DE2430192B2 - Verfahren zur Herstellung von ungesättigten Ketonen - Google Patents
Verfahren zur Herstellung von ungesättigten KetonenInfo
- Publication number
- DE2430192B2 DE2430192B2 DE2430192A DE2430192A DE2430192B2 DE 2430192 B2 DE2430192 B2 DE 2430192B2 DE 2430192 A DE2430192 A DE 2430192A DE 2430192 A DE2430192 A DE 2430192A DE 2430192 B2 DE2430192 B2 DE 2430192B2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- unsaturated
- diketene
- dimethyl
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 23
- 150000002576 ketones Chemical class 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 description 27
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 21
- 238000009835 boiling Methods 0.000 description 20
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 16
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 13
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 12
- 229910052782 aluminium Inorganic materials 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 12
- 238000006114 decarboxylation reaction Methods 0.000 description 11
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- -1 3,4-dimethylpentyl Chemical group 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000007865 diluting Methods 0.000 description 4
- UHEPJGULSIKKTP-UHFFFAOYSA-N sulcatone Chemical compound CC(C)=CCCC(C)=O UHEPJGULSIKKTP-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- HPYNZHMRTTWQTB-UHFFFAOYSA-N 2,3-dimethylpyridine Chemical compound CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- LRYWJUOPPCVNFT-UHFFFAOYSA-N 2-phenylbut-3-en-2-ol Chemical compound C=CC(O)(C)C1=CC=CC=C1 LRYWJUOPPCVNFT-UHFFFAOYSA-N 0.000 description 2
- BDFOAFUBDWPCEB-UHFFFAOYSA-N 6-phenylhept-5-en-2-one Chemical compound CC(=O)CCC=C(C)C1=CC=CC=C1 BDFOAFUBDWPCEB-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 2
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- OHEFFKYYKJVVOX-UHFFFAOYSA-N sulcatol Natural products CC(O)CCC=C(C)C OHEFFKYYKJVVOX-UHFFFAOYSA-N 0.000 description 2
- FQTLCLSUCSAZDY-UHFFFAOYSA-N (+) E(S) nerolidol Natural products CC(C)=CCCC(C)=CCCC(C)(O)C=C FQTLCLSUCSAZDY-UHFFFAOYSA-N 0.000 description 1
- FQTLCLSUCSAZDY-SDNWHVSQSA-N (6E)-nerolidol Chemical compound CC(C)=CCC\C(C)=C\CCC(C)(O)C=C FQTLCLSUCSAZDY-SDNWHVSQSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical compound CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- AWDLBZUXUNIODN-UHFFFAOYSA-N 2,3-dimethylbut-3-en-2-ol Chemical compound CC(=C)C(C)(C)O AWDLBZUXUNIODN-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical compound CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- GJQZNTNOUHDMIR-UHFFFAOYSA-N 3,6,7-trimethylocta-1,6-dien-3-ol Chemical compound CC(C)=C(C)CCC(C)(O)C=C GJQZNTNOUHDMIR-UHFFFAOYSA-N 0.000 description 1
- XLIJOVLDKFATNT-UHFFFAOYSA-N 3,7,11-trimethyldodec-1-en-3-ol Chemical compound CC(C)CCCC(C)CCCC(C)(O)C=C XLIJOVLDKFATNT-UHFFFAOYSA-N 0.000 description 1
- IUDWWFNDSJRYRV-UHFFFAOYSA-N 3,7-dimethyloct-1-en-3-ol Chemical compound CC(C)CCCC(C)(O)C=C IUDWWFNDSJRYRV-UHFFFAOYSA-N 0.000 description 1
- HNVRRHSXBLFLIG-UHFFFAOYSA-N 3-hydroxy-3-methylbut-1-ene Chemical compound CC(C)(O)C=C HNVRRHSXBLFLIG-UHFFFAOYSA-N 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- HASNVACCRLSDMU-UHFFFAOYSA-N 5,6-dimethylhept-5-en-2-one Chemical compound CC(C)=C(C)CCC(C)=O HASNVACCRLSDMU-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- RQQDJYROSYLPPK-UHFFFAOYSA-N N1=CC=CC2=CC=CC=C21.N1=CC=CC2=CC=CC=C21 Chemical compound N1=CC=CC2=CC=CC=C21.N1=CC=CC2=CC=CC=C21 RQQDJYROSYLPPK-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- YJXGADCZMLHGLV-UHFFFAOYSA-N aniline;pyridine Chemical compound C1=CC=NC=C1.NC1=CC=CC=C1 YJXGADCZMLHGLV-UHFFFAOYSA-N 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940069096 dodecene Drugs 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- WASNIKZYIWZQIP-AWEZNQCLSA-N nerolidol Natural products CC(=CCCC(=CCC[C@@H](O)C=C)C)C WASNIKZYIWZQIP-AWEZNQCLSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000012262 resinous product Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000010913 used oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
- C07C45/676—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton by elimination of carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48072094A JPS5249444B2 (enExample) | 1973-06-26 | 1973-06-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2430192A1 DE2430192A1 (de) | 1975-01-16 |
| DE2430192B2 true DE2430192B2 (de) | 1980-01-24 |
Family
ID=13479462
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2430192A Withdrawn DE2430192B2 (de) | 1973-06-26 | 1974-06-24 | Verfahren zur Herstellung von ungesättigten Ketonen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3975446A (enExample) |
| JP (1) | JPS5249444B2 (enExample) |
| CH (1) | CH605527A5 (enExample) |
| DE (1) | DE2430192B2 (enExample) |
| FR (1) | FR2235107B1 (enExample) |
| GB (1) | GB1463184A (enExample) |
| IT (1) | IT1015406B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1089011B (it) * | 1976-11-20 | 1985-06-10 | Basf Ag | Processo per la preparazione di 2-metil-1-epten-6-one |
| DE2928944A1 (de) * | 1979-07-18 | 1981-02-12 | Basf Ag | Verbessertes verfahren zur herstellung von hoeheren ungesaettigten ketonen |
| US4245122A (en) * | 1979-12-05 | 1981-01-13 | International Flavors & Fragrances Inc. | Process for the production of allyl acetone |
| DE3101143A1 (de) * | 1981-01-16 | 1982-08-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von l-aryloxy-methylketonen |
| US5955636A (en) * | 1996-07-05 | 1999-09-21 | Kuraray Co., Ltd. | Process for producing 6-methyl-3-hepten-2-one and 6-methyl-2-heptanone analogues, and process for producing phyton or isophytol |
| DE19853908A1 (de) | 1998-12-07 | 2000-06-08 | Basf Ag | Verfahren zur Herstellung von ungesättigten Ketonen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2795617A (en) * | 1957-06-11 | |||
| US2839579A (en) * | 1956-06-27 | 1958-06-17 | Hoffmann La Roche | Process for the production of ketones |
-
1973
- 1973-06-26 JP JP48072094A patent/JPS5249444B2/ja not_active Expired
-
1974
- 1974-06-24 DE DE2430192A patent/DE2430192B2/de not_active Withdrawn
- 1974-06-25 US US05/482,894 patent/US3975446A/en not_active Expired - Lifetime
- 1974-06-25 IT IT24433/74A patent/IT1015406B/it active
- 1974-06-25 GB GB2814474A patent/GB1463184A/en not_active Expired
- 1974-06-26 FR FR7422262A patent/FR2235107B1/fr not_active Expired
- 1974-06-26 CH CH876574A patent/CH605527A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2235107A1 (enExample) | 1975-01-24 |
| FR2235107B1 (enExample) | 1980-01-04 |
| CH605527A5 (enExample) | 1978-09-29 |
| JPS5249444B2 (enExample) | 1977-12-17 |
| US3975446A (en) | 1976-08-17 |
| GB1463184A (en) | 1977-02-02 |
| JPS5019709A (enExample) | 1975-03-01 |
| IT1015406B (it) | 1977-05-10 |
| DE2430192A1 (de) | 1975-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0002027B1 (de) | Verfahren zur Herstellung von 2-Buten-1-ol-Verbindungen durch Isomerisierung der entsprechenden 3-Buten-1-ol-Verbindungen | |
| EP0206054B1 (de) | Verfahren zur Herstellung von Carbonsäuren | |
| DE2610254A1 (de) | Verfahren zur oxydation von beta- aethylenischen ketonen | |
| DE2430192B2 (de) | Verfahren zur Herstellung von ungesättigten Ketonen | |
| DE2616528C2 (de) | Verfahren zur Herstellung von 1,1,1-Trihalogen-4-methylpentene | |
| DE2124718B2 (de) | Verfahren zur Herstellung einer Carbonsäure oder eines Carbonsäureesters | |
| DE3875281T2 (de) | Herstellung von pseudoiononen. | |
| DE3146313C2 (de) | Verfahren zur Herstellung von Adipinsäurediestern | |
| WO1997008125A1 (de) | Verfahren zur herstellung von carbonsäuren durch carbonylierung von olefinen | |
| DE2447069C2 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| EP0089417B1 (de) | Verfahren zur Herstellung von Phthalid | |
| DE2554403A1 (de) | Verfahren zur katalytischen kupplung von allylverbindungen an substituierte olefine | |
| EP0072401A1 (de) | Verfahren zur Herstellung von aliphatischen Nitrilen | |
| EP0100019A1 (de) | Verfahren zur Herstellung von alpha-substituierten beta-Dicarbonyl-, beta-Cyancarbonyl- und beta-Dicyanverbindungen | |
| DE602005005354T2 (de) | Verfahren zur herstellung von 1,4-dialkyl-2,3-diol-1,4-butandion | |
| DE2323867A1 (de) | Verfahren zur herstellung ungesaettigter aldehydcyanhydrine | |
| DE2659597C2 (enExample) | ||
| DE2364181A1 (de) | Verfahren zur herstellung von dihydroxyphenolen | |
| DE3636818C2 (de) | Verfahren zur Herstellung von Valpronsäure | |
| DE2154370B2 (de) | Verfahren zur Herstellung von Äther des2,6-Dimethyl-2,7-octadien-l-ols und einige dieser Äther | |
| DE69101523T2 (de) | Verfahren zur Amwandlung von N-tertiären Aminoxiden in Aldehyden. | |
| DE2345360A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure und deren alkylestern | |
| DE1643228A1 (de) | Arylsubstituierte aliphatische Aminoxyde | |
| DE19859590A1 (de) | Acetale, deren Herstellung sowie deren Verwendung | |
| DE2520735A1 (de) | Neue diole und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8239 | Disposal/non-payment of the annual fee |