DE2318412C2 - Azo-Reaktivfarbstoffe - Google Patents
Azo-ReaktivfarbstoffeInfo
- Publication number
- DE2318412C2 DE2318412C2 DE19732318412 DE2318412A DE2318412C2 DE 2318412 C2 DE2318412 C2 DE 2318412C2 DE 19732318412 DE19732318412 DE 19732318412 DE 2318412 A DE2318412 A DE 2318412A DE 2318412 C2 DE2318412 C2 DE 2318412C2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- methylsulfonyl
- chloro
- pyrimidine
- pyrimidinyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000985 reactive dye Substances 0.000 title claims description 11
- 239000002253 acid Substances 0.000 claims description 9
- -1 Naphthyl radical Chemical class 0.000 description 56
- 239000000975 dye Substances 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 11
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 5
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 238000004043 dyeing Methods 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000010186 staining Methods 0.000 description 4
- ZGQQEHVULTVXQD-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carboxylic acid Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)O)=CC=C21 ZGQQEHVULTVXQD-UHFFFAOYSA-N 0.000 description 3
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical class C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- NIAMELKDNLLWRH-UHFFFAOYSA-N 2,4-difluoro-5-methylpyrimidine Chemical compound CC1=CN=C(F)N=C1F NIAMELKDNLLWRH-UHFFFAOYSA-N 0.000 description 2
- SRISIBVZLCBDSX-UHFFFAOYSA-N 2,5-diaminonaphthalene-1-sulfonic acid Chemical compound NC1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 SRISIBVZLCBDSX-UHFFFAOYSA-N 0.000 description 2
- YZRMBOOBRWRVJU-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyrimidine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=NC(S(C)(=O)=O)=N1 YZRMBOOBRWRVJU-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 2
- SSOSFVFQZIRNQG-UHFFFAOYSA-N 4-hydroxynaphthalene-1,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SSOSFVFQZIRNQG-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 206010039587 Scarlet Fever Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000005521 carbonamide group Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical compound N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- CVXIRTCLVZZRKV-UHFFFAOYSA-N 1,4-dichlorophthalazine-6-carbonyl chloride Chemical compound ClC1=NN=C(Cl)C2=CC(C(=O)Cl)=CC=C21 CVXIRTCLVZZRKV-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- HAZJTCQWIDBCCE-UHFFFAOYSA-N 1h-triazine-6-thione Chemical compound SC1=CC=NN=N1 HAZJTCQWIDBCCE-UHFFFAOYSA-N 0.000 description 1
- NGCRLFIYVFOUMZ-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carbonyl chloride Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)Cl)=CC=C21 NGCRLFIYVFOUMZ-UHFFFAOYSA-N 0.000 description 1
- XVWNENDHBBGESN-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carboxylic acid;4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)O)=CC=C21.OS(=O)(=O)C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 XVWNENDHBBGESN-UHFFFAOYSA-N 0.000 description 1
- SRQAHESMVPUUGX-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-sulfonic acid Chemical compound N1=C(Cl)C(Cl)=NC2=CC(S(=O)(=O)O)=CC=C21 SRQAHESMVPUUGX-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- FYSHPROTETTWKB-UHFFFAOYSA-N 2,4,5,6-tetrabromopyrimidine Chemical compound BrC1=NC(Br)=C(Br)C(Br)=N1 FYSHPROTETTWKB-UHFFFAOYSA-N 0.000 description 1
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical compound FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 1
- OQNKONMCYMWUGP-UHFFFAOYSA-N 2,4,5,6-tetrakis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=C(S(C)(=O)=O)C(S(C)(=O)=O)=N1 OQNKONMCYMWUGP-UHFFFAOYSA-N 0.000 description 1
- BIMGULMREAFXSC-UHFFFAOYSA-N 2,4,5-trifluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1F BIMGULMREAFXSC-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- AZVALKSFVWAVOL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1F AZVALKSFVWAVOL-UHFFFAOYSA-N 0.000 description 1
- CZHWBISSOIPPNL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=C(F)N=C(F)N=C1F CZHWBISSOIPPNL-UHFFFAOYSA-N 0.000 description 1
- MLLSXQLOUGEEGV-UHFFFAOYSA-N 2,4,6-trifluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(F)N=C(F)N=C1F MLLSXQLOUGEEGV-UHFFFAOYSA-N 0.000 description 1
- JOYWMWSTASJQHZ-UHFFFAOYSA-N 2,4,6-trifluoropyrimidine-5-carbonitrile Chemical compound FC1=NC(F)=C(C#N)C(F)=N1 JOYWMWSTASJQHZ-UHFFFAOYSA-N 0.000 description 1
- VFIWQBCLEGAHDR-UHFFFAOYSA-N 2,4,6-tris(benzenesulfonyl)-1,3,5-triazine Chemical compound N=1C(S(=O)(=O)C=2C=CC=CC=2)=NC(S(=O)(=O)C=2C=CC=CC=2)=NC=1S(=O)(=O)C1=CC=CC=C1 VFIWQBCLEGAHDR-UHFFFAOYSA-N 0.000 description 1
- VAOWDUICNHWGRL-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 VAOWDUICNHWGRL-UHFFFAOYSA-N 0.000 description 1
- HICXVCLBOSYEAA-UHFFFAOYSA-N 2,4-bis(benzenesulfonyl)-5-chloro-6-methylpyrimidine Chemical compound ClC=1C(C)=NC(S(=O)(=O)C=2C=CC=CC=2)=NC=1S(=O)(=O)C1=CC=CC=C1 HICXVCLBOSYEAA-UHFFFAOYSA-N 0.000 description 1
- VFVBRPVPRYWTCL-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-6-(2,2,2-trichloroethoxy)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(OCC(Cl)(Cl)Cl)=NC(S(C)(=O)=O)=N1 VFVBRPVPRYWTCL-UHFFFAOYSA-N 0.000 description 1
- FNSNECVCDMIFBA-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-6-phenoxy-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(S(=O)(=O)C)=NC(OC=2C=CC=CC=2)=N1 FNSNECVCDMIFBA-UHFFFAOYSA-N 0.000 description 1
- CVXWQOAPKWGRTD-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)pyrimidine-5-sulfonyl chloride Chemical compound CS(=O)(=O)C1=NC=C(S(Cl)(=O)=O)C(S(C)(=O)=O)=N1 CVXWQOAPKWGRTD-UHFFFAOYSA-N 0.000 description 1
- YWURJMDYDBXTLA-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)quinazoline Chemical compound C1=CC=CC2=NC(S(=O)(=O)C)=NC(S(C)(=O)=O)=C21 YWURJMDYDBXTLA-UHFFFAOYSA-N 0.000 description 1
- ASVUGJYHCBOWLZ-UHFFFAOYSA-N 2,4-bis(trichloromethylsulfonyl)quinoline Chemical compound C1=CC=CC2=NC(S(=O)(=O)C(Cl)(Cl)Cl)=CC(S(=O)(=O)C(Cl)(Cl)Cl)=C21 ASVUGJYHCBOWLZ-UHFFFAOYSA-N 0.000 description 1
- YXYCPKOAGWDZKX-UHFFFAOYSA-N 2,4-difluoro-5-(trifluoromethyl)pyrimidine Chemical compound FC1=NC=C(C(F)(F)F)C(F)=N1 YXYCPKOAGWDZKX-UHFFFAOYSA-N 0.000 description 1
- QYJOBZGPEJHODY-UHFFFAOYSA-N 2,4-difluoro-5-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=CN=C(F)N=C1F QYJOBZGPEJHODY-UHFFFAOYSA-N 0.000 description 1
- GIBOHPZCGYRPBS-UHFFFAOYSA-N 2,4-difluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=CN=C(F)N=C1F GIBOHPZCGYRPBS-UHFFFAOYSA-N 0.000 description 1
- GJOGRJUICNPNSV-UHFFFAOYSA-N 2,4-difluoro-5-phenylpyrimidine Chemical compound FC1=NC(F)=NC=C1C1=CC=CC=C1 GJOGRJUICNPNSV-UHFFFAOYSA-N 0.000 description 1
- FKSSZHRRUUZKCM-UHFFFAOYSA-N 2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=CC(C(F)(F)F)=NC(F)=N1 FKSSZHRRUUZKCM-UHFFFAOYSA-N 0.000 description 1
- ZCHHTEOFXSGDMW-UHFFFAOYSA-N 2,4-difluoro-6-phenylpyrimidine Chemical compound FC1=NC(F)=CC(C=2C=CC=CC=2)=N1 ZCHHTEOFXSGDMW-UHFFFAOYSA-N 0.000 description 1
- GFYWSWDNNIYIPI-UHFFFAOYSA-N 2,5,6-tris(methylsulfonyl)-1h-pyridazine Chemical compound CS(=O)(=O)N1NC(S(C)(=O)=O)=C(S(C)(=O)=O)C=C1 GFYWSWDNNIYIPI-UHFFFAOYSA-N 0.000 description 1
- AMBBZHXGKGNTMI-UHFFFAOYSA-N 2,6-dichloro-4-ethoxy-1h-triazine Chemical compound CCOC1=NN(Cl)NC(Cl)=C1 AMBBZHXGKGNTMI-UHFFFAOYSA-N 0.000 description 1
- IOXIFBCDVPDGJV-UHFFFAOYSA-N 2,6-dichloro-4-methoxy-1h-triazine Chemical compound COC1=NN(Cl)NC(Cl)=C1 IOXIFBCDVPDGJV-UHFFFAOYSA-N 0.000 description 1
- DLMSWGCJMRVWCD-UHFFFAOYSA-N 2,6-dichloro-4-phenoxy-1h-triazine Chemical compound ClN1NC(Cl)=CC(OC=2C=CC=CC=2)=N1 DLMSWGCJMRVWCD-UHFFFAOYSA-N 0.000 description 1
- BHAFVZAFEVCQGJ-UHFFFAOYSA-N 2,6-dichloro-4-phenylsulfanyl-1h-triazine Chemical compound ClN1NC(Cl)=CC(SC=2C=CC=CC=2)=N1 BHAFVZAFEVCQGJ-UHFFFAOYSA-N 0.000 description 1
- JOHYJBDEGASSCP-UHFFFAOYSA-N 2,6-dichloro-n-ethyl-1h-triazin-4-amine Chemical compound CCNC1=NN(Cl)NC(Cl)=C1 JOHYJBDEGASSCP-UHFFFAOYSA-N 0.000 description 1
- CTSJEGLSMYPRJK-UHFFFAOYSA-N 2,6-dichloro-n-methyl-1h-triazin-4-amine Chemical compound CNC1=NN(Cl)NC(Cl)=C1 CTSJEGLSMYPRJK-UHFFFAOYSA-N 0.000 description 1
- WULMCOUFBKKFQE-UHFFFAOYSA-N 2,6-dichloro-n-phenyl-1h-triazin-4-amine Chemical compound ClN1NC(Cl)=CC(NC=2C=CC=CC=2)=N1 WULMCOUFBKKFQE-UHFFFAOYSA-N 0.000 description 1
- RGNFAGBIKYERMX-UHFFFAOYSA-N 2-(4,5-dichloro-6-methylpyrimidin-2-yl)sulfonylacetic acid Chemical compound CC1=NC(S(=O)(=O)CC(O)=O)=NC(Cl)=C1Cl RGNFAGBIKYERMX-UHFFFAOYSA-N 0.000 description 1
- IDDLHNUKISKRRT-UHFFFAOYSA-N 2-(4-chloro-6-methylpyrimidin-2-yl)sulfonylethanesulfonic acid Chemical compound CC1=CC(Cl)=NC(S(=O)(=O)CCS(O)(=O)=O)=N1 IDDLHNUKISKRRT-UHFFFAOYSA-N 0.000 description 1
- FAUYZTIBIRCNPZ-UHFFFAOYSA-N 2-(benzenesulfonyl)-4,5-dichloro-6-methylpyrimidine Chemical compound ClC1=C(Cl)C(C)=NC(S(=O)(=O)C=2C=CC=CC=2)=N1 FAUYZTIBIRCNPZ-UHFFFAOYSA-N 0.000 description 1
- LNTAMLBOBVSKGY-UHFFFAOYSA-N 2-[2-(carboxymethylsulfonyl)quinolin-4-yl]sulfonylacetic acid Chemical compound C1=CC=CC2=NC(S(=O)(=O)CC(=O)O)=CC(S(=O)(=O)CC(O)=O)=C21 LNTAMLBOBVSKGY-UHFFFAOYSA-N 0.000 description 1
- ABYPMFCXYXJTFI-UHFFFAOYSA-N 2-amino-8-nitronaphthalene-1-sulfonic acid Chemical compound C1=CC=C([N+]([O-])=O)C2=C(S(O)(=O)=O)C(N)=CC=C21 ABYPMFCXYXJTFI-UHFFFAOYSA-N 0.000 description 1
- WCBVOPMSONYWEB-UHFFFAOYSA-N 2-aminoacetyl chloride Chemical compound NCC(Cl)=O WCBVOPMSONYWEB-UHFFFAOYSA-N 0.000 description 1
- OBCQPUSRAUNDAB-UHFFFAOYSA-N 2-bromoprop-2-enoyl chloride Chemical compound ClC(=O)C(Br)=C OBCQPUSRAUNDAB-UHFFFAOYSA-N 0.000 description 1
- ZYVDXPBGWGSPGT-UHFFFAOYSA-N 2-chloro-4-methylpyrimidine-5-carbonyl chloride Chemical compound CC1=NC(Cl)=NC=C1C(Cl)=O ZYVDXPBGWGSPGT-UHFFFAOYSA-N 0.000 description 1
- CTSAKABLTRMUQJ-UHFFFAOYSA-N 2-sulfonyl-3h-1,3-benzothiazole Chemical class C1=CC=C2SC(=S(=O)=O)NC2=C1 CTSAKABLTRMUQJ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- CIOZSHPCPJZSOS-UHFFFAOYSA-N 3,6-bis(benzenesulfonyl)pyridazine Chemical compound C=1C=C(S(=O)(=O)C=2C=CC=CC=2)N=NC=1S(=O)(=O)C1=CC=CC=C1 CIOZSHPCPJZSOS-UHFFFAOYSA-N 0.000 description 1
- QTAGZDNCORZVNJ-UHFFFAOYSA-N 3,6-bis(trichloromethylsulfonyl)pyridazine Chemical compound ClC(Cl)(Cl)S(=O)(=O)C1=CC=C(S(=O)(=O)C(Cl)(Cl)Cl)N=N1 QTAGZDNCORZVNJ-UHFFFAOYSA-N 0.000 description 1
- HPCLEGOUETYZIX-UHFFFAOYSA-N 3-[(8-hydroxy-6-sulfonaphthalen-2-yl)amino]benzoic acid Chemical compound OC(=O)C1=CC=CC(NC=2C=C3C(O)=CC(=CC3=CC=2)S(O)(=O)=O)=C1 HPCLEGOUETYZIX-UHFFFAOYSA-N 0.000 description 1
- USABLKDPCXBPRX-UHFFFAOYSA-N 3-[[4,6-bis(methylsulfonyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid Chemical compound CS(=O)(=O)C1=NC(S(=O)(=O)C)=NC(NC=2C=C(C=CC=2)S(O)(=O)=O)=N1 USABLKDPCXBPRX-UHFFFAOYSA-N 0.000 description 1
- VNWVMZDJPMCAKD-UHFFFAOYSA-N 3-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1O VNWVMZDJPMCAKD-UHFFFAOYSA-N 0.000 description 1
- UCTREIIEJSFTDI-UHFFFAOYSA-N 3-aminonaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(N)=CC2=C1 UCTREIIEJSFTDI-UHFFFAOYSA-N 0.000 description 1
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 1
- CGIHHZTTZZMCRK-UHFFFAOYSA-N 3-chloroquinoxaline-6-carbonyl chloride Chemical compound N1=CC(Cl)=NC2=CC(C(=O)Cl)=CC=C21 CGIHHZTTZZMCRK-UHFFFAOYSA-N 0.000 description 1
- ZRPJLDDUZPWQGQ-UHFFFAOYSA-N 4,5-dichloro-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=C(Cl)C(S(C)(=O)=O)=N1 ZRPJLDDUZPWQGQ-UHFFFAOYSA-N 0.000 description 1
- NZXOCWXWWQNPOF-UHFFFAOYSA-N 4,5-dichloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Cl NZXOCWXWWQNPOF-UHFFFAOYSA-N 0.000 description 1
- FBDGJZXFKQZWLX-UHFFFAOYSA-N 4,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC=N1 FBDGJZXFKQZWLX-UHFFFAOYSA-N 0.000 description 1
- OQBHJNZDUUOZPL-UHFFFAOYSA-N 4-(carbamoylamino)-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)N)=CC(S(O)(=O)=O)=CC2=C1 OQBHJNZDUUOZPL-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 1
- BUVOCOQOYNGMCO-UHFFFAOYSA-N 4-benzamido-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=C(S(O)(=O)=O)C=CC=1NC(=O)C1=CC=CC=C1 BUVOCOQOYNGMCO-UHFFFAOYSA-N 0.000 description 1
- RKKZDGOUSIOSIY-UHFFFAOYSA-N 4-benzamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=1NC(=O)C1=CC=CC=C1 RKKZDGOUSIOSIY-UHFFFAOYSA-N 0.000 description 1
- SLCUSSPKUGKMGA-UHFFFAOYSA-N 4-bromo-2,6-difluoropyrimidine Chemical compound FC1=CC(Br)=NC(F)=N1 SLCUSSPKUGKMGA-UHFFFAOYSA-N 0.000 description 1
- ZRWALVBIVUPROW-UHFFFAOYSA-N 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carbonyl chloride Chemical compound CS(=O)(=O)C1=NC(Cl)=C(C(Cl)=O)C(S(C)(=O)=O)=N1 ZRWALVBIVUPROW-UHFFFAOYSA-N 0.000 description 1
- VJMKIDUNVPFBOB-UHFFFAOYSA-N 4-chloro-2,6-difluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1Cl VJMKIDUNVPFBOB-UHFFFAOYSA-N 0.000 description 1
- ACYSJALOFWHUEX-UHFFFAOYSA-N 4-chloro-2,6-difluoropyrimidine Chemical compound FC1=CC(Cl)=NC(F)=N1 ACYSJALOFWHUEX-UHFFFAOYSA-N 0.000 description 1
- NDHIIWMVAUTCNX-UHFFFAOYSA-N 4-chloro-2-methylsulfonylpyrimidine-5-sulfonic acid Chemical compound CS(=O)(=O)C1=NC=C(S(O)(=O)=O)C(Cl)=N1 NDHIIWMVAUTCNX-UHFFFAOYSA-N 0.000 description 1
- KKQNFFCRRVCNJP-UHFFFAOYSA-N 4-chloro-6-methoxy-2-methylsulfonylpyrimidine-5-carbonitrile Chemical compound COC1=NC(S(C)(=O)=O)=NC(Cl)=C1C#N KKQNFFCRRVCNJP-UHFFFAOYSA-N 0.000 description 1
- WGNKUINKIVFGBC-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonyl-5-nitropyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1[N+]([O-])=O WGNKUINKIVFGBC-UHFFFAOYSA-N 0.000 description 1
- OLOLDTJCNAOMQJ-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=CC(Cl)=NC(S(C)(=O)=O)=N1 OLOLDTJCNAOMQJ-UHFFFAOYSA-N 0.000 description 1
- BYJUMOSWVALFCO-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine-5-sulfonyl chloride Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1S(Cl)(=O)=O BYJUMOSWVALFCO-UHFFFAOYSA-N 0.000 description 1
- SXCSXKQTOUHQIY-UHFFFAOYSA-N 4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SXCSXKQTOUHQIY-UHFFFAOYSA-N 0.000 description 1
- TXGYIIYGGRVNHK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TXGYIIYGGRVNHK-UHFFFAOYSA-N 0.000 description 1
- TZBROGJRQUABOK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TZBROGJRQUABOK-UHFFFAOYSA-N 0.000 description 1
- UYCCTQPHCSKTTN-UHFFFAOYSA-N 4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 UYCCTQPHCSKTTN-UHFFFAOYSA-N 0.000 description 1
- WZAGWFIDIMWLIY-UHFFFAOYSA-N 4-methyl-3,6-bis(methylsulfonyl)pyridazine Chemical compound CC1=CC(S(C)(=O)=O)=NN=C1S(C)(=O)=O WZAGWFIDIMWLIY-UHFFFAOYSA-N 0.000 description 1
- FRSCGYMSBBDAKE-UHFFFAOYSA-N 5-(chloromethyl)-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(CCl)C(F)=N1 FRSCGYMSBBDAKE-UHFFFAOYSA-N 0.000 description 1
- BOLIYMRNXVAWIJ-UHFFFAOYSA-N 5-bromo-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Br)C(F)=N1 BOLIYMRNXVAWIJ-UHFFFAOYSA-N 0.000 description 1
- DTRZSACSYOVLAN-UHFFFAOYSA-N 5-bromo-2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=NC(F)=C(Br)C(C(F)(F)F)=N1 DTRZSACSYOVLAN-UHFFFAOYSA-N 0.000 description 1
