DE2437983C3 - Verfahren zur Herstellung von Resorcinen - Google Patents
Verfahren zur Herstellung von ResorcinenInfo
- Publication number
- DE2437983C3 DE2437983C3 DE2437983A DE2437983A DE2437983C3 DE 2437983 C3 DE2437983 C3 DE 2437983C3 DE 2437983 A DE2437983 A DE 2437983A DE 2437983 A DE2437983 A DE 2437983A DE 2437983 C3 DE2437983 C3 DE 2437983C3
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- cyclohexanedione
- resorcinol
- dehydrogenation
- solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 16
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 title claims 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 5
- HJSLFCCWAKVHIW-UHFFFAOYSA-N cyclohexane-1,3-dione Chemical class O=C1CCCC(=O)C1 HJSLFCCWAKVHIW-UHFFFAOYSA-N 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000006165 cyclic alkyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 description 29
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 17
- OILAIQUEIWYQPH-UHFFFAOYSA-N cyclohexane-1,2-dione Chemical compound O=C1CCCCC1=O OILAIQUEIWYQPH-UHFFFAOYSA-N 0.000 description 15
- -1 resorcinol aldehyde Chemical class 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 229920001223 polyethylene glycol Polymers 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 229910000510 noble metal Inorganic materials 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 1
- RJWLXGOSIRVRAR-UHFFFAOYSA-N 2,4-dimethylbenzene-1,3-diol Chemical compound CC1=CC=C(O)C(C)=C1O RJWLXGOSIRVRAR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JFTPIEHHCQPVCS-UHFFFAOYSA-N 3-methoxycyclohex-2-en-1-one Chemical compound COC1=CC(=O)CCC1 JFTPIEHHCQPVCS-UHFFFAOYSA-N 0.000 description 1
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 description 1
- JXHGEIHXCLLHPI-UHFFFAOYSA-N benzene-1,3-diol;phenol Chemical compound OC1=CC=CC=C1.OC1=CC=CC(O)=C1 JXHGEIHXCLLHPI-UHFFFAOYSA-N 0.000 description 1
- DOMXXHFJCIAARD-UHFFFAOYSA-N benzene-1,3-diol;sodium Chemical compound [Na].[Na].OC1=CC=CC(O)=C1 DOMXXHFJCIAARD-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- FDODVZVWGKVMBO-UHFFFAOYSA-N cyclohex-2-ene-1,4-diol Chemical class OC1CCC(O)C=C1 FDODVZVWGKVMBO-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- KRMSCBCZIJYFFP-UHFFFAOYSA-N methyl 4-methyl-5-oxoheptanoate Chemical compound CCC(=O)C(C)CCC(=O)OC KRMSCBCZIJYFFP-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/06—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by conversion of non-aromatic six-membered rings or of such rings formed in situ into aromatic six-membered rings, e.g. by dehydrogenation
- C07C37/07—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by conversion of non-aromatic six-membered rings or of such rings formed in situ into aromatic six-membered rings, e.g. by dehydrogenation with simultaneous reduction of C=O group in that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/64—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of functional groups containing oxygen only in singly bound form
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/65—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by splitting-off hydrogen atoms or functional groups; by hydrogenolysis of functional groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2437983A DE2437983C3 (de) | 1974-08-07 | 1974-08-07 | Verfahren zur Herstellung von Resorcinen |
| ZA00754863A ZA754863B (en) | 1974-08-07 | 1975-07-29 | Process for the manufacture of resorcinol |
| CA232,790A CA1055963A (en) | 1974-08-07 | 1975-07-31 | Process for the manufacture of resorcinol |
| NL7509211A NL7509211A (nl) | 1974-08-07 | 1975-08-01 | Werkwijze voor het bereiden van resorcinolen. |
| CH1013875A CH598166A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1974-08-07 | 1975-08-04 | |
| IT26152/75A IT1040401B (it) | 1974-08-07 | 1975-08-05 | Processo per la preparazone di resorcine |
| JP50095089A JPS5858334B2 (ja) | 1974-08-07 | 1975-08-06 | レゾルシンノセイホウ |
| BR7505061*A BR7505061A (pt) | 1974-08-07 | 1975-08-07 | Processo para a obtencao de resorcinois |
| FR7524644A FR2281347A1 (fr) | 1974-08-07 | 1975-08-07 | Procede de preparation de resorcinols |
| BE159024A BE832223A (fr) | 1974-08-07 | 1975-08-07 | Procede de preparation de resorcinols |
| GB33075/75A GB1517726A (en) | 1974-08-07 | 1975-08-07 | Manufacture of resorcinol and its derivatives |
| US05/850,815 US4160113A (en) | 1974-08-07 | 1977-11-11 | Process for the manufacture of resorcinol |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2437983A DE2437983C3 (de) | 1974-08-07 | 1974-08-07 | Verfahren zur Herstellung von Resorcinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2437983A1 DE2437983A1 (de) | 1976-02-26 |
| DE2437983B2 DE2437983B2 (de) | 1981-05-21 |
| DE2437983C3 true DE2437983C3 (de) | 1982-04-01 |
Family
ID=5922641
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2437983A Expired DE2437983C3 (de) | 1974-08-07 | 1974-08-07 | Verfahren zur Herstellung von Resorcinen |
Country Status (11)
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2533920C2 (de) * | 1975-07-30 | 1982-12-09 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Resorcinen |
| NL7612281A (nl) * | 1976-11-05 | 1978-05-09 | Stamicarbon | Werkwijze voor de bereiding van resorcinol en alkylgesubstitueerde derivaten hiervan. |
| DE2825073A1 (de) * | 1978-06-08 | 1979-12-20 | Hoechst Ag | Verfahren zur herstellung von resorcinen aus delta-ketocarbonsaeureestern |
| JPS6287548A (ja) * | 1985-10-11 | 1987-04-22 | Sumitomo Chem Co Ltd | ２−アセチルレゾルシンの製造法 |
| EP0331422A3 (en) * | 1988-03-02 | 1991-02-06 | Mitsui Petrochemical Industries, Ltd. | Method of preparing 2-acylresorcinols |
| JPH0558931A (ja) * | 1991-08-30 | 1993-03-09 | Sumitomo Chem Co Ltd | ２−メチルレゾルシノールおよび２−メチル−１，３−シクロヘキサンジオンの製造方法 |
| JP4165399B2 (ja) | 2001-10-24 | 2008-10-15 | ダイキン工業株式会社 | 触媒回収方法および触媒回収システム、ならびにパーフルオロアルキルアイオダイドテロマーの製造方法および製造装置 |
| US7294748B2 (en) | 2004-10-19 | 2007-11-13 | Wake Forest University Health Sciences | Sulfenic acid-reactive compounds and their methods of synthesis |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3865884A (en) * | 1970-05-11 | 1975-02-11 | Canadian Thermo Images Ltd | Preparation of orcinol |
| GB1188387A (en) * | 1967-05-31 | 1970-04-15 | British Oxygen Co Ltd | Preparation of Resorcinol |
| FR2084076A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1970-03-04 | 1971-12-17 | Chem Systems | |
| US3953526A (en) * | 1972-09-22 | 1976-04-27 | Atlantic Richfield Company | Synthesis of hydroquinone |
-
1974
- 1974-08-07 DE DE2437983A patent/DE2437983C3/de not_active Expired
-
1975
- 1975-07-29 ZA ZA00754863A patent/ZA754863B/xx unknown
- 1975-07-31 CA CA232,790A patent/CA1055963A/en not_active Expired
- 1975-08-01 NL NL7509211A patent/NL7509211A/xx not_active Application Discontinuation
- 1975-08-04 CH CH1013875A patent/CH598166A5/xx not_active IP Right Cessation
- 1975-08-05 IT IT26152/75A patent/IT1040401B/it active
- 1975-08-06 JP JP50095089A patent/JPS5858334B2/ja not_active Expired
- 1975-08-07 FR FR7524644A patent/FR2281347A1/fr active Granted
- 1975-08-07 BR BR7505061*A patent/BR7505061A/pt unknown
- 1975-08-07 BE BE159024A patent/BE832223A/xx not_active IP Right Cessation
- 1975-08-07 GB GB33075/75A patent/GB1517726A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5858334B2 (ja) | 1983-12-24 |
| IT1040401B (it) | 1979-12-20 |
| BE832223A (fr) | 1976-02-09 |
| NL7509211A (nl) | 1976-02-10 |
| DE2437983A1 (de) | 1976-02-26 |
| DE2437983B2 (de) | 1981-05-21 |
| FR2281347B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-10-27 |
| CA1055963A (en) | 1979-06-05 |
| JPS5141332A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1976-04-07 |
| FR2281347A1 (fr) | 1976-03-05 |
| BR7505061A (pt) | 1976-08-03 |
| GB1517726A (en) | 1978-07-12 |
| CH598166A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-04-28 |
| ZA754863B (en) | 1976-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2533920C2 (de) | Verfahren zur Herstellung von Resorcinen | |
| EP0304763A1 (de) | Verfahren zur Herstellung von Ethercarbonsäuren | |
| DE2437983C3 (de) | Verfahren zur Herstellung von Resorcinen | |
| DE2435818C3 (de) | Verfahren zur Herstellung aromatischer Diamine | |
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| EP0233337B1 (de) | Verfahren zur Herstellung von Carbonylverbindungen | |
| DE3302848A1 (de) | Verfahren zur herstellung von resorzin und substituierten resorzinen | |
| US2560950A (en) | Production of o-cresol derivatives | |
| EP0211205B1 (de) | Verfahren zur Herstellung von 2-Methyl-2-alkenalen | |
| DE2257675A1 (de) | Verfahren zur alkylierung von ketonen | |
| DE1645041A1 (de) | Neue Polyalkyl-Alkohole | |
| DE102006057296B4 (de) | Verfahren zur Erzeugung α-Alkylzimtaldehydverbindungen | |
| EP0278211A1 (de) | Verfahren zur Herstellung von p-substituierten o-Benzylphenolen | |
| DE3602180C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0155610B2 (de) | Verfahren zur Herstellung von 2-Hydroxy-(9H)-carbazol | |
| DE2640026C2 (de) | Verfahren zur Herstellung von 6,10,14-Trimethylpentadecan-2-on | |
| EP0929505A1 (de) | Verfahren zur herstellung von alkindiolen oder gemischen von alkindiolen mit alkinmonoolen | |
| DE937950C (de) | Verfahren zur Herstellung von Phenylcyclohexan durch katalytische Hydrierung von Diphenyl | |
| EP0128489B1 (de) | Verfahren zur Herstellung von Succinylobernsteinsäuredialkylestern | |
| DE1955375A1 (de) | Verfahren zur Herstellung von beta-Hydroxy- und/oder alpha-ungesaettigten Carbonylverbindungen | |
| DE1211160B (de) | Verfahren zur Herstellung von beta-Alkoxyacrylsaeureestern | |
| DE1153351C2 (de) | Verfahren zur Darstellung von Nitroacetalen | |
| EP1282608B1 (de) | Herstellung von 2-ethyl-3-methyl-1,4-diazin | |
| DE844292C (de) | Verfahren zur Herstellung lactonartiger Erzeugnisse | |
| DE1493867C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |