DE2420782A1 - Zinklegierung - Google Patents
ZinklegierungInfo
- Publication number
- DE2420782A1 DE2420782A1 DE2420782A DE2420782A DE2420782A1 DE 2420782 A1 DE2420782 A1 DE 2420782A1 DE 2420782 A DE2420782 A DE 2420782A DE 2420782 A DE2420782 A DE 2420782A DE 2420782 A1 DE2420782 A1 DE 2420782A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- zinc
- alloys
- zinc alloy
- aluminum
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910001297 Zn alloy Inorganic materials 0.000 title claims description 12
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 7
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 7
- 239000011575 calcium Substances 0.000 claims description 7
- 229910052791 calcium Inorganic materials 0.000 claims description 7
- 229910052802 copper Inorganic materials 0.000 claims description 7
- 239000010949 copper Substances 0.000 claims description 7
- 239000011777 magnesium Substances 0.000 claims description 7
- 229910052749 magnesium Inorganic materials 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910045601 alloy Inorganic materials 0.000 description 15
- 239000000956 alloy Substances 0.000 description 15
- 238000001125 extrusion Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229910018137 Al-Zn Inorganic materials 0.000 description 1
- 229910018573 Al—Zn Inorganic materials 0.000 description 1
- 229910000611 Zinc aluminium Inorganic materials 0.000 description 1
- HXFVOUUOTHJFPX-UHFFFAOYSA-N alumane;zinc Chemical compound [AlH3].[Zn] HXFVOUUOTHJFPX-UHFFFAOYSA-N 0.000 description 1
- FJMNNXLGOUYVHO-UHFFFAOYSA-N aluminum zinc Chemical compound [Al].[Zn] FJMNNXLGOUYVHO-UHFFFAOYSA-N 0.000 description 1
- 238000000641 cold extrusion Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000005242 forging Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000001192 hot extrusion Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005555 metalworking Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C22—METALLURGY; FERROUS OR NON-FERROUS ALLOYS; TREATMENT OF ALLOYS OR NON-FERROUS METALS
- C22C—ALLOYS
- C22C18/00—Alloys based on zinc
- C22C18/04—Alloys based on zinc with aluminium as the next major constituent
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Forging (AREA)
- Extrusion Of Metal (AREA)
- Reinforcement Elements For Buildings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00358275A US3850622A (en) | 1973-05-08 | 1973-05-08 | High strength zinc alloys |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2420782A1 true DE2420782A1 (de) | 1974-11-28 |
Family
ID=23409011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2420782A Pending DE2420782A1 (de) | 1973-05-08 | 1974-04-29 | Zinklegierung |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3850622A (enExample) |
| JP (1) | JPS5319447B2 (enExample) |
| AR (1) | AR199956A1 (enExample) |
| AU (1) | AU476716B2 (enExample) |
| BE (1) | BE814648A (enExample) |
| CA (1) | CA990541A (enExample) |
| DE (1) | DE2420782A1 (enExample) |
| FR (1) | FR2228850A1 (enExample) |
| GB (1) | GB1429099A (enExample) |
| IT (1) | IT1010472B (enExample) |
| LU (1) | LU70000A1 (enExample) |
| NL (1) | NL7405498A (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1442070A (en) * | 1974-05-01 | 1976-07-07 | Isc Alloys Ltd | Production of superplastic zinc-aluminium alloy sheeet |
| US3966505A (en) * | 1974-05-15 | 1976-06-29 | Ball Corporation | High strength wrought zinc alloy |
| US4029525A (en) * | 1975-04-30 | 1977-06-14 | Ball Corporation | High strength wrought zinc alloy |
| US4126450A (en) * | 1977-03-29 | 1978-11-21 | Ball Corporation | Continuously castable zinc base alloy |
| US4599279A (en) * | 1984-10-01 | 1986-07-08 | Ball Corporation | Zinc alloy for reducing copper-zinc diffusion |
| BE1000566A7 (fr) * | 1987-05-13 | 1989-02-07 | Centre Rech Metallurgique | Alliage a base de zinc resistant a chaud. |
| CA1319280C (en) * | 1988-10-04 | 1993-06-22 | Robert J. Barnhurst | Creep resistant zinc-aluminum based casting alloy |
| JPH0641620B2 (ja) * | 1989-01-31 | 1994-06-01 | 三井金属鉱業株式会社 | 金型の製造方法 |
| JPH03121869U (enExample) * | 1990-03-27 | 1991-12-12 | ||
| US5945066A (en) * | 1997-11-20 | 1999-08-31 | Griffin; James D. | Zinc-copper based alloy and castings made therefrom |
| CN110343906B (zh) * | 2019-07-17 | 2021-03-12 | 浙江工贸职业技术学院 | 一种隔热金属材料及其制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1945288A (en) * | 1931-07-09 | 1934-01-30 | American Brass Co | Zinc base alloy |
| DE663274C (de) * | 1934-01-27 | 1938-08-02 | Metallgesellschaft Akt Ges | Zink-Spritzguss-Legierungen |
| US2102869A (en) * | 1936-08-26 | 1937-12-21 | New Jersey Zinc Co | Zinc alloys |
| DE703977C (de) * | 1937-02-14 | 1941-03-20 | Metallgesellschaft Akt Ges | eitung |
| US3527601A (en) * | 1967-06-14 | 1970-09-08 | Dow Chemical Co | Process of making creep-resistant zinc-base alloys |
| US3676115A (en) * | 1968-05-03 | 1972-07-11 | Nat Res Dev | Zinc alloys |
| CA919458A (en) * | 1969-12-31 | 1973-01-23 | Cominco Ltd. | Zinc forging alloy |
-
1973
- 1973-05-08 US US00358275A patent/US3850622A/en not_active Expired - Lifetime
-
1974
- 1974-04-03 CA CA196,722A patent/CA990541A/en not_active Expired
- 1974-04-10 AU AU67710/74A patent/AU476716B2/en not_active Expired
- 1974-04-24 NL NL7405498A patent/NL7405498A/xx not_active Application Discontinuation
- 1974-04-26 AR AR253477A patent/AR199956A1/es active
- 1974-04-26 FR FR7414710A patent/FR2228850A1/fr not_active Withdrawn
- 1974-04-29 DE DE2420782A patent/DE2420782A1/de active Pending
- 1974-05-06 LU LU70000A patent/LU70000A1/xx unknown
- 1974-05-07 JP JP5064174A patent/JPS5319447B2/ja not_active Expired
- 1974-05-07 BE BE144004A patent/BE814648A/xx unknown
- 1974-05-07 GB GB2003274A patent/GB1429099A/en not_active Expired
- 1974-05-07 IT IT22376/74A patent/IT1010472B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| IT1010472B (it) | 1977-01-10 |
| FR2228850A1 (enExample) | 1974-12-06 |
| AR199956A1 (es) | 1974-10-08 |
| BE814648A (fr) | 1974-09-02 |
| JPS5319447B2 (enExample) | 1978-06-21 |
| JPS5027718A (enExample) | 1975-03-22 |
| CA990541A (en) | 1976-06-08 |
| AU476716B2 (en) | 1976-09-30 |
| NL7405498A (enExample) | 1974-11-12 |
| US3850622A (en) | 1974-11-26 |
| AU6771074A (en) | 1975-10-16 |
| GB1429099A (en) | 1976-03-24 |
| LU70000A1 (enExample) | 1974-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69125436T2 (de) | Blech aus einer Aluminiumlegierung mit guter Beständigkeit gegen Beschädigung für Flugzeugblech | |
| DE2810932A1 (de) | Aluminiumlegierung mit verbesserter schweissbarkeit | |
| DE2103614B2 (de) | Verfahren zur Herstellung von Halbzeug aus AIMgSIZr-Legierungen mit hoher Kerbschlagzähigkeit | |
| DE68913561T2 (de) | Aluminium-Lithium-Legierungen. | |
| DE2420782A1 (de) | Zinklegierung | |
| CH642108A5 (de) | Verfahren zur herstellung von halbzeugen aus einer al-mn-legierung mit verbesserten festigkeitseigenschaften. | |
| DE2235168C2 (de) | Verfahren zur Herstellung von Aluminiumlegierungen und deren Verwendung | |
| DE1483204C3 (de) | Verfahren zur Herstellung von Blechen aus Magnesiumlegierungen | |
| DE2437653A1 (de) | Kupferlegierungen fuer die herstellung von formen | |
| DE2500084B2 (de) | Verfahren zur Herstellung von Aluminium-Halbzeug | |
| DE1284095B (de) | Verfahren zum Herstellen von Aluminiumlegierungsblechen hoher Zeitstandfestigkeit | |
| DE1922213A1 (de) | Zink-Aluminium-Legierungen | |
| DE3486352T2 (de) | Aluminium-Lithium-Legierung. | |
| DE2242235C3 (de) | Superplastische Aluminiumlegierung | |
| EP0828008A2 (de) | Aluminiumlegierung mit guter Spanbarkeit | |
| DE2648967A1 (de) | Superplastisch verformbare aluminiumlegierungen | |
| DE2255824A1 (de) | Verfahren zur herstellung einer knetlegierung auf zinkbasis | |
| DE1284632B (de) | Verwendung einer Al-Si-Ni-Gusslegierung | |
| DE1758820B2 (de) | Verwendung einer alzncnmg-legierung | |
| DE1204831B (de) | Verfahren zur Herstellung von vergueteten Gussteilen aus einer Magnesium-Aluminium-Zink-Legierung | |
| CH504535A (de) | Aluminium-Gusslegierung | |
| DE2058212A1 (de) | Aluminium-Zink-Legierung | |
| DE2112370C2 (de) | Verfahren zur Herstellung superplastisch verformbarer kupferhaltiger Zink- oder Zink-Aluminium-Legierungen | |
| AT141850B (de) | Verfahren zur Veredelung von Aluminiumlegierungen. | |
| DE1458531A1 (de) | Gegenstaende aus Aluminium-Magnesium-Legierungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |