DE2456757C2 - Metallhalogenid-Hochdruckgasentladungslampe - Google Patents
Metallhalogenid-HochdruckgasentladungslampeInfo
- Publication number
- DE2456757C2 DE2456757C2 DE2456757A DE2456757A DE2456757C2 DE 2456757 C2 DE2456757 C2 DE 2456757C2 DE 2456757 A DE2456757 A DE 2456757A DE 2456757 A DE2456757 A DE 2456757A DE 2456757 C2 DE2456757 C2 DE 2456757C2
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- metal
- arsenic
- halide
- metal halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 17
- 150000005309 metal halides Chemical class 0.000 title claims description 17
- 229910052785 arsenic Inorganic materials 0.000 claims description 22
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 22
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 11
- 229910052753 mercury Inorganic materials 0.000 claims description 10
- 230000005855 radiation Effects 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 150000004820 halides Chemical class 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910001511 metal iodide Inorganic materials 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 2
- 229910001509 metal bromide Inorganic materials 0.000 claims description 2
- 229910001510 metal chloride Inorganic materials 0.000 claims description 2
- 230000005540 biological transmission Effects 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 230000007797 corrosion Effects 0.000 description 11
- 238000005260 corrosion Methods 0.000 description 11
- 238000005259 measurement Methods 0.000 description 11
- 239000007789 gas Substances 0.000 description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000007772 electrode material Substances 0.000 description 3
- 238000009877 rendering Methods 0.000 description 3
- -1 tin halide Chemical class 0.000 description 3
- 230000009471 action Effects 0.000 description 2
- IKIBSPLDJGAHPX-UHFFFAOYSA-N arsenic triiodide Chemical compound I[As](I)I IKIBSPLDJGAHPX-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000012928 buffer substance Substances 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 2
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910000413 arsenic oxide Inorganic materials 0.000 description 1
- CUGMJFZCCDSABL-UHFFFAOYSA-N arsenic(3+);trisulfide Chemical compound [S-2].[S-2].[S-2].[As+3].[As+3] CUGMJFZCCDSABL-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
- Manufacture Of Electron Tubes, Discharge Lamp Vessels, Lead-In Wires, And The Like (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2456757A DE2456757C2 (de) | 1974-11-30 | 1974-11-30 | Metallhalogenid-Hochdruckgasentladungslampe |
| US05/630,536 US4015164A (en) | 1974-11-30 | 1975-11-10 | Metallic halide high-pressure gas discharge lamp |
| CA240,120A CA1046130A (en) | 1974-11-30 | 1975-11-20 | Metallic halide high-pressure discharge lamp including arsenic |
| NL7513774A NL7513774A (nl) | 1974-11-30 | 1975-11-26 | Metaalhalogenidehogedrukgasontladingslamp. |
| CH1534375A CH594983A5 (OSRAM) | 1974-11-30 | 1975-11-26 | |
| JP50141237A JPS5178084A (OSRAM) | 1974-11-30 | 1975-11-27 | |
| BR7507885*A BR7507885A (pt) | 1974-11-30 | 1975-11-27 | Lampada de descarga de gas,de alta pressao,de halogeneto de metal |
| SE7513380A SE7513380L (sv) | 1974-11-30 | 1975-11-27 | Hogtrycksgasurladdningslampa |
| IT29732/75A IT1049892B (it) | 1974-11-30 | 1975-11-27 | Lampada a scarica in atmosfera gassosa ad alta pressione contenente alogenuri metallici |
| GB48789/75A GB1522330A (en) | 1974-11-30 | 1975-11-27 | Discharge lamp |
| AR261398A AR208575A1 (es) | 1974-11-30 | 1975-11-28 | Lampara de descarga gaseosa de haluro metalico a alta presion |
| FR7536508A FR2293056A1 (fr) | 1974-11-30 | 1975-11-28 | Lampe a decharge dans la vapeur d'halogenure metallique a haute pression |
| BE162326A BE836126A (fr) | 1974-11-30 | 1975-11-28 | Lampe a decharge dans la vapeur d'halogenure metallique a haute pression |
| AU87068/75A AU8706875A (en) | 1974-11-30 | 1975-11-28 | Metallic halide high-pressure gas discharge lamp |
| ES443058A ES443058A1 (es) | 1974-11-30 | 1975-11-28 | Perfeccionamientos introducidos en una lampara de descarga en gas a alta presion de halogenuro metalico. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2456757A DE2456757C2 (de) | 1974-11-30 | 1974-11-30 | Metallhalogenid-Hochdruckgasentladungslampe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2456757A1 DE2456757A1 (de) | 1976-08-12 |
| DE2456757C2 true DE2456757C2 (de) | 1983-06-01 |
Family
ID=5932200
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2456757A Expired DE2456757C2 (de) | 1974-11-30 | 1974-11-30 | Metallhalogenid-Hochdruckgasentladungslampe |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4015164A (OSRAM) |
| JP (1) | JPS5178084A (OSRAM) |
| AR (1) | AR208575A1 (OSRAM) |
| AU (1) | AU8706875A (OSRAM) |
| BE (1) | BE836126A (OSRAM) |
| BR (1) | BR7507885A (OSRAM) |
| CA (1) | CA1046130A (OSRAM) |
| CH (1) | CH594983A5 (OSRAM) |
| DE (1) | DE2456757C2 (OSRAM) |
| ES (1) | ES443058A1 (OSRAM) |
| FR (1) | FR2293056A1 (OSRAM) |
| GB (1) | GB1522330A (OSRAM) |
| IT (1) | IT1049892B (OSRAM) |
| NL (1) | NL7513774A (OSRAM) |
| SE (1) | SE7513380L (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4581557A (en) * | 1979-01-02 | 1986-04-08 | General Electric Company | Stabilized high intensity discharge lamp |
| NL7901480A (nl) * | 1979-02-26 | 1980-08-28 | Philips Nv | Hogedrukkwikdampontladingslamp. |
| DE4325679A1 (de) * | 1993-07-30 | 1995-02-02 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Lampe mit Halogenfüllung |
| WO2001035443A1 (en) * | 1999-11-11 | 2001-05-17 | Koninklijke Philips Electronics N.V. | High-pressure gas discharge lamp |
| DE102005061832A1 (de) * | 2005-12-23 | 2007-06-28 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe mit verbesserter Zündfähigkeit sowie Hochspannungspulsgenerator |
| US8227992B2 (en) * | 2007-07-16 | 2012-07-24 | Osram Ag | High-pressure discharge lamp |
| DE102016122228A1 (de) * | 2016-11-18 | 2018-05-24 | Ledvance Gmbh | Leuchtmittel für eine LED-Lampe und LED-Lampe |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE833221C (de) * | 1949-08-20 | 1952-03-06 | Patra Patent Treuhand | Elektrische Gasentladungsroehre, insbesondere fuer Strahlungszwecke |
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| FR1440430A (fr) * | 1964-07-16 | 1966-05-27 | Philips Nv | Lampe à décharge dans de la vapeur de mercure sous ultra-haute pression |
| NL140360B (nl) * | 1965-07-28 | 1973-11-15 | Tokyo Shibaura Electric Co | Hogedruk-gasontladingslamp. |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
| GB1283152A (en) * | 1969-05-19 | 1972-07-26 | Gen Electric | Metal halide discharge lamp |
| NL6909891A (OSRAM) * | 1969-06-27 | 1970-12-29 | ||
| GB1316803A (en) * | 1969-07-07 | 1973-05-16 | Gen Electric | High intensity arc lamp |
| NL7107535A (OSRAM) * | 1971-06-02 | 1972-12-05 |
-
1974
- 1974-11-30 DE DE2456757A patent/DE2456757C2/de not_active Expired
-
1975
- 1975-11-10 US US05/630,536 patent/US4015164A/en not_active Expired - Lifetime
- 1975-11-20 CA CA240,120A patent/CA1046130A/en not_active Expired
- 1975-11-26 CH CH1534375A patent/CH594983A5/xx not_active IP Right Cessation
- 1975-11-26 NL NL7513774A patent/NL7513774A/xx active Search and Examination
- 1975-11-27 BR BR7507885*A patent/BR7507885A/pt unknown
- 1975-11-27 GB GB48789/75A patent/GB1522330A/en not_active Expired
- 1975-11-27 IT IT29732/75A patent/IT1049892B/it active
- 1975-11-27 JP JP50141237A patent/JPS5178084A/ja active Pending
- 1975-11-27 SE SE7513380A patent/SE7513380L/xx unknown
- 1975-11-28 FR FR7536508A patent/FR2293056A1/fr active Granted
- 1975-11-28 AR AR261398A patent/AR208575A1/es active
- 1975-11-28 ES ES443058A patent/ES443058A1/es not_active Expired
- 1975-11-28 AU AU87068/75A patent/AU8706875A/en not_active Expired
- 1975-11-28 BE BE162326A patent/BE836126A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2456757A1 (de) | 1976-08-12 |
| BE836126A (fr) | 1976-05-28 |
| CH594983A5 (OSRAM) | 1978-01-31 |
| ES443058A1 (es) | 1977-04-16 |
| JPS5178084A (OSRAM) | 1976-07-07 |
| SE7513380L (sv) | 1976-05-31 |
| NL7513774A (nl) | 1976-06-01 |
| GB1522330A (en) | 1978-08-23 |
| US4015164A (en) | 1977-03-29 |
| AU8706875A (en) | 1977-06-02 |
| BR7507885A (pt) | 1976-08-10 |
| FR2293056B1 (OSRAM) | 1980-05-16 |
| CA1046130A (en) | 1979-01-09 |
| IT1049892B (it) | 1981-02-10 |
| AR208575A1 (es) | 1977-02-15 |
| FR2293056A1 (fr) | 1976-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2455277C2 (de) | Hochdruck-Zinnhalogenidentladungslampe | |
| DE2655167A1 (de) | Hochdruckentladungslampe mit metallhalogeniden | |
| EP0637056B1 (de) | Hochdruckentladungslampe | |
| DE3042291C2 (de) | Hochdruck-Metallhalogenid-Entladungslampe | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2023772B2 (de) | Metallhalogenidentladungslampe | |
| DE1911985C3 (de) | Hochdruck-Bogenentladungslampe | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| DE60031083T2 (de) | Elektrodenlose Metallhalogenid-Beleuchtungslampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2550661C3 (de) | Quecksilberdampf - Hochdrucklampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE2201831A1 (de) | Bogenentladungsvorrichtung | |
| DE69201339T2 (de) | Metalldampfentladungslampe. | |
| DE3733217C2 (OSRAM) | ||
| DE2023770C3 (de) | Hochleistungsbogenlampe | |
| WO2009115116A1 (de) | Gasentladungslampe und verfahren zum herstellen einer gasentladungslampe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE3025789A1 (de) | Hochintensive metallhalid-entladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |