DE2321452A1 - S-triazintetracarbonsaeuren und -dianhydride - Google Patents
S-triazintetracarbonsaeuren und -dianhydrideInfo
- Publication number
- DE2321452A1 DE2321452A1 DE2321452A DE2321452A DE2321452A1 DE 2321452 A1 DE2321452 A1 DE 2321452A1 DE 2321452 A DE2321452 A DE 2321452A DE 2321452 A DE2321452 A DE 2321452A DE 2321452 A1 DE2321452 A1 DE 2321452A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- triazine
- alkyl
- nitrogen
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 title description 4
- 239000002253 acid Substances 0.000 title description 4
- 150000007513 acids Chemical class 0.000 title description 2
- -1 diphenylamino group Chemical group 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000004986 diarylamino group Chemical group 0.000 claims description 9
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- UBFGYIIKLBHJQQ-UHFFFAOYSA-N 2H-1,3,5-triazine-1,5,6,6-tetracarboxylic acid Chemical class N1(C(N(CN=C1)C(=O)O)(C(=O)O)C(=O)O)C(=O)O UBFGYIIKLBHJQQ-UHFFFAOYSA-N 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims 1
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 15
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000006159 dianhydride group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- QUGARBUWMZNRER-UHFFFAOYSA-N 2,4-bis(1,6-dimethylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine Chemical compound CC1(C(C=CC=C1)C)C1=NC(=NC=N1)C1(C(C=CC=C1)C)C QUGARBUWMZNRER-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- PXZYCKZVTABEMU-UHFFFAOYSA-N 4-[4-(3,4-dicarboxyphenyl)-6-(n-phenylanilino)-1,3,5-triazin-2-yl]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1C1=NC(N(C=2C=CC=CC=2)C=2C=CC=CC=2)=NC(C=2C=C(C(C(O)=O)=CC=2)C(O)=O)=N1 PXZYCKZVTABEMU-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000004642 Polyimide Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229920001721 polyimide Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- REZANMGXIZGTFB-UHFFFAOYSA-N 2,4-bis(3,4-dimethylphenyl)-6-phenyl-1,3,5-triazine Chemical compound C1(=CC=CC=C1)C1=NC(=NC(=N1)C1=CC(=C(C=C1)C)C)C1=CC(=C(C=C1)C)C REZANMGXIZGTFB-UHFFFAOYSA-N 0.000 description 1
- AMEVJOWOWQPPJQ-UHFFFAOYSA-N 2,4-dichloro-6-phenyl-1,3,5-triazine Chemical compound ClC1=NC(Cl)=NC(C=2C=CC=CC=2)=N1 AMEVJOWOWQPPJQ-UHFFFAOYSA-N 0.000 description 1
- UITKHKNFVCYWNG-UHFFFAOYSA-N 4-(3,4-dicarboxybenzoyl)phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1C(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 UITKHKNFVCYWNG-UHFFFAOYSA-N 0.000 description 1
- OJBSZTPXJAYVHB-UHFFFAOYSA-N 4-[4-(3,4-dicarboxyphenyl)-1,3,5-triazin-2-yl]phthalic acid Chemical compound C(=O)(O)C=1C=C(C=CC1C(=O)O)C1=NC=NC(=N1)C1=CC(=C(C=C1)C(=O)O)C(=O)O OJBSZTPXJAYVHB-UHFFFAOYSA-N 0.000 description 1
- STXHTUPLMQKBMY-UHFFFAOYSA-N 4-[4-(3,4-dicarboxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1C1=NC(C=2C=CC=CC=2)=NC(C=2C=C(C(C(O)=O)=CC=2)C(O)=O)=N1 STXHTUPLMQKBMY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 229920005575 poly(amic acid) Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000000000 tetracarboxylic acids Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Plural Heterocyclic Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00248838A US3843649A (en) | 1972-05-01 | 1972-05-01 | S-triazine tetracarboxylic acids and dianhydrides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2321452A1 true DE2321452A1 (de) | 1973-11-15 |
Family
ID=22940898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2321452A Pending DE2321452A1 (de) | 1972-05-01 | 1973-04-27 | S-triazintetracarbonsaeuren und -dianhydride |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3843649A (enExample) |
| JP (1) | JPS4954387A (enExample) |
| DE (1) | DE2321452A1 (enExample) |
| FR (1) | FR2183082B1 (enExample) |
| GB (1) | GB1425241A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3946011A (en) * | 1974-07-17 | 1976-03-23 | Ciba-Geigy Corporation | S-Triazine tetracarboxylic acids and dianhydrides |
| US3943133A (en) * | 1975-02-13 | 1976-03-09 | Ciba-Geigy Corporation | S-Triazine hexacarboxylic acids and trianhydrides |
| EP2138486B2 (en) * | 2007-03-26 | 2022-10-19 | NIPPON STEEL Chemical & Material Co., Ltd. | Organic electroluminescent device |
| CN101899014B (zh) * | 2010-08-13 | 2012-06-13 | 中南大学 | 2,4-二(4-甲羧基苯基)-6-苯基-1,3,5-三嗪及其衍生物和制备方法 |
| CN118772128B (zh) * | 2024-07-09 | 2025-03-21 | 波米科技有限公司 | 一种含三嗪基团的二酐化合物及其制备方法和应用 |
-
1972
- 1972-05-01 US US00248838A patent/US3843649A/en not_active Expired - Lifetime
-
1973
- 1973-04-26 JP JP48048276A patent/JPS4954387A/ja active Pending
- 1973-04-27 FR FR7315423A patent/FR2183082B1/fr not_active Expired
- 1973-04-27 DE DE2321452A patent/DE2321452A1/de active Pending
- 1973-04-30 GB GB2057073A patent/GB1425241A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2183082B1 (enExample) | 1976-09-10 |
| FR2183082A1 (enExample) | 1973-12-14 |
| GB1425241A (en) | 1976-02-18 |
| US3843649A (en) | 1974-10-22 |
| JPS4954387A (enExample) | 1974-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0013443B1 (de) | 2,2,6,6-Tetramethylpiperidin-Derivate, Verfahren zu ihrer Herstellung und mit ihrer Hilfe stabilisierte synthetische Polymere | |
| US4754033A (en) | Process for producing pyridine-2,3-dicarboxylic acid derivatives; and novel 1-amino-1,2,3,4-tetrahydropyridine-2,3-dicarboxylic acid derivatives and 1,4-dihydropyridine-2,3-dicarboxylic acid derivatives | |
| DE2321452A1 (de) | S-triazintetracarbonsaeuren und -dianhydride | |
| DE1132560B (de) | Verfahren zur Herstellung von 1, 3, 5-Triazinderivaten | |
| DE4208005C2 (de) | Aromatische Polyamide und Verfahren zu deren Herstellung | |
| DE2462113B2 (de) | Acetylensubstituieite Polyamid-Oligomere | |
| DE2202167A1 (de) | Verfahren zur Herstellung von Aminophenoxy-Benzonitrilen und die damit erhaltenen Produkte | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE4333697A1 (de) | Verfahren zur Herstellung von 3-Aminopyridinen aus 3-Nitropyridinen | |
| DE2336551A1 (de) | Verfahren zur herstellung von diphenylamiden | |
| DE2321530A1 (de) | 4,6-bis-(alkaryl)-s-triazine und verfahren zu deren herstellung | |
| DE1816993B2 (de) | Verfahren zur herstellung von indolyl-3-essigsaeuren | |
| CH616167A5 (enExample) | ||
| DE2407044C3 (de) | Stabilisierte thermoplastische Formmasse | |
| DE2814330B2 (de) | Verfahren zur Herstellung von 2,6-Dichlorpyridin-Derivaten | |
| CH419394A (de) | Verfahren zur Herstellung von linearen Chinacridin-dionen | |
| AT251596B (de) | Verfahren zur Herstellung von neuen 5,6-Dihydro-5-oxo-11H-pyrido[2,3-b][1,5]benzodiazepinen | |
| DE3625269A1 (de) | 7,7,8,8-tetracyanchinodimethan-2,5-ylen (3-propionsaeure) und derivate davon, verfahren zu deren herstellung und deren verwendung | |
| DE2407015B2 (de) | Dihalogen-bis(2-pyridylthio)-Zinn (IV)-Verbindungen und Verfahren zu deren Herstellung | |
| DE1543941C (de) | Verfahren zur Herstellung von 1-Oxa-2-methyl-3-aminocarbonyl-4-thia-cyclohex-2-en-4-oxiden oder 4,4-dioxiden | |
| DE2605187A1 (de) | S-triazinhexacarbonsaeuren und deren anhydride | |
| DE2039820C3 (de) | Verfahren zur Herstellung von wiederkehrende Thioäthergruppen enthaltenden Polyamidsäuren und deren Verwendung | |
| AT324295B (de) | Verfahren zum chlorieren von maleinsäureanhydrid oder gegebemenfalls n-substituierten maleinsäureimiden bzw. bismaleinsäureimiden | |
| DE19727828B4 (de) | Cyclohexan-1,2,4,5-diimid-Derivat und Verfahren zur Herstellung desselben | |
| AT273097B (de) | Verfahren zur Herstellung von neuen Imidazolpyridinderivaten und ihren Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |