DE2415748A1 - Verfahren zur herstellung von polyhalogenierten nicotinsaeuren - Google Patents
Verfahren zur herstellung von polyhalogenierten nicotinsaeurenInfo
- Publication number
- DE2415748A1 DE2415748A1 DE2415748A DE2415748A DE2415748A1 DE 2415748 A1 DE2415748 A1 DE 2415748A1 DE 2415748 A DE2415748 A DE 2415748A DE 2415748 A DE2415748 A DE 2415748A DE 2415748 A1 DE2415748 A1 DE 2415748A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- formula
- weight
- nitric acid
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 239000002253 acid Substances 0.000 title claims description 8
- 150000007513 acids Chemical class 0.000 title claims description 5
- 239000000460 chlorine Substances 0.000 claims description 17
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 229910017604 nitric acid Inorganic materials 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 7
- XMJRZCYSCMZVJQ-UHFFFAOYSA-N 2,5,6-trichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl XMJRZCYSCMZVJQ-UHFFFAOYSA-N 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000002730 mercury Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910000365 copper sulfate Inorganic materials 0.000 claims description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 150000002731 mercury compounds Chemical class 0.000 claims description 2
- 229910001987 mercury nitrate Inorganic materials 0.000 claims description 2
- DRXYRSRECMWYAV-UHFFFAOYSA-N nitrooxymercury Chemical compound [Hg+].[O-][N+]([O-])=O DRXYRSRECMWYAV-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000013078 crystal Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- AJPKQSSFYHPYMH-UHFFFAOYSA-N 2,6-dichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=C(Cl)N=C1Cl AJPKQSSFYHPYMH-UHFFFAOYSA-N 0.000 description 3
- MJWYRJCJQPUTGU-UHFFFAOYSA-N 4-chloro-4-(chloromethyl)piperidine-2,6-dione Chemical compound ClCC1(Cl)CC(=O)NC(=O)C1 MJWYRJCJQPUTGU-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- -1 alkyl pyridines Chemical class 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CMPPTKONDXHDBF-UHFFFAOYSA-N 2,6-dichloro-3-(chloromethyl)pyridine Chemical compound ClCC1=CC=C(Cl)N=C1Cl CMPPTKONDXHDBF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000001291 vacuum drying Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DGRWKOIUYLWSEV-UHFFFAOYSA-N 2,3,6-trichloro-5-(chloromethyl)pyridine Chemical compound ClCC1=CC(Cl)=C(Cl)N=C1Cl DGRWKOIUYLWSEV-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical class ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- OIMQLXQDHOFORS-UHFFFAOYSA-N 2-chloro-2-(chloromethyl)pentanedinitrile Chemical compound ClCC(Cl)(C#N)CCC#N OIMQLXQDHOFORS-UHFFFAOYSA-N 0.000 description 1
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical class [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- OYOVEKUWSKJFRL-UHFFFAOYSA-N ethyl 2-hydroxy-6-oxo-1H-pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CC=C(O)N=C1O OYOVEKUWSKJFRL-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000000055 hyoplipidemic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002814 niacins Polymers 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- 150000003343 selenium compounds Chemical class 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH479773A CH575928A5 (https=) | 1973-04-04 | 1973-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2415748A1 true DE2415748A1 (de) | 1974-10-24 |
Family
ID=4282708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2415748A Pending DE2415748A1 (de) | 1973-04-04 | 1974-04-01 | Verfahren zur herstellung von polyhalogenierten nicotinsaeuren |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3956340A (https=) |
| JP (1) | JPS49127978A (https=) |
| CA (1) | CA998396A (https=) |
| CH (1) | CH575928A5 (https=) |
| DE (1) | DE2415748A1 (https=) |
| FR (1) | FR2224460B1 (https=) |
| GB (1) | GB1429405A (https=) |
| NL (1) | NL7403101A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0092117A1 (en) * | 1982-04-12 | 1983-10-26 | Ishihara Sangyo Kaisha, Ltd. | Process for producing chloronicotinic acid compounds |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN103274929B (zh) * | 2013-04-09 | 2014-12-17 | 金凯(辽宁)化工有限公司 | 一种2-三氟甲基苯甲酸的制备方法 |
| CN103467280B (zh) * | 2013-08-27 | 2015-05-20 | 上海赫腾精细化工有限公司 | 间三氟甲基苯甲酸的制备方法 |
| CN116199624A (zh) * | 2021-12-01 | 2023-06-02 | 都创(上海)医药开发有限公司 | 一种2,5,6-三氯烟酸的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2657207A (en) * | 1951-02-27 | 1953-10-27 | Du Pont | Preparation of isocinchomeronic acid |
| FR1317667A (https=) | 1961-03-15 | 1963-05-10 |
-
1973
- 1973-04-04 CH CH479773A patent/CH575928A5/xx not_active IP Right Cessation
-
1974
- 1974-02-01 CA CA191,525A patent/CA998396A/en not_active Expired
- 1974-03-07 NL NL7403101A patent/NL7403101A/xx unknown
- 1974-03-13 US US05/450,933 patent/US3956340A/en not_active Expired - Lifetime
- 1974-03-22 JP JP49033097A patent/JPS49127978A/ja active Pending
- 1974-03-29 GB GB1413874A patent/GB1429405A/en not_active Expired
- 1974-04-01 DE DE2415748A patent/DE2415748A1/de active Pending
- 1974-04-03 FR FR7411772A patent/FR2224460B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0092117A1 (en) * | 1982-04-12 | 1983-10-26 | Ishihara Sangyo Kaisha, Ltd. | Process for producing chloronicotinic acid compounds |
| US4504665A (en) * | 1982-04-12 | 1985-03-12 | Ishihara Sangyo Kaisha Ltd. | Process for producing chloronicotinic acid compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2224460A1 (https=) | 1974-10-31 |
| GB1429405A (en) | 1976-03-24 |
| NL7403101A (https=) | 1974-10-08 |
| US3956340A (en) | 1976-05-11 |
| CH575928A5 (https=) | 1976-05-31 |
| JPS49127978A (https=) | 1974-12-07 |
| FR2224460B1 (https=) | 1977-10-21 |
| CA998396A (en) | 1976-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2065236B2 (de) | Phosphonsäuresalze, ihre Herstellung und Verwendung | |
| DE2355084A1 (de) | Verbindungen mit magensaeuresekretionshemmender wirkung und verfahren zu deren herstellung | |
| DE2752287C3 (de) | Verfahren zur Gewinnung von Salzen der Asparaginsäure | |
| DE1012914B (de) | Verfahren zur Herstellung von Benzthiazolyl-2-sulfen-morpholid | |
| DE2415748A1 (de) | Verfahren zur herstellung von polyhalogenierten nicotinsaeuren | |
| DE2156662B2 (de) | Verfahren zur Herstellung von 3,3-Bis(4-dimethylaminophenyl)-6-dimethylaminophthalid (Kristallviolettacton) | |
| DE2714041A1 (de) | Verfahren zur herstellung von 2-mercaptopyridin-1-oxiden und deren salzen | |
| DE3150005A1 (de) | Verfahren zur herstellung von chinolinsaeure | |
| DE2826333C2 (de) | Oxidationsverfahren zur Herstellung von Pyridincarbonsäuren | |
| DE1911539C3 (de) | Schwefelhaltige substituierte Benzoesäuren und diese enthaltende Mittel | |
| EP0067352B1 (de) | Verfahren zur Herstellung von S-Aryl-thioglycolsäuren | |
| DE3689764T2 (de) | Zwischenprodukte und Verfahren zu ihrer Herstellung. | |
| AT230370B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| EP0309392B1 (de) | Mono- und Dichlor-4,4'-diaminodiphenyl-5,5'-disulfonsäure | |
| DE3506681A1 (de) | Verfahren zur herstellung von pyridin-2,3-dicarbonsaeure | |
| DE2510139C3 (de) | Verfahren zur Herstellung von Monochlorbenzoesäuren | |
| DE1695071C3 (de) | 3-Hydroxy-2-imino-1 (2H) -pyridinsulfonsäure-monohydrat | |
| DE2433889C2 (de) | Verfahren zur Herstellung reiner allcls-Cyclopentan-1,2,3,4-tetracarbonsäure bzw. ihre Salze | |
| AT228190B (de) | Verfahren zur Herstellung von neuen Hydrazinderivaten und ihren Salzen | |
| DE703228C (de) | Verfahren zur Darstellung von Abkoemmlingen von 2-Mercaptoarylthiazolen bzw. deren analogen Selenverbindungen | |
| EP0081459A1 (de) | Verfahren zur Herstellung von N-Phosphonomethylglycin | |
| DE2203461C3 (de) | Verfahren zur Herstellung von halogensubstituierten 3-Hydroxybenzo [c] -cinnolin-Derivaten | |
| DE1695035C3 (de) | Verfahren zur Herstellung von 5-Chlor-2,3-pyridindiol | |
| AT215421B (de) | Verfahren zur Herstellung von 4-(Pyridincarbonsäureamido- bzw. -alkylamido)-1-phenyl-2,3-dimethylpyrazolonen-(5) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |