DE2314513C3 - Verfahren zur Herstellung von wäßrigen Polyurethandispersionen - Google Patents
Verfahren zur Herstellung von wäßrigen PolyurethandispersionenInfo
- Publication number
- DE2314513C3 DE2314513C3 DE2314513A DE2314513A DE2314513C3 DE 2314513 C3 DE2314513 C3 DE 2314513C3 DE 2314513 A DE2314513 A DE 2314513A DE 2314513 A DE2314513 A DE 2314513A DE 2314513 C3 DE2314513 C3 DE 2314513C3
- Authority
- DE
- Germany
- Prior art keywords
- diisocyanate
- diisocyanates
- nco
- molecular weight
- dispersion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 30
- 230000008569 process Effects 0.000 title claims description 23
- 229920003009 polyurethane dispersion Polymers 0.000 title claims description 18
- 238000002360 preparation method Methods 0.000 title claims description 14
- 239000006185 dispersion Substances 0.000 claims description 54
- 125000005442 diisocyanate group Chemical group 0.000 claims description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 44
- 239000000203 mixture Substances 0.000 claims description 42
- 229920002635 polyurethane Polymers 0.000 claims description 22
- 239000004814 polyurethane Substances 0.000 claims description 22
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 20
- 239000004970 Chain extender Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 16
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical compound NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 claims description 12
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 150000002894 organic compounds Chemical class 0.000 claims description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 80
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 40
- 239000007787 solid Substances 0.000 description 36
- 239000010408 film Substances 0.000 description 29
- -1 hydrocarbon radical Chemical class 0.000 description 29
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 27
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 20
- 239000001361 adipic acid Substances 0.000 description 20
- 235000011037 adipic acid Nutrition 0.000 description 20
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 16
- 238000001035 drying Methods 0.000 description 16
- 239000002904 solvent Substances 0.000 description 15
- 229920000728 polyester Polymers 0.000 description 14
- 239000004215 Carbon black (E152) Substances 0.000 description 13
- 229930195733 hydrocarbon Natural products 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 10
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 10
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 10
- 239000004417 polycarbonate Substances 0.000 description 10
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 9
- 229920000515 polycarbonate Polymers 0.000 description 9
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 8
- 150000003335 secondary amines Chemical class 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 150000002009 diols Chemical class 0.000 description 7
- 229920000126 latex Polymers 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 229920000570 polyether Polymers 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 6
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000005977 Ethylene Substances 0.000 description 5
- 239000004721 Polyphenylene oxide Substances 0.000 description 5
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229940045713 antineoplastic alkylating drug ethylene imines Drugs 0.000 description 3
- 239000010425 asbestos Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000011888 foil Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 239000010985 leather Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229910052895 riebeckite Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NHXVNEDMKGDNPR-UHFFFAOYSA-N zinc;pentane-2,4-dione Chemical compound [Zn+2].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O NHXVNEDMKGDNPR-UHFFFAOYSA-N 0.000 description 3
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000003475 lamination Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- MJUXRARMNNVUNK-UHFFFAOYSA-N n-phenylethenimine Chemical compound C=C=NC1=CC=CC=C1 MJUXRARMNNVUNK-UHFFFAOYSA-N 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001610 polycaprolactone Polymers 0.000 description 2
- 239000004632 polycaprolactone Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 229920006295 polythiol Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 238000005829 trimerization reaction Methods 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- PYOLJOJPIPCRDP-UHFFFAOYSA-N 1,1,3-trimethylcyclohexane Chemical compound CC1CCCC(C)(C)C1 PYOLJOJPIPCRDP-UHFFFAOYSA-N 0.000 description 1
- GFNDFCFPJQPVQL-UHFFFAOYSA-N 1,12-diisocyanatododecane Chemical compound O=C=NCCCCCCCCCCCCN=C=O GFNDFCFPJQPVQL-UHFFFAOYSA-N 0.000 description 1
- ZTNJGMFHJYGMDR-UHFFFAOYSA-N 1,2-diisocyanatoethane Chemical compound O=C=NCCN=C=O ZTNJGMFHJYGMDR-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- YKNKBBMRKMLLJS-UHFFFAOYSA-N 1-phenylaziridine Chemical compound C1CN1C1=CC=CC=C1 YKNKBBMRKMLLJS-UHFFFAOYSA-N 0.000 description 1
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical class OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000011111 cardboard Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical class OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- ULNRRNBMNIIOJK-UHFFFAOYSA-N isocyanatourea Chemical compound NC(=O)NN=C=O ULNRRNBMNIIOJK-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- HVAAHUDGWQAAOJ-UHFFFAOYSA-N n-benzylethanamine Chemical compound CCNCC1=CC=CC=C1 HVAAHUDGWQAAOJ-UHFFFAOYSA-N 0.000 description 1
- RDXBZXWKSIEKKS-UHFFFAOYSA-N n-ethyldecan-1-amine Chemical compound CCCCCCCCCCNCC RDXBZXWKSIEKKS-UHFFFAOYSA-N 0.000 description 1
- XJINZNWPEQMMBV-UHFFFAOYSA-N n-methylhexan-1-amine Chemical compound CCCCCCNC XJINZNWPEQMMBV-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000867 polyelectrolyte Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920003225 polyurethane elastomer Polymers 0.000 description 1
- 229920003226 polyurethane urea Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000007762 w/o emulsion Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/80—Masked polyisocyanates
- C08G18/8061—Masked polyisocyanates masked with compounds having only one group containing active hydrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/7806—Nitrogen containing -N-C=0 groups
- C08G18/7818—Nitrogen containing -N-C=0 groups containing ureum or ureum derivative groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/7806—Nitrogen containing -N-C=0 groups
- C08G18/7818—Nitrogen containing -N-C=0 groups containing ureum or ureum derivative groups
- C08G18/7831—Nitrogen containing -N-C=0 groups containing ureum or ureum derivative groups containing biuret groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Paints Or Removers (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2314513A DE2314513C3 (de) | 1973-03-23 | 1973-03-23 | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
| CA194,871A CA1023887A (en) | 1973-03-23 | 1974-03-13 | Non-ionic polyurethane dispersions |
| US452180A US3920598A (en) | 1973-03-23 | 1974-03-18 | Non-ionic polyurethane dispersions having side chains of polyoxyethylene |
| GB1234274A GB1425548A (en) | 1973-03-23 | 1974-03-20 | Polyurethane elastomers and diisocyanates suitable for use in their preparation |
| DD177310A DD114961A5 (enExample) | 1973-03-23 | 1974-03-20 | |
| NL7403766A NL7403766A (enExample) | 1973-03-23 | 1974-03-20 | |
| LU69683A LU69683A1 (enExample) | 1973-03-23 | 1974-03-21 | |
| BE142263A BE812619A (fr) | 1973-03-23 | 1974-03-21 | Procede de preparation de dispersions de polyurethannes |
| FR7409979A FR2222405B1 (enExample) | 1973-03-23 | 1974-03-22 | |
| JP3163374A JPS5650745B2 (enExample) | 1973-03-23 | 1974-03-22 | |
| ES424518A ES424518A1 (es) | 1973-03-23 | 1974-03-22 | Procedimiento para la obtencion de dispersiones de poliure-tano acuosas, no ionicas, libres de emulsionantes. |
| IE626/74A IE39092B1 (en) | 1973-03-23 | 1974-03-22 | Polyurethane elastomers and novel diisocyanates suitable fr use in their preparation |
| IT49532/74A IT1005869B (it) | 1973-03-23 | 1974-03-22 | Procedimento per la produzione di elastomeri poliuretanici e loro dispersioni |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2314513A DE2314513C3 (de) | 1973-03-23 | 1973-03-23 | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2314513A1 DE2314513A1 (de) | 1974-10-03 |
| DE2314513B2 DE2314513B2 (de) | 1980-01-03 |
| DE2314513C3 true DE2314513C3 (de) | 1980-08-28 |
Family
ID=5875668
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2314513A Expired DE2314513C3 (de) | 1973-03-23 | 1973-03-23 | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3920598A (enExample) |
| JP (1) | JPS5650745B2 (enExample) |
| BE (1) | BE812619A (enExample) |
| CA (1) | CA1023887A (enExample) |
| DD (1) | DD114961A5 (enExample) |
| DE (1) | DE2314513C3 (enExample) |
| ES (1) | ES424518A1 (enExample) |
| FR (1) | FR2222405B1 (enExample) |
| GB (1) | GB1425548A (enExample) |
| IE (1) | IE39092B1 (enExample) |
| IT (1) | IT1005869B (enExample) |
| LU (1) | LU69683A1 (enExample) |
| NL (1) | NL7403766A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011051359A1 (en) | 2009-10-27 | 2011-05-05 | Cytec Austria Gmbh | Aqueously dispersible polyurethane |
| EP2690117A1 (en) | 2012-07-24 | 2014-01-29 | ALLNEX AUSTRIA GmbH | Aqueously Dispersible Polyurethane |
Families Citing this family (139)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2651505A1 (de) * | 1976-11-11 | 1978-05-24 | Bayer Ag | Kationische elektrolytstabile dispersionen |
| AU502343B2 (en) * | 1975-06-02 | 1979-07-19 | Ppg Industries, Inc. | Aqueous dispersion of a non-gelled polyurethane |
| US4028313A (en) * | 1975-06-25 | 1977-06-07 | Bayer Aktiengesellschaft | Process for the production of water-dispersible polyhydroxyl compounds |
| DE2528212A1 (de) * | 1975-06-25 | 1977-01-13 | Bayer Ag | Verfahren zur herstellung von in wasser loeslichen oder dispergierbaren polyhydroxylverbindungen |
| BR7606383A (pt) * | 1975-09-26 | 1977-06-14 | Bayer Ag | Processo para a preparacao de poliuretanos |
| US4150946A (en) * | 1975-11-04 | 1979-04-24 | Rhone-Poulenc Industries | Water-soluble polyurethanes and compositions and application thereof to substrates |
| DE2551094A1 (de) * | 1975-11-14 | 1977-05-26 | Bayer Ag | Verfahren zur herstellung von in wasser dispergierbaren polyurethanen |
| DE2555534C3 (de) * | 1975-12-10 | 1981-01-08 | Bayer Ag, 5090 Leverkusen | In Wasser dispergierbare Polyurethane |
| DE2637690A1 (de) * | 1976-08-21 | 1978-02-23 | Bayer Ag | Verfahren zur herstellung von waessrigen dispersionen bzw. loesungen von polyurethanen und deren verwendung |
| DE2651506C2 (de) * | 1976-11-11 | 1986-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen |
| DE2807479A1 (de) * | 1978-02-22 | 1979-08-23 | Bayer Ag | Ueberzugsmittel |
| DE2816815A1 (de) * | 1978-04-18 | 1979-10-31 | Bayer Ag | In wasser dispergierbare oder loesliche polyurethane, sowie ein verfahren zu ihrer herstellung |
| DE2900574A1 (de) * | 1979-01-09 | 1980-07-17 | Bayer Ag | Verwendung von wasserloeslichen elektrolyten als zusatzmittel in waessrigen kunststoffdispersionen und eine, einen wasserloeslichen elektrolyten enthaltende, waessrige kunststoffdispersion |
| US4307219A (en) * | 1980-04-30 | 1981-12-22 | Minnesota Mining And Manufacturing Company | Aqueous solvent dispersible linear polyurethane resins |
| US4408008A (en) * | 1981-07-24 | 1983-10-04 | Mobay Chemical Corporation | Stable, colloidal, aqueous dispersions of cross-linked urea-urethane polymers and their method of production |
| DE3320217A1 (de) * | 1983-06-03 | 1984-12-06 | Bayer Ag, 5090 Leverkusen | Anorganisch-organische verbundwerkstoffe und verfahren zu ihrer herstellung |
| US4567228A (en) * | 1984-05-21 | 1986-01-28 | Ppg Industries, Inc. | Aqueous dispersion, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| US4542065A (en) * | 1984-05-21 | 1985-09-17 | Ppg Industries, Inc. | Chemically treated glass fibers and strands and dispersed products thereof |
| US4582873A (en) * | 1984-05-21 | 1986-04-15 | Ppg Industries, Inc. | Process for producing aqueous dispersions, internally silylated and dispersed polyurethane resins, and surfaces containing same |
| GB2188055B (en) * | 1986-03-20 | 1989-12-28 | Smith & Nephew Ass | Hydrophilic polyurethane foams |
| GB8606988D0 (en) * | 1986-03-20 | 1986-04-23 | Smith & Nephew Ass | Foams |
| DE3641494A1 (de) * | 1986-12-04 | 1988-06-09 | Bayer Ag | In wasser loesliche oder dispergierbare poylurethane, ein verfahren zu ihrer herstellung und ihre verwendung zur beschichtung beliebiger substrate |
| US5314942A (en) * | 1987-09-14 | 1994-05-24 | Ici Americas, Inc. | Aqueous dispersions |
| GB8721533D0 (en) * | 1987-09-14 | 1987-10-21 | Polyvinyl Chemical Ind | Aqueous dispersions |
| GB2209758B (en) * | 1987-09-14 | 1990-12-12 | Ici America Inc | Aqueous dispersions |
| DE3735587A1 (de) * | 1987-10-21 | 1989-05-11 | Bayer Ag | Verfahren zur herstellung von waessrigen polyurethan-polyharnstoffdispersionen |
| US5017673A (en) * | 1989-10-12 | 1991-05-21 | Basf Corporation | Nonionically stabilized polyester urethane resin for water-borne coating compositions |
| US5763529A (en) * | 1994-03-31 | 1998-06-09 | Cytec Technology Corp. | Interpenetrating polymer network compositions |
| DK0741005T3 (da) * | 1995-05-05 | 2000-12-18 | Minnesota Mining & Mfg | Kompositfilm og anvendelse deraf |
| EP0774475A3 (de) | 1995-11-17 | 1997-10-01 | Basf Ag | Wässerige Dispersionen enthaltend ein Polyurethan mit oximblockierten Isocyanatgruppen und/oder Carbonylgruppen in Keto- oder Aldehydfunktion |
| US5834554A (en) * | 1996-03-05 | 1998-11-10 | H. B. Fuller Licensing & Financing, Inc. | Laminating adhesives for flexible packaging |
| US5821294A (en) * | 1996-08-30 | 1998-10-13 | National Starch And Chemical Investment Holding Corporation | Water-based laminating adhesives |
| US5859111A (en) * | 1996-12-18 | 1999-01-12 | National Starch And Chemical Investment Holding Corporation | Processes for making nonionic aqueous polyurethane dispersions |
| DE19812880A1 (de) | 1998-03-24 | 1999-09-30 | Bayer Ag | Formteil und flexible Folie mit geschützter Leiterbahn und Verfahren zu ihrer Herstellung |
| DE19822890A1 (de) * | 1998-05-22 | 1999-11-25 | Bayer Ag | Neue wäßrige 2 K-PUR-Beschichtungssysteme |
| US6096823A (en) * | 1998-10-14 | 2000-08-01 | Bayer Corporation | Moisture-curable compounds containing isocyanate and alkoxysilane groups |
| KR100746464B1 (ko) | 1999-12-23 | 2007-08-03 | 아크조 노벨 엔.브이. | 부가 중합체 및 폴리우레탄을 포함하는 수성 코팅 조성물 |
| US7557235B2 (en) | 2000-02-16 | 2009-07-07 | Lubrizol Advanced Materials, Inc. | Hydroxyl-terminated thiocarbonate containing compounds, polymers, and copolymers, and polyurethanes and urethane acrylics made therefrom |
| JP5009463B2 (ja) * | 2001-05-21 | 2012-08-22 | 三菱樹脂株式会社 | 塗布フィルム |
| DE10133789A1 (de) * | 2001-07-16 | 2003-02-06 | Basf Ag | Wässrige Dispersionen für hydrolysefeste Beschichtungen |
| DE10138765A1 (de) | 2001-08-07 | 2003-02-20 | Bayer Ag | Wässrige Dispersionen hydrophiler Polyurethanharze |
| DE10152294A1 (de) | 2001-10-26 | 2003-05-08 | Solutia Austria Gmbh Werndorf | Hochmolekulare Polyurethan-Dispersionen |
| GB0128221D0 (en) * | 2001-11-24 | 2002-01-16 | Avecia Ltd | Aqueous urethane dispersants |
| US7358295B2 (en) * | 2002-04-05 | 2008-04-15 | Lubrizol Advanced Materials, Inc. | Hybrid polymer composition, and article therefrom |
| US6897281B2 (en) * | 2002-04-05 | 2005-05-24 | Noveon Ip Holdings Corp. | Breathable polyurethanes, blends, and articles |
| US20050209428A1 (en) * | 2002-06-19 | 2005-09-22 | Krishnan Tamareselvy | Breathable polyurethanes, blends, and articles |
| US20040092622A1 (en) * | 2002-07-01 | 2004-05-13 | Pearlstine Kathryn Amy | Inkjet ink with reduced bronzing |
| KR101289578B1 (ko) * | 2002-12-20 | 2013-07-24 | 다우 글로벌 테크놀로지스 엘엘씨 | 합성 가죽의 제조방법 및 이러한 방법으로 제조된 합성가죽 |
| DE10324306A1 (de) * | 2003-05-30 | 2004-12-16 | Bayer Materialscience Ag | Wässrige PUR-Dispersionen zur Herstellung von Beschichtungen mit Softfeel-Effekt |
| AT500555B1 (de) | 2003-06-13 | 2009-11-15 | Cytec Surface Specialties At | Selbstvernetzende wässrige polyurethandispersionen |
| DE10328063A1 (de) * | 2003-06-23 | 2005-01-13 | Bayer Materialscience Ag | Wässrige Zubereitungen hydrophiler Polyurethanharze |
| US7238745B2 (en) * | 2003-12-15 | 2007-07-03 | Bayer Materialscience Llc | Aqueous polyurethane/urea dispersions containing alkoxysilane groups |
| DE10360043A1 (de) * | 2003-12-18 | 2005-07-21 | Basf Ag | Mit Polyadditionsprodukten umhüllte Pigmente, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE102004002526A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Thermovergilbungsstabile Polyurethan-Polyharnstoff Dispersionen |
| DE102004002527A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Schlichtezusammensetzung |
| DE102004002525A1 (de) * | 2004-01-16 | 2005-08-04 | Bayer Materialscience Ag | Beschichtungsmittelzusammensetzung |
| US20050215663A1 (en) * | 2004-01-21 | 2005-09-29 | Berge Charles T | Inkjet inks containing crosslinked polyurethanes |
| US20050182187A1 (en) * | 2004-02-12 | 2005-08-18 | Koonce William A. | Polyurethane dispersions and coatings made therefrom |
| JP2006022132A (ja) * | 2004-07-06 | 2006-01-26 | Nippon Polyurethane Ind Co Ltd | 水性ポリウレタンエマルジョン、その製造方法及びそれを用いた水性印刷インキ |
| US8137754B2 (en) * | 2004-08-06 | 2012-03-20 | Lubrizol Advanced Materials, Inc. | Hydroxyl-terminated thiocarbonate containing compounds, polymers, and copolymers, and polyurethanes and urethane acrylics made therefrom |
| WO2006020281A1 (en) | 2004-08-06 | 2006-02-23 | Noveon, Inc. | Polyurethanes and urethane acrylics made from hydroxyl-terminated thiocarbonate containing compounds |
| US20060111506A1 (en) * | 2004-11-22 | 2006-05-25 | Bedri Erdem | Filled polyurethane dispersions |
| US20060116454A1 (en) * | 2004-12-01 | 2006-06-01 | Bedri Erdem | Stable thermally coaguable polyurethane dispersions |
| ATE438672T1 (de) | 2005-12-15 | 2009-08-15 | Akzo Nobel Coatings Int Bv | Mehrlagiges beschichtungssystem |
| EP2021393A1 (en) * | 2006-05-16 | 2009-02-11 | Dow Global Technologies Inc. | Aqueous non-ionic hydrophilic polyurethane dispersions, and a continuous process of making the same |
| EP1882749A1 (en) * | 2006-07-25 | 2008-01-30 | Joseph Mellini | Leather-surface repair-composition and the method for surface repair of leather surfaces |
| DE102006036220A1 (de) * | 2006-08-03 | 2008-02-07 | Clariant International Limited | Polyetheramin-Makromonomere mit zwei benachbarten Hydroxylgruppen und ihre Verwendung zur Herstellung von Polyurethanen |
| US20080081160A1 (en) * | 2006-09-28 | 2008-04-03 | Lubrizol Advanced Materials, Inc. | Ink Receptive Coatings For Woven and Nonwoven Substrates |
| KR101463277B1 (ko) * | 2006-12-22 | 2014-11-26 | 바스프 에스이 | 카르보디이미드 기를 가지는 화합물을 포함하는 미세캡슐 |
| DE102008000270A1 (de) | 2007-02-14 | 2008-08-28 | Basf Se | Verfahren zur Herstellung von Polyurethandispersionen mit geringem Gehalt an hochsiedenden Lösungsmitteln |
| DE102008000478A1 (de) | 2007-03-05 | 2008-09-11 | Basf Se | Polyurethan-Dispersionen mit Polyethercarbonatpolyolen als Aufbaukomponente |
| US20090030161A1 (en) * | 2007-07-27 | 2009-01-29 | Bayer Materialscience Llc | Allophanate modified diphenylmethane diisocyanates, prepolymers thereof, and their use in the preparation of polyureas and polyurethanes |
| DE102008038899A1 (de) | 2008-08-13 | 2010-02-18 | Bayer Materialscience Ag | Dispersionsklebstoffe (II) |
| CL2008003124A1 (es) * | 2007-11-07 | 2009-11-27 | Bayer Materialscience Ag | Dispersiones acuosas de poliuretano-urea acuosa de; poliol(es) difuncional (es) o funcionalidad superior, compuestos(s) monofuncional (es) con la menos 50% p/p de óxido de etileno, componente(s)di o poliiocianato; y mezcla de compuestos monoamina primarios y/o secundarios; procedimiento; uso; composición; y compuesto adhesivo. |
| US20090131581A1 (en) * | 2007-11-19 | 2009-05-21 | Wylie Amy S | Aqueous, stain-resistant coating compositions |
| EP2218741A4 (en) * | 2007-12-06 | 2012-10-03 | Mitsui Chemicals Inc | AQUEOUS POLYURETHANE RESIN, HYDROPHILIC RESIN AND FILM |
| EP2271685B1 (en) * | 2007-12-26 | 2018-01-03 | Dow Global Technologies LLC | Polyurethane dispersions and coatings produced therefrom |
| DE102008004178A1 (de) | 2008-01-11 | 2009-07-16 | Basf Se | Textile Flächengebilde, Verfahren zu ihrer Herstellung und ihre Verwendung |
| ES2377708T3 (es) * | 2008-08-26 | 2012-03-30 | Basf Se | Composición adhesiva para artículos autoadhesivos desprendibles, a base de polímeros adhesivos y nanopartículas orgánicas |
| JP5726168B2 (ja) | 2009-04-14 | 2015-05-27 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | フィルムコーティングされた家具を製造するための、ポリエステルジオール、ポリエーテルジオール及びシラン化合物からのポリウレタン接着剤の使用 |
| US8916641B2 (en) | 2009-04-14 | 2014-12-23 | Basf Se | Adhesive made of polymers having crystalline domains, amorphous polyurethane and silane compounds |
| CN102597078B (zh) | 2009-08-20 | 2014-03-19 | 巴斯夫欧洲公司 | 聚合电解质复合物作为增塑剂阻挡层的用途 |
| DE102010043486A1 (de) | 2009-11-16 | 2011-05-19 | Basf Se | Kaschierverfahren unter Verwendung von Carbodiimid- und Harnstoffgruppen enthaltenden Klebstoffen |
| US9617453B2 (en) | 2009-12-14 | 2017-04-11 | Air Products And Chemicals, Inc. | Solvent free aqueous polyurethane dispersions and methods of making and using the same |
| EP2388283A1 (en) | 2010-05-18 | 2011-11-23 | Bayer MaterialScience AG | Process for adjusting the viscosity of anionic polyurethane dispersions |
| EP2576714B1 (en) | 2010-06-02 | 2014-09-24 | Lubrizol Advanced Materials, Inc. | Ink/dye receptive films, papers, and fabrics |
| WO2012013506A1 (de) | 2010-07-29 | 2012-02-02 | Basf Se | Biologisch desintegrierbare verbundfolien |
| US8956497B2 (en) | 2010-07-29 | 2015-02-17 | Basf Se | Biodisintegratable composite foils |
| US9056991B2 (en) | 2010-07-30 | 2015-06-16 | Cabot Corporation | Polymeric pigment systems and methods |
| WO2012020026A1 (en) * | 2010-08-12 | 2012-02-16 | Bayer Materialscience Ag | Process for the production of polyurethane-urea dispersions |
| US9089624B2 (en) | 2010-08-23 | 2015-07-28 | Basf Se | Ultrathin fluid-absorbent cores comprising adhesive and having very low dry SAP loss |
| WO2012052406A1 (en) | 2010-10-19 | 2012-04-26 | Bayer Materialscience Ag | Aqueous preparations having soft-feel properties |
| DK2655458T3 (en) | 2010-12-20 | 2017-06-06 | Basf Se | PROCEDURE FOR PREPARING POLYURETHAN-POLYACRYLATE HYBRID DISPERSIONS |
| DE102011015459A1 (de) | 2011-03-29 | 2012-10-04 | Basf Se | Polyurethane, ihre Herstellung und Verwendung |
| EP2691465B1 (de) | 2011-03-30 | 2015-09-09 | Basf Se | Latent reaktive polyurethandispersion mit aktivierbarer vernetzung |
| US8841369B2 (en) | 2011-03-30 | 2014-09-23 | Basf Se | Latently reactive polyurethane dispersion with activatable crosslinking |
| EP2869988B1 (de) | 2012-07-04 | 2017-06-14 | Basf Se | Verklebtes verpackungssystem für lebensmittel |
| WO2014044562A1 (en) | 2012-09-18 | 2014-03-27 | Basf Se | Polymers comprising a polyurethane backbone endcapped with reactive (meth)acrylic terminating groups and their use as adhesives |
| US9732026B2 (en) | 2012-12-14 | 2017-08-15 | Resinate Technologies, Inc. | Reaction products containing hydroxyalkylterephthalates and methods of making and using same |
| US9963822B2 (en) | 2013-01-11 | 2018-05-08 | Dow Global Technologies Llc | Polyurethane dispersion based synthetic leathers |
| DE102014204582A1 (de) | 2014-03-12 | 2015-09-17 | Basf Se | Neue Polymerdispersionen |
| WO2015184490A1 (en) * | 2014-06-03 | 2015-12-10 | Commonwealth Scientific And Industrial Research Organisation | Sprayable polymer membrane for agriculture |
| US20170121537A1 (en) | 2014-06-10 | 2017-05-04 | Basf Se | Polymer dispersions containing acylmorpholines |
| WO2016016286A1 (de) | 2014-08-01 | 2016-02-04 | Basf Se | Verfahren zur herstellung und verwendung wässriger polyurethan-polyacrylat-hybriddispersionen sowie deren verwendung in beschichtungsmitteln |
| US10240071B2 (en) | 2014-12-05 | 2019-03-26 | Basf Se | Aqueous adhesive dispersion containing polyurethanes and ethoxylated fatty alcohols |
| WO2016124251A1 (en) | 2015-02-06 | 2016-08-11 | Taminco | Aqueous polyurethane dispersions |
| WO2016162215A1 (de) | 2015-04-07 | 2016-10-13 | Basf Se | Polymerdispersionen enthaltend n-acylpyrrolidine |
| EP3118234A1 (en) | 2015-07-15 | 2017-01-18 | ALLNEX AUSTRIA GmbH | Coating compositions |
| US10106696B2 (en) | 2015-11-18 | 2018-10-23 | Cabot Corporation | Inkjet ink compositions |
| BR112018015647A2 (pt) | 2016-02-03 | 2018-12-26 | Basf Se | composição aquosa de revestimento de componente único, película de polímero, embalagem, método para formação de película polimérica, e, uso de uma composição. |
| DE102017204525A1 (de) | 2016-03-23 | 2017-09-28 | Basf Se | Verbundfolienlaminate für flexible Verpackungen |
| EP3491064B1 (de) | 2016-08-01 | 2021-09-01 | Stahl International B.V. | Polymerdispersionen mit verringerter emission von acetaldehyd |
| EP3538577A1 (en) | 2016-11-09 | 2019-09-18 | Basf Se | Polyurethane-vinyl hybrid polymers, methods of making them and their use |
| US12305090B2 (en) | 2017-10-11 | 2025-05-20 | Basf Se | Protective films made of polyolefin support material, primer and radiation-crosslinkable hot melt adhesive |
| WO2019162206A2 (de) | 2018-02-21 | 2019-08-29 | Basf Se | Verfahren zur herstellung von mit klebstoff beschichteten artikeln |
| WO2019197234A1 (en) | 2018-04-13 | 2019-10-17 | Basf Se | Oxygen scavenging aqueous lamination adhesive composition |
| JP7030307B2 (ja) * | 2018-05-24 | 2022-03-07 | 東ソー株式会社 | ポリウレタンウレア樹脂組成物及びその製造方法 |
| DE102019219214A1 (de) | 2018-12-17 | 2020-06-18 | Basf Se | Zusammensetzungen, die multifunktionelle Vinylverbindungen in Miniemulsion umfassen, und ihre Verwendung als Vernetzer für Polymere |
| ES2987066T3 (es) | 2019-01-11 | 2024-11-13 | Basf Se | Procedimiento de revestimiento de películas con sistema de rodillos de grabado |
| EP4114875A1 (en) | 2020-03-02 | 2023-01-11 | Basf Se | Composite foils biodisintegratable at home compost conditions |
| US12269247B2 (en) | 2020-06-09 | 2025-04-08 | Basf Se | Process for recycling of bonded articles |
| TWI888545B (zh) * | 2020-06-11 | 2025-07-01 | 日商Dic股份有限公司 | 凝固物的製造方法 |
| WO2022132855A1 (en) | 2020-12-16 | 2022-06-23 | Lubrizol Advanced Materials, Inc | Antifog compositions and related methods |
| EP4274865B1 (en) | 2021-01-06 | 2024-12-11 | Henkel AG & Co. KGaA | Improved cr(iii)-based passivation for zinc-aluminum coated steel |
| CN116897197A (zh) | 2021-02-24 | 2023-10-17 | 巴斯夫欧洲公司 | 包含生物可降解的水性聚氨酯压敏胶黏剂的不干胶标签 |
| CN117157349A (zh) | 2021-04-22 | 2023-12-01 | 巴斯夫欧洲公司 | 用于制备涂覆成型体的方法和涂覆成型体的用途 |
| WO2023118015A1 (en) | 2021-12-21 | 2023-06-29 | Basf Se | Environmental attributes for care composition ingredients |
| US20250326911A1 (en) | 2022-10-18 | 2025-10-23 | Basf Se | Storage-stable coated particles and their preparation |
| WO2025002949A1 (en) | 2023-06-28 | 2025-01-02 | Basf Se | Storage-stable coated particles and their preparation |
| EP4689269A1 (en) | 2023-10-27 | 2026-02-11 | Dow Silicones Corporation | Silicone - (meth)acrylate copolymer emulsion and preparation thereof and use of the emulsion to impart oil repellency to textiles |
| WO2025106268A1 (en) | 2023-11-16 | 2025-05-22 | Dow Global Technologies Llc | Aqueous coating composition containing an aminosiloxane ester copolymer, method for preparation of the aqueous coating composition, and use for treating leather |
| WO2025106269A1 (en) | 2023-11-16 | 2025-05-22 | Dow Global Technologies Llc | Aqueous coating composition containing an aminosiloxane ester copolymer and a polyurethane binder, and methods for preparation and use thereof |
| EP4559672A1 (en) | 2023-11-27 | 2025-05-28 | Henkel AG & Co. KGaA | Method of separating bonded articles |
| EP4559671A1 (en) | 2023-11-27 | 2025-05-28 | Henkel AG & Co. KGaA | Method of separating bonded articles |
| WO2025162763A1 (en) | 2024-01-29 | 2025-08-07 | Basf Se | Two-component lamination adhesive |
| WO2025216964A1 (en) | 2024-04-11 | 2025-10-16 | Dow Silicones Corporation | Aqueous coating composition containing a hydroxyl – functional aminosiloxane ester copolymer, method for preparation thereof, and use for leather treatment |
| WO2026046755A1 (en) | 2024-08-28 | 2026-03-05 | Basf Se | Enzyme mediated delamination on demand of multilayer packaging materials |
| WO2026064062A1 (en) | 2024-09-20 | 2026-03-26 | Dow Silicones Corporation | Aqueous emulsion of ultra-high molecular weight polyorganosiloxane and methods for the preparation and use thereof |
| WO2026073795A1 (en) | 2024-10-01 | 2026-04-09 | Basf Se | Mixtures of additives for the stabilization of adhesives, sealants and elastomers |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2835653A (en) * | 1953-03-19 | 1958-05-20 | Polaroid Corp | Polyoxyethylene substituted polymers and their preparation |
| DE1495745C3 (de) * | 1963-09-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung wäßriger, emulgatorfreier Polyurethan-Latices |
| US3666542A (en) * | 1969-01-31 | 1972-05-30 | Teijin Ltd | Process for the production of microporous structures |
| DE2009179C3 (de) * | 1970-02-27 | 1974-07-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Allophanatpoly isocy anaten |
| US3666835A (en) * | 1970-04-16 | 1972-05-30 | Sun Chemical Corp | Polyurethane systems |
| US3796678A (en) * | 1970-08-17 | 1974-03-12 | Minnesota Mining & Mfg | Highly branched,capped polyurethanes for pressure sensitive adhesives |
-
1973
- 1973-03-23 DE DE2314513A patent/DE2314513C3/de not_active Expired
-
1974
- 1974-03-13 CA CA194,871A patent/CA1023887A/en not_active Expired
- 1974-03-18 US US452180A patent/US3920598A/en not_active Expired - Lifetime
- 1974-03-20 DD DD177310A patent/DD114961A5/xx unknown
- 1974-03-20 NL NL7403766A patent/NL7403766A/xx unknown
- 1974-03-20 GB GB1234274A patent/GB1425548A/en not_active Expired
- 1974-03-21 LU LU69683A patent/LU69683A1/xx unknown
- 1974-03-21 BE BE142263A patent/BE812619A/xx not_active IP Right Cessation
- 1974-03-22 ES ES424518A patent/ES424518A1/es not_active Expired
- 1974-03-22 IT IT49532/74A patent/IT1005869B/it active
- 1974-03-22 FR FR7409979A patent/FR2222405B1/fr not_active Expired
- 1974-03-22 JP JP3163374A patent/JPS5650745B2/ja not_active Expired
- 1974-03-22 IE IE626/74A patent/IE39092B1/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011051359A1 (en) | 2009-10-27 | 2011-05-05 | Cytec Austria Gmbh | Aqueously dispersible polyurethane |
| EP2690117A1 (en) | 2012-07-24 | 2014-01-29 | ALLNEX AUSTRIA GmbH | Aqueously Dispersible Polyurethane |
| WO2014016171A1 (en) | 2012-07-24 | 2014-01-30 | Allnex Austria Gmbh | Aqueously dispersible polyurethane |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS49128997A (enExample) | 1974-12-10 |
| IT1005869B (it) | 1976-09-30 |
| FR2222405B1 (enExample) | 1978-01-06 |
| LU69683A1 (enExample) | 1974-10-17 |
| BE812619A (fr) | 1974-09-23 |
| CA1023887A (en) | 1978-01-03 |
| DE2314513A1 (de) | 1974-10-03 |
| FR2222405A1 (enExample) | 1974-10-18 |
| GB1425548A (en) | 1976-02-18 |
| IE39092B1 (en) | 1978-08-02 |
| DE2314513B2 (de) | 1980-01-03 |
| NL7403766A (enExample) | 1974-09-25 |
| IE39092L (en) | 1974-09-23 |
| DD114961A5 (enExample) | 1975-09-05 |
| JPS5650745B2 (enExample) | 1981-12-01 |
| US3920598A (en) | 1975-11-18 |
| ES424518A1 (es) | 1976-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2314513B2 (de) | Verfahren zur Herstellung von wäßrigen Polyurethandispersionen | |
| DE2314512C3 (de) | Thermoplastische, nichtionische, in Wasser despergierbare im wesentlichen lineare Polyurethanelastomere | |
| DE2320719C2 (de) | Thermoplastische, emulgatorfreie, nicht ionische, in Wasser despergierbare, im wesentlichen lineare Polyurethanamid-Elastomere, Verfahren zu ihrer Herstellung und Verwendung | |
| DE2555534C3 (de) | In Wasser dispergierbare Polyurethane | |
| DE2651505C2 (enExample) | ||
| EP0004927B1 (de) | In Wasser dispergierbare oder lösliche Polyurethane sowie ein Verfahren zu ihrer Herstellung | |
| DE69702408T2 (de) | Laminatklebstoffe für flexible Verpackung | |
| DE2551094C2 (enExample) | ||
| EP0269972B2 (de) | Verfahren zur Herstellung von in Wasser löslichen oder dispergierbaren Polyurethanen und ihre Verwendung zur Beschichtung beliebiger Substrate | |
| DE2343294C3 (de) | Verbundmaterialien und Verfahren zu ihrer Herstellung | |
| DE2651506C2 (de) | Verfahren zur Herstellung von in Wasser dispergierbaren Polyurethanen | |
| DE1178586B (de) | Verfahren zur Herstellung elastischer Kunststoffe, einschliesslich Flaechengebilden,ach dem Polyisocyanat-Polyadditionsverfahren | |
| EP2356163A1 (de) | Vernetzbare polyurethan-dispersionen | |
| DE1694152B2 (de) | Verfahren zur Herstellung von mikroporösen Flächengebilden | |
| EP0595149A1 (de) | Wässrige Beschichtungsmittel und ihre Verwendung zur Erzeugung wasserdampfdurchlässiger Beschichtungen | |
| EP3280775A1 (de) | Verfahren zum verkleben von substraten mit klebstoffen | |
| DE2708442A1 (de) | Verfahren zur herstellung von modifizierten, waessrigen kunststoff- dispersionen | |
| EP0319816A2 (de) | Polyurethanharnstoffe | |
| DE1769089B2 (de) | Verfahren zur Herstellung von, gegebenenfalls mikroporösen, Formkörpern | |
| DE3313237A1 (de) | Waessrige, vernetzerhaltige polyurethanzubereitungen und ihre verwendung zur thermoaktiv-einstrich-umkehrbeschichtung | |
| EP0147668B1 (de) | Hitzevernetzbare PUR-Beschichtungsmassen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2034480A1 (de) | Polyurethan-Kunststoffe und Verfahren zu ihrer Herstellung | |
| DE102007052966A1 (de) | Dispersionsklebstoffe | |
| DE19832173A1 (de) | Polyurethanzubereitung zur Beschichtung von Substraten | |
| DE2123962B2 (de) | Verfahren zur Herstellung mikroporöser Flächengebilde |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |