DE2451847A1 - Verfahren zur elektrolytischen herstellung von metallhydroxidloesungen - Google Patents
Verfahren zur elektrolytischen herstellung von metallhydroxidloesungenInfo
- Publication number
- DE2451847A1 DE2451847A1 DE19742451847 DE2451847A DE2451847A1 DE 2451847 A1 DE2451847 A1 DE 2451847A1 DE 19742451847 DE19742451847 DE 19742451847 DE 2451847 A DE2451847 A DE 2451847A DE 2451847 A1 DE2451847 A1 DE 2451847A1
- Authority
- DE
- Germany
- Prior art keywords
- chamber
- sodium hydroxide
- cells
- cell
- liter
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 59
- 230000008569 process Effects 0.000 title claims description 32
- 238000004519 manufacturing process Methods 0.000 title claims description 21
- 229910000000 metal hydroxide Inorganic materials 0.000 title claims description 14
- 150000004692 metal hydroxides Chemical class 0.000 title claims description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 246
- 239000012528 membrane Substances 0.000 claims description 90
- 239000000243 solution Substances 0.000 claims description 74
- 238000005868 electrolysis reaction Methods 0.000 claims description 41
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 36
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 25
- 229920001577 copolymer Polymers 0.000 claims description 21
- -1 polytetrafluoroethylene Polymers 0.000 claims description 19
- 239000011780 sodium chloride Substances 0.000 claims description 18
- 239000012876 carrier material Substances 0.000 claims description 16
- 239000000463 material Substances 0.000 claims description 14
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 14
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 13
- 239000003792 electrolyte Substances 0.000 claims description 13
- 239000010936 titanium Substances 0.000 claims description 12
- 229910052719 titanium Inorganic materials 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 239000010970 precious metal Substances 0.000 claims description 10
- 229920001155 polypropylene Polymers 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 7
- 239000004743 Polypropylene Substances 0.000 claims description 6
- 229910000831 Steel Inorganic materials 0.000 claims description 6
- 239000004744 fabric Substances 0.000 claims description 6
- 150000004706 metal oxides Chemical class 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 6
- 239000010959 steel Substances 0.000 claims description 6
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 6
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- 229910044991 metal oxide Inorganic materials 0.000 claims description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 5
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 5
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 4
- 229910002804 graphite Inorganic materials 0.000 claims description 4
- 239000010439 graphite Substances 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910052895 riebeckite Inorganic materials 0.000 claims description 4
- 229910052707 ruthenium Inorganic materials 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910001507 metal halide Inorganic materials 0.000 claims description 3
- 150000005309 metal halides Chemical class 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229910000923 precious metal alloy Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- JMGNVALALWCTLC-UHFFFAOYSA-N 1-fluoro-2-(2-fluoroethenoxy)ethene Chemical compound FC=COC=CF JMGNVALALWCTLC-UHFFFAOYSA-N 0.000 claims 1
- 229910000510 noble metal Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 28
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 27
- 229910052801 chlorine Inorganic materials 0.000 description 26
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 10
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000010949 copper Substances 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000007423 decrease Effects 0.000 description 5
- 230000005611 electricity Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 4
- 239000010408 film Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 229920009441 perflouroethylene propylene Polymers 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007844 bleaching agent Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000004155 Chlorine dioxide Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 239000005708 Sodium hypochlorite Substances 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 235000019398 chlorine dioxide Nutrition 0.000 description 2
- 229910001902 chlorine oxide Inorganic materials 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 238000004381 surface treatment Methods 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- TUFKHKZLBZWCAW-UHFFFAOYSA-N 2-(1-ethenoxypropan-2-yloxy)ethanesulfonyl fluoride Chemical compound C=COCC(C)OCCS(F)(=O)=O TUFKHKZLBZWCAW-UHFFFAOYSA-N 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- 229920012485 Plasticized Polyvinyl chloride Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 238000012886 linear function Methods 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Chemical compound CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011513 prestressed concrete Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 235000015598 salt intake Nutrition 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B13/00—Diaphragms; Spacing elements
- C25B13/02—Diaphragms; Spacing elements characterised by shape or form
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US411619A US3899403A (en) | 1973-11-01 | 1973-11-01 | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2451847A1 true DE2451847A1 (de) | 1975-05-07 |
Family
ID=23629662
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742451847 Pending DE2451847A1 (de) | 1973-11-01 | 1974-10-31 | Verfahren zur elektrolytischen herstellung von metallhydroxidloesungen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3899403A (OSRAM) |
| JP (1) | JPS5075195A (OSRAM) |
| AR (1) | AR209270A1 (OSRAM) |
| AU (1) | AU7452974A (OSRAM) |
| BR (1) | BR7409139D0 (OSRAM) |
| DE (1) | DE2451847A1 (OSRAM) |
| FI (1) | FI319374A7 (OSRAM) |
| FR (1) | FR2249972A1 (OSRAM) |
| IT (1) | IT1025403B (OSRAM) |
| NL (1) | NL7414203A (OSRAM) |
| NO (1) | NO743912L (OSRAM) |
| SE (1) | SE7413728L (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4147599A (en) * | 1977-07-19 | 1979-04-03 | Diamond Shamrock Corporation | Production of alkali metal carbonates in a cell having a carboxyl membrane |
| AR205953A1 (es) * | 1975-01-22 | 1976-06-15 | Diamond Shamrock Corp | Produccion de carbonatos de metales a calinos en una celula de membrana |
| JPS597795B2 (ja) * | 1975-04-17 | 1984-02-21 | 株式会社トクヤマ | 電解用陰極鑵 |
| US4212712A (en) * | 1975-11-19 | 1980-07-15 | Kureha Kagaku Kogyo Kabushiki Kaisha | Process for the electrolytic treatment of alkali metal halide solution using ion exchange membranes |
| FR2355926A1 (fr) * | 1975-11-21 | 1978-01-20 | Rhone Poulenc Ind | Diaphragme selectif d'electrolyse |
| US4036717A (en) * | 1975-12-29 | 1977-07-19 | Diamond Shamrock Corporation | Method for concentration and purification of a cell liquor in an electrolytic cell |
| US4057474A (en) * | 1976-06-25 | 1977-11-08 | Allied Chemical Corporation | Electrolytic production of alkali metal hydroxide |
| US4076603A (en) * | 1977-04-07 | 1978-02-28 | Kaiser Aluminum & Chemical Corporation | Caustic and chlorine production process |
| US4147600A (en) * | 1978-01-06 | 1979-04-03 | Hooker Chemicals & Plastics Corp. | Electrolytic method of producing concentrated hydroxide solutions |
| FR2618165B1 (fr) * | 1987-07-17 | 1991-05-10 | Rhone Poulenc Chimie | Procede de reduction par electrolyse et de separation de l'europium et cellule d'electrolyse pour la mise en oeuvre de ce procede. |
| US20020179435A1 (en) * | 2001-06-04 | 2002-12-05 | Maddan Orville Lee | Apparatus and method for producing magnesium from seawater |
| KR101118795B1 (ko) * | 2011-12-14 | 2012-03-21 | (주) 테크윈 | 소독부산물 저감형 고효율 차아염소산나트륨 발생장치 |
| CA2871092C (en) | 2012-04-23 | 2017-05-09 | Nemaska Lithium Inc. | Processes for preparing lithium hydroxide |
| CA2874917C (en) | 2012-05-30 | 2016-06-21 | Nemaska Lithium Inc. | Processes for preparing lithium carbonate |
| DK2971252T3 (da) | 2013-03-15 | 2021-03-29 | Nemaska Lithium Inc | Fremgangsmåde til fremstilling af lithiumhydroxid |
| US10036094B2 (en) * | 2013-10-23 | 2018-07-31 | Nemaska Lithium Inc. | Processes and systems for preparing lithium hydroxide |
| CA2928224C (en) | 2013-10-23 | 2018-02-27 | Nemaska Lithium Inc. | Processes for preparing lithium carbonate |
| CN103628085B (zh) * | 2013-11-22 | 2016-10-05 | 新汶矿业集团有限责任公司泰山盐化工分公司 | 氯碱生产中水资源循环利用方法 |
| PT3492632T (pt) | 2014-02-24 | 2021-04-09 | Nemaska Lithium Inc | Métodos para o tratamento de materiais que contêm lítio |
| US9644278B2 (en) * | 2015-03-13 | 2017-05-09 | Barbara Jean Manojlovich | Recycling hydrogen generator |
| CN105063655B (zh) * | 2015-08-12 | 2017-06-06 | 江苏安凯特科技股份有限公司 | 生产亚氨基二乙酸的方法 |
| JP6974444B2 (ja) | 2016-05-17 | 2021-12-01 | ディバーシー,インコーポレーテッド | 電気化学的活性化を使用して生産されるアルカリ溶液及び塩素溶液 |
| CA2940509A1 (en) | 2016-08-26 | 2018-02-26 | Nemaska Lithium Inc. | Processes for treating aqueous compositions comprising lithium sulfate and sulfuric acid |
| AU2018212642B2 (en) | 2017-01-26 | 2021-02-04 | Diversey, Inc. | Neutralization in electro-chemical activation systems |
| CN113772750B (zh) | 2017-11-22 | 2024-05-10 | 内玛斯卡锂业有限公司 | 制备各种金属的氢氧化物和氧化物以及其衍生物的方法 |
| CA3141478A1 (en) | 2019-05-22 | 2020-11-26 | Nemaska Lithium Inc. | Processes for preparing hydroxides and oxides of various metals and derivatives thereof |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2967807A (en) * | 1952-01-23 | 1961-01-10 | Hooker Chemical Corp | Electrolytic decomposition of sodium chloride |
| NL278049A (OSRAM) * | 1961-05-05 | |||
| US3282875A (en) * | 1964-07-22 | 1966-11-01 | Du Pont | Fluorocarbon vinyl ether polymers |
| US3341366A (en) * | 1964-08-19 | 1967-09-12 | Gen Electric | Sulfonated polymers of alpha, beta, beta-trifluorostyrene, with applications to structures and cells |
| US3496077A (en) * | 1967-12-18 | 1970-02-17 | Hal B H Cooper | Electrolyzing of salt solutions |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| US3773634A (en) * | 1972-03-09 | 1973-11-20 | Diamond Shamrock Corp | Control of an olyte-catholyte concentrations in membrane cells |
-
1973
- 1973-11-01 US US411619A patent/US3899403A/en not_active Expired - Lifetime
-
1974
- 1974-10-21 AU AU74529/74A patent/AU7452974A/en not_active Expired
- 1974-10-30 AR AR256341A patent/AR209270A1/es active
- 1974-10-30 FR FR7436301A patent/FR2249972A1/fr not_active Withdrawn
- 1974-10-30 NO NO743912A patent/NO743912L/no unknown
- 1974-10-30 NL NL7414203A patent/NL7414203A/xx unknown
- 1974-10-31 BR BR9139/74A patent/BR7409139D0/pt unknown
- 1974-10-31 JP JP49126516A patent/JPS5075195A/ja active Pending
- 1974-10-31 IT IT29063/74A patent/IT1025403B/it active
- 1974-10-31 SE SE7413728A patent/SE7413728L/ not_active Application Discontinuation
- 1974-10-31 FI FI3193/74A patent/FI319374A7/fi unknown
- 1974-10-31 DE DE19742451847 patent/DE2451847A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL7414203A (nl) | 1975-05-06 |
| AU7452974A (en) | 1976-04-29 |
| FI319374A7 (OSRAM) | 1975-05-02 |
| US3899403A (en) | 1975-08-12 |
| FR2249972A1 (OSRAM) | 1975-05-30 |
| BR7409139D0 (pt) | 1975-08-26 |
| JPS5075195A (OSRAM) | 1975-06-20 |
| SE7413728L (OSRAM) | 1975-05-02 |
| NO743912L (OSRAM) | 1975-05-26 |
| AR209270A1 (es) | 1977-04-15 |
| IT1025403B (it) | 1978-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451847A1 (de) | Verfahren zur elektrolytischen herstellung von metallhydroxidloesungen | |
| DE2451845C3 (de) | Verfahren zur elektrolytischen Herstellung von Chloraten | |
| DE69016459T2 (de) | Elektrochemischer chlordioxidgenerator. | |
| DE3342713C2 (de) | Verfahren zur Bildung eines quaternären Ammoniumsalzes | |
| DE2455222A1 (de) | Elektrolysezelle | |
| DE69108018T2 (de) | Vorrichtung zur herstellung von chlorsäure und verchlorsäure. | |
| DE2844496C2 (de) | Verfahren zum Herstellen von Halogen und Alkalimetallhydroxiden | |
| DE1047765B (de) | Verfahren und Vorrichtung zur Herstellung von gesaettigten aliphatischen Carbonsaeuren durch Elektrolyse von waessrigen Loesungen ihrer Salze in mehrkammerigen Zellen | |
| DE2251660A1 (de) | Verfahren und vorrichtung zur herstellung von hochreinem alkalimetallhydroxid in einer elektrolytischen zelle | |
| EP4112780B1 (de) | Dreikammerelektrolysezelle zur herstellung von alkalimetallalkoholaten | |
| DE3013538A1 (de) | Chloralkali-elektrolysezelle | |
| DE2603144A1 (de) | Betriebsverfahren fuer eine elektrolytische zelle mit drei abteilungen zur herstellung von alkalimetallhydroxiden | |
| DE2451846A1 (de) | Verfahren zur elektrolytischen herstellung von metallhydroxidloesungen | |
| DE2303589A1 (de) | Elektrolytische zellenanordnungen und chemische herstellungsverfahren | |
| DE1667835B2 (de) | Verfahren zur elektrolytischen oxydation von thallium (i) - oder cer (iii) - salzloesungen | |
| DE3786716T2 (de) | Elektrolytische Zelle. | |
| DE2454827C3 (de) | Elektrolysezelle | |
| DE2946406A1 (de) | Elektrolysezellelemente | |
| DE2551234A1 (de) | Rahmen fuer eine elektrolysezelle aus einem synthetischen, organischen polymeren und verfahren zu seiner herstellung | |
| DE2510396A1 (de) | Verfahren zur elektrolyse waessriger loesungen und elektrolysezelle zur durchfuehrung des verfahrens | |
| DE4143172C2 (de) | Verfahren zum Herstellen von Chlor und Alkalihydroxid | |
| DE2434921C3 (de) | Elektrolysezelle und Verfahren zur Elektrolyse ionisierbarer chemischer Verbindungen | |
| DE68928338T2 (de) | Zelle und Verfahren zum Betrieb einer elektrochemischen Zelle vom Typ flüssig-gasförmig | |
| DE2652771B2 (de) | Dreikammerelektrolysezelle und Verfahren zur Elektrolyse von Salzen darin | |
| DE10031018B4 (de) | Chloralkalielektrolyse-Verfahren in Membranzellen unter Elektrolyse von ungereinigtem Siedesalz |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |