DE2437322A1 - Verfahren zur herstellung von 5-sek.-alkyl-m-kresol - Google Patents
Verfahren zur herstellung von 5-sek.-alkyl-m-kresolInfo
- Publication number
- DE2437322A1 DE2437322A1 DE2437322A DE2437322A DE2437322A1 DE 2437322 A1 DE2437322 A1 DE 2437322A1 DE 2437322 A DE2437322 A DE 2437322A DE 2437322 A DE2437322 A DE 2437322A DE 2437322 A1 DE2437322 A1 DE 2437322A1
- Authority
- DE
- Germany
- Prior art keywords
- cresol
- thymol
- catalyst
- isomerization
- alkylated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 40
- 238000004519 manufacturing process Methods 0.000 title claims description 16
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 157
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 claims description 139
- 239000003054 catalyst Substances 0.000 claims description 55
- 238000006317 isomerization reaction Methods 0.000 claims description 55
- 239000005844 Thymol Substances 0.000 claims description 51
- 229960000790 thymol Drugs 0.000 claims description 51
- 230000029936 alkylation Effects 0.000 claims description 42
- 238000005804 alkylation reaction Methods 0.000 claims description 42
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 22
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 21
- 150000002672 m-cresols Chemical class 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 238000004821 distillation Methods 0.000 claims description 16
- 239000011541 reaction mixture Substances 0.000 claims description 15
- 150000001336 alkenes Chemical class 0.000 claims description 12
- 239000002808 molecular sieve Substances 0.000 claims description 11
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims description 11
- 238000004508 fractional distillation Methods 0.000 claims description 10
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 claims description 9
- 229930003836 cresol Natural products 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- 239000012013 faujasite Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 description 33
- 150000001875 compounds Chemical class 0.000 description 21
- IJALWSVNUBBQRA-UHFFFAOYSA-N 4-Isopropyl-3-methylphenol Chemical compound CC(C)C1=CC=C(O)C=C1C IJALWSVNUBBQRA-UHFFFAOYSA-N 0.000 description 15
- 239000000463 material Substances 0.000 description 14
- 239000007795 chemical reaction product Substances 0.000 description 11
- ZDUIHRJGDMTBEX-UHFFFAOYSA-N 3-methyl-5-propan-2-ylphenol Chemical compound CC(C)C1=CC(C)=CC(O)=C1 ZDUIHRJGDMTBEX-UHFFFAOYSA-N 0.000 description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 10
- 238000004817 gas chromatography Methods 0.000 description 9
- 238000004587 chromatography analysis Methods 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000002917 insecticide Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- -1 isopropyl cresols Chemical class 0.000 description 5
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 4
- KEGGEHPMMDYTGB-UHFFFAOYSA-N 2,6-Diisopropyl-3-methylphenol Chemical compound CC(C)C1=CC=C(C)C(C(C)C)=C1O KEGGEHPMMDYTGB-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 4
- 239000011949 solid catalyst Substances 0.000 description 4
- INCRRYKLCCVPJD-UHFFFAOYSA-N 6-hydroxy-5-methyl-1h-pyrimidine-2,4-dione Chemical compound CC1=C(O)NC(=O)NC1=O INCRRYKLCCVPJD-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 150000001896 cresols Chemical class 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- 229910052761 rare earth metal Inorganic materials 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NNSNIMZGXLISCO-UHFFFAOYSA-N 2,4-Diisopropyl-5-methylphenol Chemical compound CC(C)C1=CC(C(C)C)=C(O)C=C1C NNSNIMZGXLISCO-UHFFFAOYSA-N 0.000 description 2
- GHIJMVRBOLUYBO-UHFFFAOYSA-N 3-cyclohexyl-5-methylphenol Chemical compound CC1=CC(O)=CC(C2CCCCC2)=C1 GHIJMVRBOLUYBO-UHFFFAOYSA-N 0.000 description 2
- XTCHLXABLZQNNN-UHFFFAOYSA-N 3-ethyl-5-methylphenol Chemical compound CCC1=CC(C)=CC(O)=C1 XTCHLXABLZQNNN-UHFFFAOYSA-N 0.000 description 2
- OTLNPYWUJOZPPA-UHFFFAOYSA-M 4-nitrobenzoate Chemical compound [O-]C(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000002952 polymeric resin Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920003987 resole Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 230000002992 thymic effect Effects 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XLXFKTBBODPBMN-UHFFFAOYSA-N 1-methyl-5-propan-2-ylcyclohexene Chemical compound CC(C)C1CCC=C(C)C1 XLXFKTBBODPBMN-UHFFFAOYSA-N 0.000 description 1
- VFNUNYPYULIJSN-UHFFFAOYSA-N 2,5-diisopropylphenol Chemical class CC(C)C1=CC=C(C(C)C)C(O)=C1 VFNUNYPYULIJSN-UHFFFAOYSA-N 0.000 description 1
- VTCAMIHYZSBDHC-UHFFFAOYSA-N 2,6-di(butan-2-yl)-3-methylphenol Chemical compound CCC(C)C1=CC=C(C)C(C(C)CC)=C1O VTCAMIHYZSBDHC-UHFFFAOYSA-N 0.000 description 1
- KTTCLOUATPWTNB-UHFFFAOYSA-N 2-[2-[4-(6,7-dimethoxy-3,4-dihydro-1h-isoquinolin-2-yl)butylcarbamoyl]-4-methylphenoxy]ethyl methanesulfonate Chemical compound C1C=2C=C(OC)C(OC)=CC=2CCN1CCCCNC(=O)C1=CC(C)=CC=C1OCCOS(C)(=O)=O KTTCLOUATPWTNB-UHFFFAOYSA-N 0.000 description 1
- SXAMGRAIZSSWIH-UHFFFAOYSA-N 2-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,2,4-oxadiazol-5-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NOC(=N1)CC(=O)N1CC2=C(CC1)NN=N2 SXAMGRAIZSSWIH-UHFFFAOYSA-N 0.000 description 1
- ZBAXSFRZNDZTMT-UHFFFAOYSA-N 2-butan-2-yl-5-methylphenol Chemical compound CCC(C)C1=CC=C(C)C=C1O ZBAXSFRZNDZTMT-UHFFFAOYSA-N 0.000 description 1
- MOPDEMAOEMHGAS-UHFFFAOYSA-N 2-cyclohexyl-3-methylphenol Chemical compound CC1=CC=CC(O)=C1C1CCCCC1 MOPDEMAOEMHGAS-UHFFFAOYSA-N 0.000 description 1
- XCLJSERQRNTSPQ-UHFFFAOYSA-N 3-butan-2-yl-5-methylphenol Chemical compound CCC(C)C1=CC(C)=CC(O)=C1 XCLJSERQRNTSPQ-UHFFFAOYSA-N 0.000 description 1
- AZXBHGKSTNMAMK-UHFFFAOYSA-N 3-methyl-2-propan-2-ylphenol Chemical compound CC(C)C1=C(C)C=CC=C1O AZXBHGKSTNMAMK-UHFFFAOYSA-N 0.000 description 1
- BKLZNGAXZYYEHF-UHFFFAOYSA-N 3-methyl-4-propan-2-ylphenol;3-methyl-5-propan-2-ylphenol Chemical compound CC(C)C1=CC(C)=CC(O)=C1.CC(C)C1=CC=C(O)C=C1C BKLZNGAXZYYEHF-UHFFFAOYSA-N 0.000 description 1
- JOISCPZYGOECQA-UHFFFAOYSA-N 3-tert-butyl-5-methylphenol Chemical compound CC1=CC(O)=CC(C(C)(C)C)=C1 JOISCPZYGOECQA-UHFFFAOYSA-N 0.000 description 1
- MGGVALXERJRIRO-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-2-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-1H-pyrazol-5-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)O MGGVALXERJRIRO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241001178520 Stomatepia mongo Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- XTKDAFGWCDAMPY-UHFFFAOYSA-N azaperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCN(C=2N=CC=CC=2)CC1 XTKDAFGWCDAMPY-UHFFFAOYSA-N 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229960000846 camphor Drugs 0.000 description 1
- 239000000073 carbamate insecticide Substances 0.000 description 1
- HHTWOMMSBMNRKP-UHFFFAOYSA-N carvacrol Natural products CC(=C)C1=CC=C(C)C(O)=C1 HHTWOMMSBMNRKP-UHFFFAOYSA-N 0.000 description 1
- RECUKUPTGUEGMW-UHFFFAOYSA-N carvacrol Chemical compound CC(C)C1=CC=C(C)C(O)=C1 RECUKUPTGUEGMW-UHFFFAOYSA-N 0.000 description 1
- 235000007746 carvacrol Nutrition 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 210000003918 fraction a Anatomy 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- WYXXLXHHWYNKJF-UHFFFAOYSA-N isocarvacrol Natural products CC(C)C1=CC=C(O)C(C)=C1 WYXXLXHHWYNKJF-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 230000002934 lysing effect Effects 0.000 description 1
- 229940100630 metacresol Drugs 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052680 mordenite Inorganic materials 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FFNMBRCFFADNAO-UHFFFAOYSA-N pirenzepine hydrochloride Chemical compound [H+].[H+].[Cl-].[Cl-].C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 FFNMBRCFFADNAO-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012173 sealing wax Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010555 transalkylation reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
- C07C37/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms by addition reactions, i.e. reactions involving at least one carbon-to-carbon unsaturated bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/68—Purification; separation; Use of additives, e.g. for stabilisation
- C07C37/70—Purification; separation; Use of additives, e.g. for stabilisation by physical treatment
- C07C37/74—Purification; separation; Use of additives, e.g. for stabilisation by physical treatment by distillation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C39/00—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring
- C07C39/02—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring monocyclic with no unsaturation outside the aromatic ring
- C07C39/06—Alkylated phenols
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C39/00—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring
- C07C39/12—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring polycyclic with no unsaturation outside the aromatic rings
- C07C39/15—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a six-membered aromatic ring polycyclic with no unsaturation outside the aromatic rings with all hydroxy groups on non-condensed rings, e.g. phenylphenol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Oxygen, Ozone, And Oxides In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/402,160 US3992455A (en) | 1973-10-01 | 1973-10-01 | Preparation of 5-sec-alkyl-m-cresol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2437322A1 true DE2437322A1 (de) | 1975-04-10 |
Family
ID=23590774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2437322A Ceased DE2437322A1 (de) | 1973-10-01 | 1974-08-02 | Verfahren zur herstellung von 5-sek.-alkyl-m-kresol |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3992455A (cs) |
| JP (1) | JPS5852971B2 (cs) |
| BE (1) | BE820234A (cs) |
| CA (1) | CA1035792A (cs) |
| DE (1) | DE2437322A1 (cs) |
| FR (1) | FR2245594B1 (cs) |
| GB (2) | GB1461646A (cs) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0352505A1 (de) * | 1988-07-16 | 1990-01-31 | Bayer Ag | Verfahren zur Herstellung von Thymol |
| EP0370343A1 (de) * | 1988-11-25 | 1990-05-30 | Bayer Ag | Verfahren zur Herstellung von 4-Methyl-2-cyclohexyl-phenol |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4086281A (en) * | 1975-04-03 | 1978-04-25 | Koppers Company, Inc. | Process for producing mono-substituted alkylresorcinol isomers |
| US4283573A (en) * | 1979-11-20 | 1981-08-11 | Mobil Oil Corporation | Long-chain alkylphenols |
| US4329509A (en) * | 1979-11-30 | 1982-05-11 | Mobil Oil Corporation | Co-production of 2-alkanones and phenols |
| US4391998A (en) * | 1981-10-21 | 1983-07-05 | Mobil Oil Corporation | Production of para-isopropylphenol |
| US4418223A (en) * | 1982-03-29 | 1983-11-29 | Uop Inc. | Preparation of 2,4,6-trialkylphenols |
| US4532368A (en) * | 1984-02-01 | 1985-07-30 | Ethyl Corporation | Process for making meta- and para-alkylphenols |
| US5171896A (en) * | 1992-03-05 | 1992-12-15 | Texaco Chemical Company | Alkylphenol synthesis using acid-modified inorganic clay catalysts |
| DE60020277T2 (de) | 1999-02-02 | 2006-01-26 | Akzo Nobel N.V. | Verfahren zur Isomerisierung von Alkylphenolen in Gegenwart eines festen Säurekatalysators |
| DE102007035515A1 (de) * | 2007-07-28 | 2009-01-29 | Lanxess Deutschland Gmbh | Dialkylphenole |
| CN111303395B (zh) * | 2020-04-07 | 2022-08-19 | 青岛科技大学 | 一种低分子量聚己内酯的制备方法 |
| CN113244905B (zh) * | 2021-05-31 | 2023-10-20 | 淮阴工学院 | 一种高效催化剂的制备方法及其在合成百里香酚中的应用 |
| CN114849769B (zh) * | 2022-04-25 | 2023-06-13 | 安徽海华科技集团有限公司 | 合成百里香酚用催化剂及其制备方法与应用 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1886311A (en) * | 1927-07-11 | 1932-11-01 | Rheinische Kampfer Fabrik Gmbh | Process for preparing thymol |
| US2054270A (en) * | 1928-03-23 | 1936-09-15 | Firm Schering Kahlbaum A G Ber | Production of phenolic compounds |
| US2064885A (en) * | 1934-04-07 | 1936-12-22 | Givaudan Delawanna Inc | Preparation of poly alkyl-substituted phenols |
| US2286953A (en) * | 1940-08-02 | 1942-06-16 | Burton T Bush Inc | Method for making thymol |
| US2578597A (en) * | 1948-11-22 | 1951-12-11 | Phillips Petroleum Co | Production of p-tertiary-butyl phenol |
| US2684389A (en) * | 1950-11-03 | 1954-07-20 | Gulf Research Development Co | Alkylation of phenols |
| US2898322A (en) * | 1955-01-26 | 1959-08-04 | Hooker Chemical Corp | Vulcanization of butadiene rubbers with phenol-aldehyde reaction products and product obtained thereby |
| US3014079A (en) * | 1958-02-21 | 1961-12-19 | Pennsalt Chemicals Corp | Process for preparing metaalkylphenols |
| DE1142873B (de) * | 1961-01-25 | 1963-01-31 | Bayer Ag | Verfahren zur Herstellung von 2- und bzw. oder 6-Alkylphenolen |
| BE637965A (cs) * | 1962-09-27 | |||
| US3360573A (en) * | 1964-08-10 | 1967-12-26 | Gen Aniline & Film Corp | Process of preparing alkylated hydroxy aromatic compounds |
| US3655780A (en) * | 1968-09-03 | 1972-04-11 | Chevron Res | Isomerization process |
| US3655778A (en) * | 1968-12-27 | 1972-04-11 | Chevron Res | Method for isomerizing phenylphenols |
| DE2027610A1 (de) * | 1970-06-05 | 1971-12-09 | Union Rheinische Braunkohlen Kraftstoff Ag, 5047 Wesseling | Verfahren zur kontinuierlichen Herstellung von m-Alkylphenolen |
| DE2242628A1 (de) * | 1972-08-30 | 1974-03-07 | Bayer Ag | Verfahren zur herstellung von 5-isopropyl-3-methyl-phenol |
-
1973
- 1973-10-01 US US05/402,160 patent/US3992455A/en not_active Expired - Lifetime
-
1974
- 1974-07-10 CA CA204,489A patent/CA1035792A/en not_active Expired
- 1974-08-02 DE DE2437322A patent/DE2437322A1/de not_active Ceased
- 1974-08-15 GB GB3605174A patent/GB1461646A/en not_active Expired
- 1974-08-15 GB GB3605174A patent/GB1471157A/en not_active Expired
