DE2451545A1 - Halterungsaufbau fuer ein keramisches entladungsrohr - Google Patents
Halterungsaufbau fuer ein keramisches entladungsrohrInfo
- Publication number
- DE2451545A1 DE2451545A1 DE19742451545 DE2451545A DE2451545A1 DE 2451545 A1 DE2451545 A1 DE 2451545A1 DE 19742451545 DE19742451545 DE 19742451545 DE 2451545 A DE2451545 A DE 2451545A DE 2451545 A1 DE2451545 A1 DE 2451545A1
- Authority
- DE
- Germany
- Prior art keywords
- wire
- lead wire
- extends
- piston
- thin lead
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000919 ceramic Substances 0.000 title claims description 21
- WABPQHHGFIMREM-UHFFFAOYSA-N lead(0) Chemical compound [Pb] WABPQHHGFIMREM-UHFFFAOYSA-N 0.000 claims description 41
- 229910052751 metal Inorganic materials 0.000 claims description 30
- 239000002184 metal Substances 0.000 claims description 30
- 239000010955 niobium Substances 0.000 claims description 19
- 229910052758 niobium Inorganic materials 0.000 claims description 16
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 16
- 239000000463 material Substances 0.000 claims description 8
- 229910052726 zirconium Inorganic materials 0.000 claims description 8
- 150000002739 metals Chemical class 0.000 claims description 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 5
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 5
- 229910045601 alloy Inorganic materials 0.000 claims description 5
- 239000000956 alloy Substances 0.000 claims description 5
- 239000004020 conductor Substances 0.000 claims description 5
- 229910052750 molybdenum Inorganic materials 0.000 claims description 5
- 239000011733 molybdenum Substances 0.000 claims description 5
- 229910052715 tantalum Inorganic materials 0.000 claims description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052719 titanium Inorganic materials 0.000 claims description 5
- 239000010936 titanium Substances 0.000 claims description 5
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- 239000010937 tungsten Substances 0.000 claims description 5
- 229910052720 vanadium Inorganic materials 0.000 claims description 5
- 239000003870 refractory metal Substances 0.000 claims description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 4
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims 1
- 238000007789 sealing Methods 0.000 description 6
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 229910010293 ceramic material Inorganic materials 0.000 description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 2
- 239000000292 calcium oxide Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003566 sealing material Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 239000005394 sealing glass Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/34—Double-wall vessels or containers
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US412659A US3882346A (en) | 1973-11-05 | 1973-11-05 | Ceramic arc tube mounting structure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2451545A1 true DE2451545A1 (de) | 1975-05-07 |
Family
ID=23633881
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742451545 Withdrawn DE2451545A1 (de) | 1973-11-05 | 1974-10-30 | Halterungsaufbau fuer ein keramisches entladungsrohr |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3882346A (OSRAM) |
| JP (1) | JPS5442193B2 (OSRAM) |
| AR (1) | AR202666A1 (OSRAM) |
| BE (1) | BE821857A (OSRAM) |
| BR (1) | BR7409220A (OSRAM) |
| CA (1) | CA1014591A (OSRAM) |
| DE (1) | DE2451545A1 (OSRAM) |
| GB (1) | GB1486611A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2733168A1 (de) * | 1976-08-02 | 1978-02-09 | Gen Electric | Rauscharme natriumdampflampe fuer tonfrequenz-impulsbetrieb |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX144086A (es) | 1975-12-15 | 1981-08-26 | Gen Electric | Mejoras en una lampara de descarga de alta presion de vapor metalico |
| US4034252A (en) * | 1975-12-15 | 1977-07-05 | General Electric Company | Ceramic lamp seal and control of sealing frit distribution |
| JPS52164376U (OSRAM) * | 1976-06-08 | 1977-12-13 | ||
| JPS5328685U (OSRAM) * | 1976-08-17 | 1978-03-11 | ||
| US4065691A (en) * | 1976-12-06 | 1977-12-27 | General Electric Company | Ceramic lamp having electrodes supported by crimped tubular inlead |
| US4254355A (en) * | 1978-09-11 | 1981-03-03 | General Electric Company | Ceramic arc tube mounting |
| US4333032A (en) * | 1978-09-25 | 1982-06-01 | Gte Products Corporation | High pressure sodium lamp containing barium getter |
| US4401913A (en) * | 1981-06-03 | 1983-08-30 | Gte Products Corporation | Discharge lamp with mount providing self centering and thermal expansion compensation |
| US4737677A (en) * | 1984-11-30 | 1988-04-12 | Gte Products Corporation | Linear sodium lamp arc tube centering means |
| US4708679A (en) * | 1986-09-29 | 1987-11-24 | North American Philips Lighting Corp. | Method of making support means for discharge lamp tubes |
| DE3739008A1 (de) * | 1987-11-17 | 1989-05-24 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| US5229681A (en) * | 1989-10-10 | 1993-07-20 | Musco Corporation | Discharge lamp with offset or tilted arc tube |
| DE9013279U1 (de) * | 1990-09-19 | 1990-11-22 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 81543 München | Einseitig gesockelte Hochdruck-Entladungslampe |
| US5173632A (en) * | 1991-02-26 | 1992-12-22 | Gte Products Corporation | High pressure sodium arc discharge lamp with weldless arc tube support member |
| US5408157A (en) * | 1993-03-09 | 1995-04-18 | North American Philips Corporation | Dual arc tube discharge lamp having a lamp frame with coplanar spot welds and slip-free construction |
| AUPM533494A0 (en) * | 1994-04-27 | 1994-05-19 | ACMA Technologies Pte. Limited | Improvements in, or relating to lamps |
| WO2001008198A1 (en) * | 1999-07-27 | 2001-02-01 | Koninklijke Philips Electronics N.V. | Electric lamp |
| DE10015558C2 (de) | 2000-03-30 | 2002-03-14 | Heraeus Noblelight Gmbh | Optischer Strahler |
| US7132797B2 (en) * | 2002-12-18 | 2006-11-07 | General Electric Company | Hermetical end-to-end sealing techniques and lamp having uniquely sealed components |
| US7839089B2 (en) * | 2002-12-18 | 2010-11-23 | General Electric Company | Hermetical lamp sealing techniques and lamp having uniquely sealed components |
| US7215081B2 (en) * | 2002-12-18 | 2007-05-08 | General Electric Company | HID lamp having material free dosing tube seal |
| EP1611597A1 (en) * | 2003-02-27 | 2006-01-04 | Koninklijke Philips Electronics N.V. | High-pressure discharge lamp |
| US7358666B2 (en) * | 2004-09-29 | 2008-04-15 | General Electric Company | System and method for sealing high intensity discharge lamps |
| US7453212B2 (en) * | 2005-01-31 | 2008-11-18 | Osram Sylvania Inc. | Ceramic discharge vessel having tungsten alloy feedthrough |
| RU2278437C1 (ru) * | 2005-02-28 | 2006-06-20 | Виктор Иванович Цай | Лампа с вращающейся колбой и источником излучения |
| US7615929B2 (en) * | 2005-06-30 | 2009-11-10 | General Electric Company | Ceramic lamps and methods of making same |
| US7852006B2 (en) * | 2005-06-30 | 2010-12-14 | General Electric Company | Ceramic lamp having molybdenum-rhenium end cap and systems and methods therewith |
| US7432657B2 (en) * | 2005-06-30 | 2008-10-07 | General Electric Company | Ceramic lamp having shielded niobium end cap and systems and methods therewith |
| DE102005038551B3 (de) * | 2005-08-12 | 2007-04-05 | W.C. Heraeus Gmbh | Draht und Gestell für einseitig gesockelte Lampen auf Basis von Niob oder Tantal sowie Herstellungsverfahren und Verwendung |
| US7378799B2 (en) * | 2005-11-29 | 2008-05-27 | General Electric Company | High intensity discharge lamp having compliant seal |
| RU2319249C1 (ru) * | 2006-04-27 | 2008-03-10 | Виктор Иванович Цай | Лампа с вращающейся колбой и источником излучения |
| RU2322727C1 (ru) * | 2007-01-30 | 2008-04-20 | Виктор Иванович Цай | Лампа с вращающейся колбой и источником излучения |
| US8299709B2 (en) * | 2007-02-05 | 2012-10-30 | General Electric Company | Lamp having axially and radially graded structure |
| WO2009035360A1 (fr) * | 2007-09-12 | 2009-03-19 | Victor Ivanovich Tsay | Ampoule électrique à bulbe rotatif et source d'éclairage |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE440887A (OSRAM) * | 1938-09-10 | |||
| US3333132A (en) * | 1964-05-19 | 1967-07-25 | Westinghouse Electric Corp | Discharge lamp having heat reflecting shields surrounding its electrodes |
| US3453477A (en) * | 1967-02-16 | 1969-07-01 | Gen Electric | Alumina-ceramic sodium vapor lamp |
| US3558963A (en) * | 1968-08-16 | 1971-01-26 | Gen Electric | High-intensity vapor arc-lamp |
| US3623134A (en) * | 1969-12-31 | 1971-11-23 | Westinghouse Electric Corp | Arc tube centering device |
| US3746914A (en) * | 1971-12-30 | 1973-07-17 | Gte Sylvania Inc | Arc discharge tube with surrounding starting coil |
-
1973
- 1973-11-05 US US412659A patent/US3882346A/en not_active Expired - Lifetime
-
1974
- 1974-10-09 AR AR255999A patent/AR202666A1/es active
- 1974-10-09 CA CA211,095A patent/CA1014591A/en not_active Expired
- 1974-10-24 JP JP12199074A patent/JPS5442193B2/ja not_active Expired
- 1974-10-30 DE DE19742451545 patent/DE2451545A1/de not_active Withdrawn
- 1974-11-04 BR BR9220/74A patent/BR7409220A/pt unknown
- 1974-11-05 BE BE150211A patent/BE821857A/xx unknown
- 1974-11-05 GB GB47790/74A patent/GB1486611A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2733168A1 (de) * | 1976-08-02 | 1978-02-09 | Gen Electric | Rauscharme natriumdampflampe fuer tonfrequenz-impulsbetrieb |
Also Published As
| Publication number | Publication date |
|---|---|
| BR7409220A (pt) | 1976-05-11 |
| AR202666A1 (es) | 1975-06-30 |
| US3882346A (en) | 1975-05-06 |
| JPS5079183A (OSRAM) | 1975-06-27 |
| GB1486611A (en) | 1977-09-21 |
| JPS5442193B2 (OSRAM) | 1979-12-12 |
| CA1014591A (en) | 1977-07-26 |
| BE821857A (fr) | 1975-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451545A1 (de) | Halterungsaufbau fuer ein keramisches entladungsrohr | |
| DE2754001C2 (de) | Alkalimetalldampf-Hochdrucklampe | |
| DE2623099C2 (de) | Kurzbogenentladungslampe | |
| DE60130204T2 (de) | Hochdruckentladungslampe | |
| DE1220039B (de) | Elektrische Metalldampflampe | |
| EP1542256B1 (de) | Haltevorrichtung zur Fixierung eines Lampenkolbens und zugehörige Lampe | |
| DE60021218T2 (de) | Bogenröhre, Montageelement und elektrische Lampenanordnung | |
| DE19856871A1 (de) | Kittlos gesockelte Lampe | |
| EP0316617B1 (de) | Hochdruckentladungslampe | |
| EP2020018A1 (de) | Hochdruckentladungslampe | |
| DE2935980C2 (de) | Halterung für ein keramisches Entladungsrohr einer Hochleistungsentladungslampe | |
| DE2154712A1 (de) | Lampenanordnung mit Abdichtung Aluminiumdioxid-Metall | |
| DE2548301C3 (de) | Natriumdampf-Hochdrucklampe | |
| DE3151513C2 (de) | Hochdruckmetalldampflampe | |
| DE2209805C2 (de) | Metalldampfhochdruckentladungslampe | |
| DE2704105A1 (de) | Traege bzw. verzoegerungsschmelzsicherung | |
| DE4008375A1 (de) | Hochdruckentladungslampe | |
| DE2656264C3 (de) | Leitungseinführung für eine Hochdruck-Dampfentladungslampe | |
| DE2223057A1 (de) | Bogenlampe | |
| DE3012322C2 (de) | Glasige Dichtungsmasse aus CaO, BaO, Al↓2↓O↓3↓ und gegebenenfalls MgO zur Verwendung beim Verbinden mit Aluminiumoxidkeramik | |
| DE3855395T2 (de) | Natriumhochdrucklampe, gefüllt mit bestimmter Natriumamalgamquantität | |
| DE10218827A1 (de) | Niederdruckentladungslampe mit Abschaltvorrichtung am Lebensdauerende | |
| EP0588201A2 (de) | Hochdruckentladungslampe und Herstellungsverfahren für eine Hochdruckentladungslampe | |
| DE2619866A1 (de) | Gasentladungsroehre, insbesondere ueberspannungsableiter | |
| DE1571501C3 (de) | Verfahren zur Herstellung eines Entladungskolbens für eine elektrische Alkalimetalldampf-Entladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |