DE2461525C3 - Verfahren zur Herstellung von γ- Lactonen - Google Patents
Verfahren zur Herstellung von γ- LactonenInfo
- Publication number
- DE2461525C3 DE2461525C3 DE2461525A DE2461525A DE2461525C3 DE 2461525 C3 DE2461525 C3 DE 2461525C3 DE 2461525 A DE2461525 A DE 2461525A DE 2461525 A DE2461525 A DE 2461525A DE 2461525 C3 DE2461525 C3 DE 2461525C3
- Authority
- DE
- Germany
- Prior art keywords
- diol
- parts
- acid
- reaction
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 125000000457 gamma-lactone group Chemical group 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 description 19
- IEBXZRQOXHLIGF-UHFFFAOYSA-N 5,5-dimethyl-4-(2-methylprop-1-enyl)oxolan-2-one Chemical compound CC(C)=CC1CC(=O)OC1(C)C IEBXZRQOXHLIGF-UHFFFAOYSA-N 0.000 description 16
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- ORTVZLZNOYNASJ-OWOJBTEDSA-N (e)-but-2-ene-1,4-diol Chemical compound OC\C=C\CO ORTVZLZNOYNASJ-OWOJBTEDSA-N 0.000 description 7
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 150000002905 orthoesters Chemical class 0.000 description 6
- 238000000862 absorption spectrum Methods 0.000 description 5
- 150000002009 diols Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 2
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- RINTVENKYQVFSD-UHFFFAOYSA-N 2-ethoxy-2-methyl-4,7-dihydro-1,3-dioxepine Chemical compound CCOC1(C)OCC=CCO1 RINTVENKYQVFSD-UHFFFAOYSA-N 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N 3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000250966 Tanacetum cinerariifolium Species 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001559 benzoic acids Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 238000000197 pyrolysis Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- FLXLJBCLEUWWCG-UHFFFAOYSA-N (E)-2-methyl but-2-ene-1,4-diol Natural products OCC(C)=CCO FLXLJBCLEUWWCG-UHFFFAOYSA-N 0.000 description 1
- CPEMSVQIDGEZCG-AATRIKPKSA-N (e)-2,5-dimethylhex-3-ene-2,5-diol Chemical compound CC(C)(O)\C=C\C(C)(C)O CPEMSVQIDGEZCG-AATRIKPKSA-N 0.000 description 1
- FLXLJBCLEUWWCG-GORDUTHDSA-N (e)-2-methylbut-2-ene-1,4-diol Chemical compound OCC(/C)=C/CO FLXLJBCLEUWWCG-GORDUTHDSA-N 0.000 description 1
- AQSWYJHDAKIVIM-ONEGZZNKSA-N (e)-hex-3-ene-2,5-diol Chemical compound CC(O)\C=C\C(C)O AQSWYJHDAKIVIM-ONEGZZNKSA-N 0.000 description 1
- OOYLEFZKWGZRRS-NSCUHMNNSA-N (e)-pent-2-ene-1,4-diol Chemical compound CC(O)\C=C\CO OOYLEFZKWGZRRS-NSCUHMNNSA-N 0.000 description 1
- CPEMSVQIDGEZCG-WAYWQWQTSA-N (z)-2,5-dimethylhex-3-ene-2,5-diol Chemical compound CC(C)(O)\C=C/C(C)(C)O CPEMSVQIDGEZCG-WAYWQWQTSA-N 0.000 description 1
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- DYDDAUBFAGIJAJ-UHFFFAOYSA-N 2,2,5,5-tetramethylfuran Chemical compound CC1(C)OC(C)(C)C=C1 DYDDAUBFAGIJAJ-UHFFFAOYSA-N 0.000 description 1
- UZBOWOQARWWIER-UHFFFAOYSA-N 2,2-dimethyl-5-oxooxolane-3-carboxylic acid Chemical class CC1(C)OC(=O)CC1C(O)=O UZBOWOQARWWIER-UHFFFAOYSA-N 0.000 description 1
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 1
- LAVMWOGIDKQCDK-UHFFFAOYSA-N 2,4,6-tri(butan-2-yl)phenol Chemical compound CCC(C)C1=CC(C(C)CC)=C(O)C(C(C)CC)=C1 LAVMWOGIDKQCDK-UHFFFAOYSA-N 0.000 description 1
- PFEFOYRSMXVNEL-UHFFFAOYSA-N 2,4,6-tritert-butylphenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 PFEFOYRSMXVNEL-UHFFFAOYSA-N 0.000 description 1
- UCPVKANOHHUHAU-UHFFFAOYSA-N 2,4,7,9-tetramethyldec-5-ene-4,7-diol Chemical compound CC(C)CC(C)(O)C=CC(C)(O)CC(C)C UCPVKANOHHUHAU-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- SMNGQGWPUVVORF-UHFFFAOYSA-N 3,5-ditert-butyl-4-methylphenol Chemical compound CC1=C(C(C)(C)C)C=C(O)C=C1C(C)(C)C SMNGQGWPUVVORF-UHFFFAOYSA-N 0.000 description 1
- QWQZUZBHNBOACG-UHFFFAOYSA-N 4-ethylhex-2-ene-1,4-diol Chemical compound CCC(O)(CC)C=CCO QWQZUZBHNBOACG-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- GGBXJDKSEHTBLW-UHFFFAOYSA-N 5-methylhex-4-en-2-one Chemical compound CC(C)=CCC(C)=O GGBXJDKSEHTBLW-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 238000005821 Claisen rearrangement reaction Methods 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 235000017372 Piretro di Dalmazia Nutrition 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- FPIQZBQZKBKLEI-UHFFFAOYSA-N ethyl 1-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylate Chemical compound ClCCN(N=O)C(=O)NC1(C(=O)OCC)CCCCC1 FPIQZBQZKBKLEI-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical class [H]C#C* 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- RPBPQOXNRBZRIJ-UHFFFAOYSA-N hept-3-ene-2,5-diol Chemical compound CCC(O)C=CC(C)O RPBPQOXNRBZRIJ-UHFFFAOYSA-N 0.000 description 1
- AQSWYJHDAKIVIM-UHFFFAOYSA-N hex-3-ene-2,5-diol Chemical compound CC(O)C=CC(C)O AQSWYJHDAKIVIM-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- -1 isoprenoid terpene alcohols Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UKRCOLFEYJZGNV-UHFFFAOYSA-N oct-4-ene-3,6-diol Chemical compound CCC(O)C=CC(O)CC UKRCOLFEYJZGNV-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FKRCODPIKNYEAC-UHFFFAOYSA-N propionic acid ethyl ester Natural products CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229940015367 pyrethrum Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 235000011044 succinic acid Nutrition 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D315/00—Heterocyclic compounds containing rings having one oxygen atom as the only ring hetero atom according to more than one of groups C07D303/00 - C07D313/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/28—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/02—Seven-membered rings
- C07D321/04—Seven-membered rings not condensed with other rings
- C07D321/06—1,3-Dioxepines; Hydrogenated 1,3-dioxepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Furan Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14450173A JPS5438108B2 (OSRAM) | 1973-12-27 | 1973-12-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2461525A1 DE2461525A1 (de) | 1975-07-10 |
| DE2461525B2 DE2461525B2 (de) | 1978-08-10 |
| DE2461525C3 true DE2461525C3 (de) | 1979-04-05 |
Family
ID=15363816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2461525A Expired DE2461525C3 (de) | 1973-12-27 | 1974-12-27 | Verfahren zur Herstellung von γ- Lactonen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3975381A (OSRAM) |
| JP (1) | JPS5438108B2 (OSRAM) |
| CH (1) | CH602692A5 (OSRAM) |
| DE (1) | DE2461525C3 (OSRAM) |
| FR (1) | FR2256165B1 (OSRAM) |
| GB (1) | GB1441360A (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4204051A (en) * | 1976-06-05 | 1980-05-20 | Bayer Aktiengesellschaft | Process for polyurethanes from ortho-ester-blocked polyols |
| DE2740849A1 (de) * | 1977-09-10 | 1979-03-22 | Bayer Ag | Verfahren zur herstellung von halogenvinylsubstituierten tetrahydrofuran-2-onen |
| DE2747824A1 (de) * | 1977-10-26 | 1979-05-03 | Bayer Ag | Verfahren zur herstellung von halogenvinyl-gamma-butyrolactonen |
| DE2916321A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl- cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| EP0041283B1 (en) * | 1980-05-30 | 1985-07-24 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of dihalomethylene-lactones |
| DE3210705A1 (de) * | 1982-03-24 | 1983-10-06 | Basf Ag | Verfahren zur herstellung von 3-alkyl-2,5-dihydrofuran-2-onen |
| CN113121347B (zh) * | 2019-12-31 | 2023-05-23 | 黄淮学院 | 用于制备螺环内酯的丙烯酸烯丙酯类化合物、螺环内酯及其制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1269127A (fr) * | 1960-06-20 | 1961-08-11 | Rhone Poulenc Sa | Procédé de préparation de l'acide chrysanthémique |
| US3299100A (en) * | 1963-11-20 | 1967-01-17 | Gulf Oil Corp | Manufacture of butyrolactones |
-
1973
- 1973-12-27 JP JP14450173A patent/JPS5438108B2/ja not_active Expired
-
1974
- 1974-12-23 GB GB5561874A patent/GB1441360A/en not_active Expired
- 1974-12-27 FR FR7443141A patent/FR2256165B1/fr not_active Expired
- 1974-12-27 CH CH1734674A patent/CH602692A5/xx not_active IP Right Cessation
- 1974-12-27 US US05/536,781 patent/US3975381A/en not_active Expired - Lifetime
- 1974-12-27 DE DE2461525A patent/DE2461525C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50111061A (OSRAM) | 1975-09-01 |
| FR2256165B1 (OSRAM) | 1979-03-16 |
| DE2461525B2 (de) | 1978-08-10 |
| US3975381A (en) | 1976-08-17 |
| JPS5438108B2 (OSRAM) | 1979-11-19 |
| DE2461525A1 (de) | 1975-07-10 |
| FR2256165A1 (OSRAM) | 1975-07-25 |
| GB1441360A (en) | 1976-06-30 |
| CH602692A5 (OSRAM) | 1978-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2760005C2 (de) | Optisch aktive Norpinene und Verfahren zu ihrer Herstellung | |
| DE2461525C3 (de) | Verfahren zur Herstellung von γ- Lactonen | |
| DE2008878B2 (de) | 3-Keto-l-cyclopentenylessigsäurealkylester und Verfahren zu ihrer Herstellung | |
| DE2418715A1 (de) | Allensaeureester | |
| DE19840746A1 (de) | Verfahren zur Herstellung gamma,delta-ungesättigter Ketone durch Carroll-Reaktion | |
| DE2632220A1 (de) | Verfahren zur herstellung von alpha,beta-aethylenischen aldehyden | |
| DE2523695C3 (de) | Verfahren zur Herstellung von bicyclischen γ-Lactonen | |
| DE19647117A1 (de) | Verfahren zur Herstellung gamma,delta-ungesättigten Ketonen durch Caroll-Reaktion in cyclischen Carbonaten oder gamma-Lactonen als Lösungsmittel | |
| DE1618861B2 (de) | Verfahren zur herstellung von ungesaettigten esteralkoholen | |
| DE2509576C3 (de) | Verfahren zur Herstellung von a, ß-ungesättigten γ-Lactonderivaten | |
| US3227732A (en) | Production of alpha-fluorocarboxylic acid lactones | |
| DE2548187A1 (de) | Verfahren zur herstellung von 2-substituierten oder nicht-substituierten geranylessigsaeuren und deren estern | |
| DE2719976C2 (de) | Bicyclische Aldehyde und Verfahren zu deren Herstellung | |
| DE2731543A1 (de) | Verfahren zur herstellung von cyclopentadecanolid | |
| CH656610A5 (de) | Verfahren zur herstellung von 2-cyclopentenonen. | |
| US2523692A (en) | Ester condensation | |
| DE2824841B2 (de) | Verfahren zur Herstellung von 2-Cyclopentenonderivaten sowie diese enthaltende Parfüm-Kompositionen | |
| DE809806C (de) | Verfahren zur Herstellung von ungesaettigten Dicarbonylverbindungen | |
| DE1293779B (de) | Verfahren zur Herstellung von substituierten Tetrahydropyranen und 2, 3-Dihydropyranen | |
| Hirano et al. | The acid-catalyzed reaction of alicyclic ketones with formaldehyde. III. The reaction of 3-and 3, 5-methyl-substituted cyclohexanones with formaldehyde. | |
| DE1924844A1 (de) | Verfahren zur Herstellung von Trimethyl-2-cyclohexen-1-onen | |
| EP0525579A2 (de) | Verfahren zur Herstellung von substituierten Hexensäuren | |
| DE3046059C2 (de) | 4-Halogen-5,5-dialkoxypentansäureester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von 2,2-Dialkyl-3-formylcyclopropancarbonsäureestern | |
| EP0005472B1 (de) | Verfahren zur Herstellung substituierter gamma-Halogencarbonsäureester | |
| DE2143991B2 (de) | 2,6-Dimethyl-2,6-undecadien-10on-l-al und seine Acetale |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EI | Miscellaneous see part 3 | ||
| XX | Miscellaneous: |
Free format text: NAME DES ERFINDERS AENDERN IN KONDO KIYOSI |
|
| 8339 | Ceased/non-payment of the annual fee |