DE2408289A1 - Substituierte diaminoguanidine und ihre herstellung - Google Patents
Substituierte diaminoguanidine und ihre herstellungInfo
- Publication number
 - DE2408289A1 DE2408289A1 DE19742408289 DE2408289A DE2408289A1 DE 2408289 A1 DE2408289 A1 DE 2408289A1 DE 19742408289 DE19742408289 DE 19742408289 DE 2408289 A DE2408289 A DE 2408289A DE 2408289 A1 DE2408289 A1 DE 2408289A1
 - Authority
 - DE
 - Germany
 - Prior art keywords
 - formula
 - hydrazone
 - guanidine
 - halogen
 - hydrogen
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Pending
 
Links
- FQQQSNAVVZSYMB-UHFFFAOYSA-N 1,1-diaminoguanidine Chemical class NN(N)C(N)=N FQQQSNAVVZSYMB-UHFFFAOYSA-N 0.000 title claims description 3
 - 238000004519 manufacturing process Methods 0.000 title description 2
 - -1 acyl isocyanide Chemical compound 0.000 claims description 46
 - 150000007857 hydrazones Chemical class 0.000 claims description 18
 - 229910052736 halogen Inorganic materials 0.000 claims description 15
 - 150000002367 halogens Chemical class 0.000 claims description 15
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 13
 - 239000001257 hydrogen Substances 0.000 claims description 13
 - 125000004432 carbon atom Chemical group C* 0.000 claims description 12
 - 150000001875 compounds Chemical class 0.000 claims description 12
 - 238000000034 method Methods 0.000 claims description 10
 - 150000002431 hydrogen Chemical class 0.000 claims description 9
 - 239000002253 acid Substances 0.000 claims description 8
 - 125000000217 alkyl group Chemical group 0.000 claims description 7
 - 125000003545 alkoxy group Chemical group 0.000 claims description 6
 - 239000000203 mixture Substances 0.000 claims description 5
 - 238000002360 preparation method Methods 0.000 claims description 5
 - JGGFDEJXWLAQKR-UHFFFAOYSA-N 1,2-diaminoguanidine Chemical class NNC(N)=NN JGGFDEJXWLAQKR-UHFFFAOYSA-N 0.000 claims description 4
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
 - 150000008064 anhydrides Chemical class 0.000 claims description 3
 - 150000001728 carbonyl compounds Chemical class 0.000 claims description 3
 - 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
 - 201000010099 disease Diseases 0.000 claims description 3
 - 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 3
 - 150000004820 halides Chemical class 0.000 claims description 3
 - 125000001424 substituent group Chemical group 0.000 claims description 3
 - 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
 - 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
 - 150000003839 salts Chemical class 0.000 claims description 2
 - 230000000144 pharmacologic effect Effects 0.000 claims 1
 - ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 46
 - YURDSJGWWXAEBA-UHFFFAOYSA-N (4-chlorophenyl)methylidenehydrazine Chemical compound NN=CC1=CC=C(Cl)C=C1 YURDSJGWWXAEBA-UHFFFAOYSA-N 0.000 description 34
 - CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 23
 - SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 23
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
 - OHWFZCUCQSPPSJ-UHFFFAOYSA-N benzoyl isocyanide Chemical compound [C-]#[N+]C(=O)C1=CC=CC=C1 OHWFZCUCQSPPSJ-UHFFFAOYSA-N 0.000 description 17
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
 - YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 9
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 9
 - 229910052794 bromium Inorganic materials 0.000 description 9
 - 229910052731 fluorine Inorganic materials 0.000 description 9
 - 239000011737 fluorine Substances 0.000 description 9
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
 - RLAROPIDCNCRNR-UHFFFAOYSA-N Cl.Cl.[C-]#N Chemical compound Cl.Cl.[C-]#N RLAROPIDCNCRNR-UHFFFAOYSA-N 0.000 description 8
 - 229910052801 chlorine Inorganic materials 0.000 description 8
 - 239000000460 chlorine Substances 0.000 description 8
 - WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
 - YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
 - 238000002844 melting Methods 0.000 description 6
 - 230000008018 melting Effects 0.000 description 6
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
 - UYZKWRHTYCCDMP-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylideneamino]guanidine Chemical compound NC(N)=NN=CC1=CC=C(Cl)C=C1 UYZKWRHTYCCDMP-UHFFFAOYSA-N 0.000 description 4
 - 208000003495 Coccidiosis Diseases 0.000 description 4
 - 206010023076 Isosporiasis Diseases 0.000 description 4
 - 239000002904 solvent Substances 0.000 description 4
 - AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 3
 - QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
 - 241001465754 Metazoa Species 0.000 description 3
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
 - 239000004480 active ingredient Substances 0.000 description 3
 - VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
 - BAJBVTWTYVBTIL-UHFFFAOYSA-N (4-bromophenyl)methylidenehydrazine Chemical compound NN=CC1=CC=C(Br)C=C1 BAJBVTWTYVBTIL-UHFFFAOYSA-N 0.000 description 2
 - DTWXQPNQLDOYHA-UHFFFAOYSA-N (4-fluorophenyl)methylidenehydrazine Chemical compound NN=CC1=CC=C(F)C=C1 DTWXQPNQLDOYHA-UHFFFAOYSA-N 0.000 description 2
 - AIWPXJBZZDHCAG-UHFFFAOYSA-N (4-iodophenyl)methylidenehydrazine Chemical compound NN=CC1=CC=C(I)C=C1 AIWPXJBZZDHCAG-UHFFFAOYSA-N 0.000 description 2
 - IGMHTADUHJUTSD-UHFFFAOYSA-N 1-(4-chlorophenyl)ethylidenehydrazine Chemical compound NN=C(C)C1=CC=C(Cl)C=C1 IGMHTADUHJUTSD-UHFFFAOYSA-N 0.000 description 2
 - KJTVYMFBLBFDNN-UHFFFAOYSA-N 4-methanehydrazonoylbenzonitrile Chemical compound NN=CC1=CC=C(C#N)C=C1 KJTVYMFBLBFDNN-UHFFFAOYSA-N 0.000 description 2
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
 - XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
 - OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
 - CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
 - DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
 - HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
 - QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
 - 239000012876 carrier material Substances 0.000 description 2
 - MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
 - 239000003814 drug Substances 0.000 description 2
 - 239000012442 inert solvent Substances 0.000 description 2
 - PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
 - 150000002825 nitriles Chemical class 0.000 description 2
 - 244000144977 poultry Species 0.000 description 2
 - 235000013594 poultry meat Nutrition 0.000 description 2
 - 238000003756 stirring Methods 0.000 description 2
 - VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
 - IZKCWJUTZCUYDW-UHFFFAOYSA-N (2-chlorophenyl)methylidenehydrazine Chemical compound NN=CC1=CC=CC=C1Cl IZKCWJUTZCUYDW-UHFFFAOYSA-N 0.000 description 1
 - IKTJTGWJQSDQDK-UHFFFAOYSA-N (4-chlorophenyl)methanimine Chemical compound ClC1=CC=C(C=N)C=C1 IKTJTGWJQSDQDK-UHFFFAOYSA-N 0.000 description 1
 - RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
 - 125000006183 2,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])*)C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - JLMXBFIFMDQPIG-UHFFFAOYSA-N 2-[(4-iodophenyl)methylideneamino]guanidine Chemical compound NC(N)=NN=CC1=CC=C(I)C=C1 JLMXBFIFMDQPIG-UHFFFAOYSA-N 0.000 description 1
 - AUQKWAUBDKHPJD-UHFFFAOYSA-N 2-methylbenzoyl isocyanide Chemical compound C=1(C(=CC=CC=1)C(=O)[N+]#[C-])C AUQKWAUBDKHPJD-UHFFFAOYSA-N 0.000 description 1
 - 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
 - JHAWWJQGHKGXHA-UHFFFAOYSA-N 6-tert-butylquinoline Chemical compound N1=CC=CC2=CC(C(C)(C)C)=CC=C21 JHAWWJQGHKGXHA-UHFFFAOYSA-N 0.000 description 1
 - CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
 - 239000004215 Carbon black (E152) Substances 0.000 description 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
 - XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
 - ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
 - 241000287828 Gallus gallus Species 0.000 description 1
 - SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
 - AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
 - HHYZNYXSPKZUTM-UHFFFAOYSA-N NN.ClC1=CC=C(C=O)C=C1 Chemical compound NN.ClC1=CC=C(C=O)C=C1 HHYZNYXSPKZUTM-UHFFFAOYSA-N 0.000 description 1
 - CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
 - 241000283973 Oryctolagus cuniculus Species 0.000 description 1
 - 241001494479 Pecora Species 0.000 description 1
 - 241000286209 Phasianidae Species 0.000 description 1
 - 241000282887 Suidae Species 0.000 description 1
 - PGAHUJGUYJGSDA-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methylidenehydrazine Chemical compound NN=CC1=CC=C(C(F)(F)F)C=C1 PGAHUJGUYJGSDA-UHFFFAOYSA-N 0.000 description 1
 - 239000000654 additive Substances 0.000 description 1
 - 150000001299 aldehydes Chemical class 0.000 description 1
 - 150000001408 amides Chemical class 0.000 description 1
 - 150000001412 amines Chemical class 0.000 description 1
 - 244000309466 calf Species 0.000 description 1
 - 150000001733 carboxylic acid esters Chemical class 0.000 description 1
 - 238000006243 chemical reaction Methods 0.000 description 1
 - 235000013330 chicken meat Nutrition 0.000 description 1
 - 238000005660 chlorination reaction Methods 0.000 description 1
 - 239000013078 crystal Substances 0.000 description 1
 - 125000004494 ethyl ester group Chemical group 0.000 description 1
 - 150000002357 guanidines Chemical class 0.000 description 1
 - 150000008282 halocarbons Chemical class 0.000 description 1
 - 150000002366 halogen compounds Chemical class 0.000 description 1
 - DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
 - 229930195733 hydrocarbon Natural products 0.000 description 1
 - 150000002430 hydrocarbons Chemical class 0.000 description 1
 - 150000007529 inorganic bases Chemical class 0.000 description 1
 - 229910052740 iodine Inorganic materials 0.000 description 1
 - 150000002576 ketones Chemical class 0.000 description 1
 - KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical group COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
 - 150000007522 mineralic acids Chemical class 0.000 description 1
 - ZABGGFMETLIJNE-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-2,6-dichlorobenzamide Chemical compound C1=CC(Cl)=CC=C1C=NNC(NN=CC=1C=CC(Cl)=CC=1)=NC(=O)C1=C(Cl)C=CC=C1Cl ZABGGFMETLIJNE-UHFFFAOYSA-N 0.000 description 1
 - IIHSBRLFPPRAMB-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-2-fluorobenzamide Chemical compound FC1=CC=CC=C1C(=O)N=C(NN=CC=1C=CC(Cl)=CC=1)NN=CC1=CC=C(Cl)C=C1 IIHSBRLFPPRAMB-UHFFFAOYSA-N 0.000 description 1
 - YLVBSPPHLAJQFU-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-4-bromobenzamide Chemical compound C1=CC(Cl)=CC=C1C=NNC(NN=CC=1C=CC(Cl)=CC=1)=NC(=O)C1=CC=C(Br)C=C1 YLVBSPPHLAJQFU-UHFFFAOYSA-N 0.000 description 1
 - SIISAQVDYFLBFD-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-4-cyanobenzamide Chemical compound C1=CC(Cl)=CC=C1C=NNC(NN=CC=1C=CC(Cl)=CC=1)=NC(=O)C1=CC=C(C#N)C=C1 SIISAQVDYFLBFD-UHFFFAOYSA-N 0.000 description 1
 - QQWOCXKGECKJHC-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-4-fluorobenzamide Chemical compound C1=CC(F)=CC=C1C(=O)N=C(NN=CC=1C=CC(Cl)=CC=1)NN=CC1=CC=C(Cl)C=C1 QQWOCXKGECKJHC-UHFFFAOYSA-N 0.000 description 1
 - VWLDZZJLTUEGIK-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]-4-nitrobenzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N=C(NN=CC=1C=CC(Cl)=CC=1)NN=CC1=CC=C(Cl)C=C1 VWLDZZJLTUEGIK-UHFFFAOYSA-N 0.000 description 1
 - MJTWYBXJJBDJCG-UHFFFAOYSA-N n-[bis[2-[(4-chlorophenyl)methylidene]hydrazinyl]methylidene]benzamide Chemical compound C1=CC(Cl)=CC=C1C=NNC(NN=CC=1C=CC(Cl)=CC=1)=NC(=O)C1=CC=CC=C1 MJTWYBXJJBDJCG-UHFFFAOYSA-N 0.000 description 1
 - UOIUUHRQOXAUHV-UHFFFAOYSA-N n-[bis[2-[(4-fluorophenyl)methylidene]hydrazinyl]methylidene]benzamide Chemical compound C1=CC(F)=CC=C1C=NNC(NN=CC=1C=CC(F)=CC=1)=NC(=O)C1=CC=CC=C1 UOIUUHRQOXAUHV-UHFFFAOYSA-N 0.000 description 1
 - VALHIHVNCVZRPJ-UHFFFAOYSA-N n-[bis[2-[(4-iodophenyl)methylidene]hydrazinyl]methylidene]benzamide Chemical compound C1=CC(I)=CC=C1C=NNC(NN=CC=1C=CC(I)=CC=1)=NC(=O)C1=CC=CC=C1 VALHIHVNCVZRPJ-UHFFFAOYSA-N 0.000 description 1
 - 150000007524 organic acids Chemical class 0.000 description 1
 - 239000003960 organic solvent Substances 0.000 description 1
 - 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
 - QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
 - 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
 - BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
 - 238000011321 prophylaxis Methods 0.000 description 1
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
 - 239000011541 reaction mixture Substances 0.000 description 1
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 1
 - 229910000029 sodium carbonate Inorganic materials 0.000 description 1
 - 239000007858 starting material Substances 0.000 description 1
 - 150000003512 tertiary amines Chemical class 0.000 description 1
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
 - 238000002560 therapeutic procedure Methods 0.000 description 1
 - 238000011282 treatment Methods 0.000 description 1
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
 - 239000008096 xylene Substances 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
 - C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
 - C07C281/16—Compounds containing any of the groups, e.g. aminoguanidine
 - C07C281/18—Compounds containing any of the groups, e.g. aminoguanidine the other nitrogen atom being further doubly-bound to a carbon atom, e.g. guanylhydrazones
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 - Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
 
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| DE19742408289 DE2408289A1 (de) | 1974-02-21 | 1974-02-21 | Substituierte diaminoguanidine und ihre herstellung | 
| NL7501756A NL7501756A (nl) | 1974-02-21 | 1975-02-14 | Gesubstitueerde diaminoguanidinen en hun bereiding. | 
| ES434772A ES434772A1 (es) | 1974-02-21 | 1975-02-15 | Procedimiento para la preparacion de diaminoguanidinas sus- tituidas. | 
| IL46648A IL46648A0 (en) | 1974-02-21 | 1975-02-17 | Substituted diaminoguanidines and their manufacture | 
| DD184296A DD117874A5 (en:Method) | 1974-02-21 | 1975-02-19 | |
| FI750462A FI750462A7 (en:Method) | 1974-02-21 | 1975-02-19 | |
| AU78355/75A AU7835575A (en) | 1974-02-21 | 1975-02-19 | Substituted diaminoguanidines | 
| NO750557A NO750557L (en:Method) | 1974-02-21 | 1975-02-19 | |
| IT20451/75A IT1037155B (it) | 1974-02-21 | 1975-02-19 | Diaminogjanidine sostituite e loro preparazione | 
| LU71885A LU71885A1 (en:Method) | 1974-02-21 | 1975-02-19 | |
| US05/550,917 US3950539A (en) | 1974-02-21 | 1975-02-19 | Substituted diaminoguanidines | 
| FR7505138A FR2261759A1 (en:Method) | 1974-02-21 | 1975-02-19 | |
| ZA00751074A ZA751074B (en) | 1974-02-21 | 1975-02-20 | Substituted diaminoguanidines and their manufacture | 
| DK63875*#A DK63875A (en:Method) | 1974-02-21 | 1975-02-20 | |
| BE153581A BE825805A (fr) | 1974-02-21 | 1975-02-21 | Diaminoguanidines substituees, leur procede de preparation et leurs applications | 
| SE7501972A SE7501972L (en:Method) | 1974-02-21 | 1975-02-21 | |
| JP50021088A JPS50117740A (en:Method) | 1974-02-21 | 1975-02-21 | |
| ES445528A ES445528A1 (es) | 1974-02-21 | 1976-02-25 | Procedimiento para la preparacion de diaminoguanidinas sus- tituidas. | 
| ES445529A ES445529A1 (es) | 1974-02-21 | 1976-02-25 | Procedimiento para la preparacion de diaminoguanidinas sus- tituidas. | 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| DE19742408289 DE2408289A1 (de) | 1974-02-21 | 1974-02-21 | Substituierte diaminoguanidine und ihre herstellung | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| DE2408289A1 true DE2408289A1 (de) | 1975-09-11 | 
Family
ID=5908038
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| DE19742408289 Pending DE2408289A1 (de) | 1974-02-21 | 1974-02-21 | Substituierte diaminoguanidine und ihre herstellung | 
Country Status (17)
| Country | Link | 
|---|---|
| US (1) | US3950539A (en:Method) | 
| JP (1) | JPS50117740A (en:Method) | 
| AU (1) | AU7835575A (en:Method) | 
| BE (1) | BE825805A (en:Method) | 
| DD (1) | DD117874A5 (en:Method) | 
| DE (1) | DE2408289A1 (en:Method) | 
| DK (1) | DK63875A (en:Method) | 
| ES (3) | ES434772A1 (en:Method) | 
| FI (1) | FI750462A7 (en:Method) | 
| FR (1) | FR2261759A1 (en:Method) | 
| IL (1) | IL46648A0 (en:Method) | 
| IT (1) | IT1037155B (en:Method) | 
| LU (1) | LU71885A1 (en:Method) | 
| NL (1) | NL7501756A (en:Method) | 
| NO (1) | NO750557L (en:Method) | 
| SE (1) | SE7501972L (en:Method) | 
| ZA (1) | ZA751074B (en:Method) | 
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US4369883A (en) * | 1981-04-27 | 1983-01-25 | Stravitz David M | Tape cassette storage and carrying case | 
| US5749636A (en) * | 1995-06-28 | 1998-05-12 | Boury; Nabil | Storage rack for compact discs or the like | 
| WO2002008301A2 (de) * | 2000-07-25 | 2002-01-31 | Membrana Gmbh | Modifizierter polymerer formkörper, verfahren zu seiner herstellung und seine verwendung | 
| JP5954504B1 (ja) * | 2014-09-12 | 2016-07-20 | 三菱瓦斯化学株式会社 | 変性ゴム及びその製造方法、ゴム組成物、並びにタイヤ | 
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US3206478A (en) * | 1961-10-05 | 1965-09-14 | Ciba Geigy Corp | Aminoarylalkanone | 
| CH479559A (de) * | 1967-09-26 | 1969-10-15 | Wander Ag Dr A | Verfahren zur Herstellung von Acylguanidinen | 
| US3621056A (en) * | 1968-08-16 | 1971-11-16 | Sandoz Ag | Substituted benzylideneamino guanidines | 
| GB1298112A (en) * | 1969-02-20 | 1972-11-29 | Wander Ag Dr A | Phenyl acetyl guanidine derivatives | 
| US3769432A (en) * | 1970-12-02 | 1973-10-30 | American Cyanamid Co | Compositions and method of use of substituted guanidines | 
| BE791536A (fr) * | 1971-11-19 | 1973-05-17 | Merck & Co Inc | Nouvelles 1,3-diamino guanidines substituees | 
| US3856975A (en) * | 1971-11-19 | 1974-12-24 | Merck & Co Inc | Anticoccidial composition containing guanidine derivatives | 
| US3795692A (en) * | 1972-03-24 | 1974-03-05 | Merck & Co Inc | Compounds and processes | 
| US3901944A (en) * | 1972-05-08 | 1975-08-26 | American Cyanamid Co | 1,3-bis(substituted benzylideneamino)guanidines | 
- 
        1974
        
- 1974-02-21 DE DE19742408289 patent/DE2408289A1/de active Pending
 
 - 
        1975
        
- 1975-02-14 NL NL7501756A patent/NL7501756A/xx unknown
 - 1975-02-15 ES ES434772A patent/ES434772A1/es not_active Expired
 - 1975-02-17 IL IL46648A patent/IL46648A0/xx unknown
 - 1975-02-19 IT IT20451/75A patent/IT1037155B/it active
 - 1975-02-19 NO NO750557A patent/NO750557L/no unknown
 - 1975-02-19 FR FR7505138A patent/FR2261759A1/fr not_active Withdrawn
 - 1975-02-19 US US05/550,917 patent/US3950539A/en not_active Expired - Lifetime
 - 1975-02-19 FI FI750462A patent/FI750462A7/fi not_active Application Discontinuation
 - 1975-02-19 DD DD184296A patent/DD117874A5/xx unknown
 - 1975-02-19 LU LU71885A patent/LU71885A1/xx unknown
 - 1975-02-19 AU AU78355/75A patent/AU7835575A/en not_active Expired
 - 1975-02-20 DK DK63875*#A patent/DK63875A/da unknown
 - 1975-02-20 ZA ZA00751074A patent/ZA751074B/xx unknown
 - 1975-02-21 SE SE7501972A patent/SE7501972L/ unknown
 - 1975-02-21 BE BE153581A patent/BE825805A/xx unknown
 - 1975-02-21 JP JP50021088A patent/JPS50117740A/ja active Pending
 
 - 
        1976
        
- 1976-02-25 ES ES445528A patent/ES445528A1/es not_active Expired
 - 1976-02-25 ES ES445529A patent/ES445529A1/es not_active Expired
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| FR2261759A1 (en:Method) | 1975-09-19 | 
| ES434772A1 (es) | 1977-02-01 | 
| US3950539A (en) | 1976-04-13 | 
| ES445528A1 (es) | 1977-06-16 | 
| NO750557L (en:Method) | 1975-08-22 | 
| SE7501972L (en:Method) | 1975-08-22 | 
| JPS50117740A (en:Method) | 1975-09-16 | 
| IT1037155B (it) | 1979-11-10 | 
| ES445529A1 (es) | 1977-06-16 | 
| ZA751074B (en) | 1976-01-28 | 
| AU7835575A (en) | 1976-08-19 | 
| NL7501756A (nl) | 1975-08-25 | 
| FI750462A7 (en:Method) | 1975-08-22 | 
| DD117874A5 (en:Method) | 1976-02-05 | 
| DK63875A (en:Method) | 1975-10-20 | 
| BE825805A (fr) | 1975-08-21 | 
| IL46648A0 (en) | 1975-04-25 | 
| LU71885A1 (en:Method) | 1977-01-05 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| EP0004279B1 (de) | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel | |
| EP0026848B1 (de) | Tetralinderivate, ihre Herstellung und Heilmittel, welche diese Verbindungen enthalten | |
| DE3529247A1 (de) | Verwendung von thienylharnstoffen und -isoharnstoffen als leistungsfoerdernde mittel bei tieren, neue thienylharnstoffe und -isoharnstoffe und ihre herstellung | |
| DE2408289A1 (de) | Substituierte diaminoguanidine und ihre herstellung | |
| DE2155132A1 (de) | l-(2-Hydroxy-3-phenoxy- oder-phenylthic~propyl)-piperazin-Derivate | |
| DE2600513A1 (de) | Acylamino(alkyl)benzolderivate und verfahren zu ihrer herstellung | |
| DE3247454A1 (de) | Substituierte 3-phenyl-5-methyl-isoxazol-4-carboxy-anilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2131330A1 (de) | Imidazo-[1,2-a]-benzimidazolderivate und Verfahren zur Herstellung derselben | |
| DE2124907A1 (de) | 3 Amino 1,2,4 oxadiazole, Verfahren zu ihrer Herstellung und Arzneipraparate | |
| DE2810267A1 (de) | Verfahren zur herstellung von phenylpyridazinonderivaten | |
| CH619688A5 (en:Method) | ||
| CH667457A5 (de) | Verfahren zur herstellung von substituierten 7-oxomitosanen. | |
| DE2903917C2 (en:Method) | ||
| DE2354931C2 (de) | trans-2-Phenylbicyclooctan-Verbindungen, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE1795380A1 (de) | Pharmazeutische Zubereitungen fuer die Behandlung von Nematodeninfektionen | |
| DE2555685A1 (de) | Neue cyanessigsaeureanilid-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| DE2503737A1 (de) | Substituierte diaminoguanidine und ihre herstellung | |
| DD233372A5 (de) | Verfahren zur herstellung von n-substituierten aminopropansulfonsaeure-derivaten | |
| CH628045A5 (en) | Process for the preparation of dibenzothiophene derivatives | |
| DE2403811A1 (de) | Substituierte diaminoguanidine und ihre herstellung | |
| DE2728870C2 (de) | Verfahren zur Herstellung von D-Penicillamin und dessen Salzen | |
| CH622488A5 (en) | Process for the preparation of N-cyclohexyl-N-methyl-N-(2-amino-3,5-dibromobenzyl)amine | |
| DE2335721A1 (de) | Neue penicilline, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel | |
| DE1695722C3 (de) | i-Acyl-3-lndolylcarbonsäurederivate und Verfahren zu ihrer Herstellung | |
| DE1568021C3 (de) | Neue Isothiocyano diphenylather und diphenylthioather, deren Herstel lung und Mittel zur Bekämpfung parsi tarer Helminthen und zur Verhütung von Helminthiasen bei Mensch und Tier |