DE2409349A1 - Lichtstabilisierte polymere - Google Patents
Lichtstabilisierte polymereInfo
- Publication number
- DE2409349A1 DE2409349A1 DE19742409349 DE2409349A DE2409349A1 DE 2409349 A1 DE2409349 A1 DE 2409349A1 DE 19742409349 DE19742409349 DE 19742409349 DE 2409349 A DE2409349 A DE 2409349A DE 2409349 A1 DE2409349 A1 DE 2409349A1
- Authority
- DE
- Germany
- Prior art keywords
- butyl
- hydroxybenzoate
- hydroxy
- alkyl
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000642 polymer Polymers 0.000 title claims description 22
- -1 3,5-di-t-butyl-4-hydroxybenzyl Chemical group 0.000 claims description 54
- 125000004432 carbon atom Chemical group C* 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 34
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 33
- QUAMTGJKVDWJEQ-UHFFFAOYSA-N octabenzone Chemical compound OC1=CC(OCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 QUAMTGJKVDWJEQ-UHFFFAOYSA-N 0.000 claims description 23
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 239000001257 hydrogen Substances 0.000 claims description 17
- 239000012964 benzotriazole Substances 0.000 claims description 16
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 16
- 229910052759 nickel Inorganic materials 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- NMAGCVWUISAHAP-UHFFFAOYSA-N 3,5-ditert-butyl-2-(2,4-ditert-butylphenyl)-4-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1C1=C(C(O)=O)C=C(C(C)(C)C)C(O)=C1C(C)(C)C NMAGCVWUISAHAP-UHFFFAOYSA-N 0.000 claims description 14
- 239000004743 Polypropylene Substances 0.000 claims description 10
- 229920001155 polypropylene Polymers 0.000 claims description 10
- PWWSSIYVTQUJQQ-UHFFFAOYSA-N distearyl thiodipropionate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCCCCCCCC PWWSSIYVTQUJQQ-UHFFFAOYSA-N 0.000 claims description 9
- ZMWRRFHBXARRRT-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol Chemical compound CCC(C)(C)C1=CC(C(C)(C)CC)=CC(N2N=C3C=CC=CC3=N2)=C1O ZMWRRFHBXARRRT-UHFFFAOYSA-N 0.000 claims description 8
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- RNVAPPWJCZTWQL-UHFFFAOYSA-N octadecyl 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 RNVAPPWJCZTWQL-UHFFFAOYSA-N 0.000 claims description 8
- 239000002656 Distearyl thiodipropionate Substances 0.000 claims description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 6
- 235000019305 distearyl thiodipropionate Nutrition 0.000 claims description 6
- 239000002530 phenolic antioxidant Substances 0.000 claims description 6
- 239000003508 Dilauryl thiodipropionate Substances 0.000 claims description 5
- 239000007983 Tris buffer Substances 0.000 claims description 5
- 239000012965 benzophenone Substances 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- 230000006378 damage Effects 0.000 claims description 5
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 claims description 5
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 5
- 239000004611 light stabiliser Substances 0.000 claims description 5
- 229920005613 synthetic organic polymer Polymers 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 4
- 239000006096 absorbing agent Substances 0.000 claims description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229940124543 ultraviolet light absorber Drugs 0.000 claims description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 claims 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims 2
- RYISLFWCVCPQNV-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2,3,3-trimethylbutanoic acid Chemical compound CC(C)(C)C(C)(C(O)=O)C1=CC=C(O)C=C1 RYISLFWCVCPQNV-UHFFFAOYSA-N 0.000 claims 1
- YEXOWHQZWLCHHD-UHFFFAOYSA-N 3,5-ditert-butyl-4-hydroxybenzoic acid Chemical compound CC(C)(C)C1=CC(C(O)=O)=CC(C(C)(C)C)=C1O YEXOWHQZWLCHHD-UHFFFAOYSA-N 0.000 claims 1
- HLHCLFHSOMMEHX-UHFFFAOYSA-N N1N=NC2=C1C=CC=C2.OC2=C(C=C(C=C2C(C)(C)C)C(C)(C)C)N2N=C1C(=N2)C=CC(=C1)Cl Chemical compound N1N=NC2=C1C=CC=C2.OC2=C(C=C(C=C2C(C)(C)C)C(C)(C)C)N2N=C1C(=N2)C=CC(=C1)Cl HLHCLFHSOMMEHX-UHFFFAOYSA-N 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 229920000098 polyolefin Polymers 0.000 claims 1
- WHWMOMRHHQLBQQ-UHFFFAOYSA-N tert-butyl 4-hydroxybenzoate Chemical compound CC(C)(C)OC(=O)C1=CC=C(O)C=C1 WHWMOMRHHQLBQQ-UHFFFAOYSA-N 0.000 claims 1
- 125000003944 tolyl group Chemical group 0.000 claims 1
- 239000006097 ultraviolet radiation absorber Substances 0.000 claims 1
- QFOHBWFCKVYLES-UHFFFAOYSA-N Butylparaben Chemical compound CCCCOC(=O)C1=CC=C(O)C=C1 QFOHBWFCKVYLES-UHFFFAOYSA-N 0.000 description 28
- 239000003381 stabilizer Substances 0.000 description 15
- 239000003963 antioxidant agent Substances 0.000 description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 150000002989 phenols Chemical class 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 239000000654 additive Substances 0.000 description 5
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 238000002845 discoloration Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 150000003852 triazoles Chemical class 0.000 description 4
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 150000008366 benzophenones Chemical class 0.000 description 3
- 150000001565 benzotriazoles Chemical class 0.000 description 3
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 150000002815 nickel Chemical class 0.000 description 3
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920000307 polymer substrate Polymers 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- SYFIBOFYDHBYCD-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-pentylphenol Chemical compound CCCCCC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 SYFIBOFYDHBYCD-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 2
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 230000000379 polymerizing effect Effects 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- JQSSXIRDGUMPNP-UHFFFAOYSA-N (4-decoxy-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(OCCCCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 JQSSXIRDGUMPNP-UHFFFAOYSA-N 0.000 description 1
- ZHBRSHSRMYZHLS-UHFFFAOYSA-N (4-hydroxyphenyl)methylphosphonic acid Chemical compound OC1=CC=C(CP(O)(O)=O)C=C1 ZHBRSHSRMYZHLS-UHFFFAOYSA-N 0.000 description 1
- OMWSZDODENFLSV-UHFFFAOYSA-N (5-chloro-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 OMWSZDODENFLSV-UHFFFAOYSA-N 0.000 description 1
- IIHBUNQHIATFCV-UHFFFAOYSA-N (6,6-dihydroxy-4-octoxycyclohexa-2,4-dien-1-yl)-phenylmethanone Chemical compound C1=CC(OCCCCCCCC)=CC(O)(O)C1C(=O)C1=CC=CC=C1 IIHBUNQHIATFCV-UHFFFAOYSA-N 0.000 description 1
- JERGUCIJOXJXHF-DBAXYKBZSA-N 2,2,2-trideuterio-1-[(3s,8r,9s,10r,13s,14s,17r)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C([2H])([2H])[2H])(O)[C@@]1(C)CC2 JERGUCIJOXJXHF-DBAXYKBZSA-N 0.000 description 1
- ZXDDPOHVAMWLBH-UHFFFAOYSA-N 2,4-Dihydroxybenzophenone Chemical compound OC1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 ZXDDPOHVAMWLBH-UHFFFAOYSA-N 0.000 description 1
- AGINNBJBZIUVDC-UHFFFAOYSA-N 2,4-dimethyl-6-(5-methylbenzotriazol-2-yl)phenol Chemical compound N1=C2C=C(C)C=CC2=NN1C1=CC(C)=CC(C)=C1O AGINNBJBZIUVDC-UHFFFAOYSA-N 0.000 description 1
- IYAZLDLPUNDVAG-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 IYAZLDLPUNDVAG-UHFFFAOYSA-N 0.000 description 1
- KGVHAZMHOQLBEQ-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-phenylphenol Chemical compound C1=C(N2N=C3C=CC=CC3=N2)C(O)=CC=C1C1=CC=CC=C1 KGVHAZMHOQLBEQ-UHFFFAOYSA-N 0.000 description 1
- WXHVQMGINBSVAY-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 WXHVQMGINBSVAY-UHFFFAOYSA-N 0.000 description 1
- RPJLPEUNIGUTJT-UHFFFAOYSA-N 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]oxyethyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CC(=O)OCCOC(=O)CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 RPJLPEUNIGUTJT-UHFFFAOYSA-N 0.000 description 1
- QGXGFUDOEKFBGD-UHFFFAOYSA-N 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCCOC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 QGXGFUDOEKFBGD-UHFFFAOYSA-N 0.000 description 1
- QJOMNAXYTLNNHC-UHFFFAOYSA-N 2-but-1-enyl-4-hydroxy-3,5-di(propan-2-yl)benzoic acid Chemical compound CCC=CC1=C(C=C(C(=C1C(C)C)O)C(C)C)C(=O)O QJOMNAXYTLNNHC-UHFFFAOYSA-N 0.000 description 1
- CCYJFFSPIOMFBZ-UHFFFAOYSA-N 2-methylpropyl 4-hydroxy-3,5-bis(2-methylbutan-2-yl)benzoate Chemical compound CCC(C)(C)C1=CC(C(=O)OCC(C)C)=CC(C(C)(C)CC)=C1O CCYJFFSPIOMFBZ-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical class OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- IEMHIOUNBGZEAG-UHFFFAOYSA-N 4-tert-butyl-2-(5-chlorobenzotriazol-2-yl)phenol Chemical compound CC(C)(C)C1=CC=C(O)C(N2N=C3C=C(Cl)C=CC3=N2)=C1 IEMHIOUNBGZEAG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- BRVVMCUQUVCBKE-UHFFFAOYSA-N CCC(OC1(C=CC=CC1)O)=O Chemical compound CCC(OC1(C=CC=CC1)O)=O BRVVMCUQUVCBKE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- QZHKBIRYHAJMEN-UHFFFAOYSA-N P(O)(O)=O.C(CCCCCCCCCCCCCCCCC)C(C)(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)CCCCCCCCCCCCCCCCCC Chemical compound P(O)(O)=O.C(CCCCCCCCCCCCCCCCC)C(C)(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)CCCCCCCCCCCCCCCCCC QZHKBIRYHAJMEN-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- BGYHLZZASRKEJE-UHFFFAOYSA-N [3-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]-2,2-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxymethyl]propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCC(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)(COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)COC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 BGYHLZZASRKEJE-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- WXNRYSGJLQFHBR-UHFFFAOYSA-N bis(2,4-dihydroxyphenyl)methanone Chemical compound OC1=CC(O)=CC=C1C(=O)C1=CC=C(O)C=C1O WXNRYSGJLQFHBR-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229920003020 cross-linked polyethylene Polymers 0.000 description 1
- 239000004703 cross-linked polyethylene Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- SUDPUSNNGWJHKG-UHFFFAOYSA-N dodecyl 4-hydroxy-3-methyl-5-(3-methylbutyl)benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC(C)=C(O)C(CCC(C)C)=C1 SUDPUSNNGWJHKG-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- UJHUYJYLMVZJPF-UHFFFAOYSA-N ethyl 4-hydroxy-3,5-di(propan-2-yl)benzoate Chemical compound CCOC(=O)C1=CC(C(C)C)=C(O)C(C(C)C)=C1 UJHUYJYLMVZJPF-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- NZYMWGXNIUZYRC-UHFFFAOYSA-N hexadecyl 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CCCCCCCCCCCCCCCCOC(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NZYMWGXNIUZYRC-UHFFFAOYSA-N 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229940063583 high-density polyethylene Drugs 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- UBGPHZZYVGSNSW-UHFFFAOYSA-N methyl 4-hydroxy-3-methyl-5-propan-2-ylbenzoate Chemical compound COC(=O)C1=CC(C)=C(O)C(C(C)C)=C1 UBGPHZZYVGSNSW-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- SSDSCDGVMJFTEQ-UHFFFAOYSA-N octadecyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 SSDSCDGVMJFTEQ-UHFFFAOYSA-N 0.000 description 1
- BRNTYBFVLCEIEJ-UHFFFAOYSA-N octadecyl 4-hydroxy-3,5-di(propan-2-yl)benzoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1=CC(C(C)C)=C(O)C(C(C)C)=C1 BRNTYBFVLCEIEJ-UHFFFAOYSA-N 0.000 description 1
- ITYCRFXTOMEQFF-UHFFFAOYSA-N octadecyl 4-hydroxybenzoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=C(O)C=C1 ITYCRFXTOMEQFF-UHFFFAOYSA-N 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- DXGLGDHPHMLXJC-UHFFFAOYSA-N oxybenzone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXGLGDHPHMLXJC-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- YUIFFNHNYKNVNQ-UHFFFAOYSA-N phenyl 3,5-ditert-butyl-4-hydroxybenzoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C(=O)OC=2C=CC=CC=2)=C1 YUIFFNHNYKNVNQ-UHFFFAOYSA-N 0.000 description 1
- GBNRNYYETPVZEU-UHFFFAOYSA-N phenyl 4-hydroxy-3,5-di(propan-2-yl)benzoate Chemical compound CC(C)C1=C(O)C(C(C)C)=CC(C(=O)OC=2C=CC=CC=2)=C1 GBNRNYYETPVZEU-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920013639 polyalphaolefin Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920006380 polyphenylene oxide Polymers 0.000 description 1
- 229920013637 polyphenylene oxide polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical class OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/13—Phenols; Phenolates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US33947473A | 1973-03-08 | 1973-03-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2409349A1 true DE2409349A1 (de) | 1974-09-12 |
Family
ID=23329158
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742409349 Pending DE2409349A1 (de) | 1973-03-08 | 1974-02-27 | Lichtstabilisierte polymere |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS49126743A (cg-RX-API-DMAC7.html) |
| AT (1) | AT328193B (cg-RX-API-DMAC7.html) |
| BE (1) | BE811985A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1033882A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2409349A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES424012A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2225457B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1435404A (cg-RX-API-DMAC7.html) |
| NL (1) | NL7403104A (cg-RX-API-DMAC7.html) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6147744A (ja) * | 1984-08-15 | 1986-03-08 | Polyplastics Co | 耐候性ポリアセタ−ル樹脂組成物 |
| JP2529806B2 (ja) * | 1992-09-07 | 1996-09-04 | ポリプラスチックス株式会社 | 耐候性ポリアセタ―ル樹脂組成物 |
-
1974
- 1974-02-07 CA CA191,951A patent/CA1033882A/en not_active Expired
- 1974-02-27 DE DE19742409349 patent/DE2409349A1/de active Pending
- 1974-02-27 JP JP2321774A patent/JPS49126743A/ja active Pending
- 1974-03-06 GB GB1002674A patent/GB1435404A/en not_active Expired
- 1974-03-07 NL NL7403104A patent/NL7403104A/xx not_active Application Discontinuation
- 1974-03-07 FR FR7407774A patent/FR2225457B1/fr not_active Expired
- 1974-03-07 BE BE141737A patent/BE811985A/xx unknown
- 1974-03-07 AT AT190374A patent/AT328193B/de not_active IP Right Cessation
- 1974-03-07 ES ES424012A patent/ES424012A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49126743A (cg-RX-API-DMAC7.html) | 1974-12-04 |
| AU6552474A (en) | 1975-08-14 |
| BE811985A (fr) | 1974-09-09 |
| CA1033882A (en) | 1978-06-27 |
| GB1435404A (en) | 1976-05-12 |
| ES424012A1 (es) | 1977-01-01 |
| AT328193B (de) | 1976-03-10 |
| ATA190374A (de) | 1975-05-15 |
| FR2225457B1 (cg-RX-API-DMAC7.html) | 1978-02-10 |
| NL7403104A (cg-RX-API-DMAC7.html) | 1974-09-10 |
| FR2225457A1 (cg-RX-API-DMAC7.html) | 1974-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19735255B4 (de) | Synergistisches Stabilisatorgemisch auf Basis von Polyalkyl-1-oxa-diazaspirodecan-Verbindungen und dessen Verwendung | |
| DE1213409B (de) | Verwendung von substituierten 2-(2'-Hydroxyphenyl)-benztriazolverbindungen zum Schuetzen von organischen Stoffen gegen ultraviolette Strahlung | |
| US3935163A (en) | Light stabilized polymer compositions | |
| DE3880887T2 (de) | Lichtstabilisatoren auf der basis von polymeren sterisch gehinderten aminen. | |
| CH522432A (de) | Verwendung von v-Triazolen als Schutzmittel für nichttextile organische Substrate gegen UV-Strahlen | |
| DE2612314A1 (de) | Piperidinderivate als lichtschutzmittel | |
| US3935164A (en) | Light stabilized polymer compositions | |
| US3928357A (en) | Substituted piperazine diones and polymeric compositions stabilized thereby | |
| US4007157A (en) | Substituted piperazines and polymeric compositions stabilized thereby | |
| DE2409349A1 (de) | Lichtstabilisierte polymere | |
| CA1053839A (en) | Polymer compositions containing titanium dioxide having improved visible and ultraviolet and light stability | |
| DE2409350A1 (de) | Licht-stabilisierte polymere | |
| DE2409374A1 (de) | Lichtstabilisierte polymere | |
| US3706701A (en) | Stabilization of polymers | |
| DE2231671A1 (de) | 3,5-dialkyl-4-hydroxyphenylalkansaeureester von glykol und damit stabilisierte zusammensetzungen | |
| DE3880871T2 (de) | Flammhemmende Polyesterelastomermasse. | |
| DE1185610B (de) | Verwendung von 2-Phenylbenzotriazol-verbindungen zum Schuetzen von organischen Stoffen gegen ultraviolette Strahlung | |
| JPS59176256A (ja) | オリゴマーエステル及び有機ポリマーの安定化方法 | |
| US4051137A (en) | Substituted piperazine diones and polymeric compositions stabilized thereby | |
| AU550058B2 (en) | Hindered phenolic antioxidants and diazacycloalkane uv stabilizers in polymeric films | |
| SU508217A3 (ru) | Композици на основе полиолефина | |
| DE2314115A1 (de) | 3,5-dialkyl-4-hydroxyphenylalkylsubstituierte piperazindione und deren verwendung zum stabilisieren von synthetischen organischen polymerisaten | |
| DE1928541C3 (de) | Stabilisierte thermoplastische Formmassen | |
| US3839311A (en) | Polymer pro-oxidant comprising hydroxy-substituted 2,4-pentadienophenones | |
| DE1544605A1 (de) | Stabilisierung von Polymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |