DE2426683A1 - Biguanide und verfahren zu deren herstellung - Google Patents
Biguanide und verfahren zu deren herstellungInfo
- Publication number
- DE2426683A1 DE2426683A1 DE19742426683 DE2426683A DE2426683A1 DE 2426683 A1 DE2426683 A1 DE 2426683A1 DE 19742426683 DE19742426683 DE 19742426683 DE 2426683 A DE2426683 A DE 2426683A DE 2426683 A1 DE2426683 A1 DE 2426683A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- salts
- given above
- group
- biguanides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000003839 salts Chemical class 0.000 claims description 22
- -1 amino, mercapto Chemical group 0.000 claims description 14
- 229940123208 Biguanide Drugs 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 150000004283 biguanides Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000008280 blood Substances 0.000 claims description 3
- 210000004369 blood Anatomy 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 150000003672 ureas Chemical class 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- FKPUYTAEIPNGRM-UHFFFAOYSA-N 1-(diaminomethylidene)guanidine;hydron;chloride Chemical compound [Cl-].N\C([NH3+])=N/C(N)=N FKPUYTAEIPNGRM-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- KETWSVNAKWAOJM-UHFFFAOYSA-N cyclopenten-1-ylmethanamine Chemical compound NCC1=CCCC1 KETWSVNAKWAOJM-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229910003439 heavy metal oxide Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- SQSPRWMERUQXNE-UHFFFAOYSA-N Guanylurea Chemical class NC(=N)NC(N)=O SQSPRWMERUQXNE-UHFFFAOYSA-N 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- WWLOCCUNZXBJFR-UHFFFAOYSA-N azanium;benzenesulfonate Chemical compound [NH4+].[O-]S(=O)(=O)C1=CC=CC=C1 WWLOCCUNZXBJFR-UHFFFAOYSA-N 0.000 description 1
- 229960004111 buformin Drugs 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- JIRRNZWTWJGJCT-UHFFFAOYSA-N carbamothioylthiourea Chemical class NC(=S)NC(N)=S JIRRNZWTWJGJCT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229960004138 cyclobarbital Drugs 0.000 description 1
- LQNHRNOPWKZUSN-UHFFFAOYSA-N cyclobutylmethanamine Chemical compound NCC1CCC1 LQNHRNOPWKZUSN-UHFFFAOYSA-N 0.000 description 1
- FURFDEIRTOBQNV-UHFFFAOYSA-N cyclohept-2-ene-1-carbonitrile Chemical compound N#CC1CCCCC=C1 FURFDEIRTOBQNV-UHFFFAOYSA-N 0.000 description 1
- CGZZMOTZOONQIA-UHFFFAOYSA-N cycloheptanone Chemical compound O=C1CCCCCC1 CGZZMOTZOONQIA-UHFFFAOYSA-N 0.000 description 1
- VCVAVNSADWBJQK-UHFFFAOYSA-N cyclohepten-1-ylmethanamine Chemical compound NCC1=CCCCCC1 VCVAVNSADWBJQK-UHFFFAOYSA-N 0.000 description 1
- CAOQEOHEZKVYOJ-UHFFFAOYSA-N cycloheptylmethanamine Chemical compound NCC1CCCCCC1 CAOQEOHEZKVYOJ-UHFFFAOYSA-N 0.000 description 1
- FDASUSMCNXAKPU-UHFFFAOYSA-N cyclohexa-1,4-dien-1-ylmethanamine;hydrochloride Chemical compound Cl.NCC1=CCC=CC1 FDASUSMCNXAKPU-UHFFFAOYSA-N 0.000 description 1
- QEYHQERVRCNZHN-UHFFFAOYSA-N cyclohexylmethylazanium;chloride Chemical compound Cl.NCC1CCCCC1 QEYHQERVRCNZHN-UHFFFAOYSA-N 0.000 description 1
- BLTBJGAUBXILNO-UHFFFAOYSA-N cyclopent-2-en-1-ylmethanamine;hydrochloride Chemical compound Cl.NCC1CCC=C1 BLTBJGAUBXILNO-UHFFFAOYSA-N 0.000 description 1
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 1
