DE2338257B2 - Verfahren zur Herstellung Nsubstituierter Lactame - Google Patents
Verfahren zur Herstellung Nsubstituierter LactameInfo
- Publication number
- DE2338257B2 DE2338257B2 DE2338257A DE2338257A DE2338257B2 DE 2338257 B2 DE2338257 B2 DE 2338257B2 DE 2338257 A DE2338257 A DE 2338257A DE 2338257 A DE2338257 A DE 2338257A DE 2338257 B2 DE2338257 B2 DE 2338257B2
- Authority
- DE
- Germany
- Prior art keywords
- caprolactam
- reaction
- mol
- lactam
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003951 lactams Chemical class 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims 3
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 62
- 238000009835 boiling Methods 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 239000000243 solution Substances 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 9
- 125000001931 aliphatic group Chemical group 0.000 claims description 8
- -1 alkali metal hydrates Chemical class 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 238000005804 alkylation reaction Methods 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims description 3
- 229940073608 benzyl chloride Drugs 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052740 iodine Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 4
- 239000000370 acceptor Substances 0.000 claims 2
- 230000015572 biosynthetic process Effects 0.000 claims 2
- VUQPJRPDRDVQMN-UHFFFAOYSA-N 1-chlorooctadecane Chemical compound CCCCCCCCCCCCCCCCCCCl VUQPJRPDRDVQMN-UHFFFAOYSA-N 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- 230000001627 detrimental effect Effects 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- 238000011005 laboratory method Methods 0.000 claims 1
- 159000000001 potassium salts Chemical class 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 66
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 238000006243 chemical reaction Methods 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 17
- 235000011121 sodium hydroxide Nutrition 0.000 description 16
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 10
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 239000000047 product Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 235000002639 sodium chloride Nutrition 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 229940050176 methyl chloride Drugs 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- WSULSMOGMLRGKU-UHFFFAOYSA-N 1-bromooctadecane Chemical compound CCCCCCCCCCCCCCCCCCBr WSULSMOGMLRGKU-UHFFFAOYSA-N 0.000 description 2
- XXCJJEHAVIKWSF-UHFFFAOYSA-N 1-octadecylazepan-2-one Chemical compound CCCCCCCCCCCCCCCCCCN1CCCCCC1=O XXCJJEHAVIKWSF-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- XXRBJMPVYKNDPG-UHFFFAOYSA-N 1-(3-bromopropyl)-4-methylbenzene Chemical compound CC1=CC=C(CCCBr)C=C1 XXRBJMPVYKNDPG-UHFFFAOYSA-N 0.000 description 1
- LVUQCTGSDJLWCE-UHFFFAOYSA-N 1-benzylpyrrolidin-2-one Chemical compound O=C1CCCN1CC1=CC=CC=C1 LVUQCTGSDJLWCE-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- SKIDNYUZJPMKFC-UHFFFAOYSA-N 1-iododecane Chemical compound CCCCCCCCCCI SKIDNYUZJPMKFC-UHFFFAOYSA-N 0.000 description 1
- SDPNMKBPWRAPHY-UHFFFAOYSA-N 1-prop-2-enylazepan-2-one Chemical compound C=CCN1CCCCCC1=O SDPNMKBPWRAPHY-UHFFFAOYSA-N 0.000 description 1
- BWISIXSYQURMMY-UHFFFAOYSA-N 1-propylazepan-2-one Chemical compound CCCN1CCCCCC1=O BWISIXSYQURMMY-UHFFFAOYSA-N 0.000 description 1
- XSNOLDSFHANOGA-UHFFFAOYSA-N 3,3,4-trimethylazepan-2-one Chemical compound CC1CCCNC(=O)C1(C)C XSNOLDSFHANOGA-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- YDLSUFFXJYEVHW-UHFFFAOYSA-N azonan-2-one Chemical compound O=C1CCCCCCCN1 YDLSUFFXJYEVHW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MHWWXNJJLIETEQ-UHFFFAOYSA-N n-(2,2,3-trimethylcyclohexylidene)hydroxylamine Chemical compound CC1CCCC(=NO)C1(C)C MHWWXNJJLIETEQ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000010603 pastilles Nutrition 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D227/00—Heterocyclic compounds containing rings having one nitrogen atom as the only ring hetero atom, according to more than one of groups C07D203/00 - C07D225/00
- C07D227/02—Heterocyclic compounds containing rings having one nitrogen atom as the only ring hetero atom, according to more than one of groups C07D203/00 - C07D225/00 with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D227/06—Heterocyclic compounds containing rings having one nitrogen atom as the only ring hetero atom, according to more than one of groups C07D203/00 - C07D225/00 with only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D227/08—Oxygen atoms
- C07D227/087—One doubly-bound oxygen atom in position 2, e.g. lactams
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1132772A CH573404A5 (enExample) | 1972-07-28 | 1972-07-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2338257A1 DE2338257A1 (de) | 1974-02-14 |
| DE2338257B2 true DE2338257B2 (de) | 1975-04-30 |
Family
ID=4372424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2338257A Pending DE2338257B2 (de) | 1972-07-28 | 1973-07-27 | Verfahren zur Herstellung Nsubstituierter Lactame |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3865814A (enExample) |
| JP (1) | JPS4943968A (enExample) |
| BE (1) | BE802829A (enExample) |
| CH (1) | CH573404A5 (enExample) |
| DE (1) | DE2338257B2 (enExample) |
| FR (1) | FR2194703B1 (enExample) |
| GB (1) | GB1430178A (enExample) |
| NL (1) | NL7310404A (enExample) |
| ZA (1) | ZA735119B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4182715A (en) * | 1973-02-28 | 1980-01-08 | Mobil Oil Corporation | Amine derivatives of substituted gamma-butyrolactones |
| CH602636A5 (enExample) * | 1974-03-04 | 1978-07-31 | Ile De France | |
| US4125523A (en) * | 1975-06-11 | 1978-11-14 | Chevron Research Company | Catalyst for polymerization of 2-pyrrolidone |
| BE843140A (fr) * | 1975-06-19 | 1976-10-18 | Aazacycloalcan-2-ones 1-substituees et compositions pharmaceutiques contenant ces composes a titre d'excipients | |
| FR2314731A1 (fr) * | 1975-06-19 | 1977-01-14 | Nelson Res & Dev | Azacycloalcan-2-ones 1-substituees et compositions pharmaceutiques contenant ces composes a titre d'excipients |
| US4145519A (en) * | 1975-08-25 | 1979-03-20 | Chevron Research Company | Catalyst for the polymerization of 2-pyrrolidone from alkali metal |
| JPS5528549A (en) * | 1978-08-19 | 1980-02-29 | Sony Corp | Servo circuit |
| JPS5528550A (en) * | 1978-08-19 | 1980-02-29 | Sony Corp | Servo circuit |
| JPS58136992U (ja) * | 1982-03-11 | 1983-09-14 | ソニー株式会社 | モータの位相サーボ回路 |
| US4608201A (en) * | 1984-05-21 | 1986-08-26 | Ppg Industries, Inc. | Process for preparing lactam imides |
| DE3536028A1 (de) * | 1985-10-09 | 1987-04-09 | Hoechst Ag | Verfahren zur herstellung von 1-substituierten azacycloalkan-2-onen |
| US5256647A (en) * | 1986-01-31 | 1993-10-26 | Whitby Research, Inc. | Compositions comprising 1-substituted azacycloalkanes |
| DE3783683T2 (de) * | 1986-01-31 | 1993-05-19 | Whitby Research Inc | Hautpenetration verbessernde zusammensetzungen. |
| US4992422A (en) * | 1986-01-31 | 1991-02-12 | Whitby Research, Inc. | Compositions comprising 1-substituted azacycloalkanes |
| US5204339A (en) * | 1986-01-31 | 1993-04-20 | Whitby Research, Inc. | Penetration enhancers for transdermal delivery of systemic agents |
| JPS63502508A (ja) * | 1986-01-31 | 1988-09-22 | ホイットビ−・リサ−チ・インコ−ポレ−テッド | 1−置換アザシクロアルカンより成る組成物とその用途 |
| US5142044A (en) * | 1986-04-23 | 1992-08-25 | Whitby Research, Inc. | Penetration enhancers for transdermal delivery of systemic agents |
| CA1319613C (en) * | 1986-10-07 | 1993-06-29 | Gevork Minaskanian | Penetration enhancers for transdermal delivery of systemic agents |
| US4920101A (en) * | 1987-09-30 | 1990-04-24 | Nelson Research & Development Co. | Compositions comprising 1-oxo- or thiohydrocarbyl substituted azacycloaklkanes |
| US4879275A (en) * | 1987-09-30 | 1989-11-07 | Nelson Research & Development Co. | Penetration enhancers for transdermal delivery of systemic agent |
| WO1993017787A1 (en) * | 1992-03-06 | 1993-09-16 | Isp Investments Inc. | Catalyst and method for production of alkyl pyrrolidones |
| US5510477A (en) * | 1994-03-01 | 1996-04-23 | The Procter & Gamble Company | Process for the acylation of lactams |
| DE4423603C2 (de) * | 1994-07-06 | 2002-01-17 | Degussa | Verfahren zur Herstellung von N-Alkyl-Lactamen |
| GB9422153D0 (en) * | 1994-11-03 | 1994-12-21 | Procter & Gamble | Process for the production of acyl lactams |
| FR2751963B1 (fr) * | 1996-07-31 | 1998-09-04 | Poudres & Explosifs Ste Nale | Procede de preparation de lactames n-substitues |
| EP3510070B1 (en) | 2017-06-26 | 2022-08-24 | AdvanSix Resins & Chemicals LLC | Methods and compositions for polyurethane dispersions using caprolactam-derived solvents |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3661894A (en) * | 1970-06-29 | 1972-05-09 | Leuna Werke Veb | Method of producing n-alkyl lactams |
-
1972
- 1972-07-28 CH CH1132772A patent/CH573404A5/xx not_active IP Right Cessation
-
1973
- 1973-07-25 US US382461A patent/US3865814A/en not_active Expired - Lifetime
- 1973-07-26 BE BE133898A patent/BE802829A/xx unknown
- 1973-07-26 FR FR7327498A patent/FR2194703B1/fr not_active Expired
- 1973-07-26 NL NL7310404A patent/NL7310404A/xx unknown
- 1973-07-26 ZA ZA735119A patent/ZA735119B/xx unknown
- 1973-07-27 JP JP48084819A patent/JPS4943968A/ja active Pending
- 1973-07-27 GB GB3579273A patent/GB1430178A/en not_active Expired
- 1973-07-27 DE DE2338257A patent/DE2338257B2/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2194703A1 (enExample) | 1974-03-01 |
| GB1430178A (en) | 1976-03-31 |
| DE2338257A1 (de) | 1974-02-14 |
| NL7310404A (enExample) | 1974-01-30 |
| FR2194703B1 (enExample) | 1976-11-12 |
| ZA735119B (en) | 1974-07-31 |
| US3865814A (en) | 1975-02-11 |
| BE802829A (fr) | 1973-11-16 |
| CH573404A5 (enExample) | 1976-03-15 |
| JPS4943968A (enExample) | 1974-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2338257B2 (de) | Verfahren zur Herstellung Nsubstituierter Lactame | |
| DE1795808B1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| DE2550934B2 (de) | Reinigung von Caprolactam | |
| CH645623A5 (en) | 2-Methyl-3-acetoxy-4,5-bis(halomethyl)pyridines, process for their preparation and process for the preparation of pyridoxin | |
| DE2703640C2 (enExample) | ||
| DE2624360A1 (de) | Verfahren zur herstellung von gegebenenfalls substituiertem 3-phenoxybenzaldehyd | |
| DE2642608C2 (de) | Verfahren zur Herstellung eines 4-Hydroxymethyl-2-pyrrolidinons | |
| DE4408083C1 (de) | Verfahren zur Herstellung von 4-Fluoralkoxyzimtsäurenitrilen | |
| EP0378089B1 (de) | Verfahren zur Herstellung von 2-Amino-4-fluorpyrimidinderivaten | |
| DE10222330A1 (de) | Verfahren zur katalysatorfreien Herstellung von Alkoxybenzonitrilen | |
| DE2446256B2 (de) | Verfahren zur herstellung von hexahydrothieno eckige klammer auf 3,4- d eckige klammer zu -imidazol-2,4-dionen | |
| DE3936399A1 (de) | Verfahren zur herstellung von 1,4-bis-(4-hydroxybenzoyl)-benzol | |
| DE3120361A1 (de) | Verfahren zur herstellung von n-benzyl-n-isopropylpivaloylamid | |
| DE3429903C2 (enExample) | ||
| DE2458191C3 (de) | Verfahren zur Herstellung von s-Trialkoxybenzolen | |
| EP0049688B1 (de) | Verfahren zur Herstellung von N-Cyanlactamen | |
| DE2166997B2 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| DE3827117A1 (de) | Verfahren zur herstellung von chinuclidin-3-methanol | |
| DE2139084B2 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| DE2536689C3 (de) | Verfahren zur Herstellung von Melamin aus Cyanamid und/oder Dicyandiamid | |
| DE3137377A1 (de) | Verfahren zur herstellung von l-prolin | |
| DE2931887A1 (de) | Verfahren zur herstellung von 2-alkyl- oder cycloalkyl-4-methyl-6-hydroxypyrimidinen | |
| DE1294970B (de) | Verfahren zur Herstellung von substituierten 6, 11-Dihydrodibenzo[b, e]-oxepin- bzw.-thiepin-11-onen | |
| DE2839084A1 (de) | Verfahren zur herstellung von tri-(allylisocyanurat) |