- 1974-08-27 FR FR7429306A patent/FR2245594B1/fr not_active Expired
- 1974-09-23 BE BE148804A patent/BE820234A/xx not_active IP Right Cessation
- 1974-09-27 JP JP49111390A patent/JPS5852971B2/ja not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0352505A1 (de) * | 1988-07-16 | 1990-01-31 | Bayer Ag | Verfahren zur Herstellung von Thymol |
| EP0370343A1 (de) * | 1988-11-25 | 1990-05-30 | Bayer Ag | Verfahren zur Herstellung von 4-Methyl-2-cyclohexyl-phenol |
| US4990687A (en) * | 1988-11-25 | 1991-02-05 | Bayer Aktiengesellschaft | Preparation of 4-methyl-2-cyclohexylphenol |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2245594B1 (cs) | 1979-03-09 |
| BE820234A (fr) | 1975-03-24 |
| CA1035792A (en) | 1978-08-01 |
| GB1471157A (en) | 1977-04-21 |
| US3992455A (en) | 1976-11-16 |
| FR2245594A1 (cs) | 1975-04-25 |
| JPS5852971B2 (ja) | 1983-11-26 |
| JPS5059338A (cs) | 1975-05-22 |
| GB1461646A (en) | 1977-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2437322A1 (de) | Verfahren zur herstellung von 5-sek.-alkyl-m-kresol | |
| DD147664A5 (de) | Verfahren zur gleichzeitigen herstellung von reinem methyl-tert.-butylether | |
| DE1668662C3 (de) | Verfahren zum Alkylieren von Adamantankohlenwasserstoffen | |
| DE1418862A1 (de) | Verfahren zur Herstellung von Alkyl-1,1-dimethylindanen | |
| DE2425982A1 (de) | Verfahren zur herstellung von 2,6dimethylnaphthalin | |
| EP0562450B1 (de) | Decylalkoholgemische, daraus erhältliche Phthalsäureester und ihre Verwendung als Weichmacher | |
| DE2541079A1 (de) | Verfahren zur gewinnung von alkylbenzolen | |
| DE69433800T2 (de) | Verfahren zur Kristallisierung von 2,6-Dimethylnaphthalen | |
| DE60103335T2 (de) | Verfahren zur selektiven Herstellung von Di-Isobuten aus einer i-Buten enthaltenden C4 Beschickung | |
| DE69906620T2 (de) | Verfahren zur Herstellung von Alkoholen | |
| DE2063038A1 (cs) | ||
| DE1910566C3 (de) | Verfahren zur Herstellung von 5-Alkenyl-2-norbornenen durch Diels-Alder-Reaktion von Cyclopentadien mit einem 4-Alkyl-13-butadien | |
| DE2551586C2 (de) | Verfahren zur Herstellung von 1,5-Dimethylcycloocten | |
| DE69108091T2 (de) | Verfahren zur Herstellung von Methylnorbornenedicarboxysäureanhydrid. | |
| DE1618451A1 (de) | Verfahren zur Herstellung von Hydrindacenen | |
| DE638756C (cs) | ||
| DE2448231C2 (de) | Verfahren zur Herstellung von Alkylnaphthalinen | |
| DE1493025C3 (de) | Verfahren zur Herstellung von Alkyladamantanen mit 12 bis 15 Kohlenstoffatomen durch katalytische Isomerisierung von bestimmten tricyclischen perhydroaromatischen Kohlenwasserstoffen mit 12 bis 15 Kohlenstoffatomen und Unterbrechen der Reaktion vor Abschluß der Isomerisierung | |
| EP0084648B1 (de) | Verfahren zur Isomerisierung von Alkylbenzotrifluoriden | |
| DE587645C (de) | Verfahren zur Herstellung von Thymol (3-Oxy-1-methyl-4-isopropylbenzol) | |
| DE1949622C3 (de) | Verfahren zur Abtrennung von 23,6-Trimethylphenol aus einem Xylole und/ oder Trimethylphenole enthaltenden Phenolgemisch | |
| AT345788B (de) | Verfahren zur herstellung von 2,6-di- tert.butyl-4-methylphenol | |
| DE711916C (de) | Verfahren zur Herstellung von Terpenaethern | |
| DE1280830B (de) | Verfahren zur Gewinnung von ª- und ª-Methylnaphthalin hoher Reinheit aus Kohlenwasserstoffgemischen | |
| DE1949622B2 (de) | Verfahren zur abtrennung von 2,3,6- trimethylphenol aus einem xylole und/ oder trimethylphenole enthaltenden phenolgemisch |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |