DE2459967B2 - Verfahren zur herstellung von 1,4- diacetoxycyclopent-2-en - Google Patents
Verfahren zur herstellung von 1,4- diacetoxycyclopent-2-enInfo
- Publication number
- DE2459967B2 DE2459967B2 DE19742459967 DE2459967A DE2459967B2 DE 2459967 B2 DE2459967 B2 DE 2459967B2 DE 19742459967 DE19742459967 DE 19742459967 DE 2459967 A DE2459967 A DE 2459967A DE 2459967 B2 DE2459967 B2 DE 2459967B2
- Authority
- DE
- Germany
- Prior art keywords
- ene
- diacetoxycyclopent
- reaction
- salt
- dibromocyclopent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 17
- UKPIBFMHHUEUQR-UHFFFAOYSA-N (4-acetyloxycyclopent-2-en-1-yl) acetate Chemical compound CC(=O)OC1CC(OC(C)=O)C=C1 UKPIBFMHHUEUQR-UHFFFAOYSA-N 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 30
- 229910052751 metal Inorganic materials 0.000 claims description 26
- 239000002184 metal Substances 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 20
- AKAJVSSDORNOIX-UHFFFAOYSA-N 3,5-dibromocyclopentene Chemical compound BrC1CC(Br)C=C1 AKAJVSSDORNOIX-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 125000002091 cationic group Chemical group 0.000 claims description 12
- 239000004094 surface-active agent Substances 0.000 claims description 11
- 239000000243 solution Substances 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 150000002894 organic compounds Chemical group 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- -1 alkylamine salt Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000003973 alkyl amines Chemical class 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052698 phosphorus Inorganic materials 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000007788 liquid Substances 0.000 description 24
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 10
- 238000003756 stirring Methods 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- UKPIBFMHHUEUQR-DTORHVGOSA-N [(1s,4r)-4-acetyloxycyclopent-2-en-1-yl] acetate Chemical compound CC(=O)O[C@@H]1C[C@H](OC(C)=O)C=C1 UKPIBFMHHUEUQR-DTORHVGOSA-N 0.000 description 5
- 235000011056 potassium acetate Nutrition 0.000 description 5
- WFEXFNMTEBFLMM-UHFFFAOYSA-M trioctyl(propyl)azanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](CCC)(CCCCCCCC)CCCCCCCC WFEXFNMTEBFLMM-UHFFFAOYSA-M 0.000 description 5
- 239000003093 cationic surfactant Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- GTCDARUMAMVCRO-UHFFFAOYSA-M tetraethylazanium;acetate Chemical compound CC([O-])=O.CC[N+](CC)(CC)CC GTCDARUMAMVCRO-UHFFFAOYSA-M 0.000 description 3
- AKAJVSSDORNOIX-SYDPRGILSA-N (3s,5r)-3,5-dibromocyclopentene Chemical compound Br[C@H]1C[C@@H](Br)C=C1 AKAJVSSDORNOIX-SYDPRGILSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- ITHZDDVSAWDQPZ-UHFFFAOYSA-L barium acetate Chemical compound [Ba+2].CC([O-])=O.CC([O-])=O ITHZDDVSAWDQPZ-UHFFFAOYSA-L 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000010406 interfacial reaction Methods 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 2
- 229940071536 silver acetate Drugs 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- BWWXGBGGLCDPCO-UHFFFAOYSA-N (2-acetyloxycyclopent-3-en-1-yl) acetate Chemical compound CC(=O)OC1CC=CC1OC(C)=O BWWXGBGGLCDPCO-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- PNWFXPGGROADNS-UHFFFAOYSA-N 1,2-dibromocyclopentene Chemical compound BrC1=C(Br)CCC1 PNWFXPGGROADNS-UHFFFAOYSA-N 0.000 description 1
- GQWYECAAVJTKGA-UHFFFAOYSA-N 3-bromocyclopentene Chemical compound BrC1CCC=C1 GQWYECAAVJTKGA-UHFFFAOYSA-N 0.000 description 1
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- WOWHHFRSBJGXCM-UHFFFAOYSA-M cetyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)C WOWHHFRSBJGXCM-UHFFFAOYSA-M 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- LMKPHJYTFHAGHK-UHFFFAOYSA-N cyclodrine Chemical compound C1CCCC1(O)C(C(=O)OCCN(CC)CC)C1=CC=CC=C1 LMKPHJYTFHAGHK-UHFFFAOYSA-N 0.000 description 1
- IGRLIBJHDBWKNA-UHFFFAOYSA-N cyclopent-4-ene-1,3-diol Chemical compound OC1CC(O)C=C1 IGRLIBJHDBWKNA-UHFFFAOYSA-N 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- HBRNMIYLJIXXEE-UHFFFAOYSA-N dodecylazanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN HBRNMIYLJIXXEE-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- UPHWVVKYDQHTCF-UHFFFAOYSA-N octadecylazanium;acetate Chemical compound CC(O)=O.CCCCCCCCCCCCCCCCCCN UPHWVVKYDQHTCF-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- RYVBINGWVJJDPU-UHFFFAOYSA-M tributyl(hexadecyl)phosphanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC RYVBINGWVJJDPU-UHFFFAOYSA-M 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/02—Esters of acyclic saturated monocarboxylic acids having the carboxyl group bound to an acyclic carbon atom or to hydrogen
- C07C69/12—Acetic acid esters
- C07C69/16—Acetic acid esters of dihydroxylic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14118073A JPS562540B2 (enExample) | 1973-12-19 | 1973-12-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2459967A1 DE2459967A1 (de) | 1975-06-26 |
| DE2459967B2 true DE2459967B2 (de) | 1977-06-02 |
Family
ID=15285994
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742459967 Withdrawn DE2459967B2 (de) | 1973-12-19 | 1974-12-18 | Verfahren zur herstellung von 1,4- diacetoxycyclopent-2-en |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4001308A (enExample) |
| JP (1) | JPS562540B2 (enExample) |
| CA (1) | CA1045638A (enExample) |
| CH (1) | CH602551A5 (enExample) |
| DE (1) | DE2459967B2 (enExample) |
| DK (1) | DK659374A (enExample) |
| FR (1) | FR2255284B1 (enExample) |
| GB (1) | GB1462449A (enExample) |
| NL (1) | NL7416505A (enExample) |
| NO (1) | NO744565L (enExample) |
| SE (1) | SE7415840L (enExample) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2296823A (en) * | 1940-01-27 | 1942-09-22 | Pittsburgh Plate Glass Co | Preparation of unsaturated alcohol esters |
| SE354849B (enExample) * | 1969-06-12 | 1973-03-26 | Haessle Ab |
-
1973
- 1973-12-19 JP JP14118073A patent/JPS562540B2/ja not_active Expired
-
1974
- 1974-12-13 US US05/532,616 patent/US4001308A/en not_active Expired - Lifetime
- 1974-12-17 SE SE7415840A patent/SE7415840L/xx unknown
- 1974-12-18 DE DE19742459967 patent/DE2459967B2/de not_active Withdrawn
- 1974-12-18 NO NO744565A patent/NO744565L/no unknown
- 1974-12-18 CA CA216,360A patent/CA1045638A/en not_active Expired
- 1974-12-18 DK DK659374A patent/DK659374A/da not_active Application Discontinuation
- 1974-12-18 NL NL7416505A patent/NL7416505A/xx unknown
- 1974-12-19 GB GB5494474A patent/GB1462449A/en not_active Expired
- 1974-12-19 FR FR7441970A patent/FR2255284B1/fr not_active Expired
- 1974-12-19 CH CH1696574A patent/CH602551A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2255284A1 (enExample) | 1975-07-18 |
| SE7415840L (enExample) | 1975-06-23 |
| CH602551A5 (enExample) | 1978-07-31 |
| JPS562540B2 (enExample) | 1981-01-20 |
| DE2459967A1 (de) | 1975-06-26 |
| NO744565L (enExample) | 1975-07-14 |
| GB1462449A (en) | 1977-01-26 |
| US4001308A (en) | 1977-01-04 |
| CA1045638A (en) | 1979-01-02 |
| JPS5089346A (enExample) | 1975-07-17 |
| NL7416505A (nl) | 1975-06-23 |
| FR2255284B1 (enExample) | 1978-02-24 |
| DK659374A (enExample) | 1975-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0574667A1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidin-N-oxyl und in seiner 4-Stellung substituierten Derivaten | |
| EP0574666A1 (de) | N-Oxyl-Derivate des 2,2,6,6-Tetramethylpiperidins und deren Herstellung | |
| DE2124718A1 (enExample) | ||
| DE2324390C2 (de) | Verfahren zur Herstellung von Derivaten des 2,2-Dichlor- bzw. 2,2-Dibromcyclopropans | |
| DE69401368T2 (de) | Verfahren zur Herstellung von 1,4-Dicyano-2-buten | |
| DE2811722A1 (de) | Verfahren zur katalytischen isomerisierung eines cyclohexan-bis-(methylamins) | |
| DE2838030A1 (de) | Verfahren zur herstellung von alkylenglykolen | |
| DE60102679T2 (de) | Neues verfahren zur herstellung von alpha-(2-4-disulfophenyl)-n-tert-butylnitron und seine pharmazeutisch akzeptierbaren salze | |
| DE2459967B2 (de) | Verfahren zur herstellung von 1,4- diacetoxycyclopent-2-en | |
| DE3729734C2 (enExample) | ||
| DE69413803T2 (de) | Verfahren zur herstellung von diazomethanderivaten | |
| DE2519314C2 (de) | Verfahren zur Herstellung von 3-Trichlormethyl-5-niederalkoxy- 1,2,4-thiadiazol | |
| DE2061538C3 (de) | Verfahren zur Herstellung von Kobalt (III)-bis-salicylaldehydäthylendiiminat -Komplexen | |
| EP0561213B1 (de) | Verfahren zur Herstellung von Hydroxypivalinsäureneopentylglykolester | |
| DE2337621A1 (de) | Verfahren zur kernchlorierung einer aromatischen verbindung | |
| DE2907864C3 (de) | Verfahren zur Herstellung von Vitamin K↓1↓ und Vitamn K↓2↓ | |
| DE2735057A1 (de) | Verfahren zur herstellung von triorganozinnhalogeniden | |
| DE1768050A1 (de) | Phasen-Transfer-Katalyse heterogener Reaktionen durch quartaere Salze | |
| CH616430A5 (en) | Process for preparing organic esters of phosphorus | |
| DE19905222A1 (de) | Verfahren zur Herstellung von symmetrischen und unsymmetrischen Carbonaten | |
| DE1243677B (de) | Verfahren zur Herstellung von Sulfonsaeureestern | |
| DE2653446C2 (de) | Verfahren zur Herstellung von Pyrogallolverbindungen | |
| EP0773211A1 (de) | Verfahren zur Herstellung von primären Octadienylaminen | |
| DE2931876A1 (de) | Verfahren zur herstellung hoeherer alkene | |
| DE1168408B (de) | Verfahren zur Herstellung von ª‰-Methylmercaptopropionaldehyd |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8230 | Patent withdrawn |