A (enExample) |
| CH (1) | CH588535A5 (enExample) |
| DD (1) | DD120215A5 (enExample) |
| DE (1) | DE2525418C3 (enExample) |
| ES (1) | ES438611A1 (enExample) |
| FR (1) | FR2274661A1 (enExample) |
| GB (1) | GB1509093A (enExample) |
| IT (1) | IT1040642B (enExample) |
| NL (1) | NL7507068A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2903588A1 (de) * | 1979-01-31 | 1980-08-14 | Basf Ag | Polyazofarbstoffe |
| BE885252A (fr) * | 1980-09-16 | 1981-03-16 | Althouse Tertre S A Atsa | Nouveaux colorants trisazoiques |
| DE3118201A1 (de) * | 1981-05-08 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Trisazofarbstoffe |
| DE3662400D1 (en) * | 1985-03-29 | 1989-04-20 | Taoka Chemical Co Ltd | Azo compound and solution type composition comprising the same |
| US4737240A (en) * | 1985-05-02 | 1988-04-12 | Ciba-Geigy Corporation | Trisazo black dyes from 2-(4'-aminophenylazo)-7-amino-1-naphthol-3-sulfonic acid |
| US5167703A (en) * | 1990-11-30 | 1992-12-01 | Canon Kabushiki Kaisha | Ink, ink-jet recording process and instrument making use of the ink |
| US5258505A (en) * | 1991-07-26 | 1993-11-02 | Canon Kabushiki Kaisha | Trisazo compounds, and dye compositions containing same |
| US5198022A (en) * | 1991-10-25 | 1993-03-30 | Lexmark International, Inc. | Waterfast dye and aqueous ink |
| GB9217964D0 (en) * | 1992-08-24 | 1992-10-07 | Ici Plc | Compound |
| GB0106345D0 (en) * | 2001-03-14 | 2001-05-02 | Avecia Ltd | Compounds compositions and processes |
| EP3020770A1 (en) | 2014-11-17 | 2016-05-18 | DFI Chem GmbH | Black trisazo dyes, their preparation and their use |
| IT201800007605A1 (it) | 2018-07-30 | 2020-01-30 | Claudio Soresina | Asciugacapelli elettrico |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1716063A (en) * | 1925-10-22 | 1929-06-04 | Du Pont | Preparation of trisazo dyes |
| US1982332A (en) * | 1931-03-25 | 1934-11-27 | Gen Aniline Works Inc | Azodyestuffs |
| US2024797A (en) * | 1932-08-24 | 1935-12-17 | Firm Of Durand & Huguenin S A | Mordant trisazo-dyestuffs and their production |
| US2488076A (en) * | 1944-05-25 | 1949-11-15 | Geigy Ag J R | Polyazo-dyestuffs |
| US2676957A (en) * | 1951-12-22 | 1954-04-27 | Gen Aniline & Film Corp | Deaminated trisazo dye |
| JPS517572B2 (enExample) * | 1972-08-23 | 1976-03-09 | ||
| GB1465889A (en) * | 1972-12-21 | 1977-03-02 | Ici Ltd | Trisazo dyes |
| US3917887A (en) * | 1974-01-24 | 1975-11-04 | Sandoz Ag | Process for dyeing oxide layers on aluminum and aluminum alloys |
-
1974
- 1974-06-17 CH CH825274A patent/CH588535A5/xx not_active IP Right Cessation
-
1975
- 1975-01-01 AR AR259216A patent/AR207865A1/es active
- 1975-06-07 DE DE2525418A patent/DE2525418C3/de not_active Expired
- 1975-06-10 US US05/585,663 patent/US4097476A/en not_active Expired - Lifetime
- 1975-06-13 NL NL7507068A patent/NL7507068A/xx not_active Application Discontinuation
- 1975-06-16 GB GB25531/75A patent/GB1509093A/en not_active Expired
- 1975-06-16 BE BE157366A patent/BE830284A/xx unknown
- 1975-06-16 DD DD186670A patent/DD120215A5/xx unknown
- 1975-06-16 JP JP7210375A patent/JPS5726540B2/ja not_active Expired
- 1975-06-16 ES ES438611A patent/ES438611A1/es not_active Expired
- 1975-06-16 CA CA229,450A patent/CA1052374A/en not_active Expired
- 1975-06-17 FR FR7518880A patent/FR2274661A1/fr active Granted
- 1975-06-17 BR BR4884/75D patent/BR7503798A/pt unknown
- 1975-06-17 IT IT7550075A patent/IT1040642B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DD120215A5 (enExample) | 1976-06-05 |
| CH588535A5 (enExample) | 1977-06-15 |
| FR2274661A1 (fr) | 1976-01-09 |
| CA1052374A (en) | 1979-04-10 |
| DE2525418B2 (de) | 1979-01-11 |
| NL7507068A (nl) | 1975-12-19 |
| GB1509093A (en) | 1978-04-26 |
| AR207865A1 (es) | 1976-11-08 |
| US4097476A (en) | 1978-06-27 |
| BE830284A (fr) | 1975-12-16 |
| FR2274661B1 (enExample) | 1979-04-13 |
| IT1040642B (it) | 1979-12-20 |
| ES438611A1 (es) | 1977-07-01 |
| JPS5726540B2 (enExample) | 1982-06-04 |
| DE2525418A1 (de) | 1976-01-02 |
| BR7503798A (pt) | 1976-07-06 |
| JPS5112821A (enExample) | 1976-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644208A1 (de) | Reaktivfarbstoffe | |
| DE3033611A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| DE2525418C3 (de) | Trisazoverbindungen, deren Herstellung und Verwendung | |
| DE1644203A1 (de) | Reaktivfarbstoff | |
| EP0036582B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE60101903T2 (de) | Faserreaktive disazoverbindungen | |
| EP2768907B1 (de) | Trisazo-säurefarbstoffe | |
| DE1289930B (de) | Verfahren zur Herstellung von Azofarbstoffen und deren Metallkomplexverbindungen | |
| EP0586331B1 (de) | Verfahren zum Färben von synthetischen Polyamidfasermaterialien | |
| DE3034686A1 (de) | Chromkomplexe von disazoverbindungen, deren herstellung und verwendung | |
| DE2154942C3 (de) | faserreaktive Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von nativen oder regenerierten Cellulosefasern, natürlichen oder synthetischen Polyamidfasern oder von Polyurethanfasern | |
| DE3536688A1 (de) | Wasserloesliche disazoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| DE2347551C3 (de) | Trisazoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung zum Färben von Papier und Leder | |
| CH622543A5 (enExample) | ||
| DE1644132C3 (de) | Monoazoreaktivfarbstoffe, und ihre Verwendung zum Färben und Bedrucken von Leder, Seide, Wolle, Superpolyamiden oder Superpolyurethanen | |
| DE19529853A1 (de) | Aluminium-Phthalocyanin-Reaktivfarbstoffe | |
| DE2604799A1 (de) | Wasserloesliche, braune 1 zu 2- chrom-mischkomplexfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von natuerlichen und synthetischen polyamidfasern | |
| DE19922825A1 (de) | Neue fluortriazinhaltige brillantgelbe Farbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von hydroxy- und amidgruppenhaltigen Materialien | |
| CH492767A (de) | Verfahren zur Herstellung von Reaktivfarbstoffen | |
| DE1904113B2 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE964975C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1419840C (de) | Verfahren zur Herstellung von reaktiven Färb stoffen | |
| DE3022928A1 (de) | Anionische disazoverbindungen | |
| DE2460466C3 (de) | Wasserlösliche Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1644164C3 (de) | 2 zu 1-Chromkomplex-Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |