DE2407187B2 - Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern - Google Patents
Verfahren zur Herstellung von aromatischen HydroxycarbonsäurealkylesternInfo
- Publication number
- DE2407187B2 DE2407187B2 DE2407187A DE2407187A DE2407187B2 DE 2407187 B2 DE2407187 B2 DE 2407187B2 DE 2407187 A DE2407187 A DE 2407187A DE 2407187 A DE2407187 A DE 2407187A DE 2407187 B2 DE2407187 B2 DE 2407187B2
- Authority
- DE
- Germany
- Prior art keywords
- aromatic hydroxycarboxylic
- alkyl esters
- acid
- hydroxycarboxylic acid
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 3
- -1 aromatic hydroxycarboxylic acids Chemical class 0.000 claims description 13
- 230000032050 esterification Effects 0.000 claims description 8
- 238000005886 esterification reaction Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 150000008050 dialkyl sulfates Chemical class 0.000 claims description 6
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 230000021523 carboxylation Effects 0.000 claims description 3
- 238000006473 carboxylation reaction Methods 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000007942 carboxylates Chemical class 0.000 claims description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 8
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 230000008929 regeneration Effects 0.000 description 3
- 238000011069 regeneration method Methods 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000007965 phenolic acids Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- RNELSSOIEGVRNT-UHFFFAOYSA-N 2-hydroxydibenzofuran-1-carboxylic acid Chemical class O1C2=CC=CC=C2C2=C1C=CC(O)=C2C(=O)O RNELSSOIEGVRNT-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- QBPAUIDFWFXLKB-UHFFFAOYSA-N 9h-carbazol-1-ol Chemical compound N1C2=CC=CC=C2C2=C1C(O)=CC=C2 QBPAUIDFWFXLKB-UHFFFAOYSA-N 0.000 description 1
- 241000134426 Ceratopogonidae Species 0.000 description 1
- 238000007065 Kolbe-Schmitt synthesis reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 150000005169 dihydroxybenzoic acids Chemical class 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- BDXGQHHFVPQVAQ-UHFFFAOYSA-N methyl 2-methoxynaphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)=C(OC)C=CC2=C1 BDXGQHHFVPQVAQ-UHFFFAOYSA-N 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-M naphthalen-1-olate Chemical compound C1=CC=C2C([O-])=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-M 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/67—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of saturated acids
- C07C69/708—Ethers
- C07C69/712—Ethers the hydroxy group of the ester being etherified with a hydroxy compound having the hydroxy group bound to a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2407187A DE2407187B2 (de) | 1974-02-15 | 1974-02-15 | Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern |
| NL7501551A NL7501551A (nl) | 1974-02-15 | 1975-02-10 | Werkwijze voor het bereiden van aromatische hydroxycarbonzuuralkylesters. |
| US05/549,173 US4052438A (en) | 1974-02-15 | 1975-02-12 | Process for preparing aromatic hydroxy-carboxylic acid alkyl esters |
| LU71834A LU71834A1 (https=) | 1974-02-15 | 1975-02-13 | |
| IT20252/75A IT1031725B (it) | 1974-02-15 | 1975-02-13 | Processo per la preparazione di esteri alchilici di acidi idrossi carbossilica aromatici |
| GB629875A GB1474651A (en) | 1974-02-15 | 1975-02-14 | Preparation of esters of aromatic carboxylic acids |
| JP50018099A JPS50116439A (https=) | 1974-02-15 | 1975-02-14 | |
| DK55475*#A DK55475A (https=) | 1974-02-15 | 1975-02-14 | |
| IE292/75A IE40606B1 (en) | 1974-02-15 | 1975-02-14 | Improvements in and relating to the preparation of esters of aromatic carboxylic acids |
| FR7504798A FR2261255B1 (https=) | 1974-02-15 | 1975-02-17 | |
| BE153437A BE825632A (fr) | 1974-02-15 | 1975-02-17 | Procede de preparation d'esters alkyliques d'acides hydroxycarboxyliques aromatiques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2407187A DE2407187B2 (de) | 1974-02-15 | 1974-02-15 | Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2407187A1 DE2407187A1 (de) | 1975-08-21 |
| DE2407187B2 true DE2407187B2 (de) | 1976-01-08 |
Family
ID=5907452
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2407187A Pending DE2407187B2 (de) | 1974-02-15 | 1974-02-15 | Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4052438A (https=) |
| JP (1) | JPS50116439A (https=) |
| BE (1) | BE825632A (https=) |
| DE (1) | DE2407187B2 (https=) |
| DK (1) | DK55475A (https=) |
| FR (1) | FR2261255B1 (https=) |
| GB (1) | GB1474651A (https=) |
| IE (1) | IE40606B1 (https=) |
| IT (1) | IT1031725B (https=) |
| LU (1) | LU71834A1 (https=) |
| NL (1) | NL7501551A (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3307637A1 (de) * | 1983-03-04 | 1984-09-06 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von reinen 1-hydroxy-2-naphtoesaeurealkylestern |
| DE3822043A1 (de) * | 1988-06-30 | 1990-01-11 | Hoechst Ag | Grenzflaechenaktive verbindungen auf basis von oxynaphthoesaeureestern, ihre herstellung und verwendung |
| EP1947125A1 (en) * | 2007-01-16 | 2008-07-23 | Cognis IP Management GmbH | Grafted Polymers |
-
1974
- 1974-02-15 DE DE2407187A patent/DE2407187B2/de active Pending
-
1975
- 1975-02-10 NL NL7501551A patent/NL7501551A/xx not_active Application Discontinuation
- 1975-02-12 US US05/549,173 patent/US4052438A/en not_active Expired - Lifetime
- 1975-02-13 IT IT20252/75A patent/IT1031725B/it active
- 1975-02-13 LU LU71834A patent/LU71834A1/xx unknown
- 1975-02-14 JP JP50018099A patent/JPS50116439A/ja active Pending
- 1975-02-14 DK DK55475*#A patent/DK55475A/da unknown
- 1975-02-14 IE IE292/75A patent/IE40606B1/xx unknown
- 1975-02-14 GB GB629875A patent/GB1474651A/en not_active Expired
- 1975-02-17 BE BE153437A patent/BE825632A/xx unknown
- 1975-02-17 FR FR7504798A patent/FR2261255B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2261255B1 (https=) | 1978-10-06 |
| FR2261255A1 (https=) | 1975-09-12 |
| DK55475A (https=) | 1975-10-06 |
| IE40606B1 (en) | 1979-07-04 |
| GB1474651A (en) | 1977-05-25 |
| JPS50116439A (https=) | 1975-09-11 |
| BE825632A (fr) | 1975-08-18 |
| US4052438A (en) | 1977-10-04 |
| IE40606L (en) | 1975-08-15 |
| LU71834A1 (https=) | 1977-01-05 |
| IT1031725B (it) | 1979-05-10 |
| DE2407187A1 (de) | 1975-08-21 |
| NL7501551A (nl) | 1975-08-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2449492A1 (de) | Verfahren zur herstellung von optisch aktivem p-hydroxyphenylglycin | |
| DE1445506B2 (de) | Verfahren zur gewinnung von reinem alpha-aminobenzylpenicillin | |
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| EP0176026B1 (de) | Verfahren zur Herstellung von 2,4-Dichlor-5-fluor-benzoesäure | |
| DE2407187B2 (de) | Verfahren zur Herstellung von aromatischen Hydroxycarbonsäurealkylestern | |
| EP0154223B1 (de) | Verfahren zur Herstellung von 6-Acetoxy-2-naphthoesäure und von reiner 6-Hydroxy-2-naphthoesäure | |
| DE2653601A1 (de) | Perfluoralkylgruppen enthaltende hydroxyketone | |
| DD200795A5 (de) | Verfahren zur herstellung von diphenylaether-derivaten | |
| DE1768114A1 (de) | Verfahren zur Herstellung von alpha-Ketoglutarsaeure | |
| AT326638B (de) | Verfahren zur herstellung von n(beta-diäthylaminoäthyl) -4-amino-5-chlor-2-methoxybenzamid | |
| DE2621431B2 (de) | Verfahren zur Herstellung von Phloroglucin | |
| DE3338547C2 (de) | Verfahren zur Herstellung von 2,2,4-Trimethyl-1,3-pentandioldiisobutyrat | |
| DE1793175C3 (de) | Verfahren zur Herstellung von 5-Benzyl-3-furancarbonsäure | |
| EP0155506B1 (de) | Verbessertes Verfahren zur Herstellung von Riboflavin | |
| CH447147A (de) | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen | |
| DE1618162B1 (de) | Verfahren zur Herstellung con Cyclohexan-1.2.3.4.5.6-hexan-carbonsäure | |
| DE1154095B (de) | Verfahren zur Herstellung von O, O-Dialkyldithiophosphorylessigsaeureestern | |
| DE2133897C3 (de) | Verfahren zur Herstellung von 4,4'-Dibrombenzil | |
| DE2165219C3 (de) | Verfahren zur Herstellung von Sorbinsäure | |
| DE960722C (de) | Verfahren zur Herstellung von Serinen aus Glykokoll und Aldehyden | |
| DE2134251A1 (de) | 4 Hydroxyphenyl glycin und Verfahren zu dessen Herstellung | |
| DE1072988B (https=) | ||
| CH633245A5 (de) | Verfahren zur herstellung von 2,3-dichlor-1-(c1-7)-alkoxybenzolen. | |
| DE2647255C2 (de) | Verfahren zur Herstellung von 4-Acylamido^^-dicarbalkoxy-butanalphenylhydrazon | |
| DE2023460C3 (de) | L- und DL-Tyrosine und Verfahren zu ihrer Herstellung |