DE2304265A1 - 6-triazolyl-(2')-benzofurane und optische aufheller - Google Patents
6-triazolyl-(2')-benzofurane und optische aufhellerInfo
- Publication number
- DE2304265A1 DE2304265A1 DE19732304265 DE2304265A DE2304265A1 DE 2304265 A1 DE2304265 A1 DE 2304265A1 DE 19732304265 DE19732304265 DE 19732304265 DE 2304265 A DE2304265 A DE 2304265A DE 2304265 A1 DE2304265 A1 DE 2304265A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- methyl
- formula
- carbon atoms
- triazolyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000003287 optical effect Effects 0.000 title claims description 5
- MPNFMCAOBNNFJF-UHFFFAOYSA-N 2,3-diphenyl-1-benzofuran Chemical compound C1=CC=CC=C1C1=C(C=2C=CC=CC=2)C2=CC=CC=C2O1 MPNFMCAOBNNFJF-UHFFFAOYSA-N 0.000 title 1
- -1 cyano, carboxyl Chemical group 0.000 claims description 33
- 150000001875 compounds Chemical class 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- HXGDTGSAIMULJN-UHFFFAOYSA-N acetnaphthylene Natural products C1=CC(C=C2)=C3C2=CC=CC3=C1 HXGDTGSAIMULJN-UHFFFAOYSA-N 0.000 claims description 3
- 125000005138 alkoxysulfonyl group Chemical group 0.000 claims description 3
- 125000005521 carbonamide group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004957 naphthylene group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229940124530 sulfonamide Drugs 0.000 claims description 3
- 150000003456 sulfonamides Chemical class 0.000 claims description 3
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229920002678 cellulose Polymers 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000000975 dye Substances 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims description 2
- 229920002994 synthetic fiber Polymers 0.000 claims description 2
- 239000012209 synthetic fiber Substances 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims 1
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000987 azo dye Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N benzofuran Natural products C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- ALKJBGCNJVHOTH-UHFFFAOYSA-N 2-(6-amino-3-methyl-1-benzofuran-2-yl)benzonitrile Chemical compound O1C2=CC(N)=CC=C2C(C)=C1C1=CC=CC=C1C#N ALKJBGCNJVHOTH-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- CJKUOFBILVRPCL-UHFFFAOYSA-N 4-(6-amino-3-methyl-1-benzofuran-2-yl)benzonitrile Chemical compound O1C2=CC(N)=CC=C2C(C)=C1C1=CC=C(C#N)C=C1 CJKUOFBILVRPCL-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- QQRIEKOVTCPIEV-UHFFFAOYSA-N methyl 4-(6-amino-3-methyl-1-benzofuran-2-yl)benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C1=C(C)C2=CC=C(N)C=C2O1 QQRIEKOVTCPIEV-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- LOQLDQJTSMKBJU-UHFFFAOYSA-N 4-(chloromethyl)benzonitrile Chemical compound ClCC1=CC=C(C#N)C=C1 LOQLDQJTSMKBJU-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000006261 methyl amino sulfonyl group Chemical group [H]N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732304265 DE2304265A1 (de) | 1973-01-30 | 1973-01-30 | 6-triazolyl-(2')-benzofurane und optische aufheller |
| FR7402396A FR2215422B3 (https=) | 1973-01-30 | 1974-01-24 | |
| CH119274A CH561719A5 (https=) | 1973-01-30 | 1974-01-29 | |
| IT4800674A IT1008774B (it) | 1973-01-30 | 1974-01-29 | 6 triazolil 2 benzofurani e sbian canti ottici |
| GB397074A GB1450862A (en) | 1973-01-30 | 1974-01-29 | 6-triazolyl-2-benzofurans and optical brighteners |
| JP1193774A JPS49107322A (https=) | 1973-01-30 | 1974-01-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732304265 DE2304265A1 (de) | 1973-01-30 | 1973-01-30 | 6-triazolyl-(2')-benzofurane und optische aufheller |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2304265A1 true DE2304265A1 (de) | 1974-08-01 |
Family
ID=5870247
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732304265 Pending DE2304265A1 (de) | 1973-01-30 | 1973-01-30 | 6-triazolyl-(2')-benzofurane und optische aufheller |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS49107322A (https=) |
| CH (1) | CH561719A5 (https=) |
| DE (1) | DE2304265A1 (https=) |
| FR (1) | FR2215422B3 (https=) |
| GB (1) | GB1450862A (https=) |
| IT (1) | IT1008774B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4268670A (en) * | 1979-02-08 | 1981-05-19 | Bayer Aktiengesellschaft | Process for the preparation of benzimidazolylbenzofuranes |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918965A1 (de) * | 1979-05-11 | 1980-11-20 | Bayer Ag | Benzofuranverbindungen sowie deren verwendung als optische aufheller |
| JP6140389B2 (ja) | 2011-06-24 | 2017-05-31 | 富士フイルム株式会社 | セルロースアシレートフィルム、これを用いた偏光板および液晶表示装置 |
-
1973
- 1973-01-30 DE DE19732304265 patent/DE2304265A1/de active Pending
-
1974
- 1974-01-24 FR FR7402396A patent/FR2215422B3/fr not_active Expired
- 1974-01-29 GB GB397074A patent/GB1450862A/en not_active Expired
- 1974-01-29 CH CH119274A patent/CH561719A5/xx not_active IP Right Cessation
- 1974-01-29 IT IT4800674A patent/IT1008774B/it active
- 1974-01-30 JP JP1193774A patent/JPS49107322A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4268670A (en) * | 1979-02-08 | 1981-05-19 | Bayer Aktiengesellschaft | Process for the preparation of benzimidazolylbenzofuranes |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2215422A1 (https=) | 1974-08-23 |
| IT1008774B (it) | 1976-11-30 |
| FR2215422B3 (https=) | 1976-11-19 |
| CH561719A5 (https=) | 1975-05-15 |
| GB1450862A (en) | 1976-09-29 |
| JPS49107322A (https=) | 1974-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0003784B1 (de) | Distyryl-Verbindungen, sowie deren Herstellung und Verwendung als Weisstöner und Laserfarbstoff | |
| EP0014344B1 (de) | Cumarinverbindungen, Verfahren zu ihrer Herstellung und deren Verwendung als Weisstöner und Laserfarbstoffe | |
| DE1148341B (de) | Verfahren zur Herstellung von Farbstoffen | |
| EP0047881B1 (de) | Dimethinverbindungen der Cumarinreihe, Verfahren zu deren Herstellung sowie deren Verwendung als Leuchtfarbstoffe | |
| EP0038296B1 (de) | Disazoverbindungen | |
| DE1069313B (https=) | ||
| DE2304265A1 (de) | 6-triazolyl-(2')-benzofurane und optische aufheller | |
| CH639119A5 (de) | Azopigmente. | |
| DE2000027A1 (de) | Optische Aufheller | |
| DE2912428A1 (de) | Neue dispersionsfarbstoffe, deren herstellung und verwendung | |
| DE2340571B2 (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| DE2308706C2 (de) | Verfahren zur Herstellung von Styrylfarbstoffen | |
| DE1234224B (de) | Verfahren zur Herstellung von fluoreszierenden 1, 2, 3-Triazolderivaten des 3-Phenylcumarins | |
| EP0144640A1 (de) | Distyrylverbindungen | |
| CH343560A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| DE2557523A1 (de) | Beta-anilinoaethansulfonylfluoride | |
| DE2017764A1 (de) | Benzoxanthen- und Benzothioxanthenfarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1644371A1 (de) | Verfahren zur Herstellung in Wasser schwer loeslicher Farbstoffe | |
| DE3510410A1 (de) | Azofarbstoffe | |
| DE730590C (de) | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen | |
| DE2415819A1 (de) | Azlactonfarbstoffe | |
| DE1904653A1 (de) | Substituierte Benzthiazol-N-oxide | |
| DE1020026B (de) | Verfahren zur Herstellung von 2-Stilbylmononaphtho-1, 2, 3-triazolverbindungen | |
| DE955418C (de) | Verfahren zur Herstellung von fluoreszierenden Stilbylditriazolverbindungen | |
| DE1052405B (de) | Verfahren zur Herstellung von organisch-loeslichen, fluoreszierenden 4-(4,5-Arylen-1, |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |