DE2319816C2 - Piperidin-Derivate, Verfahren zu deren Herstellung und deren Verwendung - Google Patents
Piperidin-Derivate, Verfahren zu deren Herstellung und deren VerwendungInfo
- Publication number
- DE2319816C2 DE2319816C2 DE2319816A DE2319816A DE2319816C2 DE 2319816 C2 DE2319816 C2 DE 2319816C2 DE 2319816 A DE2319816 A DE 2319816A DE 2319816 A DE2319816 A DE 2319816A DE 2319816 C2 DE2319816 C2 DE 2319816C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- general formula
- triazine
- hours
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title description 7
- 238000002360 preparation method Methods 0.000 title description 6
- 150000003053 piperidines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 47
- -1 alkyl radical Chemical class 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 35
- 239000000203 mixture Substances 0.000 description 34
- 239000000243 solution Substances 0.000 description 34
- 239000007787 solid Substances 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- 238000004458 analytical method Methods 0.000 description 25
- 238000000921 elemental analysis Methods 0.000 description 25
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 19
- 239000000463 material Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 229920000642 polymer Polymers 0.000 description 18
- 239000004743 Polypropylene Substances 0.000 description 16
- 229920001155 polypropylene Polymers 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000001257 hydrogen Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- 238000001914 filtration Methods 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-Tetramethylpiperidine Substances CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 150000002431 hydrogen Chemical group 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 230000005855 radiation Effects 0.000 description 6
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- FTVFPPFZRRKJIH-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-amine Chemical compound CC1(C)CC(N)CC(C)(C)N1 FTVFPPFZRRKJIH-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000000944 Soxhlet extraction Methods 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000004611 light stabiliser Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000008033 biological extinction Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- YAXWOADCWUUUNX-UHFFFAOYSA-N 1,2,2,3-tetramethylpiperidine Chemical group CC1CCCN(C)C1(C)C YAXWOADCWUUUNX-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VLTHAKKFNPUWSB-UHFFFAOYSA-N 1-benzyl-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1CC1=CC=CC=C1 VLTHAKKFNPUWSB-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- FAPCFNWEPHTUQK-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[NH+]1[O-] FAPCFNWEPHTUQK-UHFFFAOYSA-N 0.000 description 1
- DPVIABCMTHHTGB-UHFFFAOYSA-N 2,4,6-trichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(Cl)=N1 DPVIABCMTHHTGB-UHFFFAOYSA-N 0.000 description 1
- LHPPDQUVECZQSW-UHFFFAOYSA-N 2-(benzotriazol-2-yl)-4,6-ditert-butylphenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(N2N=C3C=CC=CC3=N2)=C1O LHPPDQUVECZQSW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- ACAHVXOSWOUZAB-UHFFFAOYSA-N 4,6-dichloro-n-ethyl-1,3,5-triazin-2-amine Chemical compound CCNC1=NC(Cl)=NC(Cl)=N1 ACAHVXOSWOUZAB-UHFFFAOYSA-N 0.000 description 1
- UWDMKTDPDJCJOP-UHFFFAOYSA-N 4-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylate Chemical compound CC1(C)CC(O)(C(O)=O)CC(C)(C)N1 UWDMKTDPDJCJOP-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 238000003833 Wallach reaction Methods 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000012435 aralkylating agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N butyl alcohol Substances CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001715 carbamic acids Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- QFXZANXYUCUTQH-UHFFFAOYSA-N ethynol Chemical compound OC#C QFXZANXYUCUTQH-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 238000001782 photodegradation Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical class [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000037072 sun protection Effects 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
- C08K5/34926—Triazines also containing heterocyclic groups other than triazine groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1855872A GB1393551A (en) | 1972-04-21 | 1972-04-21 | Piperidine derivatives |
| GB546973 | 1973-02-03 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2319816A1 DE2319816A1 (de) | 1973-10-31 |
| DE2319816C2 true DE2319816C2 (de) | 1982-07-29 |
Family
ID=26239907
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2319816A Expired DE2319816C2 (de) | 1972-04-21 | 1973-04-18 | Piperidin-Derivate, Verfahren zu deren Herstellung und deren Verwendung |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3925376A (enExample) |
| JP (1) | JPS5756516B2 (enExample) |
| AT (1) | AT328191B (enExample) |
| CA (1) | CA1003417A (enExample) |
| CH (1) | CH587337A5 (enExample) |
| DE (1) | DE2319816C2 (enExample) |
| FR (1) | FR2181059B1 (enExample) |
| GB (1) | GB1393551A (enExample) |
| HK (1) | HK47777A (enExample) |
| IT (1) | IT982818B (enExample) |
| MY (1) | MY7800026A (enExample) |
| NL (1) | NL175417C (enExample) |
| SE (1) | SE409576B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3304266A1 (de) * | 1982-02-10 | 1983-08-18 | APITAL Produzioni Industriali S.p.A., Milano | Piperidin derivate und ihre anwendung als stabilisatoren fuer polymere |
| EP0107615A1 (de) * | 1982-09-30 | 1984-05-02 | Ciba-Geigy Ag | Mit Bis- oder Tris-(polyalkylpiperidinyl-amino)-1,3,5-triazine stabilisierte Polyolefine |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH582231A5 (enExample) * | 1973-12-10 | 1976-11-30 | Sandoz Ag | |
| US4204060A (en) | 1974-10-04 | 1980-05-20 | Akzona Incorporated | Novel monochloro-s-triazine derivatives |
| US4191683A (en) * | 1975-05-28 | 1980-03-04 | Ciba-Geigy Corporation | Derivatives of 4-aminopiperidine as stabilizers for polymers |
| IT1052501B (it) * | 1975-12-04 | 1981-07-20 | Chimosa Chimica Organica Spa | Composti politriazinici utilizzabili per la stabilizzazione di polimeri sintetici e procedimento per la loro preparazione |
| IT1060458B (it) * | 1975-12-18 | 1982-08-20 | Chimosa Chimica Organica Spa | Composti piperidil triazinici adatti per la stabilizzazione di polimeri sintetici e procedimento per la loro preparazione |
| US4161592A (en) * | 1976-07-08 | 1979-07-17 | Ciba-Geigy Corporation | Piperidinyl-s-triazines |
| IT1123083B (it) * | 1976-11-26 | 1986-04-30 | Chimosa Chimica Organica Spa | Derivati piperidinici della 1,3,5 triazina quali stabilizzanti per polimeri sintetici che li comprendono e procedimento per la loro preparazione |
| JPS5373241A (en) * | 1976-12-10 | 1978-06-29 | Adeka Argus Chem Co Ltd | Stabilized synthetic resin compositions |
| EP0002754B1 (de) * | 1977-12-30 | 1983-05-18 | Ciba-Geigy Ag | Neue Polyalkylpiperidinderivate von s-Triazinen, ihre Verwendung zum Stabilisieren von Kunststoffen und die so stabilisierten Kunststoffe |
| DE2862332D1 (en) | 1977-12-30 | 1983-11-10 | Ciba Geigy Ag | Stabilisation of heat-curable metallic enamel paints against the action of light, humidity and oxygen by the addition of polyalkylpiperidine derivatives |
| DE2961381D1 (en) * | 1978-02-08 | 1982-01-28 | Ciba Geigy Ag | Polyalkylpiperidine derivatives of s-triazines, their use as stabilizers for polymers and polymers thus stabilized |
| JPS554331A (en) * | 1978-06-24 | 1980-01-12 | Sankyo Co Ltd | Piperidine-spiro-hydantoin derivative |
| US4315859A (en) * | 1979-01-15 | 1982-02-16 | Ciba-Geigy Corporation | 1,3,5-Triazines containing at least one piperidine radical |
| US4288593A (en) * | 1979-02-06 | 1981-09-08 | Ciba-Geigy Corporation | Polyalkylpiperidine derivatives of s-triazines |
| JPS564639A (en) * | 1979-06-23 | 1981-01-19 | Sankyo Co Ltd | Stabilizer for high-molecular material |
| DE2933078A1 (de) * | 1979-08-16 | 1981-03-26 | Hoechst Ag, 65929 Frankfurt | Neue triazinderivate, ihre herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
| DE2944729A1 (de) * | 1979-11-06 | 1981-05-14 | Hoechst Ag, 6000 Frankfurt | Neue triazinstabilisatoren |
| DE3027223A1 (de) * | 1980-07-18 | 1982-02-11 | Hoechst Ag, 6000 Frankfurt | Triazinylaminotriazine, ihre herstellung und verwendung |
| DE3201415A1 (de) * | 1981-01-28 | 1982-08-26 | Sandoz-Patent-GmbH, 7850 Lörrach | 4-aminomethyl-polyalkylpiperidine |
| DE3111209A1 (de) * | 1981-03-21 | 1982-09-30 | Hoechst Ag, 6000 Frankfurt | Hochmolekulare piperidingruppenhaltige ester und urethane, verfahren zu ihrer herstellung, ihre verwendung als stabilisatoren fuer polymere sowie diese verbindungen enthaltende polymere |
| DE3269955D1 (en) * | 1981-07-20 | 1986-04-24 | American Cyanamid Co | Novel light stabilizers for polymers |
| JPS5847030A (ja) * | 1981-09-14 | 1983-03-18 | Adeka Argus Chem Co Ltd | 安定化された合成樹脂組成物 |
| IT1195277B (it) * | 1981-10-02 | 1988-10-12 | Chimosa Chimica Organica Spa | Piperidil derivati di composti triazinici macrociclici,aventi attivita' stabilizzante per i polimeri e processi per la loro preparazione |
| EP0078603A1 (en) * | 1981-10-12 | 1983-05-11 | Imperial Chemical Industries Plc | Polyolefin compositions and articles sterilisable by irradiation |
| EP0080431B1 (de) * | 1981-10-16 | 1986-09-24 | Ciba-Geigy Ag | Synergistisches Gemisch von niedermolekularen und hochmolekularen Polyalkylpiperidinen |
| IT1152192B (it) * | 1982-05-19 | 1986-12-31 | Apital Prod Ind | Composti per stabilizzare i polimeri |
| DE3379050D1 (en) * | 1982-08-11 | 1989-03-02 | Ciba Geigy Ag | Process for the chemical bond between a stabilising compound and a polymer |
| US5260362A (en) * | 1982-09-30 | 1993-11-09 | Ciba-Geigy Corporation | Polyolefines which have been stabilized with bis-(polyalkypiperidiny(amino)-1,3,5-triazines or tris-(polyalkylpiperidinyl(amino)-1,3,5-triazines |
| US4511684A (en) * | 1982-12-15 | 1985-04-16 | Ems-Inventa Ag | Flame retardant polyamides and agent for inducing flame retardancy |
| US4696959A (en) * | 1983-09-26 | 1987-09-29 | Ppg Industries, Inc. | Modified piperidines as ultraviolet light stabilizers |
| US4960593A (en) * | 1985-01-30 | 1990-10-02 | Hilmont Incorporated | Process for preparing thermally stable olefinic polymers |
| JPS6218443A (ja) * | 1985-07-17 | 1987-01-27 | Adeka Argus Chem Co Ltd | 安定化高分子材料組成物 |
| US4629752A (en) | 1985-07-22 | 1986-12-16 | The B. F. Goodrich Company | Substituted oxo-piperazinyl-triazines and UV light stabilized compositions |
| JPS6250342A (ja) * | 1985-08-30 | 1987-03-05 | Adeka Argus Chem Co Ltd | 安定化された高分子材料組成物 |
| US4746692A (en) * | 1986-05-05 | 1988-05-24 | Shell Oil Company | Polyolefin compositions for use with water systems |
| IT1223405B (it) * | 1987-12-04 | 1990-09-19 | Ciba Geigy Spa | Procedimento per la metilazione di composti triazinici contenenti gruppi 2,2,6,6 tetrametilpiperidinici |
| AU621082B2 (en) * | 1988-02-08 | 1992-03-05 | Ciba-Geigy Ag | Tetramethylpiperidino-s-triazines |
| US5000917A (en) * | 1988-02-29 | 1991-03-19 | Phillips Petroleum Company | Corrosion inhibition of polymethylphenthene |
| US4793972A (en) * | 1988-02-29 | 1988-12-27 | Phillips Petroleum Company | Corrosion inhibition of polymethylpentene |
| US5066460A (en) * | 1988-02-29 | 1991-11-19 | Phillips Petroleum Company | Corrosion inhibition of polymethylpentene |
| US4968736A (en) * | 1988-02-29 | 1990-11-06 | Willcox Kenneth W | Corrosion inhibition of polymethylpentene |
| EP0351360B1 (de) * | 1988-06-30 | 1995-02-22 | Ciba-Geigy Ag | Verfahren zur Herstellung von thermisch stabilen Olefinpolymeren |
| US5244948A (en) * | 1988-06-30 | 1993-09-14 | Ciba-Geigy Corporation | Process for the stabilization of polyolefins |
| IT1226857B (it) * | 1988-09-23 | 1991-02-19 | Ciba Geigy Spa | Composti piperidin triazinici atti all'impiego come stabilizzanti per materiali organici. |
| CS273098B1 (en) * | 1989-01-02 | 1991-03-12 | Manasek Zdenek | Substituted polyaminotriazines and method of their preparation |
| US5932640A (en) * | 1989-01-21 | 1999-08-03 | Clariant Finance (Bvi) Limited | Dyeability or mass coloration of synthetic polyamide |
| DE69008406T2 (de) * | 1989-03-21 | 1994-08-25 | Ciba Geigy Ag | N-Hydroxycarbyloxy-Derivate von s-Triazinen mit gehinderter Aminogruppe. |
| IT1230091B (it) * | 1989-04-27 | 1991-10-05 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| US5194466A (en) * | 1989-04-27 | 1993-03-16 | Ciba-Geigy Corporation | Piperidine-triazine compounds for use as stabilizers for organic materials |
| IT1237126B (it) * | 1989-11-07 | 1993-05-18 | Ciba Geigy Spa | Stabilizzanti polimerici contenenti gruppi amminici impediti e gruppi idrossilamminici |
| JP2559302B2 (ja) * | 1991-03-25 | 1996-12-04 | 平安油脂化学工業株式会社 | 絹製品の改質加工用組成物及びその改質加工方法 |
| IT1247977B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Stabilizzazione di materiali organici polimerici mediante l`impiego dimiscele sinergiche costituite da ammine cicliche stericamente impeditee derivati del 3-pirazolidinone o del 1,2,4,-triazolidin-3,5,-dione |
| IT1252227B (it) * | 1991-12-17 | 1995-06-05 | Ciba Geigy Spa | Composti tetrametilpiperidinici atti all'impiego come stabilizzanti per materiali organici |
| IT1256636B (it) * | 1992-12-10 | 1995-12-12 | Ciba Geigy Spa | Processo per la preparazione di 2,2,6,6-tetrametil-4- piperidilossi-1,3,5-triazine contenenti due o piu' anelli triazinici |
| IT1263993B (it) * | 1993-04-05 | 1996-09-06 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| US5449777A (en) * | 1993-07-08 | 1995-09-12 | Ciba-Geigy Corporation | Phenolic s-triazines |
| TW358820B (en) * | 1995-04-11 | 1999-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW390897B (en) * | 1995-07-21 | 2000-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| CN101812056A (zh) * | 2004-06-18 | 2010-08-25 | 神经研究公司 | 作为单胺神经递质再摄取抑制剂的新颖烷基取代的哌啶衍生物 |
| CN103122076A (zh) * | 2006-10-17 | 2013-05-29 | 三井化学株式会社 | 树脂组合物以及由该组合物得到的成型体 |
| BRPI1006391B1 (pt) | 2009-04-03 | 2019-07-02 | 3M Innovative Properties Company | Meio filtrante de eletreto e método de preparo de uma manta de eletreto |
| BRPI1006343B1 (pt) | 2009-04-03 | 2022-02-01 | 3M Innovative Properties Company | Métodos de preparação de uma manta e de uma manta de eletreto e meio filtrante à base de eletreto |
| AU2014336388B2 (en) | 2013-10-17 | 2018-04-12 | Basf Se | Triazine, piperidine and pyrrolidine based hindered amine light stabilizers |
| JP7172527B2 (ja) * | 2017-12-26 | 2022-11-16 | Jnc株式会社 | ピペリジン誘導体、液晶組成物および液晶表示素子 |
| EP3853300A1 (en) * | 2018-09-19 | 2021-07-28 | Borealis AG | Use of a low molecular weight triazine based compound as thermal / light stabilizer in polymers |
| CN110256730A (zh) * | 2019-06-03 | 2019-09-20 | 华南理工大学 | 用于耐候聚氯乙烯材料的光稳定剂及其制备方法与应用 |
| CN112759577A (zh) * | 2020-12-30 | 2021-05-07 | 宿迁联盛科技股份有限公司 | 一种光稳定剂及其制备方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL126079C (enExample) * | 1960-04-12 | |||
| US3156689A (en) * | 1960-04-12 | 1964-11-10 | Geigy Chem Corp | 1, 4-phenylene-bis |
| US3156690A (en) * | 1960-04-12 | 1964-11-10 | Geigy Chem Corp | 6 (nu-acyl-alkylhydroxyanilino)-2, 4-bis-(alkylthio)-1, 3, 5-triazines |
| DE1695737B2 (de) * | 1966-06-15 | 1976-09-23 | Sankyo Co. Ltd., Tokio | 2,2,5,5-tetrasubstituierte imidazolidin-4-on-1-oxide |
| US3753986A (en) * | 1970-04-02 | 1973-08-21 | Exxon Research Engineering Co | Triazine herbicides |
| US3734883A (en) * | 1970-04-16 | 1973-05-22 | Ciba Geigy Corp | Stabilizing organic material with piperidone azines |
-
1972
- 1972-04-21 GB GB1855872A patent/GB1393551A/en not_active Expired
-
1973
- 1973-04-04 SE SE7304735A patent/SE409576B/xx unknown
- 1973-04-10 CA CA168,344A patent/CA1003417A/en not_active Expired
- 1973-04-11 US US350296A patent/US3925376A/en not_active Expired - Lifetime
- 1973-04-18 CH CH563373A patent/CH587337A5/xx not_active IP Right Cessation
- 1973-04-18 DE DE2319816A patent/DE2319816C2/de not_active Expired
- 1973-04-19 NL NLAANVRAGE7305620,A patent/NL175417C/xx not_active IP Right Cessation
- 1973-04-19 AT AT353973A patent/AT328191B/de not_active IP Right Cessation
- 1973-04-20 FR FR7314553A patent/FR2181059B1/fr not_active Expired
- 1973-04-20 JP JP48045007A patent/JPS5756516B2/ja not_active Expired
- 1973-04-20 IT IT7323342A patent/IT982818B/it active
-
1977
- 1977-09-15 HK HK477/77A patent/HK47777A/xx unknown
-
1978
- 1978-12-31 MY MY197826A patent/MY7800026A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3304266A1 (de) * | 1982-02-10 | 1983-08-18 | APITAL Produzioni Industriali S.p.A., Milano | Piperidin derivate und ihre anwendung als stabilisatoren fuer polymere |
| EP0107615A1 (de) * | 1982-09-30 | 1984-05-02 | Ciba-Geigy Ag | Mit Bis- oder Tris-(polyalkylpiperidinyl-amino)-1,3,5-triazine stabilisierte Polyolefine |
| EP0227640A1 (de) * | 1982-09-30 | 1987-07-01 | Ciba-Geigy Ag | Mit Bis-(polyalkylpiperidinyl-amino)-1,3,5-triazinen stabilisierte Polyolefine |
Also Published As
| Publication number | Publication date |
|---|---|
| IT982818B (it) | 1974-10-21 |
| US3925376A (en) | 1975-12-09 |
| GB1393551A (en) | 1975-05-07 |
| JPS4921389A (enExample) | 1974-02-25 |
| CH587337A5 (enExample) | 1977-04-29 |
| CA1003417A (en) | 1977-01-11 |
| DE2319816A1 (de) | 1973-10-31 |
| NL175417B (nl) | 1984-06-01 |
| MY7800026A (en) | 1978-12-31 |
| SE409576B (sv) | 1979-08-27 |
| NL175417C (nl) | 1984-11-01 |
| FR2181059B1 (enExample) | 1976-04-23 |
| FR2181059A1 (enExample) | 1973-11-30 |
| HK47777A (en) | 1977-09-23 |
| JPS5756516B2 (enExample) | 1982-11-30 |
| ATA353973A (de) | 1975-05-15 |
| NL7305620A (enExample) | 1973-10-23 |
| AT328191B (de) | 1976-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2319816C2 (de) | Piperidin-Derivate, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2760429C2 (enExample) | ||
| DE2456864C2 (enExample) | ||
| DE2258752C2 (enExample) | ||
| DE2636130C3 (de) | Mindestens einen 2,2,6,6-Tetramethylpiperidylrest enthaltende 133-Triazinylverbindungen, Verfahren zu ihrer Herstellung und Mittel zur Stabilisierung von Polymerisaten | |
| EP0014683B1 (de) | Neue Polyalkylpiperidinderivate von s-Triazinen, deren Verwendung als Stabilisatoren für Polymere und mit diesen Verbindungen stabilisierte Polymerzusammensetzungen | |
| DE2352658C2 (enExample) | ||
| DE2636144A1 (de) | Neue polytriazinverbindungen | |
| EP0024338A1 (de) | Neue Triazinderivate, ihre Herstellung und ihre Verwendung als Stabilisatoren für synthetische Polymere | |
| EP0101411B1 (de) | Verfahren zur chemischen Bindung von Stabilisatoren an Polymere | |
| DE2730449A1 (de) | Neue 1,3-pyrimidine und 1,3,5-triazine | |
| DE1769646C3 (de) | Stabilisierung von synthetischen Polymeren | |
| EP0031304A1 (de) | Piperidinderivate als Stabilisatoren für synthetische Polymere | |
| EP0029522A1 (de) | s-Triazinderivate, ihre Herstellung aus Halogentriazinylaminen und Polyaminen, und ihre Verwendung als Stabilisatoren | |
| DE3229640A1 (de) | Copolymere polyalkylpiperidine | |
| DE3304266A1 (de) | Piperidin derivate und ihre anwendung als stabilisatoren fuer polymere | |
| DE2851448C2 (enExample) | ||
| DE2128757A1 (de) | Piperidinderivate und deren Verwendung als Stabilisatoren | |
| DE3027223A1 (de) | Triazinylaminotriazine, ihre herstellung und verwendung | |
| EP0013443A1 (de) | 2,2,6,6-Tetramethylpiperidin-Derivate, Verfahren zu ihrer Herstellung und mit ihrer Hilfe stabilisierte synthetische Polymere | |
| DE2233122C3 (de) | 1,3,8-Triaza-7,7,9,9 -tetramethyl-spiro [4.5] decan-2,4-dione | |
| DE2621841A1 (de) | Lichtschutzmittel fuer polymere | |
| DE2337796A1 (de) | Neue piperidinderivate | |
| DE2821579C2 (enExample) | ||
| EP0019578A1 (de) | Piperidinverbindungen, Verfahren zu deren Herstellung und diese enthaltende polymere Zusammensetzungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |