DE2331599A1 - Cephalosporinverbindungen und diese verbindungen enthaltende arzneimittel - Google Patents
Cephalosporinverbindungen und diese verbindungen enthaltende arzneimittelInfo
- Publication number
- DE2331599A1 DE2331599A1 DE2331599A DE2331599A DE2331599A1 DE 2331599 A1 DE2331599 A1 DE 2331599A1 DE 2331599 A DE2331599 A DE 2331599A DE 2331599 A DE2331599 A DE 2331599A DE 2331599 A1 DE2331599 A1 DE 2331599A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- radical
- het
- cephem
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title description 47
- 229940126601 medicinal product Drugs 0.000 title description 2
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- -1 Cephalosporin compounds Chemical class 0.000 claims description 263
- 229930186147 Cephalosporin Natural products 0.000 claims description 39
- 229940124587 cephalosporin Drugs 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 20
- 150000003254 radicals Chemical class 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 101100070541 Podospora anserina (strain S / ATCC MYA-4624 / DSM 980 / FGSC 10383) het-S gene Proteins 0.000 claims description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 125000004434 sulfur atom Chemical group 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 229920006395 saturated elastomer Polymers 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 5
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 5
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims description 3
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims description 3
- IDIICHZCEIGXGB-UHFFFAOYSA-N 1-piperazinecarbodithioic acid Chemical group SC(=S)N1CCNCC1 IDIICHZCEIGXGB-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 2
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 claims 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- FAIPQCJQEAURIB-UHFFFAOYSA-N piperidine-1-carbodithioic acid Chemical compound SC(=S)N1CCCCC1 FAIPQCJQEAURIB-UHFFFAOYSA-N 0.000 claims 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 85
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 84
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 69
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 66
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- 239000000203 mixture Substances 0.000 description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 40
- 238000000034 method Methods 0.000 description 35
- 239000002904 solvent Substances 0.000 description 33
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 238000001914 filtration Methods 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 239000011877 solvent mixture Substances 0.000 description 21
- FRPHFZCDPYBUAU-UHFFFAOYSA-N Bromocresolgreen Chemical compound CC1=C(Br)C(O)=C(Br)C=C1C1(C=2C(=C(Br)C(O)=C(Br)C=2)C)C2=CC=CC=C2S(=O)(=O)O1 FRPHFZCDPYBUAU-UHFFFAOYSA-N 0.000 description 19
- 239000012286 potassium permanganate Substances 0.000 description 19
- 239000000047 product Substances 0.000 description 18
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 15
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 15
- 235000019253 formic acid Nutrition 0.000 description 15
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 14
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 10
- BQIMPGFMMOZASS-UHFFFAOYSA-N beta-amino-3-hydroxymethyl-3-cefem-4-carboxylic acid Natural products S1CC(CO)=C(C(O)=O)N2C(=O)C(N)C21 BQIMPGFMMOZASS-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000012948 isocyanate Substances 0.000 description 7
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 238000007920 subcutaneous administration Methods 0.000 description 5
- HJSGHKMSDOLGJJ-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 HJSGHKMSDOLGJJ-IOJJLOCKSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000002211 ultraviolet spectrum Methods 0.000 description 4
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241000588747 Klebsiella pneumoniae Species 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 3
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 3
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- YEWUYXBDRUXQMT-FBMWCMRBSA-N (6r)-7-(benzylcarbamoylamino)-8-oxo-3-(pyrimidin-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CC=CC=1CNC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NC=CC=N1 YEWUYXBDRUXQMT-FBMWCMRBSA-N 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- OUZCWDMJTKYHCA-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound CC1=NNC(S)=N1 OUZCWDMJTKYHCA-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 101150052863 THY1 gene Proteins 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 2
- 150000001780 cephalosporins Chemical group 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 2
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical class C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 2
- BQYXCLHQPAZUSO-FBMWCMRBSA-N (6R)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-7-[(4-methylphenyl)methylcarbamoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 BQYXCLHQPAZUSO-FBMWCMRBSA-N 0.000 description 1
- KIPFECZXOGCJBD-FQNRMIAFSA-N (6R)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-7-[(4-nitrophenyl)methylcarbamoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound [N+](=O)([O-])C1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 KIPFECZXOGCJBD-FQNRMIAFSA-N 0.000 description 1
- KSSQSZIAIHUYMP-BDSCKGBASA-N (6R)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-7-(1-phenylethylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC(C1=CC=CC=C1)NC(NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)C)C(=O)O)C1=O)=O KSSQSZIAIHUYMP-BDSCKGBASA-N 0.000 description 1
- ZSQIAGUIVIUISA-FQNRMIAFSA-N (6R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-[(4-nitrophenyl)methylcarbamoylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound [N+](=O)([O-])C1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(S3)C)C(=O)O)C2=O)=O)C=C1 ZSQIAGUIVIUISA-FQNRMIAFSA-N 0.000 description 1
- UCEICOVUFSZICX-BDSCKGBASA-N (6R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-(1-phenylethylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC(C1=CC=CC=C1)NC(NC1[C@@H]2N(C(=C(CS2)CSC=2SC(=NN=2)C)C(=O)O)C1=O)=O UCEICOVUFSZICX-BDSCKGBASA-N 0.000 description 1
- UHBVDCHZXVAVBB-FBMWCMRBSA-N (6R)-7-(benzylcarbamoylamino)-3-[(4-methyl-1,3,5-triazin-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NC=NC(SCC=2CS[C@H]3N(C(C3NC(=O)NCC=3C=CC=CC=3)=O)C=2C(O)=O)=N1 UHBVDCHZXVAVBB-FBMWCMRBSA-N 0.000 description 1
- ZTGLNQRGWGLGDM-FQNRMIAFSA-N (6R)-7-(benzylcarbamoylamino)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound O1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)NCC=3C=CC=CC=3)[C@H]2SC1 ZTGLNQRGWGLGDM-FQNRMIAFSA-N 0.000 description 1
- MCTWRRFRQUETCK-FQNRMIAFSA-N (6R)-7-[(2-chlorophenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC1=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(S3)C)C(=O)O)C2=O)=O)C=CC=C1 MCTWRRFRQUETCK-FQNRMIAFSA-N 0.000 description 1
- KGWAEUOXAKUSBS-FBMWCMRBSA-N (6R)-7-[(4-acetyloxyphenyl)methylcarbamoylamino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)(=O)OC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 KGWAEUOXAKUSBS-FBMWCMRBSA-N 0.000 description 1
- IQDIGEIEBIGZMU-WPZCJLIBSA-N (6R)-7-[(4-chlorophenyl)methylcarbamoylamino]-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC=3OC=NN=3)C(=O)O)C2=O)=O)C=C1 IQDIGEIEBIGZMU-WPZCJLIBSA-N 0.000 description 1
- BWDKLJXEXILWLL-FQNRMIAFSA-N (6R)-7-[(4-chlorophenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 BWDKLJXEXILWLL-FQNRMIAFSA-N 0.000 description 1
- OVVHSGJVTHXRCP-FQNRMIAFSA-N (6R)-7-[(4-chlorophenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC=3SC(=NN=3)C)C(=O)O)C2=O)=O)C=C1 OVVHSGJVTHXRCP-FQNRMIAFSA-N 0.000 description 1
- YMKDKUZUXYZBCS-FQNRMIAFSA-N (6R)-7-[(4-hydroxyphenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(S3)C)C(=O)O)C2=O)=O)C=C1 YMKDKUZUXYZBCS-FQNRMIAFSA-N 0.000 description 1
- VWOWMISXEYIPKA-FBMWCMRBSA-N (6R)-7-[(4-methoxyphenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound COC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 VWOWMISXEYIPKA-FBMWCMRBSA-N 0.000 description 1
- NRQBAYRXWMVHLX-FBMWCMRBSA-N (6R)-7-[(4-methoxyphenyl)methylcarbamoylamino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound COC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(S3)C)C(=O)O)C2=O)=O)C=C1 NRQBAYRXWMVHLX-FBMWCMRBSA-N 0.000 description 1
- MLDGKUVBKPTMNM-FQNRMIAFSA-N (6R)-7-[(4-methylphenyl)methylcarbamoylamino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 MLDGKUVBKPTMNM-FQNRMIAFSA-N 0.000 description 1
- IJJTVZZFHZAUKK-FBMWCMRBSA-N (6R)-7-[2-(4-chlorophenyl)ethylcarbamoylamino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound ClC1=CC=C(CCNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(S3)C)C(=O)O)C2=O)=O)C=C1 IJJTVZZFHZAUKK-FBMWCMRBSA-N 0.000 description 1
- SKCQHHVLWWZOGM-QHDYGNBISA-N (6r)-3-(1,3,4-oxadiazol-2-ylsulfanylmethyl)-8-oxo-7-(propylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)NCCC)CC=1CSC1=NN=CO1 SKCQHHVLWWZOGM-QHDYGNBISA-N 0.000 description 1
- LYYXTAXBJFPOAE-QHDYGNBISA-N (6r)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-7-(ethylcarbamoylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)NCC)CC=1CSC1=NCCS1 LYYXTAXBJFPOAE-QHDYGNBISA-N 0.000 description 1
- BEWAHMOHAAXXOT-FFFFSGIJSA-N (6r)-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-8-oxo-7-(propan-2-ylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)NC(C)C)CC=1CSC1=NCCS1 BEWAHMOHAAXXOT-FFFFSGIJSA-N 0.000 description 1
- QHBPZZNAEUCKHO-FFFFSGIJSA-N (6r)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]-8-oxo-7-(propylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)NCCC)CC=1CSC1=NN=C(C)O1 QHBPZZNAEUCKHO-FFFFSGIJSA-N 0.000 description 1
- OJLNNSZXZCJHCR-FBMWCMRBSA-N (6r)-3-[(5-methyl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-7-(2-phenylethylcarbamoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C(C)=NC(SCC=2CS[C@H]3N(C(C3NC(=O)NCCC=3C=CC=CC=3)=O)C=2C(O)=O)=N1 OJLNNSZXZCJHCR-FBMWCMRBSA-N 0.000 description 1
- MYGDBAYVXQNBCO-IOJJLOCKSA-N (6r)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1C=C(C(O)=O)N2C(=O)C[C@H]2S1 MYGDBAYVXQNBCO-IOJJLOCKSA-N 0.000 description 1
- GPUHGMLLUPZORD-FBMWCMRBSA-N (6r)-7-(benzylcarbamoylamino)-3-[(1,5-dimethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1C(C)=NC(SCC=2CS[C@H]3N(C(C3NC(=O)NCC=3C=CC=CC=3)=O)C=2C(O)=O)=N1 GPUHGMLLUPZORD-FBMWCMRBSA-N 0.000 description 1
- RKDIYVUYSGOYPR-FQNRMIAFSA-N (6r)-7-(benzylcarbamoylamino)-3-[(5-methyl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C(C)=NC(SCC=2CS[C@H]3N(C(C3NC(=O)NCC=3C=CC=CC=3)=O)C=2C(O)=O)=N1 RKDIYVUYSGOYPR-FQNRMIAFSA-N 0.000 description 1
- RZGSSHNLOJMQOZ-FQNRMIAFSA-N (6r)-7-(benzylcarbamoylamino)-8-oxo-3-(1,3,5-triazin-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CC=CC=1CNC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NC=NC=N1 RZGSSHNLOJMQOZ-FQNRMIAFSA-N 0.000 description 1
- YYUNNZAKLYKACS-WPZCJLIBSA-N (6r)-7-(benzylcarbamoylamino)-8-oxo-3-(1h-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CC=CC=1CNC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NC=NN1 YYUNNZAKLYKACS-WPZCJLIBSA-N 0.000 description 1
- IWROUQOPDLRPPQ-QHDYGNBISA-N (6r)-7-(ethylcarbamoylamino)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)NC(=O)NCC)CC=1CSC1=NN=C(C)S1 IWROUQOPDLRPPQ-QHDYGNBISA-N 0.000 description 1
- GGVCWQJRWQRPSI-IOJJLOCKSA-N (6r)-7-amino-3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NCCS1 GGVCWQJRWQRPSI-IOJJLOCKSA-N 0.000 description 1
- GRGBINRQDDFFAH-UHFFFAOYSA-N 1,2-dibromo-1-isocyanatoethane Chemical compound BrCC(Br)N=C=O GRGBINRQDDFFAH-UHFFFAOYSA-N 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- WSAIKWBIEKCYFN-UHFFFAOYSA-N 1,5-dimethyl-1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound CC1=NC(S)=NN1C WSAIKWBIEKCYFN-UHFFFAOYSA-N 0.000 description 1
- NJLYUINWLSVLFJ-UHFFFAOYSA-N 1-(3-isocyanatopropoxy)butane Chemical compound CCCCOCCCN=C=O NJLYUINWLSVLFJ-UHFFFAOYSA-N 0.000 description 1
- PDJISIIISGZOOQ-UHFFFAOYSA-N 1-chloro-2-isocyanatocyclohexane Chemical compound ClC1CCCCC1N=C=O PDJISIIISGZOOQ-UHFFFAOYSA-N 0.000 description 1
- DSVGFKBFFICWLZ-UHFFFAOYSA-N 1-fluoro-4-isocyanatobenzene Chemical compound FC1=CC=C(N=C=O)C=C1 DSVGFKBFFICWLZ-UHFFFAOYSA-N 0.000 description 1
- CPPGZWWUPFWALU-UHFFFAOYSA-N 1-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(N=C=O)=C1 CPPGZWWUPFWALU-UHFFFAOYSA-N 0.000 description 1
- JXMBHJOWDAGCPP-UHFFFAOYSA-N 1-isocyanato-3-nitropropane Chemical compound [O-][N+](=O)CCCN=C=O JXMBHJOWDAGCPP-UHFFFAOYSA-N 0.000 description 1
- FMDGXCSMDZMDHZ-UHFFFAOYSA-N 1-isocyanato-4-methoxybenzene Chemical compound COC1=CC=C(N=C=O)C=C1 FMDGXCSMDZMDHZ-UHFFFAOYSA-N 0.000 description 1
- QNKQBDZVEKZFBN-UHFFFAOYSA-N 1-isocyanato-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(N=C=O)C=C1 QNKQBDZVEKZFBN-UHFFFAOYSA-N 0.000 description 1
- GFNKTLQTQSALEJ-UHFFFAOYSA-N 1-isocyanato-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(N=C=O)C=C1 GFNKTLQTQSALEJ-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 1
- HKAVADYDPYUPRD-UHFFFAOYSA-N 1h-pyrazine-2-thione Chemical compound SC1=CN=CC=N1 HKAVADYDPYUPRD-UHFFFAOYSA-N 0.000 description 1
- YQQSRZSUGBETRS-UHFFFAOYSA-N 1h-pyridazine-6-thione Chemical compound SC1=CC=CN=N1 YQQSRZSUGBETRS-UHFFFAOYSA-N 0.000 description 1
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- VLBAAFPRHLOCAN-UHFFFAOYSA-N 2-isocyanato-2-phenylacetic acid Chemical compound O=C=NC(C(=O)O)C1=CC=CC=C1 VLBAAFPRHLOCAN-UHFFFAOYSA-N 0.000 description 1
- DADDPUQESVFWTL-UHFFFAOYSA-N 2-isocyanato-5-nitrofuran Chemical compound [O-][N+](=O)C1=CC=C(N=C=O)O1 DADDPUQESVFWTL-UHFFFAOYSA-N 0.000 description 1
- RWKVPOCZWXIRNE-UHFFFAOYSA-N 2-isocyanato-n,n-dimethylethanamine Chemical compound CN(C)CCN=C=O RWKVPOCZWXIRNE-UHFFFAOYSA-N 0.000 description 1
- RQSCFNPNNLWQBJ-UHFFFAOYSA-N 2-methyl-1,3,4-thiadiazole Chemical compound CC1=NN=CS1 RQSCFNPNNLWQBJ-UHFFFAOYSA-N 0.000 description 1
- FTERHQFTRLXWDG-UHFFFAOYSA-N 2-methyl-1h-1,2,4-triazole-5-thione Chemical compound CN1C=NC(S)=N1 FTERHQFTRLXWDG-UHFFFAOYSA-N 0.000 description 1
- HACRKYQRZABURO-UHFFFAOYSA-N 2-phenylethyl isocyanate Chemical compound O=C=NCCC1=CC=CC=C1 HACRKYQRZABURO-UHFFFAOYSA-N 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- SHPPDIBKHYVIKL-UHFFFAOYSA-N 3-isocyanatoprop-1-yne Chemical compound O=C=NCC#C SHPPDIBKHYVIKL-UHFFFAOYSA-N 0.000 description 1
- FXQINRXVWWPGIQ-UHFFFAOYSA-N 3-methyl-1h-pyridazine-6-thione Chemical compound CC1=CC=C(S)N=N1 FXQINRXVWWPGIQ-UHFFFAOYSA-N 0.000 description 1
- YZEHDFBYSOKBED-UHFFFAOYSA-N 4-isocyanato-n,n-dimethylaniline Chemical compound CN(C)C1=CC=C(N=C=O)C=C1 YZEHDFBYSOKBED-UHFFFAOYSA-N 0.000 description 1
- IYSAYSBNKDUNKZ-UHFFFAOYSA-N 4-isocyanatobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(N=C=O)C=C1 IYSAYSBNKDUNKZ-UHFFFAOYSA-N 0.000 description 1
- BPZYWIXVIGKGSF-UHFFFAOYSA-N 4-isocyanatobenzenethiol Chemical compound SC1=CC=C(N=C=O)C=C1 BPZYWIXVIGKGSF-UHFFFAOYSA-N 0.000 description 1
- TVSXDZNUTPLDKY-UHFFFAOYSA-N 4-isocyanatobenzonitrile Chemical compound O=C=NC1=CC=C(C#N)C=C1 TVSXDZNUTPLDKY-UHFFFAOYSA-N 0.000 description 1
- YHTXKUQEAUWAPA-UHFFFAOYSA-N 4-isocyanatocyclohexene Chemical compound O=C=NC1CCC=CC1 YHTXKUQEAUWAPA-UHFFFAOYSA-N 0.000 description 1
- DYKCDKICHOCWGU-UHFFFAOYSA-N 4-isocyanatophenol Chemical compound OC1=CC=C(N=C=O)C=C1 DYKCDKICHOCWGU-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- NLHAIPFBNQZTMY-UHFFFAOYSA-N 4-methyl-3h-1,3-thiazole-2-thione Chemical compound CC1=CSC(S)=N1 NLHAIPFBNQZTMY-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- UDXSIDQGDWMVDD-UHFFFAOYSA-N 5-methyl-1h-pyrimidine-2-thione Chemical compound CC1=CN=C(S)N=C1 UDXSIDQGDWMVDD-UHFFFAOYSA-N 0.000 description 1
- ZVGKPQCCKGLQPB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-oxadiazole-2-thione Chemical compound CC1=NN=C(S)O1 ZVGKPQCCKGLQPB-UHFFFAOYSA-N 0.000 description 1
- BHQUBONFIYNJDA-UHFFFAOYSA-N 5-nitro-1h-pyridine-2-thione Chemical compound [O-][N+](=O)C1=CC=C(S)N=C1 BHQUBONFIYNJDA-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- BVPHXTUEZOQIBS-UHFFFAOYSA-N 6-methyl-1h-pyrimidine-2-thione Chemical compound CC1=CC=NC(S)=N1 BVPHXTUEZOQIBS-UHFFFAOYSA-N 0.000 description 1
- MAQAGRJURDEYDQ-UHFFFAOYSA-N 6-methylpyridine Chemical compound CC1=C=CC=C[N]1 MAQAGRJURDEYDQ-UHFFFAOYSA-N 0.000 description 1
- HWXGKKOXNSMKSZ-UHFFFAOYSA-N 9-ethyl-3-isocyanatocarbazole Chemical compound O=C=NC1=CC=C2N(CC)C3=CC=CC=C3C2=C1 HWXGKKOXNSMKSZ-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BJKUCSFJIKRLPD-FQNRMIAFSA-N COC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 Chemical compound COC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 BJKUCSFJIKRLPD-FQNRMIAFSA-N 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RAZVTVICQHRGJM-FQNRMIAFSA-N ClC1=CC=C(CCNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 Chemical compound ClC1=CC=C(CCNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)=O)C=C1 RAZVTVICQHRGJM-FQNRMIAFSA-N 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- PODLMAYQTFQZPK-FQNRMIAFSA-N FC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 Chemical compound FC1=CC=C(CNC(NC2[C@@H]3N(C(=C(CS3)CSC3=NN=C(O3)C)C(=O)O)C2=O)=O)C=C1 PODLMAYQTFQZPK-FQNRMIAFSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000531795 Salmonella enterica subsp. enterica serovar Paratyphi A Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- UMEUMGUZBPZVMV-VOTSOKGWSA-N [(e)-2-isocyanatoethenyl]benzene Chemical compound O=C=N\C=C\C1=CC=CC=C1 UMEUMGUZBPZVMV-VOTSOKGWSA-N 0.000 description 1
- DDYJUACDFHVTJD-UHFFFAOYSA-N [azido(isocyanato)methyl]benzene Chemical compound [N-]=[N+]=NC(N=C=O)C1=CC=CC=C1 DDYJUACDFHVTJD-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- VZZBCNXVZFAIQX-UHFFFAOYSA-N bms-986260 Chemical compound ClC=1C=C(C=CC=1F)C=1N=CN(C=1C=1C=CC=2N(N=1)C(=CN=2)C#N)CCO VZZBCNXVZFAIQX-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 150000001714 carbamic acid halides Chemical class 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 235000011950 custard Nutrition 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- ANJPRQPHZGHVQB-UHFFFAOYSA-N hexyl isocyanate Chemical compound CCCCCCN=C=O ANJPRQPHZGHVQB-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- YVTBKHCZJRFTJQ-UHFFFAOYSA-N isocyanato(phenyl)methanamine Chemical compound O=C=NC(N)C1=CC=CC=C1 YVTBKHCZJRFTJQ-UHFFFAOYSA-N 0.000 description 1
- IIYRBUWJXKXDQY-UHFFFAOYSA-N isocyanatomethanol Chemical compound OCN=C=O IIYRBUWJXKXDQY-UHFFFAOYSA-N 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000003120 macrolide antibiotic agent Substances 0.000 description 1
- 229940041033 macrolides Drugs 0.000 description 1
- OFOPUJCXOFNWAL-UHFFFAOYSA-N n-(4-isocyanatophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N=C=O)C=C1 OFOPUJCXOFNWAL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical class *S* 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003559 thiocarbamic acid halides Chemical class 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26537172A | 1972-06-22 | 1972-06-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2331599A1 true DE2331599A1 (de) | 1974-01-10 |
Family
ID=23010158
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2331599A Pending DE2331599A1 (de) | 1972-06-22 | 1973-06-20 | Cephalosporinverbindungen und diese verbindungen enthaltende arzneimittel |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS4954394A (enExample) |
| BE (1) | BE801099A (enExample) |
| CH (1) | CH573945A5 (enExample) |
| DE (1) | DE2331599A1 (enExample) |
| ES (1) | ES416110A1 (enExample) |
| FR (1) | FR2189018B1 (enExample) |
| GB (1) | GB1392156A (enExample) |
| LU (1) | LU67826A1 (enExample) |
| NL (1) | NL7308634A (enExample) |
| ZA (1) | ZA733650B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4164586A (en) * | 1974-07-19 | 1979-08-14 | Hoffmann-La Roche Inc. | Therapeutic agent for improving cardiovascular function |
| US4174399A (en) * | 1978-07-10 | 1979-11-13 | Syntex (Usa) Inc. | Treatment of lactic acidosis in ruminants |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792112A (fr) * | 1971-12-06 | 1973-05-30 | Smith Kline French Lab | 7-ureidocephalosporines |
-
1973
- 1973-05-29 ZA ZA733650A patent/ZA733650B/xx unknown
- 1973-06-14 CH CH865373A patent/CH573945A5/xx not_active IP Right Cessation
- 1973-06-19 BE BE132416A patent/BE801099A/xx unknown
- 1973-06-20 DE DE2331599A patent/DE2331599A1/de active Pending
- 1973-06-20 ES ES416110A patent/ES416110A1/es not_active Expired
- 1973-06-20 LU LU67826A patent/LU67826A1/xx unknown
- 1973-06-20 FR FR7322462A patent/FR2189018B1/fr not_active Expired
- 1973-06-21 NL NL7308634A patent/NL7308634A/xx unknown
- 1973-06-22 GB GB2969973A patent/GB1392156A/en not_active Expired
- 1973-06-22 JP JP48071235A patent/JPS4954394A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2189018A1 (enExample) | 1974-01-25 |
| ES416110A1 (es) | 1976-02-16 |
| JPS4954394A (enExample) | 1974-05-27 |
| LU67826A1 (enExample) | 1973-08-28 |
| AU5726073A (en) | 1975-01-09 |
| BE801099A (fr) | 1973-12-19 |
| GB1392156A (en) | 1975-04-30 |
| ZA733650B (en) | 1974-04-24 |
| NL7308634A (enExample) | 1973-12-27 |
| FR2189018B1 (enExample) | 1976-12-31 |
| CH573945A5 (enExample) | 1976-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR800001569B1 (ko) | 세팔로스포린 유도체의 제조법 | |
| DE3486259T2 (de) | Carboxyalkenamidocephalosporine. | |
| CH630923A5 (de) | Verfahren zur herstellung von neuen cephalosporinderivaten. | |
| CH641467A5 (de) | (2-(syn)-carbamoyloximinoacetamido)-cephalosporine. | |
| EP0034760A1 (de) | Cephalosporinderivate, sie enthaltende pharmazeutische Präparate und Verfahren zu ihrer Herstellung | |
| EP0009008A2 (de) | Cephalosporinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE2736471A1 (de) | Ungesaettigte 7-acylamido-3-cephem- 4-carbonsaeure-derivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel und veterinaermittel | |
| DE2527653C3 (de) | Cephalosporine, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DD202164A5 (de) | Verfahren zur herstellung von 7 beta(alpha-syn-methoxyimino-alpha-(2-aminothiazol-4-yl)-acetamido] 3-[1,2,3-thiazol-5-yl-thio]-methyl-3-cephem-4-carbonsaeure-derivaten | |
| DE2331599A1 (de) | Cephalosporinverbindungen und diese verbindungen enthaltende arzneimittel | |
| US4609654A (en) | Derivatives of cephalosporins substituted in 3 position by a thiomethyl heterocycle group; and pharmaceutical compositions containing them | |
| DE2359544A1 (de) | Cephemderivate und verfahren zu ihrer herstellung | |
| DE3851906T2 (de) | Cephalosporinverbindungen und antibakterielle Mittel. | |
| CH622799A5 (enExample) | ||
| US3912728A (en) | 7-(3-Substituted ureido and -thioureido) cephalosporins | |
| DE2539411A1 (de) | Cephamycine, ihre salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| US3994887A (en) | 7-(3-Substituted ureido) cephalosporins | |
| US3994886A (en) | 7-(3-Substituted ureido) cephalosporins | |
| DE3689762T2 (de) | Antibakterielle Verbindungen, ihre Herstellung und Verwendung. | |
| US4311842A (en) | Cephalosporin compounds | |
| CH626624A5 (enExample) | ||
| US4079134A (en) | 7-Acylamino-3-(5-sulfomethyl-1,3,4-thiadiazol-2-ylthiomethyl)-3-cephem-4-carboxylic acids | |
| EP0159011B1 (en) | Cephalosporin derivatives, process for preparing them and pharmaceutical compositions containing them | |
| DE3043865A1 (de) | N-substituierte thiazolylderivate von oxy-imino-substituierten cephalosporinen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische und veterinaermedizinische mittel | |
| DE2559932C2 (de) | Cephalosporine, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |