DE2322127A1 - Cephalosporinverbindungen und deren salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel - Google Patents
Cephalosporinverbindungen und deren salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittelInfo
- Publication number
- DE2322127A1 DE2322127A1 DE2322127A DE2322127A DE2322127A1 DE 2322127 A1 DE2322127 A1 DE 2322127A1 DE 2322127 A DE2322127 A DE 2322127A DE 2322127 A DE2322127 A DE 2322127A DE 2322127 A1 DE2322127 A1 DE 2322127A1
- Authority
- DE
- Germany
- Prior art keywords
- carboxylic acid
- cephem
- acid
- methyl
- ylmercaptomethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 28
- 150000001875 compounds Chemical class 0.000 title claims description 24
- 150000003839 salts Chemical class 0.000 title claims description 8
- 229940126601 medicinal product Drugs 0.000 title description 2
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- -1 nitro, amino Chemical group 0.000 claims description 77
- 229940124587 cephalosporin Drugs 0.000 claims description 27
- 229930186147 Cephalosporin Natural products 0.000 claims description 26
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- VYNUATGQEAAPAQ-UHFFFAOYSA-N 2-sulfonylacetic acid Chemical compound OC(=O)C=S(=O)=O VYNUATGQEAAPAQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- CRRVDOAUWWYNDN-FFFFSGIJSA-N CN1C=NN=C1SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)(=O)C)SC2)C(=O)O Chemical compound CN1C=NN=C1SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)(=O)C)SC2)C(=O)O CRRVDOAUWWYNDN-FFFFSGIJSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- NAACAICRJIXPRJ-MRVPVSSYSA-N (6R)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1C(=NN=C1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O NAACAICRJIXPRJ-MRVPVSSYSA-N 0.000 claims 1
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 claims 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 claims 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 claims 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims 1
- SGHNHYDGYAEFCF-QHDYGNBISA-N NS(=O)(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2C)C(=O)O)C1=O Chemical compound NS(=O)(=O)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2C)C(=O)O)C1=O SGHNHYDGYAEFCF-QHDYGNBISA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- 239000000243 solution Substances 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000002253 acid Substances 0.000 description 21
- 150000002148 esters Chemical class 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 159000000000 sodium salts Chemical class 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- NYEHUAQIJXERLP-UHFFFAOYSA-N 2-methylsulfonylacetic acid Chemical compound CS(=O)(=O)CC(O)=O NYEHUAQIJXERLP-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- CIDCHEUESAYNBR-UHFFFAOYSA-N 2-(dimethylsulfamoyl)acetic acid Chemical compound CN(C)S(=O)(=O)CC(O)=O CIDCHEUESAYNBR-UHFFFAOYSA-N 0.000 description 6
- FUYOZIVWKHUWQX-UHFFFAOYSA-N 2-sulfamoylacetic acid Chemical class NS(=O)(=O)CC(O)=O FUYOZIVWKHUWQX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 6
- FYXYSGFRHQVNCY-UHFFFAOYSA-N 2-(trifluoromethylsulfonyl)acetic acid Chemical compound OC(=O)CS(=O)(=O)C(F)(F)F FYXYSGFRHQVNCY-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 4
- XTKCDFOXCDJUGE-UHFFFAOYSA-N 2-ethylsulfonylacetic acid Chemical compound CCS(=O)(=O)CC(O)=O XTKCDFOXCDJUGE-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical class OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 4
- HJSGHKMSDOLGJJ-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 HJSGHKMSDOLGJJ-IOJJLOCKSA-N 0.000 description 3
- YTEFAALYDTWTLB-UHFFFAOYSA-N 2-(benzenesulfonyl)acetic acid Chemical compound OC(=O)CS(=O)(=O)C1=CC=CC=C1 YTEFAALYDTWTLB-UHFFFAOYSA-N 0.000 description 3
- JYLZNLNPDIOMOV-UHFFFAOYSA-N 2-propylsulfonylacetic acid Chemical compound CCCS(=O)(=O)CC(O)=O JYLZNLNPDIOMOV-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ITLHXEGAYQFOHJ-UHFFFAOYSA-N [diazo(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(=[N+]=[N-])C1=CC=CC=C1 ITLHXEGAYQFOHJ-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- VNNJNTZHOWNSOH-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C(C)=NC(SCC=2CS[C@H]3N(C(C3N)=O)C=2C(O)=O)=N1 VNNJNTZHOWNSOH-IOJJLOCKSA-N 0.000 description 2
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 2
- HGTBAIVLETUVCG-UHFFFAOYSA-N (methylthio)acetic acid Chemical compound CSCC(O)=O HGTBAIVLETUVCG-UHFFFAOYSA-N 0.000 description 2
- OMAFFHIGWTVZOH-UHFFFAOYSA-N 1-methyltetrazole Chemical compound CN1C=NN=N1 OMAFFHIGWTVZOH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- XXWVANNYZKZOPC-NRWPOFLRSA-N benzhydryl (6r)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]12)CC=C(C(=O)OC(C=3C=CC=CC=3)C=3C=CC=CC=3)N1C(=O)C2NC(=O)CC1=CC=CS1 XXWVANNYZKZOPC-NRWPOFLRSA-N 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- ZZJNYZZMWBXNON-SSDOTTSWSA-N (6R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O ZZJNYZZMWBXNON-SSDOTTSWSA-N 0.000 description 1
- SZITXVHJZWMRFJ-QHDYGNBISA-N (6R)-7-[(2-methylsulfonylacetyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CS(C)(=O)=O)[C@H]2SC1 SZITXVHJZWMRFJ-QHDYGNBISA-N 0.000 description 1
- LBJTZAXHUUNCPM-XCGJVMPOSA-N (6R)-7-amino-3-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CSC2=NN=C(N2C)C(F)(F)F)C(=O)O)C1=O LBJTZAXHUUNCPM-XCGJVMPOSA-N 0.000 description 1
- ATIDVCNJKCPDAC-QFSRMBNQSA-N (6R)-8-oxo-7-[(2-sulfonylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S(=O)(=O)=CC(=O)NC1[C@@H]2N(C(=CCS2)C(=O)O)C1=O ATIDVCNJKCPDAC-QFSRMBNQSA-N 0.000 description 1
- VWKZOTOKKINGGP-GCZXYKMCSA-N (6r)-3-formyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid Chemical compound C1([C@@H]2N(C1=O)C(C(=CS2)C=O)C(=O)O)NC(=O)CC1=CC=CS1 VWKZOTOKKINGGP-GCZXYKMCSA-N 0.000 description 1
- BOKURNIWEHKSMR-OMNKOJBGSA-N (6r)-3-methyl-7-[(2-methylsulfonylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(NC(=O)CS(C)(=O)=O)[C@@H]12 BOKURNIWEHKSMR-OMNKOJBGSA-N 0.000 description 1
- HRINDZBWUZSILE-FFFFSGIJSA-N (6r)-7-[[2-(dimethylsulfamoyl)acetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)(=O)N(C)C)[C@@H]12 HRINDZBWUZSILE-FFFFSGIJSA-N 0.000 description 1
- SUNGFUINURJPOM-FFFFSGIJSA-N (6r)-7-[[2-(dimethylsulfamoyl)acetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(CSC)=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)(=O)N(C)C)[C@@H]12 SUNGFUINURJPOM-FFFFSGIJSA-N 0.000 description 1
- UYULZIHAGHENDF-QFSRMBNQSA-N (6r)-7-amino-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S([C@@H]1C(C(N1C=1)=O)N)CC=1CSC1=NN=CS1 UYULZIHAGHENDF-QFSRMBNQSA-N 0.000 description 1
- VPELFMVIWMHYHL-IOJJLOCKSA-N (6r)-7-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NSC(SCC=2CS[C@H]3N(C(C3N)=O)C=2C(O)=O)=N1 VPELFMVIWMHYHL-IOJJLOCKSA-N 0.000 description 1
- RSULBEJNHMXIEP-IOJJLOCKSA-N (6r)-7-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1C=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 RSULBEJNHMXIEP-IOJJLOCKSA-N 0.000 description 1
- IWPJVSCKARINRQ-FFFFSGIJSA-N (6r)-7-amino-3-[(5-butyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(CCCC)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 IWPJVSCKARINRQ-FFFFSGIJSA-N 0.000 description 1
- CJRSCCYNMLNTMS-OMNKOJBGSA-N (6r)-7-amino-3-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(CC)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 CJRSCCYNMLNTMS-OMNKOJBGSA-N 0.000 description 1
- MWVRMPWRUIHXEP-OMNKOJBGSA-N (6r)-7-amino-3-[(5-ethyl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C(CC)=NC(SCC=2CS[C@H]3N(C(C3N)=O)C=2C(O)=O)=N1 MWVRMPWRUIHXEP-OMNKOJBGSA-N 0.000 description 1
- ZORQJZNPETZVMH-NHXUYEQSSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)-sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1C(S)C1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 ZORQJZNPETZVMH-NHXUYEQSSA-N 0.000 description 1
- MJLFVGPLFHIBHR-IOJJLOCKSA-N (6r)-7-amino-3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(N(C)C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 MJLFVGPLFHIBHR-IOJJLOCKSA-N 0.000 description 1
- NVIAYEIXYQCDAN-HWZXHQHMSA-N (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 NVIAYEIXYQCDAN-HWZXHQHMSA-N 0.000 description 1
- LRGZZONZUPMKGF-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-(2h-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC=1N=NNN=1 LRGZZONZUPMKGF-HWZXHQHMSA-N 0.000 description 1
- BDSDFCVDQUGOFB-XNCJUZBTSA-N (6s,7s)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical group S1CC(COC)=C(C(O)=O)N2C(=O)[C@H](N)[C@H]12 BDSDFCVDQUGOFB-XNCJUZBTSA-N 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- HZDMNWYSHCWPLK-UHFFFAOYSA-N 2-(trifluoromethyl)-1,3,4-thiadiazole Chemical compound FC(F)(F)C1=NN=CS1 HZDMNWYSHCWPLK-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MCFSNYMQISXQTF-UHFFFAOYSA-N 2-chlorosulfonylacetyl chloride Chemical compound ClC(=O)CS(Cl)(=O)=O MCFSNYMQISXQTF-UHFFFAOYSA-N 0.000 description 1
- VJIKFWJCVWFZIN-UHFFFAOYSA-N 2-ethylsulfanylacetic acid Chemical compound CCSCC(O)=O VJIKFWJCVWFZIN-UHFFFAOYSA-N 0.000 description 1
- RBKUOSVTNSIAAB-UHFFFAOYSA-N 2-methylsulfonylpropanoic acid Chemical group OC(=O)C(C)S(C)(=O)=O RBKUOSVTNSIAAB-UHFFFAOYSA-N 0.000 description 1
- MOTOSAGBNXXRRE-UHFFFAOYSA-N 2-phenylsulfanylacetic acid Chemical compound OC(=O)CSC1=CC=CC=C1 MOTOSAGBNXXRRE-UHFFFAOYSA-N 0.000 description 1
- ZLAIUYZHCQJJCE-UHFFFAOYSA-N 2-propylsulfanylacetic acid Chemical compound CCCSCC(O)=O ZLAIUYZHCQJJCE-UHFFFAOYSA-N 0.000 description 1
- JSGPBRQYMLFVJQ-UHFFFAOYSA-N 2-sulfanylhexanoic acid Chemical compound CCCCC(S)C(O)=O JSGPBRQYMLFVJQ-UHFFFAOYSA-N 0.000 description 1
- IMGGANUNCHXAQF-UHFFFAOYSA-N 2-sulfanylpentanoic acid Chemical compound CCCC(S)C(O)=O IMGGANUNCHXAQF-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- AGXRPOJTZPZMMO-FFFFSGIJSA-N CC1=NC(=NN1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)(=O)C)SC2)C(=O)O Chemical compound CC1=NC(=NN1)SCC2=C(N3[C@@H](C(C3=O)NC(=O)CS(=O)(=O)C)SC2)C(=O)O AGXRPOJTZPZMMO-FFFFSGIJSA-N 0.000 description 1
- KXQCDSNENZJCSL-LHIURRSHSA-N CCN1C(SCC(CS[C@@H]2C3N)=CN2C3=O)=NN=C1 Chemical compound CCN1C(SCC(CS[C@@H]2C3N)=CN2C3=O)=NN=C1 KXQCDSNENZJCSL-LHIURRSHSA-N 0.000 description 1
- PPTFNEITTBJWDW-FFFFSGIJSA-N CCS(=O)(=O)CC(=O)NC1[C@@H]2N(C1=O)C(=C(CS2)CSC3=NN=NN3C)C(=O)O Chemical compound CCS(=O)(=O)CC(=O)NC1[C@@H]2N(C1=O)C(=C(CS2)CSC3=NN=NN3C)C(=O)O PPTFNEITTBJWDW-FFFFSGIJSA-N 0.000 description 1
- JLEXVVLPSMMNDS-JLOHTSLTSA-N CCS(=O)(=O)CC(=O)NC1[C@@H]2N(C1=O)C(=C(CS2)CSC3=NNC(=N3)C)C(=O)O Chemical compound CCS(=O)(=O)CC(=O)NC1[C@@H]2N(C1=O)C(=C(CS2)CSC3=NNC(=N3)C)C(=O)O JLEXVVLPSMMNDS-JLOHTSLTSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- SGULOPRLUCGLSH-UHFFFAOYSA-M Cl[Rh].[C]=O.c1ccc(cc1)P(c1ccccc1)c1ccccc1.c1ccc(cc1)P(c1ccccc1)c1ccccc1 Chemical compound Cl[Rh].[C]=O.c1ccc(cc1)P(c1ccccc1)c1ccccc1.c1ccc(cc1)P(c1ccccc1)c1ccccc1 SGULOPRLUCGLSH-UHFFFAOYSA-M 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- 229910014142 Na—O Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- NYYBPASOTOAXQW-LRTDYKAYSA-N benzhydryl (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@@H]1C(C(N11)=O)N)CC=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 NYYBPASOTOAXQW-LRTDYKAYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000002031 ethanolic fraction Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- ARUIMKUOHIINGI-UHFFFAOYSA-N trifluoro(methylsulfonyl)methane Chemical compound CS(=O)(=O)C(F)(F)F ARUIMKUOHIINGI-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/542—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with heterocyclic ring systems
- A61K31/545—Compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins, cefaclor, or cephalexine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US249858A US3865819A (en) | 1972-05-03 | 1972-05-03 | Substituted sulfonylacetamido cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2322127A1 true DE2322127A1 (de) | 1973-11-22 |
Family
ID=22945311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2322127A Pending DE2322127A1 (de) | 1972-05-03 | 1973-05-02 | Cephalosporinverbindungen und deren salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3865819A (enExample) |
| JP (1) | JPS4954391A (enExample) |
| AU (1) | AU466397B2 (enExample) |
| BE (1) | BE798927A (enExample) |
| CA (1) | CA1027110A (enExample) |
| CH (1) | CH594683A5 (enExample) |
| DE (1) | DE2322127A1 (enExample) |
| FR (1) | FR2183225B1 (enExample) |
| GB (1) | GB1363222A (enExample) |
| NL (1) | NL7305941A (enExample) |
| SE (1) | SE419339B (enExample) |
| ZA (1) | ZA732980B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3880848A (en) * | 1973-06-18 | 1975-04-29 | Smithkline Corp | 7-Trifluorome thylsulfinylacetamido cephalosporins |
| US3963709A (en) * | 1973-08-17 | 1976-06-15 | Smithkline Corporation | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins |
| US3963711A (en) * | 1973-08-17 | 1976-06-15 | Smithkline Corporation | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins |
| US3998819A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethyl-mercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US3998818A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethylmercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US4107304A (en) * | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4091217A (en) * | 1974-05-28 | 1978-05-23 | Toshiyasu Ishimaru | 7-((5'-N-Methylthioacetamido)-adipoamido)cephalosporin derivatives |
| GB1457238A (en) * | 1974-05-28 | 1976-12-01 | Sangyo Kagaku Kenkyu Kyokai | Cephalosporin derivatives |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| DK586175A (da) * | 1974-12-28 | 1976-06-29 | Asahi Chemical Ind | Cephalosporin-forbindelser |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4020057A (en) * | 1975-06-18 | 1977-04-26 | Smithkline Corporation | 7β-Acyloxy cephalosporins |
| US4075338A (en) * | 1975-12-29 | 1978-02-21 | Smithkline Corporation | Substituted acetamidocephalosporins |
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4034092A (en) * | 1976-05-03 | 1977-07-05 | Smithkline Corporation | 7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4229573A (en) * | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1067965A (en) * | 1965-01-22 | 1967-05-10 | Beecham Group Ltd | Penicillins, esters, amides and salts thereof |
| GB1279402A (en) * | 1968-06-14 | 1972-06-28 | Glaxo Lab Ltd | Improvements in or relating to cephalosporin derivatives |
| US3657232A (en) * | 1970-06-19 | 1972-04-18 | R & L Molecular Research Ltd | 7-((o-aminomethylphenylthio)-acetamido) cephalosporanic acid |
-
1972
- 1972-05-03 US US249858A patent/US3865819A/en not_active Expired - Lifetime
-
1973
- 1973-04-26 GB GB1985773A patent/GB1363222A/en not_active Expired
- 1973-04-27 NL NL7305941A patent/NL7305941A/xx not_active Application Discontinuation
- 1973-04-30 BE BE130594A patent/BE798927A/xx not_active IP Right Cessation
- 1973-04-30 CA CA169,838A patent/CA1027110A/en not_active Expired
- 1973-05-02 AU AU55151/73A patent/AU466397B2/en not_active Expired
- 1973-05-02 CH CH623373A patent/CH594683A5/xx not_active IP Right Cessation
- 1973-05-02 DE DE2322127A patent/DE2322127A1/de active Pending
- 1973-05-02 ZA ZA732980A patent/ZA732980B/xx unknown
- 1973-05-02 JP JP48049603A patent/JPS4954391A/ja active Pending
- 1973-05-02 SE SE7306097A patent/SE419339B/xx unknown
- 1973-05-03 FR FR7315922A patent/FR2183225B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE419339B (sv) | 1981-07-27 |
| AU5515173A (en) | 1974-11-07 |
| US3865819A (en) | 1975-02-11 |
| FR2183225B1 (enExample) | 1976-12-31 |
| NL7305941A (enExample) | 1973-11-06 |
| BE798927A (fr) | 1973-10-30 |
| CA1027110A (en) | 1978-02-28 |
| FR2183225A1 (enExample) | 1973-12-14 |
| CH594683A5 (enExample) | 1978-01-31 |
| JPS4954391A (enExample) | 1974-05-27 |
| AU466397B2 (en) | 1975-10-30 |
| ZA732980B (en) | 1974-04-24 |
| GB1363222A (en) | 1974-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461478C2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| DE2322127A1 (de) | Cephalosporinverbindungen und deren salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH630923A5 (de) | Verfahren zur herstellung von neuen cephalosporinderivaten. | |
| DE2834097A1 (de) | Eckige klammer auf 2-(syn)-carbamoyloximinoacetamido eckige klammer zu -cephalosporine, verfahren zu deren herstellung sowie diese enthaltende therapeutische mittel fuer die behandlung von bakteriellen infektionen | |
| DE2439880C3 (de) | (6R, 7R)-3-Carbamoyloxymethyl-7- [2-(fur-2-yl)-2methoxyiminoacetamido] -ceph-S-em^carbonsäure und Verfahren zur ihrer Herstellung | |
| DE2848912C2 (enExample) | ||
| DE2336345A1 (de) | Cephalosporinverbindungen, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2824559A1 (de) | 7 alpha -methoxy-7 beta-(1,3- dithietan-2-carboxamido)cephalosporansaeurederivate und verfahren zu ihrer herstellung | |
| EP0009008A2 (de) | Cephalosporinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE3789720T2 (de) | Cephalosporinverbindungen. | |
| DE2217563A1 (de) | Verfahren zur Herstellung von Acylaminoverbindungen | |
| DE2852538A1 (de) | Neue oximderivate der 3-substituierten 7-amino-thiazolyl-acetamido-cephalosporansaeure, verfahren zu deren herstellung und die sie enthaltenden pharmazeutischen zusammensetzungen | |
| DE1670324A1 (de) | Neue Derivate der 7-Amino-cephalosporansaeure | |
| DE3650157T2 (de) | Cephalosporin-verbindungen. | |
| CH609700A5 (en) | Process for the preparation of cephalosporin derivatives | |
| DE2914843A1 (de) | 7 alpha -methoxycephalosporin-derivate, verfahren zu deren herstellung und deren verwendung | |
| DE2724073A1 (de) | 3,7-disubstituierte 3-cephem-4- carbonsaeuren und sie enthaltende pharmazeutische zubereitungen | |
| DE2539411A1 (de) | Cephamycine, ihre salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| DE2158330A1 (de) | Cephalosporansäureverbindungen und diese Verbindungen enthaltende Arzneimittel | |
| DE2345236A1 (de) | Quaternaere ammoniumverbindungen, verfahren zu deren herstellung und sie enthaltende arzneimittel | |
| DE3035259A1 (de) | Cephalosporinverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| AT391319B (de) | Verfahren zur herstellung von neuen cephalosporinverbindungen | |
| DE2804040A1 (de) | Verfahren zur herstellung von cephemverbindungen | |
| DE2427267A1 (de) | Cephalosporansaeurederivate, verfahren zu ihrer herstellung und ihre verwendung in pharmazeutischen zubereitungen | |
| CH634848A5 (de) | Verfahren zur herstellung neuer 7-(n-substituierter 2-phenylglycinamido)-3-substituierte-3-cephem-4-carbonsaeuren. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |