DE2457465C2 - Flüssigkristall-Anzeigeanordnung - Google Patents
Flüssigkristall-AnzeigeanordnungInfo
- Publication number
- DE2457465C2 DE2457465C2 DE2457465A DE2457465A DE2457465C2 DE 2457465 C2 DE2457465 C2 DE 2457465C2 DE 2457465 A DE2457465 A DE 2457465A DE 2457465 A DE2457465 A DE 2457465A DE 2457465 C2 DE2457465 C2 DE 2457465C2
- Authority
- DE
- Germany
- Prior art keywords
- layer
- liquid crystal
- polyimide
- display
- leads
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004973 liquid crystal related substance Substances 0.000 title claims description 26
- 229920001721 polyimide Polymers 0.000 claims description 30
- 239000004642 Polyimide Substances 0.000 claims description 29
- 239000000463 material Substances 0.000 claims description 18
- 239000011521 glass Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims 1
- 229920002647 polyamide Polymers 0.000 claims 1
- 238000000576 coating method Methods 0.000 description 11
- 238000000034 method Methods 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 7
- 210000002858 crystal cell Anatomy 0.000 description 5
- 229920005575 poly(amic acid) Polymers 0.000 description 5
- 239000004988 Nematic liquid crystal Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 230000004913 activation Effects 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000004020 conductor Substances 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000002019 doping agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- FEIWNULTQYHCDN-UHFFFAOYSA-N mbba Chemical compound C1=CC(CCCC)=CC=C1N=CC1=CC=C(OC)C=C1 FEIWNULTQYHCDN-UHFFFAOYSA-N 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- DVBJBNKEBPCGSY-UHFFFAOYSA-M cetylpyridinium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 DVBJBNKEBPCGSY-UHFFFAOYSA-M 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- HXWGXXDEYMNGCT-UHFFFAOYSA-M decyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCC[N+](C)(C)C HXWGXXDEYMNGCT-UHFFFAOYSA-M 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000006159 dianhydride group Chemical group 0.000 description 1
- LCXAARCEIWRIMU-UHFFFAOYSA-M dibenzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C[N+](C)(C)CC1=CC=CC=C1 LCXAARCEIWRIMU-UHFFFAOYSA-M 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 230000005669 field effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- -1 pyridinium compound Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000008030 superplasticizer Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/13—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on liquid crystals, e.g. single liquid crystal display cells
- G02F1/133—Constructional arrangements; Operation of liquid crystal cells; Circuit arrangements
- G02F1/1333—Constructional arrangements; Manufacturing methods
- G02F1/133345—Insulating layers
Landscapes
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- Mathematical Physics (AREA)
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Liquid Crystal (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US422236A US3912366A (en) | 1973-12-06 | 1973-12-06 | Liquid crystal display assembly having polyimide layers |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2457465A1 DE2457465A1 (de) | 1975-06-12 |
| DE2457465C2 true DE2457465C2 (de) | 1981-12-03 |
Family
ID=23673969
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2457465A Expired DE2457465C2 (de) | 1973-12-06 | 1974-12-05 | Flüssigkristall-Anzeigeanordnung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3912366A (enExample) |
| JP (1) | JPS5091345A (enExample) |
| CA (1) | CA1024636A (enExample) |
| DE (1) | DE2457465C2 (enExample) |
| GB (1) | GB1475565A (enExample) |
| IT (1) | IT1022785B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3966305A (en) * | 1974-10-10 | 1976-06-29 | American Micro-Systems, Inc. | Liquid crystal cell with improved alignment |
| JPS5510180B2 (enExample) * | 1974-12-04 | 1980-03-14 | ||
| JPS5227654A (en) * | 1975-08-27 | 1977-03-02 | Dainippon Printing Co Ltd | Electrooptical cell |
| DE2837257A1 (de) * | 1977-04-12 | 1979-03-22 | Sharp Kk | Fluoreszenz-fluessigkristall-anzeigevorrichtung |
| NL7800584A (nl) * | 1978-01-18 | 1979-07-20 | Philips Nv | Weergeefinrichting. |
| FR2462755A1 (fr) * | 1979-07-27 | 1981-02-13 | Thomson Csf | Dispositif de visualisation a cristal liquide, et terminal telephonique comportant un tel dispositif |
| JPS5694386A (en) * | 1979-12-27 | 1981-07-30 | Suwa Seikosha Kk | Liquiddcrystal display unit |
| US4456638A (en) * | 1981-04-06 | 1984-06-26 | Polytronix, Inc. | Polymer packaging material for liquid crystal cell |
| US4456336A (en) * | 1981-10-06 | 1984-06-26 | Minnesota Mining And Manufacturing Company | High brightness internal reflector for liquid crystal displays and its method of fabrication |
| US4422726A (en) * | 1981-10-14 | 1983-12-27 | Eaton Corporation | Method of making an electro-optical display |
| JPS58205181A (ja) * | 1982-05-26 | 1983-11-30 | セイコーインスツルメンツ株式会社 | マトリクス液晶表示装置 |
| US4763995A (en) * | 1983-04-28 | 1988-08-16 | Canon Kabushiki Kaisha | Spacers with alignment effect and substrates having a weak alignment effect |
| KR0130554B1 (ko) * | 1984-03-19 | 1998-04-11 | 유젠 웬닝거 | 합성수지 매트릭스 및 이에 분산된 액정으로 이루어진 광변조제와 그 제조방법 |
| US4647156A (en) * | 1984-04-12 | 1987-03-03 | Casio Computer Co., Ltd. | Liquid crystal device |
| DE3526973A1 (de) * | 1984-08-01 | 1986-02-06 | Sharp Kk | Blendfreier spiegel vom fluessigkristall-typ |
| JPS6145224A (ja) * | 1984-08-10 | 1986-03-05 | Alps Electric Co Ltd | 液晶表示素子の製造方法 |
| DE3587737T2 (de) * | 1984-11-12 | 1994-05-05 | Semiconductor Energy Lab | Flüssigkristallanzeigeschirm und Verfahren zu seiner Herstellung. |
| US4671618A (en) * | 1986-05-22 | 1987-06-09 | Wu Bao Gang | Liquid crystalline-plastic material having submillisecond switch times and extended memory |
| US4673255A (en) * | 1986-05-22 | 1987-06-16 | John West | Method of controlling microdroplet growth in polymeric dispersed liquid crystal |
| US4685771A (en) * | 1985-09-17 | 1987-08-11 | West John L | Liquid crystal display material comprising a liquid crystal dispersion in a thermoplastic resin |
| JPS6285222A (ja) * | 1986-05-30 | 1987-04-18 | Dainippon Printing Co Ltd | 液晶表示用電極基板の製造法 |
| US4923421A (en) * | 1988-07-06 | 1990-05-08 | Innovative Display Development Partners | Method for providing polyimide spacers in a field emission panel display |
| US8362151B2 (en) * | 2002-05-31 | 2013-01-29 | Elsicon, Inc. | Hybrid polymer materials for liquid crystal alignment layers |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3179614A (en) * | 1961-03-13 | 1965-04-20 | Du Pont | Polyamide-acids, compositions thereof, and process for their preparation |
| US3179634A (en) * | 1962-01-26 | 1965-04-20 | Du Pont | Aromatic polyimides and the process for preparing them |
| US3600060A (en) * | 1968-02-23 | 1971-08-17 | Ncr Co | Display device containing minute droplets of cholesteric liquid crystals in a substantially continuous polymeric matrix |
| US3625591A (en) * | 1969-11-10 | 1971-12-07 | Ibm | Liquid crystal display element |
| US3612654A (en) * | 1970-05-27 | 1971-10-12 | Rca Corp | Liquid crystal display device |
| US3656834A (en) * | 1970-12-09 | 1972-04-18 | Ibm | Additive for liquid crystal material |
| US3694053A (en) * | 1971-06-22 | 1972-09-26 | Bell Telephone Labor Inc | Nematic liquid crystal device |
| US3700306A (en) * | 1971-09-22 | 1972-10-24 | Ncr Co | Electro-optic shutter having a thin glass or silicon oxide layer between the electrodes and the liquid crystal |
| US3836231A (en) * | 1971-09-30 | 1974-09-17 | Gen Electric | Uniform liquid crystal cells and method for making the same |
| JPS5083051A (enExample) * | 1973-06-30 | 1975-07-04 |
-
1973
- 1973-12-06 US US422236A patent/US3912366A/en not_active Expired - Lifetime
-
1974
- 1974-10-11 IT IT28313/74A patent/IT1022785B/it active
- 1974-10-18 GB GB4532174A patent/GB1475565A/en not_active Expired
- 1974-11-01 JP JP49125602A patent/JPS5091345A/ja active Pending
- 1974-11-13 CA CA213,603A patent/CA1024636A/en not_active Expired
- 1974-12-05 DE DE2457465A patent/DE2457465C2/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1475565A (en) | 1977-06-01 |
| US3912366A (en) | 1975-10-14 |
| CA1024636A (en) | 1978-01-17 |
| JPS5091345A (enExample) | 1975-07-22 |
| DE2457465A1 (de) | 1975-06-12 |
| IT1022785B (it) | 1978-04-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2457465C2 (de) | Flüssigkristall-Anzeigeanordnung | |
| DE2246250C2 (de) | Elektro-optische Vorrichtung | |
| DE69027875T2 (de) | Orientierungsfilm für Flüssigkristall und sein Herstellungsverfahren und Flüssigkristall-Anzeige unter Verwendung eines solchen Orientierungsfilms und Verfahren zu deren Herstellung | |
| DE3508137A1 (de) | Mehrschichtige fluessigkristallanzeige | |
| DE3020645C2 (de) | Flüssigkristallanzeige und Verfahren zu ihrer Herstellung | |
| DE68924726T2 (de) | Flüssigkristall-Anzeigevorrichtung. | |
| DE68922417T2 (de) | Elektro-optische Vorrichtung. | |
| CH644955A5 (de) | Fluessigkristall-anzeigeelement und verfahren zu dessen herstellung. | |
| DE3201122A1 (de) | Nicht-linearer widerstand und verfahren zur herstellung eines solche verwendenden matrix-fk-anzeigefeldes | |
| DE3874457T2 (de) | Fluessigkristall-anzeigevorrichtung. | |
| DE69011884T2 (de) | Aktive matrixadressierte Flüssigkristall-Bildanzeige und Verfahren zu ihrer Herstellung. | |
| DE4012750A1 (de) | Ferroelektrisches fluessigkristalldisplay mit hohem kontrast und hoher helligkeit | |
| DE68915370T2 (de) | Anzeigevorrichtung. | |
| DE3784440T2 (de) | Elektrodenstruktur zur anwendung in einer elektro-optischen vorrichtung. | |
| CH643073A5 (de) | Fluessigkristall-anzeigevorrichtung. | |
| DE2946334C2 (enExample) | ||
| DE3841384C2 (de) | Anordnung mit einer Vielzahl von elektrischen Bauelementen mit nichtlinearer Strom-Spannungskennlinie sowie Verfahren zur Herstellung einer solchen Anordnung | |
| DE2349208C3 (de) | Elektrooptisches Anzeigegerät | |
| DE2838287C2 (de) | Feldeffektsteuerbare Flüssigkristall-Anzeigezelle mit verdrehtem nematischem Flüssigkristall und aufgedampften Ausrichtschichten | |
| DE3048024A1 (de) | "fluessigkristall-anzeigevorrichtung mit verdreht-nematischer fluessigkristallfuellung" | |
| DE69117398T2 (de) | Flüssigkristallanzeigevorrichtung | |
| DE2620530C2 (de) | Flüssigkristall-Matrixanzeige | |
| DE2810571C2 (de) | Flüssigkristall-Anzeigevorrichtung | |
| DE3305711A1 (de) | Fluessigkristallzusammensetzung | |
| DE102004037010B4 (de) | Verfahren zum Herstellen einer LCD-Vorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |