DE2442428A1 - Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylestern - Google Patents
Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylesternInfo
- Publication number
- DE2442428A1 DE2442428A1 DE2442428A DE2442428A DE2442428A1 DE 2442428 A1 DE2442428 A1 DE 2442428A1 DE 2442428 A DE2442428 A DE 2442428A DE 2442428 A DE2442428 A DE 2442428A DE 2442428 A1 DE2442428 A1 DE 2442428A1
- Authority
- DE
- Germany
- Prior art keywords
- nickel
- chloride
- allyl
- catalyst
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 30
- 230000008569 process Effects 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 84
- 239000003054 catalyst Substances 0.000 claims description 52
- 238000006243 chemical reaction Methods 0.000 claims description 46
- 229910052759 nickel Inorganic materials 0.000 claims description 26
- 239000007868 Raney catalyst Substances 0.000 claims description 24
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 24
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 16
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 14
- 229910017052 cobalt Inorganic materials 0.000 claims description 13
- 239000010941 cobalt Substances 0.000 claims description 13
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 13
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 12
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 claims description 10
- 238000004821 distillation Methods 0.000 claims description 10
- -1 alkyl phosphite Chemical compound 0.000 claims description 8
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 claims description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 150000001348 alkyl chlorides Chemical class 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 230000003197 catalytic effect Effects 0.000 description 9
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 8
- 229960003750 ethyl chloride Drugs 0.000 description 8
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 8
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 7
- QOPBTFMUVTXWFF-UHFFFAOYSA-N tripropyl phosphite Chemical compound CCCOP(OCCC)OCCC QOPBTFMUVTXWFF-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 6
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 5
- YPJHXRAHMUKXAE-UHFFFAOYSA-N 3-diethoxyphosphorylprop-1-ene Chemical compound CCOP(=O)(CC=C)OCC YPJHXRAHMUKXAE-UHFFFAOYSA-N 0.000 description 5
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 229950000688 phenothiazine Drugs 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YFEWYGFTFNHSQF-UHFFFAOYSA-N 1-[ethenyl(propoxy)phosphoryl]oxypropane Chemical compound CCCOP(=O)(C=C)OCCC YFEWYGFTFNHSQF-UHFFFAOYSA-N 0.000 description 3
- VIRWKAJWTKAIMA-UHFFFAOYSA-N 2-chloroethyl acetate Chemical compound CC(=O)OCCCl VIRWKAJWTKAIMA-UHFFFAOYSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- RZKYDQNMAUSEDZ-UHFFFAOYSA-N prop-2-enylphosphonic acid Chemical compound OP(O)(=O)CC=C RZKYDQNMAUSEDZ-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000007306 turnover Effects 0.000 description 3
- OHBQPCCCRFSCAX-UHFFFAOYSA-N 1,4-Dimethoxybenzene Chemical compound COC1=CC=C(OC)C=C1 OHBQPCCCRFSCAX-UHFFFAOYSA-N 0.000 description 2
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical class [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000012432 intermediate storage Methods 0.000 description 2
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- 229940050176 methyl chloride Drugs 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- GNHMRTZZNHZDDM-UHFFFAOYSA-N 3-chloropropionitrile Chemical compound ClCCC#N GNHMRTZZNHZDDM-UHFFFAOYSA-N 0.000 description 1
- ZOSQAGGCVFVCNO-UHFFFAOYSA-N 3-dimethoxyphosphorylprop-1-ene Chemical compound COP(=O)(OC)CC=C ZOSQAGGCVFVCNO-UHFFFAOYSA-N 0.000 description 1
- JTTMYKSFKOOQLP-UHFFFAOYSA-N 4-hydroxydiphenylamine Chemical compound C1=CC(O)=CC=C1NC1=CC=CC=C1 JTTMYKSFKOOQLP-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000007014 Michaelis-Becker reaction Methods 0.000 description 1
- 229910018553 Ni—O Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 125000003700 epoxy group Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- XAKRTGZVYPZHCO-UHFFFAOYSA-O hydroxy-methoxy-oxophosphanium Chemical group CO[P+](O)=O XAKRTGZVYPZHCO-UHFFFAOYSA-O 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- ZPFZQRQDUOHLJK-UHFFFAOYSA-N nickel;prop-2-enenitrile Chemical compound [Ni].C=CC#N.C=CC#N ZPFZQRQDUOHLJK-UHFFFAOYSA-N 0.000 description 1
- QCYXGORGJYUYMT-UHFFFAOYSA-N nickel;triphenylphosphane Chemical compound [Ni].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QCYXGORGJYUYMT-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- RPGWZZNNEUHDAQ-UHFFFAOYSA-N phenylphosphine Chemical compound PC1=CC=CC=C1 RPGWZZNNEUHDAQ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000009997 thermal pre-treatment Methods 0.000 description 1
- 150000003623 transition metal compounds Chemical class 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- SJHCUXCOGGKFAI-UHFFFAOYSA-N tripropan-2-yl phosphite Chemical compound CC(C)OP(OC(C)C)OC(C)C SJHCUXCOGGKFAI-UHFFFAOYSA-N 0.000 description 1
- LUVCTYHBTXSAMX-UHFFFAOYSA-N tris(2-chloroethyl) phosphite Chemical compound ClCCOP(OCCCl)OCCCl LUVCTYHBTXSAMX-UHFFFAOYSA-N 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4015—Esters of acyclic unsaturated acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2442428A DE2442428A1 (de) | 1974-09-05 | 1974-09-05 | Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylestern |
| US05/607,946 US4017564A (en) | 1974-09-05 | 1975-08-26 | Process for the production of (meth)allyl phosphonic acid dialkyl esters |
| NL7510350A NL7510350A (nl) | 1974-09-05 | 1975-09-02 | Werkwijze ter bereiding van (meth)-allylfosfon- zuurdialkylesters. |
| LU73319A LU73319A1 (enExample) | 1974-09-05 | 1975-09-03 | |
| JP50106075A JPS5152131A (en) | 1974-09-05 | 1975-09-03 | * meto * ariruhosupponsanjiarukiruesuteruno seizohoho |
| AT678775A AT334397B (de) | 1974-09-05 | 1975-09-03 | Verfahren zur herstellung von allyl- oder methallylphosphonsauredialkylestern |
| DK397275A DK397275A (da) | 1974-09-05 | 1975-09-04 | Fremgangsmade til fremstilling af (meth)-allylphosphonsyredialkylestere |
| ES440721A ES440721A1 (es) | 1974-09-05 | 1975-09-04 | Procedimiento para la obtencion de esteres de dialquilo de acido alil y metalifosfonicos. |
| DD188189A DD123480A5 (enExample) | 1974-09-05 | 1975-09-04 | |
| FR7527372A FR2283901A1 (fr) | 1974-09-05 | 1975-09-05 | Procede de preparation d'esters dialcoyles d'acide (meth)allylphosphonique |
| BE159758A BE833097A (fr) | 1974-09-05 | 1975-09-05 | Procede de preparation d'esters dialcoyles d'acide (meth)allyl-phosphonique |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2442428A DE2442428A1 (de) | 1974-09-05 | 1974-09-05 | Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2442428A1 true DE2442428A1 (de) | 1976-03-18 |
Family
ID=5924894
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2442428A Pending DE2442428A1 (de) | 1974-09-05 | 1974-09-05 | Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylestern |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4017564A (enExample) |
| JP (1) | JPS5152131A (enExample) |
| AT (1) | AT334397B (enExample) |
| BE (1) | BE833097A (enExample) |
| DD (1) | DD123480A5 (enExample) |
| DE (1) | DE2442428A1 (enExample) |
| DK (1) | DK397275A (enExample) |
| ES (1) | ES440721A1 (enExample) |
| FR (1) | FR2283901A1 (enExample) |
| LU (1) | LU73319A1 (enExample) |
| NL (1) | NL7510350A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0043482A3 (en) * | 1980-07-04 | 1982-05-19 | Bayer Ag | Process for preparing aryl-phosphonyl compounds |
| US4758384A (en) * | 1987-08-07 | 1988-07-19 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
| US5047578A (en) * | 1987-08-07 | 1991-09-10 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
| US5077366A (en) * | 1987-08-07 | 1991-12-31 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4633005A (en) * | 1984-07-02 | 1986-12-30 | Allied Corporation | Method for the preparation of allyl phosphonate diesters |
| US5124047A (en) * | 1990-11-01 | 1992-06-23 | W. R. Grace & Co.-Conn. | Method of inhibiting scale deposits |
| US5091491A (en) * | 1990-11-01 | 1992-02-25 | W. R. Grace & Co.-Conn. | Water-soluble allylphosphonate copolymers |
| US5177238A (en) * | 1991-07-16 | 1993-01-05 | W. R. Grace & Co.-Conn. | Preparation of dialkyl allylphosphonic acid diesters |
| US5142084A (en) * | 1991-10-11 | 1992-08-25 | Carter Charles G | Preparation of allylphosphonic acid |
| US7423168B2 (en) * | 2002-08-29 | 2008-09-09 | Mitsubishi Chemical Corporation | Method for producing allyl compound |
| CN118652489B (zh) * | 2024-07-01 | 2025-02-11 | 广东德源亨电缆实业有限公司 | 一种低烟无卤阻燃聚烯烃护套电力电缆 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2636027A (en) * | 1948-10-06 | 1953-04-21 | Eastman Kodak Co | Alkyl esters of allyl phosphonic acids and polymers prepared therefrom |
| US3493639A (en) * | 1965-10-27 | 1970-02-03 | Shell Oil Co | Process for producing pentavalent phosphorus derivatives |
| US3705214A (en) * | 1970-04-15 | 1972-12-05 | Stauffer Chemical Co | Catalyzed process for producing pentavalent phosphorus derivatives |
-
1974
- 1974-09-05 DE DE2442428A patent/DE2442428A1/de active Pending
-
1975
- 1975-08-26 US US05/607,946 patent/US4017564A/en not_active Expired - Lifetime
- 1975-09-02 NL NL7510350A patent/NL7510350A/xx not_active Application Discontinuation
- 1975-09-03 LU LU73319A patent/LU73319A1/xx unknown
- 1975-09-03 AT AT678775A patent/AT334397B/de not_active IP Right Cessation
- 1975-09-03 JP JP50106075A patent/JPS5152131A/ja active Pending
- 1975-09-04 ES ES440721A patent/ES440721A1/es not_active Expired
- 1975-09-04 DD DD188189A patent/DD123480A5/xx unknown
- 1975-09-04 DK DK397275A patent/DK397275A/da unknown
- 1975-09-05 FR FR7527372A patent/FR2283901A1/fr active Granted
- 1975-09-05 BE BE159758A patent/BE833097A/xx unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0043482A3 (en) * | 1980-07-04 | 1982-05-19 | Bayer Ag | Process for preparing aryl-phosphonyl compounds |
| US4391761A (en) | 1980-07-04 | 1983-07-05 | Bayer Aktiengesellschaft | Process for the production of aryl phosphonyl compounds |
| US4758384A (en) * | 1987-08-07 | 1988-07-19 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
| US5047578A (en) * | 1987-08-07 | 1991-09-10 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
| US5077366A (en) * | 1987-08-07 | 1991-12-31 | The Dow Chemical Company | Novel phosphonic acid compounds and method of preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| ES440721A1 (es) | 1977-03-16 |
| LU73319A1 (enExample) | 1976-08-13 |
| NL7510350A (nl) | 1976-03-09 |
| FR2283901A1 (fr) | 1976-04-02 |
| DK397275A (da) | 1976-03-06 |
| DD123480A5 (enExample) | 1976-12-20 |
| FR2283901B1 (enExample) | 1979-06-22 |
| US4017564A (en) | 1977-04-12 |
| BE833097A (fr) | 1976-03-05 |
| ATA678775A (de) | 1976-05-15 |
| JPS5152131A (en) | 1976-05-08 |
| AT334397B (de) | 1976-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2442428A1 (de) | Verfahren zur herstellung von (meth)allylphosphonsaeuredialkylestern | |
| DE899040C (de) | Verfahren zur Herstellung organischer Phosphine | |
| DE3146197A1 (de) | Verfahren zur herstellung von phosphonigsaeuremonoalkylestern | |
| DE1903356C3 (de) | Verfahren zur Herstellung substituierter Vinylester von Phosphorsäuren | |
| DE1131671B (de) | Verfahren zur Herstellung von Vinylphosphinen | |
| DE4012489A1 (de) | Verfahren zur herstellung von 1-halogen-1-oxophospholenen | |
| DE1211204B (de) | Verfahren zur Herstellung von 1:1-Addukten von alpha-Dicarbonylverbindungen an dreiwertige Phosphorverbindungen | |
| DE2127821A1 (en) | Acyloxyalkanephosphonic and phosphinic acid diester prepn - - phosphinic acid diester prepn | |
| DE19828419A1 (de) | Verfahren zur Herstellung von Vinylphosphonsäure-Verbindungen | |
| CH646130A5 (de) | Verfahren zur herstellung von eine perfluorkohlenstoffgruppe enthaltenden aldehyden. | |
| EP0130439B1 (de) | Verfahren zur Herstellung von Derivaten der Vinylphosphon-, oder Vinylpyrophosphonsäure | |
| EP0019719B1 (de) | Verfahren zur Herstellung von Alkenen, neue Zwischenprodukte zu ihrer Herstellung und Verfahren zu deren Herstellung | |
| DE1050760B (de) | Verfahren zur Herstellung von polymerisierbaren olefinisch ungesättigten Acyloxyhalogenalkoxyphosphorsäureestern bzw. -phosphonsäureestern | |
| DE19933601A1 (de) | Verfahren zur Herstellung ungesättigter Phosphonsäureester | |
| EP0144743B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| EP0031915B1 (de) | Verfahren zur Herstellung von Halogenalkenen | |
| DE3641100C2 (enExample) | ||
| DE2511932C2 (de) | Verfahren zur Herstellung von tert.-Hydroxyalkylphosphinoxiden | |
| DE4205115C1 (enExample) | ||
| DE2461906B2 (de) | Phosphinoxide mit polyfluorierter Kette und Verfahren zu ihrer Herstellung | |
| DE2407006C3 (de) | Verfahren zur Oxyalkylierung von Chloriden und Bromiden des dreiwertigen Phosphors | |
| DE3111152A1 (de) | Verfahren zur herstellung von oligophosphonsaeuren beziehungsweise oligophosphinsaeuren, ihren salzen und/oder estern sowie neue phosphonsaeure- und phosphinsaeurederivate | |
| DD154696A5 (de) | Verfahren zur herstellung von 1,1-dichloralkenen | |
| AT292017B (de) | Verfahren zur Herstellung von substituierten Vinylestern von Phosphorsäuren | |
| DE2826621A1 (de) | Verfahren zur herstellung von 1-oxophospholenen- delta hoch 3 |