DE2331974A1 - Arylsubstituierte diketone und ketoester, verfahren zu deren herstellung und neue zwischenprodukte - Google Patents
Arylsubstituierte diketone und ketoester, verfahren zu deren herstellung und neue zwischenprodukteInfo
- Publication number
- DE2331974A1 DE2331974A1 DE2331974A DE2331974A DE2331974A1 DE 2331974 A1 DE2331974 A1 DE 2331974A1 DE 2331974 A DE2331974 A DE 2331974A DE 2331974 A DE2331974 A DE 2331974A DE 2331974 A1 DE2331974 A1 DE 2331974A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- group
- groups
- carbon atoms
- heptanedione
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 41
- 238000004519 manufacturing process Methods 0.000 title description 37
- 239000013067 intermediate product Substances 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 313
- -1 3,4-methylenedioxy group Chemical group 0.000 claims description 153
- 238000002360 preparation method Methods 0.000 claims description 92
- 229910052727 yttrium Inorganic materials 0.000 claims description 38
- 101150065749 Churc1 gene Proteins 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 37
- 102100038239 Protein Churchill Human genes 0.000 claims description 36
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 33
- DGCTVLNZTFDPDJ-UHFFFAOYSA-N heptane-3,5-dione Chemical compound CCC(=O)CC(=O)CC DGCTVLNZTFDPDJ-UHFFFAOYSA-N 0.000 claims description 27
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 9
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 9
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 239000012320 chlorinating reagent Substances 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- OVYZGHPMXYUIAX-UHFFFAOYSA-N 4-[6-(4-methoxyphenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(OC)C=C1 OVYZGHPMXYUIAX-UHFFFAOYSA-N 0.000 claims description 3
- 150000001351 alkyl iodides Chemical class 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 87
- 239000003921 oil Substances 0.000 description 84
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 79
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 56
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 52
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 42
- 238000009835 boiling Methods 0.000 description 38
- 238000004458 analytical method Methods 0.000 description 36
- 229910002091 carbon monoxide Inorganic materials 0.000 description 34
- 241000709661 Enterovirus Species 0.000 description 33
- 241000283073 Equus caballus Species 0.000 description 33
- 239000000203 mixture Substances 0.000 description 33
- 238000000338 in vitro Methods 0.000 description 32
- 229910003002 lithium salt Inorganic materials 0.000 description 32
- 159000000002 lithium salts Chemical class 0.000 description 32
- 239000000243 solution Substances 0.000 description 32
- 238000002329 infrared spectrum Methods 0.000 description 31
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 29
- 229910052720 vanadium Inorganic materials 0.000 description 28
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 241000238631 Hexapoda Species 0.000 description 25
- 239000000047 product Substances 0.000 description 24
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 241000700605 Viruses Species 0.000 description 20
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 230000000361 pesticidal effect Effects 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 14
- 230000002401 inhibitory effect Effects 0.000 description 14
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 14
- 235000009518 sodium iodide Nutrition 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 14
- 241000254173 Coleoptera Species 0.000 description 13
- 241000254109 Tenebrio molitor Species 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 241000254105 Tenebrio Species 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 229940102001 zinc bromide Drugs 0.000 description 12
- 239000012280 lithium aluminium hydride Substances 0.000 description 11
- 208000002606 Paramyxoviridae Infections Diseases 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- HVCFCNAITDHQFX-UHFFFAOYSA-N 1-cyclopropylethanone Chemical compound CC(=O)C1CC1 HVCFCNAITDHQFX-UHFFFAOYSA-N 0.000 description 6
- TWFKEGONKTUVSX-UHFFFAOYSA-N 1-cyclopropylprop-2-en-1-one Chemical compound C=CC(=O)C1CC1 TWFKEGONKTUVSX-UHFFFAOYSA-N 0.000 description 6
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 6
- UUVJVMPOLJUADJ-UHFFFAOYSA-N 5-(4-ethyl-6-iodohex-3-enyl)-1,3-benzodioxole Chemical compound ICCC(CC)=CCCC1=CC=C2OCOC2=C1 UUVJVMPOLJUADJ-UHFFFAOYSA-N 0.000 description 6
- 241000430519 Human rhinovirus sp. Species 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- BQCWKDYUVAGNSI-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(CC)=CCCC1=CC=C2OCOC2=C1 BQCWKDYUVAGNSI-UHFFFAOYSA-N 0.000 description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 5
- 241000722249 Rhodnius prolixus Species 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 125000005594 diketone group Chemical class 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 5
- 230000000241 respiratory effect Effects 0.000 description 5
- SIHRAUXVWUQLMQ-UHFFFAOYSA-N 1-(6-iodohexyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCCCCI)C=C1 SIHRAUXVWUQLMQ-UHFFFAOYSA-N 0.000 description 4
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 4
- FXPMDQKCBRJXGI-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C2OCOC2=C1 FXPMDQKCBRJXGI-UHFFFAOYSA-N 0.000 description 4
- QWSWWDHIOWZVQB-UHFFFAOYSA-N 4-[6-(4-chlorophenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(Cl)C=C1 QWSWWDHIOWZVQB-UHFFFAOYSA-N 0.000 description 4
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 241000256118 Aedes aegypti Species 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241000819999 Nymphes Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229940081310 piperonal Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 3
- OWTPSTAVYYYLIF-UHFFFAOYSA-N 1-(7-iodoheptyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCCCCCI)C=C1 OWTPSTAVYYYLIF-UHFFFAOYSA-N 0.000 description 3
- DRKHCTFBGBIOLU-UHFFFAOYSA-N 1-(8-iodooct-3-enyl)-4-phenylmethoxybenzene Chemical compound C1=CC(CCC=CCCCCI)=CC=C1OCC1=CC=CC=C1 DRKHCTFBGBIOLU-UHFFFAOYSA-N 0.000 description 3
- JXDSRZQLYWVUDX-UHFFFAOYSA-N 1-(8-iodoocta-1,5-dienyl)-4-methoxybenzene Chemical compound COC1=CC=C(C=CCCC=CCCI)C=C1 JXDSRZQLYWVUDX-UHFFFAOYSA-N 0.000 description 3
- RVXRJXATYIPGTC-UHFFFAOYSA-N 1-cyclopropyl-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one Chemical compound C1=CC(OC(F)(F)F)=CC=C1C=CC(=O)C1CC1 RVXRJXATYIPGTC-UHFFFAOYSA-N 0.000 description 3
- ZVTCOQDWIJYYSQ-UHFFFAOYSA-N 1-cyclopropylpropan-1-ol Chemical compound CCC(O)C1CC1 ZVTCOQDWIJYYSQ-UHFFFAOYSA-N 0.000 description 3
- VOTZGGMARADEOO-UHFFFAOYSA-N 4-(6-phenylhexyl)heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=CC=C1 VOTZGGMARADEOO-UHFFFAOYSA-N 0.000 description 3
- YWCVPYFBLWJMTJ-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhex-3-enyl]-4-methylheptane-3,5-dione Chemical compound CCC(=O)C(C)(C(=O)CC)CCC(CC)=CCCC1=CC=C2OCOC2=C1 YWCVPYFBLWJMTJ-UHFFFAOYSA-N 0.000 description 3
- JDWWRGPFQISFBE-UHFFFAOYSA-N 4-[6-(2,4-dichlorophenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(Cl)C=C1Cl JDWWRGPFQISFBE-UHFFFAOYSA-N 0.000 description 3
- CMJZKJQOZBQJCT-UHFFFAOYSA-N 4-[6-(4-hydroxyphenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(O)C=C1 CMJZKJQOZBQJCT-UHFFFAOYSA-N 0.000 description 3
- DOMHUCZNVKDQJA-UHFFFAOYSA-N 4-[6-[4-(trifluoromethoxy)phenyl]hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(OC(F)(F)F)C=C1 DOMHUCZNVKDQJA-UHFFFAOYSA-N 0.000 description 3
- GVBXKCXSNFGAOG-UHFFFAOYSA-N 8-(4-phenylmethoxyphenyl)oct-5-en-1-ol Chemical compound C1=CC(CCC=CCCCCO)=CC=C1OCC1=CC=CC=C1 GVBXKCXSNFGAOG-UHFFFAOYSA-N 0.000 description 3
- FVCXCONIDRHGGU-UHFFFAOYSA-N 8-(4-phenylmethoxyphenyl)oct-5-enoic acid Chemical compound C1=CC(CCC=CCCCC(=O)O)=CC=C1OCC1=CC=CC=C1 FVCXCONIDRHGGU-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001649 bromium compounds Chemical class 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NGCRXXLKJAAUQQ-UHFFFAOYSA-N undec-5-ene Chemical compound CCCCCC=CCCCC NGCRXXLKJAAUQQ-UHFFFAOYSA-N 0.000 description 3
- XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 2
- VXBYIERHAQOMIY-UHFFFAOYSA-N 1-(1-ethylcyclopropyl)ethanone Chemical compound CCC1(C(C)=O)CC1 VXBYIERHAQOMIY-UHFFFAOYSA-N 0.000 description 2
- CLIAEOGUFVMPDX-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCC=CCCBr)C=C1 CLIAEOGUFVMPDX-UHFFFAOYSA-N 0.000 description 2
- JYHZDLYUHIVFIG-UHFFFAOYSA-N 1-(6-bromohexyl)-2,4-dichlorobenzene Chemical compound ClC1=CC=C(CCCCCCBr)C(Cl)=C1 JYHZDLYUHIVFIG-UHFFFAOYSA-N 0.000 description 2
- PRKULQWCQBNEDW-UHFFFAOYSA-N 1-(6-bromohexyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCCCCCBr)C=C1 PRKULQWCQBNEDW-UHFFFAOYSA-N 0.000 description 2
- XBEHMMCJQKYZKV-UHFFFAOYSA-N 1-(6-iodohex-3-enyl)-4-phenylmethoxybenzene Chemical compound C1=CC(CCC=CCCI)=CC=C1OCC1=CC=CC=C1 XBEHMMCJQKYZKV-UHFFFAOYSA-N 0.000 description 2
- KMHFBVBSLJGRSY-UHFFFAOYSA-N 1-(6-iodohexyl)-4-methylbenzene Chemical compound CC1=CC=C(CCCCCCI)C=C1 KMHFBVBSLJGRSY-UHFFFAOYSA-N 0.000 description 2
- FXENHUKTFZJOKP-UHFFFAOYSA-N 1-bromo-4-(6-iodohexyl)benzene Chemical compound BrC1=CC=C(CCCCCCI)C=C1 FXENHUKTFZJOKP-UHFFFAOYSA-N 0.000 description 2
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 2
- FIIVZQLNVYLNMG-UHFFFAOYSA-N 1-cyclopropyl-3-(2,4-dichlorophenyl)prop-2-en-1-one Chemical compound ClC1=CC(Cl)=CC=C1C=CC(=O)C1CC1 FIIVZQLNVYLNMG-UHFFFAOYSA-N 0.000 description 2
- WFTSFPGSOOQOAI-UHFFFAOYSA-N 1-cyclopropyl-3-(2,4-dichlorophenyl)propan-1-ol Chemical compound C1CC1C(O)CCC1=CC=C(Cl)C=C1Cl WFTSFPGSOOQOAI-UHFFFAOYSA-N 0.000 description 2
- KPVCIVVGAJBEKS-UHFFFAOYSA-N 1-cyclopropyl-3-(4-fluorophenyl)propan-1-ol Chemical compound C1CC1C(O)CCC1=CC=C(F)C=C1 KPVCIVVGAJBEKS-UHFFFAOYSA-N 0.000 description 2
- PZFHOONKTKGCSA-UHFFFAOYSA-N 1-cyclopropyl-3-(4-hydroxyphenyl)prop-2-en-1-one Chemical compound C1=CC(O)=CC=C1C=CC(=O)C1CC1 PZFHOONKTKGCSA-UHFFFAOYSA-N 0.000 description 2
- OIPDQFASJNLEME-UHFFFAOYSA-N 1-cyclopropyl-3-phenylprop-2-en-1-one Chemical compound C1CC1C(=O)C=CC1=CC=CC=C1 OIPDQFASJNLEME-UHFFFAOYSA-N 0.000 description 2
- HNQSOXPGQVVBTN-UHFFFAOYSA-N 1-cyclopropyl-3-phenylpropan-1-ol Chemical compound C1CC1C(O)CCC1=CC=CC=C1 HNQSOXPGQVVBTN-UHFFFAOYSA-N 0.000 description 2
- JWADFSVPEFCBKC-UHFFFAOYSA-N 1-methoxy-4-(7-phenylsulfanylheptyl)benzene Chemical compound C1=CC(OC)=CC=C1CCCCCCCSC1=CC=CC=C1 JWADFSVPEFCBKC-UHFFFAOYSA-N 0.000 description 2
- XGBVRFJXGNDDTN-UHFFFAOYSA-N 2,4-dichloro-1-(6-iodohexyl)benzene Chemical compound ClC1=CC=C(CCCCCCI)C(Cl)=C1 XGBVRFJXGNDDTN-UHFFFAOYSA-N 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- FDNRHVNGVKQRAG-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-(1-propan-2-ylcyclopropyl)propan-1-ol Chemical compound C=1C=C2OCOC2=CC=1CCC(O)C1(C(C)C)CC1 FDNRHVNGVKQRAG-UHFFFAOYSA-N 0.000 description 2
- RGHGLMKPDWTEKD-UHFFFAOYSA-N 4-(6-naphthalen-1-ylhexyl)heptane-3,5-dione Chemical compound C1=CC=C2C(CCCCCCC(C(=O)CC)C(=O)CC)=CC=CC2=C1 RGHGLMKPDWTEKD-UHFFFAOYSA-N 0.000 description 2
- KKLLACSLOOGXLG-UHFFFAOYSA-N 4-[3-(1-ethylcyclopropyl)-3-hydroxyprop-1-enyl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C=CC(O)C1(CC)CC1 KKLLACSLOOGXLG-UHFFFAOYSA-N 0.000 description 2
- DBPCPDUWQPMDLE-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhex-3-enyl]-4-chloroheptane-3,5-dione Chemical compound CCC(=O)C(Cl)(C(=O)CC)CCC(CC)=CCCC1=CC=C2OCOC2=C1 DBPCPDUWQPMDLE-UHFFFAOYSA-N 0.000 description 2
- WWPHAJMTNMYHTP-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C2OCOC2=C1 WWPHAJMTNMYHTP-UHFFFAOYSA-N 0.000 description 2
- FVYKAELGRBCZNZ-UHFFFAOYSA-N 4-[6-(3,4-dimethoxyphenyl)-3-ethylhex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(CC)=CCCC1=CC=C(OC)C(OC)=C1 FVYKAELGRBCZNZ-UHFFFAOYSA-N 0.000 description 2
- OIBBCSGLWFACPI-UHFFFAOYSA-N 4-[6-(4-fluorophenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(F)C=C1 OIBBCSGLWFACPI-UHFFFAOYSA-N 0.000 description 2
- BABIPRLGWLHTQX-UHFFFAOYSA-N 4-[6-(4-methoxyphenyl)hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(OC)C=C1 BABIPRLGWLHTQX-UHFFFAOYSA-N 0.000 description 2
- QCZLLHFJQDOKMP-UHFFFAOYSA-N 4-[6-(4-methylphenyl)hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(C)C=C1 QCZLLHFJQDOKMP-UHFFFAOYSA-N 0.000 description 2
- GWRSPLHEWMVETE-UHFFFAOYSA-N 4-[6-(4-phenylmethoxyphenyl)hex-3-enyl]heptane-3,5-dione Chemical compound C1=CC(CCC=CCCC(C(=O)CC)C(=O)CC)=CC=C1OCC1=CC=CC=C1 GWRSPLHEWMVETE-UHFFFAOYSA-N 0.000 description 2
- DCQPZNSCNHXGIH-UHFFFAOYSA-N 4-[6-[4-(dimethylamino)phenyl]hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(N(C)C)C=C1 DCQPZNSCNHXGIH-UHFFFAOYSA-N 0.000 description 2
- XXNBOSLAQNKODZ-UHFFFAOYSA-N 4-[6-[4-(trifluoromethoxy)phenyl]hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(OC(F)(F)F)C=C1 XXNBOSLAQNKODZ-UHFFFAOYSA-N 0.000 description 2
- ILBGKNIEKHTCDP-UHFFFAOYSA-N 4-[8-(4-methoxyphenyl)octa-3,7-dienyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC=CC1=CC=C(OC)C=C1 ILBGKNIEKHTCDP-UHFFFAOYSA-N 0.000 description 2
- BEXZDDUUQBWCSV-UHFFFAOYSA-N 4-[8-(4-methoxyphenyl)octyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCCCC1=CC=C(OC)C=C1 BEXZDDUUQBWCSV-UHFFFAOYSA-N 0.000 description 2
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 2
- LRGMBWMNWJFBEB-UHFFFAOYSA-N 5-(4-methylhexa-3,5-dienyl)-1,3-benzodioxole Chemical compound C=CC(C)=CCCC1=CC=C2OCOC2=C1 LRGMBWMNWJFBEB-UHFFFAOYSA-N 0.000 description 2
- WDWDITZIWOKNSW-UHFFFAOYSA-N 6-iodohexylbenzene Chemical compound ICCCCCCC1=CC=CC=C1 WDWDITZIWOKNSW-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IJBYNARRPXSCRU-UHFFFAOYSA-N 8-(4-phenylmethoxyphenyl)oct-5-enyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCCCC=CCCC(C=C1)=CC=C1OCC1=CC=CC=C1 IJBYNARRPXSCRU-UHFFFAOYSA-N 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- FIWILGQIZHDAQG-UHFFFAOYSA-N NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F Chemical compound NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F FIWILGQIZHDAQG-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- AXOYJYKYJWBBJT-UHFFFAOYSA-N [4-(3-cyclopropyl-3-oxoprop-1-enyl)phenyl] benzoate Chemical compound C1CC1C(=O)C=CC(C=C1)=CC=C1OC(=O)C1=CC=CC=C1 AXOYJYKYJWBBJT-UHFFFAOYSA-N 0.000 description 2
- MULNXUJKIXDTHS-UHFFFAOYSA-N [4-(8-oxo-7-propanoyldec-3-enyl)phenyl] benzoate Chemical compound C1=CC(CCC=CCCC(C(=O)CC)C(=O)CC)=CC=C1OC(=O)C1=CC=CC=C1 MULNXUJKIXDTHS-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 2
- 230000000840 anti-viral effect Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000011905 homologation Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- DBYQHFPBWKKZAT-UHFFFAOYSA-N lithium;benzene Chemical compound [Li+].C1=CC=[C-]C=C1 DBYQHFPBWKKZAT-UHFFFAOYSA-N 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical class [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 229910001509 metal bromide Inorganic materials 0.000 description 2
- XFLXZQGRFWSYRN-UHFFFAOYSA-N methyl 4-(4-ethyl-8-oxo-7-propanoyldec-3-enyl)benzoate Chemical compound CCC(=O)C(C(=O)CC)CCC(CC)=CCCC1=CC=C(C(=O)OC)C=C1 XFLXZQGRFWSYRN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- SNZXFRFQGXSSGN-UHFFFAOYSA-N phenylsulfanyloxysulfanylbenzene Chemical compound C=1C=CC=CC=1SOSC1=CC=CC=C1 SNZXFRFQGXSSGN-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 description 2
- WJUFSDZVCOTFON-UHFFFAOYSA-N veratraldehyde Chemical compound COC1=CC=C(C=O)C=C1OC WJUFSDZVCOTFON-UHFFFAOYSA-N 0.000 description 2
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical group O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 1
- WAQICVBNUBLYFH-UHFFFAOYSA-N 1,2-dichloro-4-(6-iodohexyl)benzene Chemical compound ClC1=CC=C(CCCCCCI)C=C1Cl WAQICVBNUBLYFH-UHFFFAOYSA-N 0.000 description 1
- ZXEKOXIBRBVCKD-UHFFFAOYSA-N 1,3-bis(1-ethylcyclopropyl)propan-2-one Chemical compound C1CC1(CC)CC(=O)CC1(CC)CC1 ZXEKOXIBRBVCKD-UHFFFAOYSA-N 0.000 description 1
- XWLRKHQULLNIMG-UHFFFAOYSA-N 1-(1-butylcyclopropyl)ethanone Chemical compound CCCCC1(C(C)=O)CC1 XWLRKHQULLNIMG-UHFFFAOYSA-N 0.000 description 1
- OQBCJXUAQQMTRW-UHFFFAOYSA-N 1-(1-methylcyclopropyl)ethanone Chemical compound CC(=O)C1(C)CC1 OQBCJXUAQQMTRW-UHFFFAOYSA-N 0.000 description 1
- KVMBMUGSLSHYOA-UHFFFAOYSA-N 1-(1-propan-2-ylcyclopropyl)ethanone Chemical compound CC(C)C1(C(C)=O)CC1 KVMBMUGSLSHYOA-UHFFFAOYSA-N 0.000 description 1
- JROKSIRBDPADLL-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)-2,4-dichlorobenzene Chemical compound ClC1=CC=C(CCC=CCCBr)C(Cl)=C1 JROKSIRBDPADLL-UHFFFAOYSA-N 0.000 description 1
- RJXKHSZNRPNQRF-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCC=CCCBr)C=C1 RJXKHSZNRPNQRF-UHFFFAOYSA-N 0.000 description 1
- URHGGOLFXFWKNE-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCC=CCCBr)C=C1 URHGGOLFXFWKNE-UHFFFAOYSA-N 0.000 description 1
- BGFJGBVNLYOGRA-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)-4-phenylmethoxybenzene Chemical compound C1=CC(CCC=CCCBr)=CC=C1OCC1=CC=CC=C1 BGFJGBVNLYOGRA-UHFFFAOYSA-N 0.000 description 1
- KFYBVTHSTKECMD-UHFFFAOYSA-N 1-(6-bromohex-3-enyl)naphthalene Chemical compound C1=CC=C2C(CCC=CCCBr)=CC=CC2=C1 KFYBVTHSTKECMD-UHFFFAOYSA-N 0.000 description 1
- SZLSURAFBFYFHS-UHFFFAOYSA-N 1-(6-bromohexyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCCCCCBr)C=C1 SZLSURAFBFYFHS-UHFFFAOYSA-N 0.000 description 1
- NBIYJFNFEDUTOK-UHFFFAOYSA-N 1-(6-bromohexyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCCCCCBr)C=C1 NBIYJFNFEDUTOK-UHFFFAOYSA-N 0.000 description 1
- WVSYQCITZUEVAS-UHFFFAOYSA-N 1-(6-bromohexyl)-4-chlorobenzene Chemical compound ClC1=CC=C(CCCCCCBr)C=C1 WVSYQCITZUEVAS-UHFFFAOYSA-N 0.000 description 1
- KPHMFAVMIDDTKL-UHFFFAOYSA-N 1-(6-bromohexyl)-4-methylbenzene Chemical compound CC1=CC=C(CCCCCCBr)C=C1 KPHMFAVMIDDTKL-UHFFFAOYSA-N 0.000 description 1
- XKMVNYOTGFFKLH-UHFFFAOYSA-N 1-(6-iodohex-3-enyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CCC=CCCI)C=C1 XKMVNYOTGFFKLH-UHFFFAOYSA-N 0.000 description 1
- JQMCWZYOJIPBDN-UHFFFAOYSA-N 1-(6-iodohex-3-enyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCC=CCCI)C=C1 JQMCWZYOJIPBDN-UHFFFAOYSA-N 0.000 description 1
- OQVIYEYVCZNGIP-UHFFFAOYSA-N 1-(6-iodohex-3-enyl)-4-methylbenzene Chemical compound CC1=CC=C(CCC=CCCI)C=C1 OQVIYEYVCZNGIP-UHFFFAOYSA-N 0.000 description 1
- WSFKXKYTJWHICR-UHFFFAOYSA-N 1-(6-iodohexyl)-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CCCCCCI)C=C1 WSFKXKYTJWHICR-UHFFFAOYSA-N 0.000 description 1
- LLGHNBHABGJJQR-UHFFFAOYSA-N 1-(6-iodohexyl)naphthalene Chemical compound C1=CC=C2C(CCCCCCI)=CC=CC2=C1 LLGHNBHABGJJQR-UHFFFAOYSA-N 0.000 description 1
- NISSUFYFNTXPGR-UHFFFAOYSA-N 1-bromo-4-(6-bromohex-3-enyl)benzene Chemical compound BrCCC=CCCC1=CC=C(Br)C=C1 NISSUFYFNTXPGR-UHFFFAOYSA-N 0.000 description 1
- GBLYKAYFSRNIBE-UHFFFAOYSA-N 1-bromo-4-(6-bromohexyl)benzene Chemical compound BrCCCCCCC1=CC=C(Br)C=C1 GBLYKAYFSRNIBE-UHFFFAOYSA-N 0.000 description 1
- FBUZNPORDKVYFD-UHFFFAOYSA-N 1-bromohex-1-ene Chemical compound CCCCC=CBr FBUZNPORDKVYFD-UHFFFAOYSA-N 0.000 description 1
- SLSFTFOVJUNXPZ-UHFFFAOYSA-N 1-chloro-4-(6-iodohexyl)benzene Chemical compound ClC1=CC=C(CCCCCCI)C=C1 SLSFTFOVJUNXPZ-UHFFFAOYSA-N 0.000 description 1
- WKZOGNHWJCYZQX-UHFFFAOYSA-N 1-cyclopropyl-3-(3,4-dichlorophenyl)prop-2-en-1-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C=CC(=O)C1CC1 WKZOGNHWJCYZQX-UHFFFAOYSA-N 0.000 description 1
- QZFHUZLFIAUIFY-UHFFFAOYSA-N 1-cyclopropyl-3-(3,4-dichlorophenyl)propan-1-ol Chemical compound C1CC1C(O)CCC1=CC=C(Cl)C(Cl)=C1 QZFHUZLFIAUIFY-UHFFFAOYSA-N 0.000 description 1
- QFRQUXAPBURFAE-UHFFFAOYSA-N 1-cyclopropyl-3-(4-fluorophenyl)prop-2-en-1-one Chemical compound C1=CC(F)=CC=C1C=CC(=O)C1CC1 QFRQUXAPBURFAE-UHFFFAOYSA-N 0.000 description 1
- MQUOARGIVDGAGH-UHFFFAOYSA-N 1-cyclopropyl-3-(4-methylphenyl)prop-2-en-1-one Chemical compound C1=CC(C)=CC=C1C=CC(=O)C1CC1 MQUOARGIVDGAGH-UHFFFAOYSA-N 0.000 description 1
- XEFOGOMELWBHPM-UHFFFAOYSA-N 1-cyclopropyl-3-(4-methylphenyl)propan-1-ol Chemical compound C1=CC(C)=CC=C1CCC(O)C1CC1 XEFOGOMELWBHPM-UHFFFAOYSA-N 0.000 description 1
- DDCGUCLQLCTSOO-UHFFFAOYSA-N 1-cyclopropyl-3-[4-(trifluoromethoxy)phenyl]propan-1-ol Chemical compound C1CC1C(O)CCC1=CC=C(OC(F)(F)F)C=C1 DDCGUCLQLCTSOO-UHFFFAOYSA-N 0.000 description 1
- XBWXYNIAULSXSH-UHFFFAOYSA-N 1-cyclopropyl-3-[4-(trifluoromethyl)phenyl]propan-1-ol Chemical compound C1CC1C(O)CCC1=CC=C(C(F)(F)F)C=C1 XBWXYNIAULSXSH-UHFFFAOYSA-N 0.000 description 1
- DKKVKJZXOBFLRY-UHFFFAOYSA-N 1-cyclopropylethanol Chemical compound CC(O)C1CC1 DKKVKJZXOBFLRY-UHFFFAOYSA-N 0.000 description 1
- JVESLUYOFSLBKD-UHFFFAOYSA-N 1-fluoro-4-(6-iodohexyl)benzene Chemical compound FC1=CC=C(CCCCCCI)C=C1 JVESLUYOFSLBKD-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- FJPGAMCQJNLTJC-UHFFFAOYSA-N 2,3-Heptanedione Chemical compound CCCCC(=O)C(C)=O FJPGAMCQJNLTJC-UHFFFAOYSA-N 0.000 description 1
- YSFBEAASFUWWHU-UHFFFAOYSA-N 2,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C(Cl)=C1 YSFBEAASFUWWHU-UHFFFAOYSA-N 0.000 description 1
- KWPQTFXULUUCGD-UHFFFAOYSA-N 3,4,5,7,8,9,10,10a-octahydropyrido[1,2-a][1,4]diazepine Chemical compound C1CCN=CC2CCCCN21 KWPQTFXULUUCGD-UHFFFAOYSA-N 0.000 description 1
- ZWUSBSHBFFPRNE-UHFFFAOYSA-N 3,4-dichlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Cl ZWUSBSHBFFPRNE-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- ATWHLWWVFKRYTI-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-(1-butylcyclopropyl)propan-1-ol Chemical compound C=1C=C2OCOC2=CC=1CCC(O)C1(CCCC)CC1 ATWHLWWVFKRYTI-UHFFFAOYSA-N 0.000 description 1
- RQNMXJAPARMTGG-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-(1-ethylcyclopropyl)prop-2-en-1-ol Chemical compound C=1C=C2OCOC2=CC=1C=CC(O)C1(CC)CC1 RQNMXJAPARMTGG-UHFFFAOYSA-N 0.000 description 1
- NFILGYIURBZVHW-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-(1-ethylcyclopropyl)propan-1-ol Chemical compound C=1C=C2OCOC2=CC=1CCC(O)C1(CC)CC1 NFILGYIURBZVHW-UHFFFAOYSA-N 0.000 description 1
- CBMGCTRQNAHZIE-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-(1-methylcyclopropyl)prop-2-en-1-one Chemical compound C=1C=C2OCOC2=CC=1C=CC(=O)C1(C)CC1 CBMGCTRQNAHZIE-UHFFFAOYSA-N 0.000 description 1
- SBCVLOYZFITICR-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-1-cyclopropylpropan-1-ol Chemical compound C=1C=C2OCOC2=CC=1CCC(O)C1CC1 SBCVLOYZFITICR-UHFFFAOYSA-N 0.000 description 1
- ULZHJBRLVXJUJQ-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-(1-ethylcyclopropyl)prop-2-en-1-one Chemical compound C=1C=C(OC)C(OC)=CC=1C=CC(=O)C1(CC)CC1 ULZHJBRLVXJUJQ-UHFFFAOYSA-N 0.000 description 1
- KVSAIZFYKJTYRI-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-1-(1-ethylcyclopropyl)propan-1-ol Chemical compound C=1C=C(OC)C(OC)=CC=1CCC(O)C1(CC)CC1 KVSAIZFYKJTYRI-UHFFFAOYSA-N 0.000 description 1
- FTFKRKODZVLSHA-UHFFFAOYSA-N 3-(4-bromophenyl)-1-cyclopropylprop-2-en-1-one Chemical compound C1=CC(Br)=CC=C1C=CC(=O)C1CC1 FTFKRKODZVLSHA-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- WEERIWUSPPRJHA-UHFFFAOYSA-N 4-(4-ethyl-6-iodohex-3-enyl)-1,2-dimethoxybenzene Chemical compound ICCC(CC)=CCCC1=CC=C(OC)C(OC)=C1 WEERIWUSPPRJHA-UHFFFAOYSA-N 0.000 description 1
- TWNNMDJBYGYGFI-UHFFFAOYSA-N 4-(6-bromohex-3-enyl)-1,2-dichlorobenzene Chemical compound ClC1=CC=C(CCC=CCCBr)C=C1Cl TWNNMDJBYGYGFI-UHFFFAOYSA-N 0.000 description 1
- JVNGJHJQSQUAEY-UHFFFAOYSA-N 4-(6-bromohexyl)-1,2-dichlorobenzene Chemical compound ClC1=CC=C(CCCCCCBr)C=C1Cl JVNGJHJQSQUAEY-UHFFFAOYSA-N 0.000 description 1
- XQNVDQZWOBPLQZ-UHFFFAOYSA-N 4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1 XQNVDQZWOBPLQZ-UHFFFAOYSA-N 0.000 description 1
- BEOBZEOPTQQELP-UHFFFAOYSA-N 4-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=C(C=O)C=C1 BEOBZEOPTQQELP-UHFFFAOYSA-N 0.000 description 1
- JBNMFTZMQPBHPV-UHFFFAOYSA-N 4-[3-(1-ethylcyclopropyl)-3-oxoprop-1-enyl]benzoic acid Chemical compound C=1C=C(C(O)=O)C=CC=1C=CC(=O)C1(CC)CC1 JBNMFTZMQPBHPV-UHFFFAOYSA-N 0.000 description 1
- WRRXOGDUURYROX-UHFFFAOYSA-N 4-[3-[3-(1,3-benzodioxol-5-yl)propyl]heptyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(CCCC)CCCC1=CC=C2OCOC2=C1 WRRXOGDUURYROX-UHFFFAOYSA-N 0.000 description 1
- IWRUIYPBSVJHDF-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhex-3-enyl]-4-propan-2-ylheptane-3,5-dione Chemical compound CCC(=O)C(C(C)C)(C(=O)CC)CCC(CC)=CCCC1=CC=C2OCOC2=C1 IWRUIYPBSVJHDF-UHFFFAOYSA-N 0.000 description 1
- XENQVJFPLSBYBC-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhexa-3,5-dienyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(CC)=CC=CC1=CC=C2OCOC2=C1 XENQVJFPLSBYBC-UHFFFAOYSA-N 0.000 description 1
- JCUPMALTSIPPIU-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-ethylhexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(CC)CCCC1=CC=C2OCOC2=C1 JCUPMALTSIPPIU-UHFFFAOYSA-N 0.000 description 1
- AMHYLPVSDSSOCX-UHFFFAOYSA-N 4-[6-(1,3-benzodioxol-5-yl)-3-propan-2-ylhexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC(C(C)C)CCCC1=CC=C2OCOC2=C1 AMHYLPVSDSSOCX-UHFFFAOYSA-N 0.000 description 1
- QXAUITFRSUEYOR-UHFFFAOYSA-N 4-[6-(3,4-dihydroxyphenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(O)C(O)=C1 QXAUITFRSUEYOR-UHFFFAOYSA-N 0.000 description 1
- TUCCKBCYNVXZPT-UHFFFAOYSA-N 4-[6-(3,5-dimethoxy-4-phenylmethoxyphenyl)hex-3-enyl]heptane-3,5-dione Chemical compound COC1=CC(CCC=CCCC(C(=O)CC)C(=O)CC)=CC(OC)=C1OCC1=CC=CC=C1 TUCCKBCYNVXZPT-UHFFFAOYSA-N 0.000 description 1
- FPXFEOIDUMDDDP-UHFFFAOYSA-N 4-[6-(4-bromophenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC=C(Br)C=C1 FPXFEOIDUMDDDP-UHFFFAOYSA-N 0.000 description 1
- BUNFSYUTYBDCAM-UHFFFAOYSA-N 4-[6-(4-hydroxy-3,5-dimethoxyphenyl)hexyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCC1=CC(OC)=C(O)C(OC)=C1 BUNFSYUTYBDCAM-UHFFFAOYSA-N 0.000 description 1
- MNKHHJLYCVRTRQ-UHFFFAOYSA-N 4-[6-(4-hydroxyphenyl)hex-3-enyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(O)C=C1 MNKHHJLYCVRTRQ-UHFFFAOYSA-N 0.000 description 1
- CRGGPOCDWOMMEN-UHFFFAOYSA-N 4-[6-[3,4-bis(phenylmethoxy)phenyl]hex-3-enyl]heptane-3,5-dione Chemical compound C=1C=CC=CC=1COC1=CC(CCC=CCCC(C(=O)CC)C(=O)CC)=CC=C1OCC1=CC=CC=C1 CRGGPOCDWOMMEN-UHFFFAOYSA-N 0.000 description 1
- MWMUXAHDKDNZSX-UHFFFAOYSA-N 4-[7-(4-methoxyphenyl)heptyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCCCCCC1=CC=C(OC)C=C1 MWMUXAHDKDNZSX-UHFFFAOYSA-N 0.000 description 1
- BXSPEZUASMBWLR-UHFFFAOYSA-N 4-[8-(4-methoxyphenyl)nona-4,8-dienyl]heptane-3,5-dione Chemical compound CCC(=O)C(C(=O)CC)CCCC=CCCC(=C)C1=CC=C(OC)C=C1 BXSPEZUASMBWLR-UHFFFAOYSA-N 0.000 description 1
- ZTPWHYWIRVKGPJ-UHFFFAOYSA-N 4-[8-(4-phenylmethoxyphenyl)oct-5-enyl]heptane-3,5-dione Chemical compound C1=CC(CCC=CCCCCC(C(=O)CC)C(=O)CC)=CC=C1OCC1=CC=CC=C1 ZTPWHYWIRVKGPJ-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 1
- LIGJUEXPVIAVLF-UHFFFAOYSA-N 5-(4-ethyl-6-iodohexa-1,3-dienyl)-1,3-benzodioxole Chemical compound ICCC(CC)=CC=CC1=CC=C2OCOC2=C1 LIGJUEXPVIAVLF-UHFFFAOYSA-N 0.000 description 1
- UXXZVBMJBBNWGO-UHFFFAOYSA-N 5-(4-ethylhexa-3,5-dienyl)-1,3-benzodioxole Chemical compound CCC(C=C)=CCCC1=CC=C2OCOC2=C1 UXXZVBMJBBNWGO-UHFFFAOYSA-N 0.000 description 1
- BPQSJUZPZHSPRI-UHFFFAOYSA-N 5-(6-bromo-4-ethylhex-3-enyl)-1,3-benzodioxole Chemical compound BrCCC(CC)=CCCC1=CC=C2OCOC2=C1 BPQSJUZPZHSPRI-UHFFFAOYSA-N 0.000 description 1
- UKNBZSZEBDQVIO-UHFFFAOYSA-N 5-(6-iodohex-3-enyl)-1,3-benzodioxole Chemical compound ICCC=CCCC1=CC=C2OCOC2=C1 UKNBZSZEBDQVIO-UHFFFAOYSA-N 0.000 description 1
- LDTDCTKUGQABRW-UHFFFAOYSA-N 5-[4-(2-bromoethyl)-5-methylhex-3-enyl]-1,3-benzodioxole Chemical compound BrCCC(C(C)C)=CCCC1=CC=C2OCOC2=C1 LDTDCTKUGQABRW-UHFFFAOYSA-N 0.000 description 1
- NNPDGACVTNLCQT-UHFFFAOYSA-N 5-[4-(2-bromoethyl)octyl]-1,3-benzodioxole Chemical compound CCCCC(CCBr)CCCC1=CC=C2OCOC2=C1 NNPDGACVTNLCQT-UHFFFAOYSA-N 0.000 description 1
- ZDNHNBXMFQWNOZ-UHFFFAOYSA-N 5-[4-(2-iodoethyl)-5-methylhexyl]-1,3-benzodioxole Chemical compound ICCC(C(C)C)CCCC1=CC=C2OCOC2=C1 ZDNHNBXMFQWNOZ-UHFFFAOYSA-N 0.000 description 1
- AVMNJCQSPLZSRW-UHFFFAOYSA-N 5-[4-(2-iodoethyl)octyl]-1,3-benzodioxole Chemical compound CCCCC(CCI)CCCC1=CC=C2OCOC2=C1 AVMNJCQSPLZSRW-UHFFFAOYSA-N 0.000 description 1
- RAOLIGFNQJMMKW-UHFFFAOYSA-N 6-bromohexylbenzene Chemical compound BrCCCCCCC1=CC=CC=C1 RAOLIGFNQJMMKW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000567412 Estigmene acrea Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- CPJQVMMKRUIINA-UHFFFAOYSA-N [4-(3-cyclopropyl-3-hydroxypropyl)phenyl] benzoate Chemical compound C1CC1C(O)CCC(C=C1)=CC=C1OC(=O)C1=CC=CC=C1 CPJQVMMKRUIINA-UHFFFAOYSA-N 0.000 description 1
- FXZHKJWBVJXRLM-UHFFFAOYSA-N [4-(6-bromohex-3-enyl)phenyl] benzoate Chemical compound C1=CC(CCC=CCCBr)=CC=C1OC(=O)C1=CC=CC=C1 FXZHKJWBVJXRLM-UHFFFAOYSA-N 0.000 description 1
- LDWMUQLLODGZOR-UHFFFAOYSA-N [4-(6-iodohex-3-enyl)phenyl] benzoate Chemical compound C1=CC(CCC=CCCI)=CC=C1OC(=O)C1=CC=CC=C1 LDWMUQLLODGZOR-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003609 aryl vinyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 229940117916 cinnamic aldehyde Drugs 0.000 description 1
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- BIPUHAHGLJKIPK-UHFFFAOYSA-N dicyclopropylmethanone Chemical compound C1CC1C(=O)C1CC1 BIPUHAHGLJKIPK-UHFFFAOYSA-N 0.000 description 1
- TZVKDUPRPHXLSB-UHFFFAOYSA-N diethyl 2-[6-(4-phenylmethoxyphenyl)hex-3-enyl]propanedioate Chemical compound C1=CC(CCC=CCCC(C(=O)OCC)C(=O)OCC)=CC=C1OCC1=CC=CC=C1 TZVKDUPRPHXLSB-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- KQWWVLVLVYYYDT-UHFFFAOYSA-N ethyl 3-oxohexanoate Chemical compound CCCC(=O)CC(=O)OCC KQWWVLVLVYYYDT-UHFFFAOYSA-N 0.000 description 1
- UDRCONFHWYGWFI-UHFFFAOYSA-N ethyl 3-oxopentanoate Chemical compound CCOC(=O)CC(=O)CC UDRCONFHWYGWFI-UHFFFAOYSA-N 0.000 description 1
- MCEPASCMTMBCBH-UHFFFAOYSA-N ethyl 8-(1,3-benzodioxol-5-yl)-2-butanoyl-5-ethyloct-5-enoate Chemical compound CCCC(=O)C(C(=O)OCC)CCC(CC)=CCCC1=CC=C2OCOC2=C1 MCEPASCMTMBCBH-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NDOGLIPWGGRQCO-UHFFFAOYSA-N hexane-2,4-dione Chemical compound CCC(=O)CC(C)=O NDOGLIPWGGRQCO-UHFFFAOYSA-N 0.000 description 1
- MWVFCEVNXHTDNF-UHFFFAOYSA-N hexanedione Natural products CCCC(=O)C(C)=O MWVFCEVNXHTDNF-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 230000000366 juvenile effect Effects 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- ZEIUKGHYEDXUID-UHFFFAOYSA-N methyl 4-(4-ethyl-6-iodohex-3-enyl)benzoate Chemical compound ICCC(CC)=CCCC1=CC=C(C(=O)OC)C=C1 ZEIUKGHYEDXUID-UHFFFAOYSA-N 0.000 description 1
- RCCGHZNDIACTDF-UHFFFAOYSA-N methyl 4-(6-bromo-4-ethylhex-3-enyl)benzoate Chemical compound BrCCC(CC)=CCCC1=CC=C(C(=O)OC)C=C1 RCCGHZNDIACTDF-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- QIFYSQAJJFUXFG-UHFFFAOYSA-N n-[4-(8-oxo-7-propanoyldec-3-enyl)phenyl]acetamide Chemical compound CCC(=O)C(C(=O)CC)CCC=CCCC1=CC=C(NC(C)=O)C=C1 QIFYSQAJJFUXFG-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 1
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 150000003609 titanium compounds Chemical class 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 241000712461 unidentified influenza virus Species 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/20—Preparation of halogenated hydrocarbons by replacement by halogens of halogen atoms by other halogen atoms
- C07C17/202—Preparation of halogenated hydrocarbons by replacement by halogens of halogen atoms by other halogen atoms two or more compounds being involved in the reaction
- C07C17/208—Preparation of halogenated hydrocarbons by replacement by halogens of halogen atoms by other halogen atoms two or more compounds being involved in the reaction the other compound being MX
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/16—Preparation of halogenated hydrocarbons by replacement by halogens of hydroxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/35—Preparation of halogenated hydrocarbons by reactions not affecting the number of carbon or of halogen atoms in the reaction
- C07C17/354—Preparation of halogenated hydrocarbons by reactions not affecting the number of carbon or of halogen atoms in the reaction by hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/34—Monohydroxylic alcohols containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/40—Halogenated unsaturated alcohols
- C07C33/50—Halogenated unsaturated alcohols containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/62—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by hydrogenation of carbon-to-carbon double or triple bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/74—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups combined with dehydration
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/54—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/60—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00265333A US3829475A (en) | 1972-06-22 | 1972-06-22 | 2-(carboxyphenyl)ethyl and 2-(carboxyphenyl)vinyl cyclopropyl carbinols |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2331974A1 true DE2331974A1 (de) | 1974-01-10 |
Family
ID=23010014
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2331974A Pending DE2331974A1 (de) | 1972-06-22 | 1973-06-22 | Arylsubstituierte diketone und ketoester, verfahren zu deren herstellung und neue zwischenprodukte |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3829475A (enExample) |
| JP (1) | JPS4949930A (enExample) |
| AU (1) | AU5725773A (enExample) |
| BE (1) | BE801206A (enExample) |
| CA (1) | CA1046070A (enExample) |
| DE (1) | DE2331974A1 (enExample) |
| FR (2) | FR2189068B1 (enExample) |
| GB (3) | GB1414569A (enExample) |
| NL (1) | NL7308772A (enExample) |
| SE (1) | SE395883B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4171376A (en) * | 1973-07-23 | 1979-10-16 | Sterling Drug Inc. | Aryloxyalkyl keto-esters |
| US4246284A (en) * | 1973-07-23 | 1981-01-20 | Sterling Drug Inc. | Aminosulfonyl-substituted aryloxyalkyl diketones |
| US4182761A (en) * | 1973-07-23 | 1980-01-08 | Sterling Drug Inc. | Acyloxy-substituted aryloxyalkyl diketones |
| US4153719A (en) * | 1977-09-06 | 1979-05-08 | Sterling Drug Inc. | Aromatic diketones |
| US4347192A (en) * | 1979-07-30 | 1982-08-31 | G. D. Searle & Co. | Derivatives of α,β-unsaturated ketones |
| GB8729107D0 (en) * | 1987-12-14 | 1988-01-27 | Ici Plc | Chemical process |
| US7036520B2 (en) * | 2004-02-19 | 2006-05-02 | Pearson Jr Kenneth W | Hot water heater recirculation system and method |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3629336A (en) * | 1968-02-19 | 1971-12-21 | Polaroid Corp | Ligands which are also silver halide developing agents |
-
1972
- 1972-06-22 US US00265333A patent/US3829475A/en not_active Expired - Lifetime
-
1973
- 1973-06-18 GB GB3385974A patent/GB1414569A/en not_active Expired
- 1973-06-18 GB GB2879373A patent/GB1414568A/en not_active Expired
- 1973-06-18 GB GB3386074A patent/GB1414570A/en not_active Expired
- 1973-06-21 SE SE7308805A patent/SE395883B/xx unknown
- 1973-06-21 BE BE1005178A patent/BE801206A/xx unknown
- 1973-06-21 CA CA174,664A patent/CA1046070A/en not_active Expired
- 1973-06-21 FR FR7322760A patent/FR2189068B1/fr not_active Expired
- 1973-06-22 JP JP48069957A patent/JPS4949930A/ja active Pending
- 1973-06-22 DE DE2331974A patent/DE2331974A1/de active Pending
- 1973-06-22 NL NL7308772A patent/NL7308772A/xx not_active Application Discontinuation
- 1973-06-22 AU AU57257/73A patent/AU5725773A/en not_active Expired
-
1975
- 1975-05-23 FR FR7516200A patent/FR2272972B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7308772A (enExample) | 1973-12-27 |
| FR2272972A1 (enExample) | 1975-12-26 |
| FR2189068A1 (enExample) | 1974-01-25 |
| AU5725773A (en) | 1975-01-09 |
| SE395883B (sv) | 1977-08-29 |
| CA1046070A (en) | 1979-01-09 |
| FR2272972B1 (enExample) | 1978-09-29 |
| GB1414568A (en) | 1975-11-19 |
| BE801206A (fr) | 1973-12-21 |
| GB1414569A (en) | 1975-11-19 |
| FR2189068B1 (enExample) | 1978-01-13 |
| JPS4949930A (enExample) | 1974-05-15 |
| GB1414570A (en) | 1975-11-19 |
| US3829475A (en) | 1974-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2822848A1 (de) | Mevalonolacton-derivate und verfahren zu deren herstellung | |
| DE2729818C2 (de) | Verfahren zur Herstellung von 6a, 10a-trans-1-Hydroxy-3-alkylsubstituierten-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo[b,d]-pyran-9-onen | |
| DE2849224A1 (de) | 1,9-dihydroxyoctahydrophenanthrene, 1-hydroxyoctahydrophenanthren-9-one sowie derivate hiervon und diese enthaltende arzneimittel | |
| DE2839836C2 (de) | 3-[2-Hydroxy-4-(substituierte)-phenyl]- cycloalkanderivate und diese enthaltende Arzneimittel | |
| DE2331974A1 (de) | Arylsubstituierte diketone und ketoester, verfahren zu deren herstellung und neue zwischenprodukte | |
| US3917718A (en) | Cyclopropyl carbinol derivatives | |
| DE69322353T2 (de) | Chromen-Derivate mit einer Trien-Kette zur Verwendung bei der Behandlung der Osteoporose und der entzündlichen Erkrankungen | |
| DD140454A5 (de) | Verfahren zur herstellung von 3-eckige klammer auf 2-hydroxy-4-(substituierte)-phenyl eckige klammer zu cycloalkanone | |
| US4125541A (en) | Aryl substituted ketones | |
| DE2004038C3 (de) | 5-Cyclohexyl-1-indancarbonsäuren,,deren Niedrigalkyl- und tert.-Aminoniedrigalkylester, nicht-toxische pharmakologisch verträgliche Salze und Verfahren zu deren Herstellung | |
| DE2341507A1 (de) | Neue biphenylderivate und verfahren zur herstellung | |
| DE2524959A1 (de) | Neue isoxazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| DE2729816A1 (de) | 2-oxy-5-isopropyliden-7-hydroxy-9- substituierte-2,6-methano-3,4,5,6-tetrahydro-2h-1-benzoxocine und verfahren zu ihrer herstellung | |
| DE69007572T2 (de) | Chalkonderivate. | |
| DE2729846C2 (de) | Verfahren zur Herstellung von in 3-Stellung alkylsubstituierten cis-1-Hydroxy-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo [b,d] pyran-9-onen | |
| US4093736A (en) | Methylenedioxyphenyl substituted aliphatic diketones | |
| DE1518042C3 (de) | 1,4-Benzodioxanderivate und Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE2838276A1 (de) | Beta -substituierte diketone, verfahren zu deren herstellung und diese enthaltende arzneimittel | |
| DE2315557A1 (de) | Synthese von zearalanen ii und verwandten verbindungen und zwischenprodukten, die zu deren synthese verwendbar sind | |
| DE2253089C2 (de) | 9-Oxo-9,10,seco-östran-Derivate und Verfahren zur Herstellung dieser Verbindungen und von 9-Oxo-D-homo-9,10-seco-östran-Derivaten | |
| DE2729817C2 (de) | Verfahren zur Herstellung von dl- 6a-10a-cis-1-Hydroxy-3-alkylsubstituierten-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo[b,d]-pyran-9-onen | |
| US4171378A (en) | Aryl substituted diketones | |
| DE2335080A1 (de) | Neue cyclohexenonester, verfahren zu ihrer herstellung und diese ester enthaltende arzneimittel | |
| DE2435378A1 (de) | Verfahren zur herstellung von aryloxyalkyldiketonen und -ketoestern | |
| DE1593373C (de) | Verfahren zur Herstellung von optisch aktivem Dihydrochrysanthemolacton |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |