DE2408726A1 - Verbesserte koerperunterlage - Google Patents
Verbesserte koerperunterlageInfo
- Publication number
- DE2408726A1 DE2408726A1 DE19742408726 DE2408726A DE2408726A1 DE 2408726 A1 DE2408726 A1 DE 2408726A1 DE 19742408726 DE19742408726 DE 19742408726 DE 2408726 A DE2408726 A DE 2408726A DE 2408726 A1 DE2408726 A1 DE 2408726A1
- Authority
- DE
- Germany
- Prior art keywords
- liquid
- particles
- diameter
- approx
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000007788 liquid Substances 0.000 claims description 32
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 24
- 239000002245 particle Substances 0.000 claims description 21
- 239000008187 granular material Substances 0.000 claims description 20
- 239000000945 filler Substances 0.000 claims description 19
- 239000004793 Polystyrene Substances 0.000 claims description 14
- 229920002223 polystyrene Polymers 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 12
- 239000000377 silicon dioxide Substances 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 11
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 9
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 9
- 239000004794 expanded polystyrene Substances 0.000 claims description 8
- 230000002421 anti-septic effect Effects 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 5
- 230000000844 anti-bacterial effect Effects 0.000 claims description 4
- 230000001580 bacterial effect Effects 0.000 claims description 3
- 235000015110 jellies Nutrition 0.000 claims description 3
- 239000008274 jelly Substances 0.000 claims description 3
- 239000000779 smoke Substances 0.000 claims description 3
- 239000010445 mica Substances 0.000 claims description 2
- 229910052618 mica group Inorganic materials 0.000 claims description 2
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 claims 1
- 208000004210 Pressure Ulcer Diseases 0.000 description 7
- 230000009969 flowable effect Effects 0.000 description 5
- 239000011324 bead Substances 0.000 description 4
- 239000011236 particulate material Substances 0.000 description 4
- 239000004599 antimicrobial Substances 0.000 description 3
- 210000002683 foot Anatomy 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 150000004760 silicates Chemical class 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 2
- 206010011985 Decubitus ulcer Diseases 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 210000003423 ankle Anatomy 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000003414 extremity Anatomy 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 230000000474 nursing effect Effects 0.000 description 2
- 210000004197 pelvis Anatomy 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 229920004933 Terylene® Polymers 0.000 description 1
- 208000003443 Unconsciousness Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000037237 body shape Effects 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002984 plastic foam Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47C—CHAIRS; SOFAS; BEDS
- A47C27/00—Spring, stuffed or fluid mattresses or cushions specially adapted for chairs, beds or sofas
- A47C27/08—Fluid mattresses
- A47C27/085—Fluid mattresses of liquid type, e.g. filled with water or gel
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61G—TRANSPORT, PERSONAL CONVEYANCES, OR ACCOMMODATION SPECIALLY ADAPTED FOR PATIENTS OR DISABLED PERSONS; OPERATING TABLES OR CHAIRS; CHAIRS FOR DENTISTRY; FUNERAL DEVICES
- A61G7/00—Beds specially adapted for nursing; Devices for lifting patients or disabled persons
- A61G7/05—Parts, details or accessories of beds
- A61G7/057—Arrangements for preventing bed-sores or for supporting patients with burns, e.g. mattresses specially adapted therefor
- A61G7/05738—Arrangements for preventing bed-sores or for supporting patients with burns, e.g. mattresses specially adapted therefor with fluid-like particles, e.g. sand, mud, seeds, gel, beads
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S5/00—Beds
- Y10S5/909—Flowable viscous, e.g. gel material containing
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Nursing (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Mattresses And Other Support Structures For Chairs And Beds (AREA)
- Invalid Beds And Related Equipment (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919373A GB1454292A (en) | 1973-02-24 | 1973-02-24 | Body support means |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2408726A1 true DE2408726A1 (de) | 1974-08-29 |
Family
ID=9867201
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742408726 Withdrawn DE2408726A1 (de) | 1973-02-24 | 1974-02-22 | Verbesserte koerperunterlage |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3968530A (enExample) |
| CA (1) | CA988630A (enExample) |
| DE (1) | DE2408726A1 (enExample) |
| FR (1) | FR2218871B1 (enExample) |
| GB (1) | GB1454292A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4418853A1 (de) * | 1994-05-30 | 1995-12-07 | Kostas Sarris | Entspannungsliege |
| DE10038117B4 (de) * | 2000-02-09 | 2005-03-03 | Marion Brust | Sitz-und Liegekissen |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE8022373U1 (de) * | 1980-08-22 | 1980-12-04 | Knoche, Bodo, 3204 Nordstemmen | Unterlage fuer sitz- oder liegeflaechen |
| FR2523841B1 (fr) * | 1982-03-25 | 1985-10-25 | Lacoste Francois | Lit fluidise a usage therapeutique |
| GB8418217D0 (en) * | 1984-07-17 | 1984-08-22 | Perring W R | Cushion |
| US4673216A (en) * | 1984-08-06 | 1987-06-16 | Alfer Jaroslaw G | Basic lotus posture comfort seat |
| US4637377A (en) * | 1985-09-20 | 1987-01-20 | Loop Floyd D | Pillow or support member for surgical use |
| US4766627A (en) * | 1986-02-24 | 1988-08-30 | Brumline Usa, Inc. | Bed pad support for an invalid |
| FR2602963B1 (fr) * | 1986-08-21 | 1988-12-02 | Defaut Michel | Coussins et matelas anti-escarres a usage medical |
| GB8713953D0 (en) * | 1987-06-15 | 1987-07-22 | Mentor Medical Developments Lt | Cushion mattress/like support |
| US5497789A (en) * | 1987-07-20 | 1996-03-12 | Zook; Gerald P. | Foot protector incorporating a viscoelastic gel |
| FR2627383A1 (fr) * | 1988-02-18 | 1989-08-25 | Acouturier Bertrand | Coussin ortho-medical en caoutchouc-silicone, a triple enveloppe synthetique |
| US4962769A (en) * | 1988-05-11 | 1990-10-16 | Prevent Products, Inc. | Use of bubble packaging film for relieving decubitus ulcers or pressure ulcers |
| US4870999A (en) * | 1989-01-03 | 1989-10-03 | Dennis Linda H | Process for forming embellished fabric by core yarn removal |
| NL8902458A (nl) * | 1989-10-03 | 1991-05-01 | Stichting Revalidatiecentrum A | Drukvereffenende ondersteuningsinrichting. |
| US5103517A (en) * | 1990-08-18 | 1992-04-14 | The Institute For Rehabilitation And Research | Disposable surgical pad |
| USD346923S (en) | 1990-10-30 | 1994-05-17 | Todd Holm | Mattress filled with beads that absorb and retain heat |
| US5201780A (en) * | 1991-09-06 | 1993-04-13 | Jay Medical, Ltd. | Anti-decubitus mattress pad |
| US5513899A (en) * | 1991-11-13 | 1996-05-07 | Invacare Corporation | Seat cushion for wheelchairs |
| US5364339A (en) * | 1993-04-07 | 1994-11-15 | Juanita Carver | Bed sore pad |
| US5421874A (en) * | 1993-06-22 | 1995-06-06 | Genesis Composites, L.C. | Composite microsphere and lubricant mixture |
| US5881409A (en) * | 1993-06-22 | 1999-03-16 | Teksource, Ll | Puff-quilted bladders for containing flowable cushioning medium |
| US5590430A (en) * | 1993-10-15 | 1997-01-07 | Sereboff; Joel L. | Gel filled deformable cushion and composition contained therein |
| US5475882A (en) * | 1993-10-15 | 1995-12-19 | Sereboff; Joel L. | Gel filled deformable cushion and composition contained therein |
| US5592706A (en) * | 1993-11-09 | 1997-01-14 | Teksource, Lc | Cushioning device formed from separate reshapable cells |
| US5606785A (en) * | 1994-05-19 | 1997-03-04 | Position-Aire, Inc. | Air bladder positioner for cadavers |
| DE4425306C1 (de) * | 1994-07-18 | 1996-02-08 | Gernot Dr Loehnert | Wasserbettmatratze und Gelkissen mit reduziertem Gewicht |
| US5624128A (en) * | 1995-03-06 | 1997-04-29 | Owens; Jesse L. | Transport system for disabled people |
| US5869164A (en) * | 1995-11-08 | 1999-02-09 | Rik Medical Llc | Pressure-compensating compositions and pads made therefrom |
| US5749111A (en) * | 1996-02-14 | 1998-05-12 | Teksource, Lc | Gelatinous cushions with buckling columns |
| US5724917A (en) * | 1996-06-21 | 1998-03-10 | Milliken Research Corporation | Cattle mattress |
| US6196156B1 (en) * | 1997-04-15 | 2001-03-06 | Seefar Technologies, Inc. | Bedding articles possessing microbe-inhibiting properties |
| US5778470A (en) * | 1997-04-21 | 1998-07-14 | Haider; Thomas T. | Partitioned therapeutic pillow with bead filling |
| USD399568S (en) | 1997-10-21 | 1998-10-13 | Schering-Plough Healthcare Products, Inc. | Toe and finger wrap |
| US5899207A (en) * | 1998-03-16 | 1999-05-04 | The Seaberg Company, Inc. | Protecting skin from friction |
| US5920915A (en) * | 1998-09-22 | 1999-07-13 | Brock Usa, Llc | Protective padding for sports gear |
| US6032300A (en) | 1998-09-22 | 2000-03-07 | Brock Usa, Llc | Protective padding for sports gear |
| GB2342857A (en) * | 1998-10-20 | 2000-04-26 | James Arthur Hill | Viscous fluid filled seat cushion |
| DE19938609C2 (de) * | 1999-08-14 | 2002-11-14 | Erhard Weber | Kugelgel-Flächenlager |
| DE10001798A1 (de) * | 2000-01-18 | 2001-09-13 | Burth Ann Cathrin | Eine körperadaptive Gesundheitsmatratze |
| GB0002635D0 (en) * | 2000-02-07 | 2000-03-29 | Norbrook Lab Ltd | Bedding |
| US7662468B2 (en) * | 2000-10-06 | 2010-02-16 | Brock Usa, Llc | Composite materials made from pretreated, adhesive coated beads |
| US7555615B2 (en) * | 2001-01-10 | 2009-06-30 | Tempur-Pedic Management, Inc. | Product demonstration system and method for using same |
| US6648535B2 (en) * | 2001-02-27 | 2003-11-18 | Daniel A. Ferrara, Jr. | Cushioning element |
| WO2004021837A1 (en) * | 2002-09-09 | 2004-03-18 | Jackson Donna K | Enhanced impact/trauma mitigating seating devices |
| US20040073931A1 (en) * | 2002-10-10 | 2004-04-15 | Tempur World, Inc. | Interactive bed display |
| US6934990B2 (en) * | 2002-12-20 | 2005-08-30 | Tom Rapisarda | Non-liquid buoyant bedding |
| JP4611980B2 (ja) * | 2003-08-08 | 2011-01-12 | ザ シーバーグ カンパニー インコーポレイテッド | 摩擦減少装置 |
| US20050033211A1 (en) * | 2003-08-08 | 2005-02-10 | Samuel Scheinberg | Friction reducing bandage |
| US7244477B2 (en) * | 2003-08-20 | 2007-07-17 | Brock Usa, Llc | Multi-layered sports playing field with a water draining, padding layer |
| US20050089678A1 (en) * | 2003-08-20 | 2005-04-28 | Mead Steven R. | Multi-layered floorig composite including an acoustic underlayment |
| GB2409809A (en) * | 2004-01-08 | 2005-07-13 | Tracie Herrtage | Hammock stuffed with polystyrene beans |
| US7540847B2 (en) * | 2004-01-16 | 2009-06-02 | Klein Charles W | Apparatus and method for selectively transmitting vibrations to an individual situated on a support surface |
| US20050166330A1 (en) * | 2004-01-31 | 2005-08-04 | Williams Carla M. | Particulate filler mattress |
| US7185604B2 (en) * | 2004-04-12 | 2007-03-06 | Debra Leah Holte | Orthopedic pet cushion |
| US6986170B2 (en) * | 2004-06-22 | 2006-01-17 | Nelson Thomas M | Fluid filled body padding for fall protection |
| US6990701B1 (en) | 2005-08-05 | 2006-01-31 | Vera Litvak | Sectional non-slip mattress |
| US20070083995A1 (en) * | 2005-10-12 | 2007-04-19 | Purdy William J | Fluidized positioning and protection system |
| GB0612460D0 (en) * | 2006-06-23 | 2006-08-02 | James Leckey Design Ltd | An improved support cushion and sleeping system incorporating same |
| US8607387B2 (en) * | 2006-11-20 | 2013-12-17 | Stryker Corporation | Multi-walled gelastic mattress system |
| WO2009018669A1 (en) * | 2007-08-03 | 2009-02-12 | Snooztime Inc. | Improved microbead pillow |
| US20090041437A1 (en) * | 2007-08-06 | 2009-02-12 | Razor Usa Llc | Portable media player |
| US8075981B2 (en) * | 2007-08-23 | 2011-12-13 | Edizone, Llc | Alternating pattern gel cushioning elements and related methods |
| US8434748B1 (en) | 2007-10-03 | 2013-05-07 | Edizone, Llc | Cushions comprising gel springs |
| US8424137B1 (en) | 2007-11-27 | 2013-04-23 | Edizone, Llc | Ribbed gel |
| US8549684B2 (en) * | 2008-03-25 | 2013-10-08 | Stryker Corporation | Gelastic material having variable or same hardness and balanced, independent buckling in a mattress system |
| US20090249740A1 (en) * | 2008-04-03 | 2009-10-08 | Crookston Lawrence A | Roofing shingle support system |
| US8932692B2 (en) * | 2008-10-03 | 2015-01-13 | Edizone, Llc | Cushions comprising deformable members and related methods |
| WO2010135542A2 (en) * | 2009-05-21 | 2010-11-25 | Edizone, Llc | Cushions comprising core structures and related methods |
| US8590075B1 (en) | 2009-06-09 | 2013-11-26 | Ibrahim H. Amjad | Mattress assembly for newborn infants |
| US9504621B2 (en) | 2011-06-09 | 2016-11-29 | Molnlycke Health Care Usa, Llc | System and method for patient turning and repositioning with simultaneous off-loading of the bony prominences |
| US10925790B2 (en) | 2011-06-09 | 2021-02-23 | Mölnlycke Health Care Ab | System and method for patient turning and repositioning |
| US20130152285A1 (en) * | 2011-12-20 | 2013-06-20 | Drandalie, Llc. | Lightweight and Flexible Protective Equipment System |
| US8966668B2 (en) * | 2011-12-20 | 2015-03-03 | Andrew Cameron Sutton | Web and bladder suspension protection system |
| US10363185B2 (en) * | 2014-09-04 | 2019-07-30 | Mölnlycke Health Care Ab | System and method for off-loading of the body in the prone position and for patient turning and repositioning |
| US10688004B2 (en) * | 2016-02-08 | 2020-06-23 | Prime Medical, LLC | Overlay support pad for medical bean bag device |
| CN106264936A (zh) * | 2016-08-25 | 2017-01-04 | 张苗 | 一种压疮药物抗菌消炎垫 |
| US20190191895A1 (en) * | 2017-12-26 | 2019-06-27 | Michael Shek | Pillow |
| CN111658363A (zh) * | 2020-07-10 | 2020-09-15 | 重庆知翔科技有限公司 | 一种外科护理设备及其护理方法 |
| AU2021236440B1 (en) * | 2021-09-20 | 2023-03-02 | Rolapal Limited | A seat incorporating a cushion |
| EP4458339A1 (en) * | 2023-05-02 | 2024-11-06 | Mölnlycke Health Care AB | A moldable pad for supporting a body part |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3082768A (en) * | 1960-08-18 | 1963-03-26 | James N Johns | Healing mattress |
| US3403414A (en) * | 1966-11-17 | 1968-10-01 | Unger Leo | Composite fiber and urethane foam pillow and bedding structures |
| US3721232A (en) * | 1968-05-24 | 1973-03-20 | Trenchard M | Surgical pad method for decubitus ulcer management |
| US3638255A (en) * | 1969-10-02 | 1972-02-01 | Eugene L Sterrett | Seat cushion or pillow |
| GB1288319A (enExample) * | 1970-04-10 | 1972-09-06 | ||
| US3787908A (en) * | 1971-07-01 | 1974-01-29 | Minnesota Mining & Mfg | Incompressible, conformable structure containing cellular particles |
-
1973
- 1973-02-24 GB GB919373A patent/GB1454292A/en not_active Expired
-
1974
- 1974-02-19 US US05/443,606 patent/US3968530A/en not_active Expired - Lifetime
- 1974-02-22 CA CA193,302A patent/CA988630A/en not_active Expired
- 1974-02-22 DE DE19742408726 patent/DE2408726A1/de not_active Withdrawn
- 1974-02-25 FR FR7406382A patent/FR2218871B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4418853A1 (de) * | 1994-05-30 | 1995-12-07 | Kostas Sarris | Entspannungsliege |
| DE10038117B4 (de) * | 2000-02-09 | 2005-03-03 | Marion Brust | Sitz-und Liegekissen |
Also Published As
| Publication number | Publication date |
|---|---|
| CA988630A (en) | 1976-05-04 |
| FR2218871B1 (enExample) | 1978-07-07 |
| FR2218871A1 (enExample) | 1974-09-20 |
| GB1454292A (en) | 1976-11-03 |
| US3968530A (en) | 1976-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2408726A1 (de) | Verbesserte koerperunterlage | |
| DE3337009C2 (enExample) | ||
| DE69429177T2 (de) | Selbstanpassendes sitzsystem | |
| DE102009043730A1 (de) | Kissen, Ausstattung und Herstellungsverfahren | |
| DE1554031A1 (de) | Kissen,Pfuehl oder aehnlicher Stuetzkoerper,bestehend aus einer weichen Huelle mit Fuellung aus losem Material | |
| DE1926177A1 (de) | Chirurgischer Polster bzw. Matratze und Apparat zur Behandlung von Decubitus Ulcer | |
| DE2730521A1 (de) | Matratze | |
| DE602006000564T2 (de) | Kindermatraze | |
| DE2953328C2 (enExample) | ||
| EP0318730B1 (de) | Polster oder dergleichen, sowie Verfahren zu seiner Herstellung | |
| DE1539709B2 (de) | Zur Anfertigung von Bettdecken, Polstern, Kissen, deren Bezügen oder ähnlichem mit dem menschlichen Körper verbindbarem Bedeckungsmaterial dienender flächiger Werkstoff | |
| DE19737733B4 (de) | Vorrichtung zur Absorption von Vibrationen an Körperbereichen | |
| DE9414100U1 (de) | Vorrichtung zur Lagerung von Teilen des menschlichen Körpers, insbesondere der Beine | |
| EP0614636B1 (de) | Anatomisch ausgebildete Liegematratze | |
| WO1982000578A1 (fr) | Element de protection pour sieges ou lits | |
| DE2945008C2 (de) | Stützelement für medizinische Lagerungszwecke | |
| DE29707932U1 (de) | Lagerungsvorrichtung | |
| DE331517C (de) | Polsterhuelle fuer Beinstuempfe | |
| DE3435261A1 (de) | Auflage auf matratzen oder andere liegeflaechen | |
| DE102005033202A1 (de) | Wirkstoffvlies | |
| WO2017063619A1 (de) | Matratzensystem | |
| DE102005051110A1 (de) | Kombiniertes Fluidbett | |
| DE202009013139U1 (de) | Kissen und Ausstattung | |
| DE2715051A1 (de) | Kissen bzw. polster fuer einen rollstuhl oder einen geriatrischen stuhl | |
| DE1937451U (de) | Sitzauflage. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee | ||
| 8141 | Disposal/no request for examination |