- MSXJLEPWWWZERM-UHFFFAOYSA-N cyclopentylmethanamine;hydrochloride Chemical compound Cl.NCC1CCCC1 MSXJLEPWWWZERM-UHFFFAOYSA-N 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 208000006443 lactic acidosis Diseases 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910000474 mercury oxide Inorganic materials 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229960003243 phenformin Drugs 0.000 description 1
- ICFJFFQQTFMIBG-UHFFFAOYSA-N phenformin Chemical compound NC(=N)NC(=N)NCCC1=CC=CC=C1 ICFJFFQQTFMIBG-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C277/00—Preparation of guanidine or its derivatives, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/24—Y being a hetero atom
- C07C279/26—X and Y being nitrogen atoms, i.e. biguanides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742426683 DE2426683A1 (de) | 1974-06-01 | 1974-06-01 | Biguanide und verfahren zu deren herstellung |
| AR259024A AR205644A1 (es) | 1974-06-01 | 1975-01-01 | Procedimiento para preparar cicloalquil-metil-biguanidas |
| US05/575,098 US4017539A (en) | 1974-06-01 | 1975-05-07 | Biguanide compounds and anti-diabetic compositions |
| CA227,188A CA1052391A (en) | 1974-06-01 | 1975-05-16 | Biguanides |
| GB2273175A GB1461020A (en) | 1974-06-01 | 1975-05-23 | Biguanides |
| BE156721A BE829499A (fr) | 1974-06-01 | 1975-05-26 | Biguanides substituees et procedes de preparation |
| FI751528A FI751528A7 (OSRAM) | 1974-06-01 | 1975-05-26 | |
| AU81536/75A AU483307B2 (en) | 1974-06-01 | 1975-05-26 | New biguanides andthe preparation thereof |
| ZA00753355A ZA753355B (en) | 1974-06-01 | 1975-05-26 | New biguanides and the preparation thereof |
| SE7506025A SE7506025L (sv) | 1974-06-01 | 1975-05-27 | Forfarande for framstellning av biguanider |
| DD186278A DD119225A5 (OSRAM) | 1974-06-01 | 1975-05-27 | |
| NL7506270A NL7506270A (nl) | 1974-06-01 | 1975-05-28 | Werkwijze ter bereiding van biguaniden. |
| JP50065237A JPS516950A (OSRAM) | 1974-06-01 | 1975-05-30 | |
| CS7500003819A CS183804B2 (en) | 1974-06-01 | 1975-05-30 | Method of preparing cycloalkylmethyl biguanidines |
| AT412175A AT343675B (de) | 1974-06-01 | 1975-05-30 | Verfahren zur herstellung von neuen biguaniden |
| FR7516925A FR2272652B1 (OSRAM) | 1974-06-01 | 1975-05-30 | |
| HUBO1558A HU168739B (OSRAM) | 1974-06-01 | 1975-05-30 | |
| PL1975180819A PL94249B1 (OSRAM) | 1974-06-01 | 1975-05-31 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742426683 DE2426683A1 (de) | 1974-06-01 | 1974-06-01 | Biguanide und verfahren zu deren herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2426683A1 true DE2426683A1 (de) | 1975-12-18 |
Family
ID=5917126
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742426683 Pending DE2426683A1 (de) | 1974-06-01 | 1974-06-01 | Biguanide und verfahren zu deren herstellung |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4017539A (OSRAM) |
| JP (1) | JPS516950A (OSRAM) |
| AR (1) | AR205644A1 (OSRAM) |
| AT (1) | AT343675B (OSRAM) |
| BE (1) | BE829499A (OSRAM) |
| CA (1) | CA1052391A (OSRAM) |
| CS (1) | CS183804B2 (OSRAM) |
| DD (1) | DD119225A5 (OSRAM) |
| DE (1) | DE2426683A1 (OSRAM) |
| FI (1) | FI751528A7 (OSRAM) |
| FR (1) | FR2272652B1 (OSRAM) |
| GB (1) | GB1461020A (OSRAM) |
| HU (1) | HU168739B (OSRAM) |
| NL (1) | NL7506270A (OSRAM) |
| PL (1) | PL94249B1 (OSRAM) |
| SE (1) | SE7506025L (OSRAM) |
| ZA (1) | ZA753355B (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1985004399A1 (en) | 1984-04-03 | 1985-10-10 | Peremartoni Vegyipari Vállalat | Isothiuronium salts |
| GB2167750A (en) * | 1984-04-03 | 1986-06-04 | Peremartoni Vegyipari Vallalat | Isothiuronium salts |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60127996A (ja) * | 1983-12-15 | 1985-07-08 | 松下電器産業株式会社 | 工業用ロボツトの塵埃飛散防止装置 |
| US6099859A (en) * | 1998-03-20 | 2000-08-08 | Andrx Pharmaceuticals, Inc. | Controlled release oral tablet having a unitary core |
| US6417208B1 (en) * | 1999-02-05 | 2002-07-09 | Albert Einstein College Of Medicine Of Yeshiva University | Method of identification of inhibitors of PDE1C |
| WO2010011860A1 (en) * | 2008-07-23 | 2010-01-28 | Diabetomics, Llc | Methods for detecting pre-diabetes and diabetes |
| KR102061390B1 (ko) * | 2014-04-17 | 2019-12-31 | 이뮤노메트테라퓨틱스 인코포레이티드 | 구아니딘 화합물 및 그의 용도 |
| GB2540643B (en) * | 2015-02-03 | 2019-11-06 | Univ Court Univ St Andrews | NO containing compositions |
| AU2017253088B2 (en) | 2016-04-20 | 2022-04-28 | New Frontier Labs, Llc | Azelaic acid esters in the treatment of insulin resistance |
| CN107353232A (zh) * | 2017-06-21 | 2017-11-17 | 成都市考恩斯科技有限责任公司 | 有机物盐形式的硫化氢供体及其制备方法 |
| CN110615886A (zh) * | 2019-09-05 | 2019-12-27 | 哈尔滨工程大学 | 一种双胍衍生物抗菌型环氧树脂固化剂及其制备方法 |
| CN111018748A (zh) * | 2019-12-27 | 2020-04-17 | 广东省生物医药技术研究所 | 化合物(s)-1-(1-萘基)乙基双胍及其制备方法和应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3170925A (en) * | 1965-02-23 | L-subsmtuted | ||
| US3270036A (en) * | 1965-10-07 | 1966-08-30 | Squibb & Sons Inc | Adamantylbiguanides |
| US3471491A (en) * | 1967-08-28 | 1969-10-07 | Squibb & Sons Inc | Adamantyl-s-triazines |
-
1974
- 1974-06-01 DE DE19742426683 patent/DE2426683A1/de active Pending
-
1975
- 1975-01-01 AR AR259024A patent/AR205644A1/es active
- 1975-05-07 US US05/575,098 patent/US4017539A/en not_active Expired - Lifetime
- 1975-05-16 CA CA227,188A patent/CA1052391A/en not_active Expired
- 1975-05-23 GB GB2273175A patent/GB1461020A/en not_active Expired
- 1975-05-26 ZA ZA00753355A patent/ZA753355B/xx unknown
- 1975-05-26 FI FI751528A patent/FI751528A7/fi not_active Application Discontinuation
- 1975-05-26 BE BE156721A patent/BE829499A/xx unknown
- 1975-05-27 SE SE7506025A patent/SE7506025L/xx not_active Application Discontinuation
- 1975-05-27 DD DD186278A patent/DD119225A5/xx unknown
- 1975-05-28 NL NL7506270A patent/NL7506270A/xx not_active Application Discontinuation
- 1975-05-30 FR FR7516925A patent/FR2272652B1/fr not_active Expired
- 1975-05-30 CS CS7500003819A patent/CS183804B2/cs unknown
- 1975-05-30 JP JP50065237A patent/JPS516950A/ja active Pending
- 1975-05-30 HU HUBO1558A patent/HU168739B/hu unknown
- 1975-05-30 AT AT412175A patent/AT343675B/de not_active IP Right Cessation
- 1975-05-31 PL PL1975180819A patent/PL94249B1/pl unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1985004399A1 (en) | 1984-04-03 | 1985-10-10 | Peremartoni Vegyipari Vállalat | Isothiuronium salts |
| GB2167750A (en) * | 1984-04-03 | 1986-06-04 | Peremartoni Vegyipari Vallalat | Isothiuronium salts |
| DE3590133T1 (de) * | 1984-04-03 | 1986-06-26 | Peremartoni Vegyipari Vállalat, Peremartongyártelep | Isothiuronium-salze, deren Herstellung und diese Verbindungen enthaltenden pharmazeutische Präparate |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS516950A (OSRAM) | 1976-01-20 |
| GB1461020A (en) | 1977-01-13 |
| SE7506025L (sv) | 1975-12-02 |
| PL94249B1 (OSRAM) | 1977-07-30 |
| CS183804B2 (en) | 1978-07-31 |
| AU8153675A (en) | 1976-12-02 |
| FR2272652A1 (OSRAM) | 1975-12-26 |
| CA1052391A (en) | 1979-04-10 |
| FR2272652B1 (OSRAM) | 1978-10-06 |
| BE829499A (fr) | 1975-11-26 |
| ZA753355B (en) | 1976-05-26 |
| AT343675B (de) | 1978-06-12 |
| HU168739B (OSRAM) | 1976-07-28 |
| DD119225A5 (OSRAM) | 1976-04-12 |
| US4017539A (en) | 1977-04-12 |
| FI751528A7 (OSRAM) | 1975-12-02 |
| AR205644A1 (es) | 1976-05-21 |
| ATA412175A (de) | 1977-10-15 |
| NL7506270A (nl) | 1975-12-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503815C2 (de) | Indazol-Derivate, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE1695093A1 (de) | Neue Imidazolderivate | |
| DE2139526A1 (OSRAM) | ||
| DE2205815A1 (de) | Piperazinderivate und verfahren zu ihrer herstellung | |
| DE2426683A1 (de) | Biguanide und verfahren zu deren herstellung | |
| DE2344833A1 (de) | Guanidine, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH423751A (de) | Verfahren zur Herstellung neuer Guanidine | |
| DE2141818A1 (de) | 2-phenylimino-imidazolidine, deren saeureadditionssalze und verfahren zu deren herstellung | |
| DE2220906A1 (de) | Neue substituierte 2-phenylaminoimidazoline-(2), deren saeureadditionssalze sowie verfahren zu deren herstellung | |
| DE2636732A1 (de) | Neue substituierte 2-phenylamino- imidazoline- (2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE2006895A1 (de) | Neue Phenacetylguanidine und Verfahren zu ihrer Herstellung | |
| DE69011046T2 (de) | Pyridinderivate, Verfahren zur Herstellung und pharmazeutische Zusammensetzungen. | |
| EP0029505B1 (de) | Substituierte 2-Phenylamino-imidazoline-(2), deren Säureadditionssalze, diese enthaltende Arzneimittel und Verfahren zur Herstellung derselben | |
| DE1468135C3 (OSRAM) | ||
| DD249479A5 (de) | Verfahren zur herstellung von propionamidin-derivaten | |
| DE1620018B2 (de) | 1-methyl-5-nitroimidazol-derivate, ihre salze mit saeuren, verfahren zu ihrer herstellung und antiparasitaere mittel | |
| DE2832310A1 (de) | Neue substituierte 2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE4119756A1 (de) | Aminoalkylsubstituierte 5-mercaptothiazole, ihre herstellung und verwendung | |
| DE2030314A1 (OSRAM) | ||
| DE2106620C3 (de) | ureidobenzylalkohole und Verfahren zu ihrer Herstellung | |
| DE1645974A1 (de) | Isonicotinsaeureamide enthaltende Arzneimittel | |
| DE2026661A1 (de) | Tropan 3 öl Derivate und Verfahren zu deren Herstellung | |
| DE2623377A1 (de) | 2-imidazoline und ihre anwendung in pharmazeutischen zubereitungen sowie verfahren zu ihrer herstellung | |
| DE2628642C2 (de) | In 2-Stellung substituierte 1,3-Diaza-fünfringkohlenstoffverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| AT258952B (de) | Verfahren zur Herstellung neuer heterocyclischer Guanidinverbindungen und ihrer Säureadditionssalze |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |