DE2307863A1 - Verfahren zur herstellung von chlorpyrimidinen - Google Patents
Verfahren zur herstellung von chlorpyrimidinenInfo
- Publication number
- DE2307863A1 DE2307863A1 DE19732307863 DE2307863A DE2307863A1 DE 2307863 A1 DE2307863 A1 DE 2307863A1 DE 19732307863 DE19732307863 DE 19732307863 DE 2307863 A DE2307863 A DE 2307863A DE 2307863 A1 DE2307863 A1 DE 2307863A1
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- cyanoethyl
- acid chloride
- temperatures
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 150000005698 chloropyrimidines Chemical class 0.000 title description 3
- 239000000460 chlorine Substances 0.000 claims description 43
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 42
- 229910052801 chlorine Inorganic materials 0.000 claims description 42
- 238000006243 chemical reaction Methods 0.000 claims description 24
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 22
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 11
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- LWUUXENGQFMODR-UHFFFAOYSA-N n-(2-cyanoethyl)formamide Chemical compound O=CNCCC#N LWUUXENGQFMODR-UHFFFAOYSA-N 0.000 claims description 6
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims description 5
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000003701 inert diluent Substances 0.000 claims description 3
- 238000004821 distillation Methods 0.000 claims description 2
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 1
- 150000003948 formamides Chemical class 0.000 claims 1
- 239000011574 phosphorus Substances 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 claims 1
- 229910052703 rhodium Inorganic materials 0.000 claims 1
- 239000010948 rhodium Substances 0.000 claims 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims 1
- 238000005660 chlorination reaction Methods 0.000 description 32
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 32
- AUWPHGWEYHEAIG-UHFFFAOYSA-N 4,5,6-trichloropyrimidine Chemical compound ClC1=NC=NC(Cl)=C1Cl AUWPHGWEYHEAIG-UHFFFAOYSA-N 0.000 description 22
- 239000002244 precipitate Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 239000007789 gas Substances 0.000 description 11
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 10
- 239000003085 diluting agent Substances 0.000 description 8
- -1 methoxyethyl Chemical group 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- GNIARTJEBSBYFL-UHFFFAOYSA-N n-(2-cyanoethyl)-n-methylformamide Chemical compound O=CN(C)CCC#N GNIARTJEBSBYFL-UHFFFAOYSA-N 0.000 description 7
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000012456 homogeneous solution Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- RBHUJQUOUVTSBA-UHFFFAOYSA-N n-(2-cyanoethyl)-n-ethylformamide Chemical compound CCN(C=O)CCC#N RBHUJQUOUVTSBA-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- PANVCEBTPSTUEL-UHFFFAOYSA-N 1,1,2,3,3-pentachloropropane Chemical compound ClC(Cl)C(Cl)C(Cl)Cl PANVCEBTPSTUEL-UHFFFAOYSA-N 0.000 description 1
- GIKMWFAAEIACRF-UHFFFAOYSA-N 2,4,5-trichloropyrimidine Chemical compound ClC1=NC=C(Cl)C(Cl)=N1 GIKMWFAAEIACRF-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FPGVMJDQNJEAJM-UHFFFAOYSA-N 3-(butylamino)propanenitrile Chemical compound CCCCNCCC#N FPGVMJDQNJEAJM-UHFFFAOYSA-N 0.000 description 1
- RUVUQOOKKGVDNN-UHFFFAOYSA-N 3-(ethylamino)propanenitrile Chemical compound CCNCCC#N RUVUQOOKKGVDNN-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000007700 distillative separation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- VUNCWTMEJYMOOR-UHFFFAOYSA-N hexachlorocyclopentadiene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl VUNCWTMEJYMOOR-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 230000003330 sporicidal effect Effects 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732307863 DE2307863A1 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur herstellung von chlorpyrimidinen |
| NL7402047A NL7402047A (https=) | 1973-02-17 | 1974-02-14 | |
| BR1074/74A BR7401074D0 (pt) | 1973-02-17 | 1974-02-14 | Processo para a fabricacao de cloropirimidinas |
| IT48376/74A IT1008235B (it) | 1973-02-17 | 1974-02-14 | Processo per la produzione di cloropirimidine |
| FR7405302A FR2218334B1 (https=) | 1973-02-17 | 1974-02-15 | |
| JP49017709A JPS49110678A (https=) | 1973-02-17 | 1974-02-15 | |
| US443120A US3920649A (en) | 1973-02-17 | 1974-02-15 | Process for the preparation of chloropyrimidines |
| GB693574A GB1432306A (en) | 1973-02-17 | 1974-02-15 | Process for the preparation of chloropyrimidines |
| BE140941A BE811070A (fr) | 1973-02-17 | 1974-02-15 | Procede de preparation de chloropyrimidines |
| DD176588A DD113231A5 (https=) | 1973-02-17 | 1974-02-15 | |
| ES423323A ES423323A1 (es) | 1973-02-17 | 1974-02-16 | Procedimiento para la obtencion de cloropirimidinas. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732307863 DE2307863A1 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur herstellung von chlorpyrimidinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2307863A1 true DE2307863A1 (de) | 1974-08-22 |
Family
ID=5872217
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732307863 Pending DE2307863A1 (de) | 1973-02-17 | 1973-02-17 | Verfahren zur herstellung von chlorpyrimidinen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3920649A (https=) |
| JP (1) | JPS49110678A (https=) |
| BE (1) | BE811070A (https=) |
| BR (1) | BR7401074D0 (https=) |
| DD (1) | DD113231A5 (https=) |
| DE (1) | DE2307863A1 (https=) |
| ES (1) | ES423323A1 (https=) |
| FR (1) | FR2218334B1 (https=) |
| GB (1) | GB1432306A (https=) |
| IT (1) | IT1008235B (https=) |
| NL (1) | NL7402047A (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4266059A (en) | 1978-12-22 | 1981-05-05 | Bayer Aktiengesellschaft | Process for the preparation of 2,4,5-trichloropyrimidine |
| EP0127827A3 (en) * | 1983-06-01 | 1987-09-02 | Bayer Ag | Process for preparing chloropyrimidines |
| EP0377905A1 (de) * | 1989-01-13 | 1990-07-18 | Bayer Ag | Verfahren zur Herstellung von 4,5,6-Trichlorpyrimidin |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2451630A1 (de) * | 1974-10-30 | 1976-05-06 | Bayer Ag | Verfahren zur herstellung von tetrachlorpyrimidin |
| DE2659694A1 (de) * | 1976-12-31 | 1978-07-13 | Bayer Ag | Verfahren zur herstellung von substituierten chlorpyrimidinen |
| DE2701797A1 (de) * | 1977-01-18 | 1978-07-20 | Bayer Ag | Verfahren zur herstellung von 2,4,5-trichlorpyrimidin |
| DE2725888A1 (de) * | 1977-06-08 | 1978-12-21 | Bayer Ag | Verfahren zur herstellung von 2,4,5-trichlorpyrimidin |
| DE2753204A1 (de) * | 1977-11-29 | 1979-05-31 | Bayer Ag | Verfahren zur herstellung von tetrachlorpyrimidin |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH505114A (de) * | 1967-06-08 | 1971-03-31 | Bayer Ag | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin und 2,4,5,6-Tetrachlorpyrimidin |
| DE1670971A1 (de) * | 1968-01-12 | 1971-03-18 | Bayer Ag | Chlorpyrimidin-Derivate |
-
1973
- 1973-02-17 DE DE19732307863 patent/DE2307863A1/de active Pending
-
1974
- 1974-02-14 BR BR1074/74A patent/BR7401074D0/pt unknown
- 1974-02-14 IT IT48376/74A patent/IT1008235B/it active
- 1974-02-14 NL NL7402047A patent/NL7402047A/xx unknown
- 1974-02-15 DD DD176588A patent/DD113231A5/xx unknown
- 1974-02-15 GB GB693574A patent/GB1432306A/en not_active Expired
- 1974-02-15 FR FR7405302A patent/FR2218334B1/fr not_active Expired
- 1974-02-15 BE BE140941A patent/BE811070A/xx unknown
- 1974-02-15 US US443120A patent/US3920649A/en not_active Expired - Lifetime
- 1974-02-15 JP JP49017709A patent/JPS49110678A/ja active Pending
- 1974-02-16 ES ES423323A patent/ES423323A1/es not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4266059A (en) | 1978-12-22 | 1981-05-05 | Bayer Aktiengesellschaft | Process for the preparation of 2,4,5-trichloropyrimidine |
| EP0127827A3 (en) * | 1983-06-01 | 1987-09-02 | Bayer Ag | Process for preparing chloropyrimidines |
| EP0377905A1 (de) * | 1989-01-13 | 1990-07-18 | Bayer Ag | Verfahren zur Herstellung von 4,5,6-Trichlorpyrimidin |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7402047A (https=) | 1974-08-20 |
| BR7401074D0 (pt) | 1974-09-10 |
| US3920649A (en) | 1975-11-18 |
| BE811070A (fr) | 1974-08-16 |
| FR2218334B1 (https=) | 1977-09-30 |
| GB1432306A (en) | 1976-04-14 |
| ES423323A1 (es) | 1976-09-01 |
| JPS49110678A (https=) | 1974-10-22 |
| DD113231A5 (https=) | 1975-05-20 |
| IT1008235B (it) | 1976-11-10 |
| FR2218334A1 (https=) | 1974-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3840954A1 (de) | Herstellung von 2-chlornicotinsaeureestern | |
| DE3209472C2 (de) | Verfahren zur Herstellung von 3-Oxonitrilen sowie neue 3-Oxonitrile | |
| DE2307863A1 (de) | Verfahren zur herstellung von chlorpyrimidinen | |
| DE2751901A1 (de) | Herstellungsverfahren fuer am stickstoff substituierte imide | |
| DE3200069A1 (de) | Verfahren zur herstellung von 2,4,6-trichloranilin | |
| DE1933784C3 (de) | Verfahren zur Herstellung von Tetrachlorpyrimidin | |
| EP1598331B1 (de) | Verfahren zur Herstellung von Phthalsäuredichlorid | |
| DD249479A5 (de) | Verfahren zur herstellung von propionamidin-derivaten | |
| DE69011977T2 (de) | In bezug auf die Umwelt sicheres Verfahren zur Herstellung eines bestimmten Dialkylamins. | |
| CH503035A (de) | Verfahren zur Herstellung von Chlorpyrimidinen | |
| EP0127827B1 (de) | Verfahren zur Herstellung von Chlorpyrimidinen | |
| DE2640616C3 (de) | Verfahren zur Herstellung von N-Acyl-2-aiylglycinen | |
| EP0000042B1 (de) | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin | |
| DE2827062A1 (de) | Verfahren zur herstellung von phenylalkylsulfonen | |
| CH505114A (de) | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin und 2,4,5,6-Tetrachlorpyrimidin | |
| EP0552759A1 (de) | Verfahren zur Herstellung von 4,6-Dialkoxypyrimidinen | |
| DE2701797A1 (de) | Verfahren zur herstellung von 2,4,5-trichlorpyrimidin | |
| DE2065698B2 (de) | Verfahren zur Herstellung von 2-Isopropyl-6-methyl-4(3H)-pyrimidon | |
| DE1593967C2 (de) | Verfahren zur Herstellung von substituierten 2-Amino-benzophenonen | |
| DE1670971A1 (de) | Chlorpyrimidin-Derivate | |
| DE2745497A1 (de) | Verfahren zur herstellung von 2,4,5-trichlorpyrimidin und tetrachlorpyrimidin | |
| EP0071791B1 (de) | Neue Trichlormethylthiobenzoylhalogenide und Verfahren zur Herstellung von m- oder p-Trichlormethylthiobenzoylhalogeniden | |
| DE1670877C3 (de) | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin und 2,4,5,6-Tetrac hlorpyrimidin | |
| DE1545805B2 (de) | Verfahren zur Herstellung von Benzothiazocln-Derlvaten | |
| EP0012932B1 (de) | Verfahren zur Herstellung von 2,4,5-Trichlorpyrimidin |