- ZBTCTILYGQNVOJ-UHFFFAOYSA-N 5-bromo-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Br ZBTCTILYGQNVOJ-UHFFFAOYSA-N 0.000 description 1
- FATRNESSGITUQV-UHFFFAOYSA-N 5-bromo-4-chloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Br)C(Cl)=N1 FATRNESSGITUQV-UHFFFAOYSA-N 0.000 description 1
- XKHYTPKPHOHPIJ-UHFFFAOYSA-N 5-bromo-4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Br XKHYTPKPHOHPIJ-UHFFFAOYSA-N 0.000 description 1
- OPLXQBDWWSSPEX-UHFFFAOYSA-N 5-bromo-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Br OPLXQBDWWSSPEX-UHFFFAOYSA-N 0.000 description 1
- RQYBTXRFJGTRFK-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoro-1-methyl-2h-pyrimidine Chemical compound CN1C(F)N=C(F)C(Cl)=C1F RQYBTXRFJGTRFK-UHFFFAOYSA-N 0.000 description 1
- HLWJZTCAFDZNCD-UHFFFAOYSA-N 5-chloro-2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=C(Cl)C(S(C)(=O)=O)=N1 HLWJZTCAFDZNCD-UHFFFAOYSA-N 0.000 description 1
- GNDKYGCYDWCLHH-UHFFFAOYSA-N 5-chloro-2,4-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Cl)C(S(C)(=O)=O)=N1 GNDKYGCYDWCLHH-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- WCSDABYIQOLLOV-UHFFFAOYSA-N 5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1S(O)(=O)=O WCSDABYIQOLLOV-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- OZDPATQEBXWLPZ-UHFFFAOYSA-N 6-chloro-2-methylsulfonylpyrimidine-4-carboxylic acid Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(C(O)=O)=N1 OZDPATQEBXWLPZ-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- XJKHHGWQULDTQA-UHFFFAOYSA-N ClN1NC(=CC(=N1)Cl)N Chemical compound ClN1NC(=CC(=N1)Cl)N XJKHHGWQULDTQA-UHFFFAOYSA-N 0.000 description 1
- OQBOLSKKTBWEDM-UHFFFAOYSA-N ClN1NC(=CC(=N1)Cl)NC1=CC=C(C=C1)S(=O)(=O)O Chemical compound ClN1NC(=CC(=N1)Cl)NC1=CC=C(C=C1)S(=O)(=O)O OQBOLSKKTBWEDM-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- XFKKGBSRZTYJPD-UHFFFAOYSA-N FC1=NC(F)=C(Cl)C(F)=N1.C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 Chemical compound FC1=NC(F)=C(Cl)C(F)=N1.C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 XFKKGBSRZTYJPD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical class F* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 150000005204 hydroxybenzenes Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- USPGWRYCHDAJCB-UHFFFAOYSA-N methyl 2,4-difluoropyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(F)N=C1F USPGWRYCHDAJCB-UHFFFAOYSA-N 0.000 description 1
- YSEQKGHEMQCJCC-UHFFFAOYSA-N methyl 2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(F)=NC(F)=N1 YSEQKGHEMQCJCC-UHFFFAOYSA-N 0.000 description 1
- FSQBCNBFHWRUGG-UHFFFAOYSA-N methyl 6-chloro-2-methylsulfonylpyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(Cl)=NC(S(C)(=O)=O)=N1 FSQBCNBFHWRUGG-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- HYFMZOAPNQAXHU-UHFFFAOYSA-N naphthalene-1,7-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(S(=O)(=O)O)=CC=C21 HYFMZOAPNQAXHU-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical group C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- XVIAPHVAGFEFFN-UHFFFAOYSA-N pyrimidine-5-carbonitrile Chemical compound N#CC1=CN=CN=C1 XVIAPHVAGFEFFN-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000012487 rinsing solution Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06P—DYEING OR PRINTING TEXTILES; DYEING LEATHER, FURS OR SOLID MACROMOLECULAR SUBSTANCES IN ANY FORM
- D06P1/00—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed
- D06P1/38—General processes of dyeing or printing textiles, or general processes of dyeing leather, furs, or solid macromolecular substances in any form, classified according to the dyes, pigments, or auxiliary substances employed using reactive dyes
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Cosmetics (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732318412 DE2318412C2 (de) | 1973-04-12 | 1973-04-12 | Azo-Reaktivfarbstoffe |
| FR7411553A FR2225486B1 (enExample) | 1973-04-12 | 1974-04-01 | |
| CH500874D CH500874A4 (enExample) | 1973-04-12 | 1974-04-10 | |
| CH500874A CH574530B5 (enExample) | 1973-04-12 | 1974-04-10 | |
| JP4004074A JPS5646498B2 (enExample) | 1973-04-12 | 1974-04-10 | |
| GB1612274A GB1427904A (en) | 1973-04-12 | 1974-04-11 | Fibre-reactive azo dyestuffs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732318412 DE2318412C2 (de) | 1973-04-12 | 1973-04-12 | Azo-Reaktivfarbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2318412A1 DE2318412A1 (de) | 1974-10-31 |
| DE2318412C2 true DE2318412C2 (de) | 1984-05-17 |
Family
ID=5877825
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732318412 Expired DE2318412C2 (de) | 1973-04-12 | 1973-04-12 | Azo-Reaktivfarbstoffe |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS5646498B2 (enExample) |
| CH (2) | CH574530B5 (enExample) |
| DE (1) | DE2318412C2 (enExample) |
| FR (1) | FR2225486B1 (enExample) |
| GB (1) | GB1427904A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2333029A1 (fr) * | 1975-11-28 | 1977-06-24 | Ugine Kuhlmann | Nouveaux colorants complexes chromiferes reactifs, leurs preparations et leurs applications |
| JPS53142002A (en) * | 1977-05-16 | 1978-12-11 | Sanyo Kiki Kk | Device for translating hydraulic bucket of loader |
| DE2829711C2 (de) * | 1978-07-06 | 1986-04-03 | Bayer Ag, 5090 Leverkusen | Azoreaktivfarbstoff |
| EP0112797A1 (de) * | 1982-11-26 | 1984-07-04 | Ciba-Geigy Ag | Verfahren zum Färben oder Bedrucken von cellulosehaltigem Fasermaterial mit Reaktivfarbstoffen |
| CH656140A5 (de) * | 1983-11-04 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
| CH656141A5 (de) * | 1983-11-07 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
| CH656142A5 (de) * | 1983-11-10 | 1986-06-13 | Ciba Geigy Ag | Faserreaktive chromkomplexe und deren herstellung. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH406480A (de) * | 1960-01-29 | 1966-01-31 | Sandoz Ag | Verfahren zur Herstellung von Reaktivfarbstoffen |
| CH443522A (de) * | 1961-02-07 | 1967-09-15 | Bayer Ag | Verfahren zur Herstellung metallhaltiger azogruppenhaltiger Farbstoffe |
| JP2575733B2 (ja) * | 1987-09-18 | 1997-01-29 | 財団法人 鉄道総合技術研究所 | 車両の台枠 |
-
1973
- 1973-04-12 DE DE19732318412 patent/DE2318412C2/de not_active Expired
-
1974
- 1974-04-01 FR FR7411553A patent/FR2225486B1/fr not_active Expired
- 1974-04-10 JP JP4004074A patent/JPS5646498B2/ja not_active Expired
- 1974-04-10 CH CH500874A patent/CH574530B5/xx not_active IP Right Cessation
- 1974-04-10 CH CH500874D patent/CH500874A4/xx unknown
- 1974-04-11 GB GB1612274A patent/GB1427904A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2225486B1 (enExample) | 1978-01-13 |
| JPS503124A (enExample) | 1975-01-14 |
| DE2318412A1 (de) | 1974-10-31 |
| JPS5646498B2 (enExample) | 1981-11-04 |
| CH500874A4 (enExample) | 1975-10-15 |
| FR2225486A1 (enExample) | 1974-11-08 |
| GB1427904A (en) | 1976-03-10 |
| CH574530B5 (enExample) | 1976-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0070808B1 (de) | Reaktivfarbstoffe, deren Herstellung und Verwendung | |
| CH628671A5 (de) | Verfahren zur herstellung von reaktivfarbstoffen. | |
| DE1419859A1 (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE1644203C3 (enExample) | ||
| DE2232541A1 (de) | Azoreaktivfarbstoffe | |
| DE2831912C2 (enExample) | ||
| DE2318412C2 (de) | Azo-Reaktivfarbstoffe | |
| DE2600164A1 (de) | Faserreaktive disazofarbstoffe, deren herstellung und verwendung | |
| DE2349709A1 (de) | Azoverbindungen, deren herstellung und verwendung | |
| DE2315638C2 (de) | Metallfreie Monoazo-Reaktivfarbstoffe | |
| DE1230152B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| CH624426A5 (en) | Process for preparing reactive azo dyes | |
| DE2751785C2 (enExample) | ||
| DE1904112C3 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von Textilmaterial | |
| EP0013936B1 (de) | Azoreaktivfarbstoffe sowie deren Herstellung und Verwendung zum Färben von Hydroxyl- und Amidgruppen enthaltenden Materialien | |
| DE1419794B2 (de) | Verfahren zur Herstellung von Disazoreaktivfarbstoffen und deren Verwendung | |
| DE1924570B2 (de) | Wasserloesliche azofarbstoffe, verfahren zu deren herstellung und ihre verwendung zum faerben und bedrucken | |
| DE3009788A1 (de) | Wasserloesliche nickelphtalocyaninazofarbstoffe | |
| AT200687B (de) | Verfahren zur Herstellung neuer Azofarbstoffe | |
| EP0043411B1 (de) | Dis-Azoreaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von stickstoff- und/oder hydroxylgruppenhaltigen Materialien | |
| DE2113298C3 (de) | Reaktivfarbstoffe und deren Verwendung zum Färben und Bedrucken hydroxyl- oder amidgruppenhaltiger Fasermaterialien | |
| DE1283984B (de) | Verfahren zur Herstellung von faserreaktiven Schwermetallkomplexen von Monoazofarbstoffen | |
| DE1211733B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| CH634093A5 (en) | Process for preparing fibre-reactive azo dyes | |
| DE1261257B (de) | Verfahren zur Herstellung von Farbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8125 | Change of the main classification |
Ipc: C09B 62/026 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |