DE2325310A1 - Gaserzeugungssystem zum aufblasen eines prallsackes - Google Patents
Gaserzeugungssystem zum aufblasen eines prallsackesInfo
- Publication number
- DE2325310A1 DE2325310A1 DE2325310A DE2325310A DE2325310A1 DE 2325310 A1 DE2325310 A1 DE 2325310A1 DE 2325310 A DE2325310 A DE 2325310A DE 2325310 A DE2325310 A DE 2325310A DE 2325310 A1 DE2325310 A1 DE 2325310A1
- Authority
- DE
- Germany
- Prior art keywords
- gas
- layer
- chamber
- azide
- perchlorate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000007789 gas Substances 0.000 claims description 123
- 229910052751 metal Inorganic materials 0.000 claims description 77
- 239000002184 metal Substances 0.000 claims description 77
- 239000000126 substance Substances 0.000 claims description 54
- 239000000203 mixture Substances 0.000 claims description 46
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 27
- 239000007800 oxidant agent Substances 0.000 claims description 23
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 18
- 150000001540 azides Chemical class 0.000 claims description 17
- PDEROVFZLWBVSG-UHFFFAOYSA-N strontium;diazide Chemical compound [Sr+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] PDEROVFZLWBVSG-UHFFFAOYSA-N 0.000 claims description 17
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical group [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 15
- 229910052796 boron Inorganic materials 0.000 claims description 15
- 229910052782 aluminium Inorganic materials 0.000 claims description 13
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical group [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 13
- 239000003638 chemical reducing agent Substances 0.000 claims description 13
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims description 12
- 239000011777 magnesium Substances 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 12
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims description 12
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 11
- -1 alkali metal azide Chemical class 0.000 claims description 11
- 229910052749 magnesium Inorganic materials 0.000 claims description 11
- UUXFWHMUNNXFHD-UHFFFAOYSA-N barium azide Chemical compound [Ba+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] UUXFWHMUNNXFHD-UHFFFAOYSA-N 0.000 claims description 9
- 235000010333 potassium nitrate Nutrition 0.000 claims description 9
- 239000004323 potassium nitrate Substances 0.000 claims description 9
- 229910052712 strontium Inorganic materials 0.000 claims description 9
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical group [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 8
- 229910052845 zircon Inorganic materials 0.000 claims description 8
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical group [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium superoxide Chemical compound [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 6
- 239000010703 silicon Chemical group 0.000 claims description 6
- 229920002050 silicone resin Polymers 0.000 claims description 6
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- 239000010936 titanium Chemical group 0.000 claims description 6
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical group [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 239000011575 calcium Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 claims description 4
- 229910001486 lithium perchlorate Inorganic materials 0.000 claims description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 4
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 claims description 4
- 229910001488 sodium perchlorate Inorganic materials 0.000 claims description 4
- 239000011135 tin Chemical group 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- 239000011800 void material Substances 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Chemical group 0.000 claims description 3
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910000519 Ferrosilicon Inorganic materials 0.000 claims description 2
- 239000004153 Potassium bromate Substances 0.000 claims description 2
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 claims description 2
- 229940117975 chromium trioxide Drugs 0.000 claims description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 claims description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 claims description 2
- HPGPEWYJWRWDTP-UHFFFAOYSA-N lithium peroxide Chemical compound [Li+].[Li+].[O-][O-] HPGPEWYJWRWDTP-UHFFFAOYSA-N 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical group [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229940094037 potassium bromate Drugs 0.000 claims description 2
- 235000019396 potassium bromate Nutrition 0.000 claims description 2
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 claims description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 claims 2
- UPEMTJWJZGTCKB-UHFFFAOYSA-N chloric acid perchloric acid Chemical compound OCl(=O)=O.OCl(=O)(=O)=O UPEMTJWJZGTCKB-UHFFFAOYSA-N 0.000 claims 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 claims 1
- YOBAEOGBNPPUQV-UHFFFAOYSA-N iron;trihydrate Chemical compound O.O.O.[Fe].[Fe] YOBAEOGBNPPUQV-UHFFFAOYSA-N 0.000 claims 1
- 229910021514 lead(II) hydroxide Inorganic materials 0.000 claims 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims 1
- 239000004744 fabric Substances 0.000 description 30
- 239000000463 material Substances 0.000 description 21
- 238000002485 combustion reaction Methods 0.000 description 16
- 239000003826 tablet Substances 0.000 description 15
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 13
- 239000004677 Nylon Substances 0.000 description 12
- 229920001778 nylon Polymers 0.000 description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 11
- 239000011888 foil Substances 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical group [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000011491 glass wool Substances 0.000 description 6
- 230000004048 modification Effects 0.000 description 6
- 238000012986 modification Methods 0.000 description 6
- 239000011148 porous material Substances 0.000 description 6
- 229910001220 stainless steel Inorganic materials 0.000 description 6
- 229910052726 zirconium Inorganic materials 0.000 description 6
- 229910052742 iron Inorganic materials 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 229910052788 barium Inorganic materials 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 3
- 239000000567 combustion gas Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000009931 harmful effect Effects 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000003252 repetitive effect Effects 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 239000002341 toxic gas Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 101710171359 3-deoxy-manno-octulosonate cytidylyltransferase 2 Proteins 0.000 description 1
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- ZRGUXTGDSGGHLR-UHFFFAOYSA-K aluminum;triperchlorate Chemical compound [Al+3].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O ZRGUXTGDSGGHLR-UHFFFAOYSA-K 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- XMFOQHDPRMAJNU-UHFFFAOYSA-N lead(ii,iv) oxide Chemical group O1[Pb]O[Pb]11O[Pb]O1 XMFOQHDPRMAJNU-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940080286 lowsium Drugs 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- TWRAJPCQPHBABR-UHFFFAOYSA-N magnesium;diazide Chemical compound [Mg+2].[N-]=[N+]=[N-].[N-]=[N+]=[N-] TWRAJPCQPHBABR-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000004972 metal peroxides Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000033116 oxidation-reduction process Effects 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 230000001739 rebound effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/26—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow
- B60R21/264—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic
- B60R21/2644—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic using only solid reacting substances, e.g. pellets, powder
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/04—Blasting cartridges, i.e. case and explosive for producing gas under pressure
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/26—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow
- B60R21/263—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using a variable source, e.g. plural stage or controlled output
- B60R2021/2633—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using a variable source, e.g. plural stage or controlled output with a plurality of inflation levels
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R21/00—Arrangements or fittings on vehicles for protecting or preventing injuries to occupants or pedestrians in case of accidents or other traffic risks
- B60R21/02—Occupant safety arrangements or fittings, e.g. crash pads
- B60R21/16—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags
- B60R21/26—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow
- B60R21/264—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic
- B60R21/2644—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic using only solid reacting substances, e.g. pellets, powder
- B60R2021/2648—Inflatable occupant restraints or confinements designed to inflate upon impact or impending impact, e.g. air bags characterised by the inflation fluid source or means to control inflation fluid flow using instantaneous generation of gas, e.g. pyrotechnic using only solid reacting substances, e.g. pellets, powder comprising a plurality of combustion chambers or sub-chambers
Landscapes
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP47049743A JPS4913837A (enExample) | 1972-05-19 | 1972-05-19 | |
| JP1972060085U JPS5152745Y2 (enExample) | 1972-05-23 | 1972-05-23 | |
| JP1972060086U JPS5152746Y2 (enExample) | 1972-05-23 | 1972-05-23 | |
| JP1972063103U JPS5152747Y2 (enExample) | 1972-05-29 | 1972-05-29 | |
| JP2552773A JPS5729440B2 (enExample) | 1973-03-03 | 1973-03-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2325310A1 true DE2325310A1 (de) | 1973-12-06 |
Family
ID=27520747
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2325310A Ceased DE2325310A1 (de) | 1972-05-19 | 1973-05-18 | Gaserzeugungssystem zum aufblasen eines prallsackes |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3904221A (enExample) |
| DE (1) | DE2325310A1 (enExample) |
| FR (1) | FR2185982A5 (enExample) |
| GB (1) | GB1399574A (enExample) |
| IT (1) | IT990576B (enExample) |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2600426A1 (de) * | 1975-01-08 | 1976-07-15 | Eaton Corp | Stroemungsmittelversorgung |
| DE2551921A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Gaserzeugendes azid-verbindungsgemisch |
| DE2551920A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Stroemungsmittelversorgung fuer ein insassen-rueckhaltesystem |
| DE2629463A1 (de) * | 1975-06-30 | 1977-01-20 | Eaton Corp | Stroemungsmittelgenerator |
| DE2629462A1 (de) * | 1975-06-30 | 1977-01-20 | Eaton Corp | Filter |
| FR2340762A1 (fr) * | 1976-02-13 | 1977-09-09 | Eaton Corp | Perfectionnements relatifs aux filtres pour les alimentations en fluide des dispositifs de retenue d'occupant de vehicule |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
| EP0135030A1 (en) * | 1983-07-26 | 1985-03-27 | Chubb Australia Limited | Fire detectors and fire protection systems incorporating such detectors |
| DE3602731A1 (de) * | 1985-01-30 | 1986-10-30 | Talley Defense Systems, Inc., Mesa, Ariz. | Zusammensetzung und verfahren zur erzeugung von stickstoffgas |
| DE19681768B4 (de) * | 1996-10-29 | 2006-04-20 | Daicel Chemical Industries, Ltd. | Gasgenerator für einen Airbag |
| DE112015005459B4 (de) * | 2014-12-03 | 2024-02-15 | Daicel Corporation | Gasgenerator |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1443547A (en) | 1973-12-17 | 1976-07-21 | Canadian Ind | Metal oxide/azide gas generating compositions |
| JPS5321779B2 (enExample) * | 1974-05-15 | 1978-07-05 | ||
| US4005876A (en) * | 1975-04-10 | 1977-02-01 | Thiokol Corporation | Gas generator for automobile safety cushions |
| US4322385A (en) * | 1976-02-13 | 1982-03-30 | Eaton Corporation | Filters for vehicle occupant restraint system fluid supplies |
| JPS52121242A (en) * | 1976-04-05 | 1977-10-12 | Daicel Chem Ind Ltd | Gas generator for gas bag |
| US4158696A (en) * | 1977-09-28 | 1979-06-19 | Talley Industries Of Arizona, Inc. | Air cushion restraint inflator assembly |
| US4648460A (en) * | 1979-10-12 | 1987-03-10 | Chubb Australia Limited | Fire protection system |
| US4533416A (en) * | 1979-11-07 | 1985-08-06 | Rockcor, Inc. | Pelletizable propellant |
| US4810005A (en) * | 1986-07-22 | 1989-03-07 | Trw Repa Gmbh | Gas cushion impact protection device for motor vehicles |
| US4758287A (en) * | 1987-06-15 | 1988-07-19 | Talley Industries, Inc. | Porous propellant grain and method of making same |
| US4796912A (en) * | 1987-11-12 | 1989-01-10 | Morton Thiokol, Inc. | Elongate gas generator for inflating vehicle inflatable restraint cushions |
| GB2213404A (en) * | 1987-12-14 | 1989-08-16 | Breed Automotive Corp | Airbag inflator |
| US4858951A (en) * | 1988-05-04 | 1989-08-22 | Trw Vehicle Safety Systems, Inc. | Igniter for gas generating material |
| US4929290A (en) * | 1988-07-25 | 1990-05-29 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US4920743A (en) * | 1988-07-25 | 1990-05-01 | Hercules Incorporated | Crash bag propellant composition and method for generating nitrogen gas |
| US4923212A (en) * | 1988-08-17 | 1990-05-08 | Talley Automotive Products, Inc. | Lightweight non-welded inflator unit for automobile airbags |
| US4907819A (en) * | 1988-09-16 | 1990-03-13 | Talley Automotive Products, Inc. | Lightweight non-welded gas generator with rolled spun lip |
| GB2227552B (en) * | 1988-11-24 | 1992-12-09 | Autoliv Dev | Improvements in or relating to a gas generator |
| US4915410A (en) * | 1988-11-28 | 1990-04-10 | Trw Vehicle Safety Systems Inc. | Vehicle air bag module and method of assembly |
| US5005486A (en) * | 1989-02-03 | 1991-04-09 | Trw Vehicle Safety Systems Inc. | Igniter for airbag propellant grains |
| US5033390A (en) * | 1989-11-13 | 1991-07-23 | Morton International, Inc. | Trilevel performance gas generator |
| US5060973A (en) * | 1990-07-23 | 1991-10-29 | General Electric Company | Liquid propellant inflator for vehicle occupant restraint apparatus |
| DE4200833A1 (de) * | 1991-01-19 | 1992-07-23 | Dynamit Nobel Ag | Gasgenerator, insbesondere fuer airbag |
| US5197756A (en) * | 1991-04-12 | 1993-03-30 | Trw Vehicle Safety Systems Inc. | Air bag inflator and method of assembly |
| JPH0829696B2 (ja) * | 1991-06-21 | 1996-03-27 | ティーアールダブリュー・ヴィークル・セーフティ・システムズ・インコーポレーテッド | エアバッグインフレータ |
| US5390954A (en) * | 1991-06-21 | 1995-02-21 | Trw Vehicle Safety Systems Inc. | Inflator assembly |
| US5478109A (en) * | 1991-06-21 | 1995-12-26 | Trw Vehicle Safety Systems, Inc. | Inflator assembly |
| US5387296A (en) * | 1991-08-23 | 1995-02-07 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| US5143567A (en) * | 1991-08-23 | 1992-09-01 | Morton International, Inc. | Additive approach to ballistic and slag melting point control of azide-based gas generant compositions |
| DE4229624C2 (de) * | 1991-09-05 | 2000-12-07 | Trw Inc | Aufblasvorrichtung für eine Fahrzeuginsassen-Rückhaltevorrichtung |
| US5197758A (en) * | 1991-10-09 | 1993-03-30 | Morton International, Inc. | Non-azide gas generant formulation, method, and apparatus |
| US5160386A (en) * | 1991-11-04 | 1992-11-03 | Morton International, Inc. | Gas generant formulations containing poly(nitrito) metal complexes as oxidants and method |
| US5397544A (en) * | 1991-11-14 | 1995-03-14 | Nippon Koki Co., Ltd | Air bag inflation gas generator |
| DE4239167C2 (de) * | 1992-11-21 | 1996-03-21 | Bayerische Motoren Werke Ag | Gasgenerator für eine Gassack-Einheit |
| US5423384A (en) * | 1993-06-24 | 1995-06-13 | Olin Corporation | Apparatus for suppressing a fire |
| US5449041A (en) * | 1993-06-24 | 1995-09-12 | Olin Corporation | Apparatus and method for suppressing a fire |
| KR0148835B1 (ko) * | 1993-08-20 | 1998-10-15 | 제임스 엠. 루즈벨트 | 팽창 기구를 팽창시키는 장치 |
| US5514230A (en) * | 1995-04-14 | 1996-05-07 | Automotive Systems Laboratory, Inc. | Nonazide gas generating compositions with a built-in catalyst |
| DE749946T1 (de) * | 1995-06-22 | 1997-09-04 | Nippon Koki Kk | Gaserzeugende Zusammensetzung |
| FR2740545B1 (fr) * | 1995-10-30 | 1997-12-05 | Livbag Snc | Generateur pyrotechnique de gaz,a debit variable,pour coussins de protection |
| US5849054A (en) * | 1995-10-31 | 1998-12-15 | Nippon Reinz Co., Ltd. | Filter for an inflator |
| DE19541584A1 (de) * | 1995-11-08 | 1997-05-15 | Temic Bayern Chem Airbag Gmbh | Anordnung zum mehrstufigen Zünden von Gasgeneratoren |
| US5934705A (en) * | 1997-03-06 | 1999-08-10 | Automotive Systems Laboratory, Inc. | Two chamber inflator body |
| US5799969A (en) * | 1997-03-18 | 1998-09-01 | Trw Inc. | Vehicle occupant protection apparatus |
| DE19728438A1 (de) * | 1997-07-03 | 1999-01-07 | Temic Bayern Chem Airbag Gmbh | Pyrotechnischer Gasgenerator |
| US6007098A (en) * | 1998-02-18 | 1999-12-28 | Autoliv Asp, Inc. | Low cost pyrotechnic inflator |
| US6123359A (en) * | 1998-07-25 | 2000-09-26 | Breed Automotive Technology, Inc. | Inflator for use with gas generant compositions containing guanidines |
| US6217441B1 (en) | 1999-03-30 | 2001-04-17 | Honeywell International Inc. | Method and apparatus for sealing building ductwork during chemical or biological attack |
| ATE419218T1 (de) * | 1999-05-18 | 2009-01-15 | Southwest Res Inst | Energieaktivierte zusammensetzung zur kontrollierten, zeitverzögerten gasfreisetzung |
| US7273567B1 (en) | 1999-11-24 | 2007-09-25 | Microactive Corp. | Energy-activated compositions for controlled sustained release of a gas |
| US6428680B1 (en) | 1999-07-23 | 2002-08-06 | Honeywell International Inc. | Method of providing safe haven within buildings during chemical or biological attack |
| US6701772B2 (en) | 2000-12-22 | 2004-03-09 | Honeywell International Inc. | Chemical or biological attack detection and mitigation system |
| US6688968B2 (en) | 2001-01-22 | 2004-02-10 | Honeywell International Inc. | Method and apparatus for protecting buildings from contamination during chemical or biological attack |
| JP4632787B2 (ja) * | 2002-09-13 | 2011-02-16 | オートモーティブ システムズ ラボラトリー インコーポレーテッド | インフレータ |
| US7192055B2 (en) * | 2003-11-13 | 2007-03-20 | Automotive Systems Laboratory, Inc. | Pyrotechnic linear inflator |
| US7243946B2 (en) * | 2003-11-18 | 2007-07-17 | Automotive Systems Laboratory, Inc. | Peroxide linear inflator |
| US7080854B2 (en) | 2004-01-13 | 2006-07-25 | Automotive Systems Laboratory, Inc. | Pyrotechnic linear inflator |
| US20050200103A1 (en) * | 2004-02-27 | 2005-09-15 | Burns Sean P. | Pyrotechnic linear inflator with structural enhancement |
| US7789018B2 (en) * | 2004-04-02 | 2010-09-07 | Automotive Systems Laboratory, Inc. | Gas generator assembly |
| US7293798B2 (en) * | 2004-04-05 | 2007-11-13 | Automotive Systems Laboratory, Inc. | Pyrotechnic linear inflator |
| KR100612417B1 (ko) * | 2004-07-21 | 2006-08-16 | 삼성전자주식회사 | 펄스-기반 고속 저전력 게이티드 플롭플롭 회로 |
| US8622419B2 (en) * | 2004-07-27 | 2014-01-07 | Automotive Systems Laboratory, Inc. | Vehicle component with integral inflator |
| WO2006078819A2 (en) * | 2005-01-20 | 2006-07-27 | Automotive Systems Laboratory, Inc. | Flexible gas generator |
| JP4953998B2 (ja) * | 2007-09-18 | 2012-06-13 | 株式会社ダイセル | 人員拘束装置用ガス発生器 |
| JP6563773B2 (ja) * | 2015-10-20 | 2019-08-21 | 株式会社ダイセル | 煙幕発生器 |
| JP6543560B2 (ja) * | 2015-11-26 | 2019-07-10 | 株式会社ダイセル | ガス発生器 |
| WO2020191063A1 (en) * | 2019-03-18 | 2020-09-24 | Fenyves Andras | Airbag system and related methods of inflating an airbag |
| DE102019134263A1 (de) * | 2019-12-13 | 2021-06-17 | Zf Airbag Germany Gmbh | Gasgenerator |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3066014A (en) * | 1958-04-18 | 1962-11-27 | Hycon Mfg Company | Cool gas generator |
| US3527472A (en) * | 1968-01-23 | 1970-09-08 | Eaton Yale & Towne | Vehicle safety apparatus |
| US3618976A (en) * | 1969-10-31 | 1971-11-09 | Chrysler Corp | Inflatable bag and gas diffusing device |
| US3663035A (en) * | 1970-01-27 | 1972-05-16 | Ensign Bickford Co | Self-contained passenger restraining system |
| CA935457A (en) * | 1970-02-18 | 1973-10-16 | Kurokawa Isao | Gas-producing device for an inflatable body-protecting bag on a high-speed vehicle |
| US3690695A (en) * | 1970-08-14 | 1972-09-12 | Jones Sr John L | Personnel restraint system for vehicular occupants |
| US3733180A (en) * | 1971-01-08 | 1973-05-15 | Boeing Co | Solid state cool gas generator |
| US3666289A (en) * | 1971-01-11 | 1972-05-30 | Gen Motors Corp | Inflatable occupant restraint system |
| US3785674A (en) * | 1971-06-14 | 1974-01-15 | Rocket Research Corp | Crash restraint nitrogen generating inflation system |
| US3741585A (en) * | 1971-06-29 | 1973-06-26 | Thiokol Chemical Corp | Low temperature nitrogen gas generating composition |
| US3773351A (en) * | 1971-08-02 | 1973-11-20 | Timmerman H | Gas generator |
-
1973
- 1973-05-10 US US358931A patent/US3904221A/en not_active Expired - Lifetime
- 1973-05-17 GB GB2350073A patent/GB1399574A/en not_active Expired
- 1973-05-18 FR FR7318230A patent/FR2185982A5/fr not_active Expired
- 1973-05-18 DE DE2325310A patent/DE2325310A1/de not_active Ceased
- 1973-05-21 IT IT7324331A patent/IT990576B/it active
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2551921A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Gaserzeugendes azid-verbindungsgemisch |
| DE2551920A1 (de) * | 1974-11-29 | 1976-08-12 | Eaton Corp | Stroemungsmittelversorgung fuer ein insassen-rueckhaltesystem |
| DE2600426A1 (de) * | 1975-01-08 | 1976-07-15 | Eaton Corp | Stroemungsmittelversorgung |
| FR2332787A1 (fr) * | 1975-06-30 | 1977-06-24 | Eaton Corp | Filtre pour alimentation en fluide d'un systeme de retenue d'occupant de vehicule et son procede de montage |
| DE2629462A1 (de) * | 1975-06-30 | 1977-01-20 | Eaton Corp | Filter |
| US4012211A (en) * | 1975-06-30 | 1977-03-15 | Eaton Corporation | Filter for occupant restraint system fluid supply |
| DE2629463A1 (de) * | 1975-06-30 | 1977-01-20 | Eaton Corp | Stroemungsmittelgenerator |
| FR2340762A1 (fr) * | 1976-02-13 | 1977-09-09 | Eaton Corp | Perfectionnements relatifs aux filtres pour les alimentations en fluide des dispositifs de retenue d'occupant de vehicule |
| DE3316529A1 (de) * | 1982-10-16 | 1984-11-08 | Erno Raumfahrttechnik Gmbh, 2800 Bremen | Stoffgemisch zur gaserzeugung |
| EP0135030A1 (en) * | 1983-07-26 | 1985-03-27 | Chubb Australia Limited | Fire detectors and fire protection systems incorporating such detectors |
| DE3602731A1 (de) * | 1985-01-30 | 1986-10-30 | Talley Defense Systems, Inc., Mesa, Ariz. | Zusammensetzung und verfahren zur erzeugung von stickstoffgas |
| DE19681768B4 (de) * | 1996-10-29 | 2006-04-20 | Daicel Chemical Industries, Ltd. | Gasgenerator für einen Airbag |
| DE112015005459B4 (de) * | 2014-12-03 | 2024-02-15 | Daicel Corporation | Gasgenerator |
Also Published As
| Publication number | Publication date |
|---|---|
| IT990576B (it) | 1975-07-10 |
| US3904221A (en) | 1975-09-09 |
| FR2185982A5 (enExample) | 1974-01-04 |
| GB1399574A (en) | 1975-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2325310A1 (de) | Gaserzeugungssystem zum aufblasen eines prallsackes | |
| DE4412871C2 (de) | Zusammensetzungen für Gasgeneratoren | |
| DE69727601T2 (de) | Gasgenerator für eine Fahrzeugluftsackanordnung und Fahrzeugluftsackanordnung | |
| DE3840571C2 (enExample) | ||
| DE2551921C2 (enExample) | ||
| DE69216532T2 (de) | Azidfreie gaserzeugende Zusammensetzungen | |
| DE3602731C2 (de) | Zusammensetzung zur Erzeugung von Stickstoffgas | |
| DE3820443C2 (de) | Poröses Treibmittelkorn und Verfahren zu seiner Herstellung | |
| DE69716150T2 (de) | Rauch und Teilchen vermeidende Aufblasvorrichtung für eine aufblasbare Rückhaltesicherheitsvorrichtung | |
| DE3727851C2 (enExample) | ||
| DE69220412T2 (de) | Verfahren zur Kontrolle der Menge von Stickoxiden im generierten Gas für Airbags | |
| DE2107859C3 (de) | Gaserzeugende Vorrichtung zum Aufblasen eines zum Schutz von Fahrzeuginsassen, insbesondere Kraftfahrzeuginsassen, dienenden Sackes | |
| DE2229038A1 (de) | Lufterzeugendes Aufblassystem zur Stossdammung | |
| DE69709583T2 (de) | Gasgenerator für einen Airbag | |
| DE69316530T2 (de) | Zweikomponenten-Zünder für Gaserzeugungszusammensetzungen | |
| DE68904921T2 (de) | Zuendladungen und verfahren zu ihrer herstellung. | |
| DE2229039A1 (de) | Stickstofferzeugendes Aufblassystem zur Stoßdammung | |
| DE2712963A1 (de) | Allpyrotechnische aufblasvorrichtung | |
| DE69704030T2 (de) | Feinsteisenoxydteilchen enthaltende selbstzündungstreibladung und verfahren zur verminderung der selbstzündungtemperatur eines anzünders | |
| DE4318883A1 (de) | Mehrfachgeschichtete Gaserzeugungsscheibe zur Verwendung in Gasgeneratoren | |
| EP0712767A1 (de) | Gasgenerator für einen Airbag | |
| DE112005001238T5 (de) | Gaserzeugungssystem | |
| DE69323410T2 (de) | Gaserzeugungsmittel für airbags | |
| DE10034287C2 (de) | Gaserzeugende Zusammensetzung, die Guanylharnstoff-Dinitramid aufweist und deren Verwendung | |
| DE69621130T2 (de) | Voll pyrotechnisches verfahren zum generieren eines teilchenfreien, farblosen und geruchlosen nicht-giftigen gases |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8131 | Rejection |