DE2303048A1 - Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel - Google Patents
Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittelInfo
- Publication number
- DE2303048A1 DE2303048A1 DE2303048A DE2303048A DE2303048A1 DE 2303048 A1 DE2303048 A1 DE 2303048A1 DE 2303048 A DE2303048 A DE 2303048A DE 2303048 A DE2303048 A DE 2303048A DE 2303048 A1 DE2303048 A1 DE 2303048A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- alkyl
- halogen
- alkoxy
- optionally
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 229940126601 medicinal product Drugs 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 65
- -1 1- Puryl Chemical group 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 33
- 125000003545 alkoxy group Chemical group 0.000 claims description 30
- 238000002360 preparation method Methods 0.000 claims description 19
- 150000002367 halogens Chemical class 0.000 claims description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 230000000507 anthelmentic effect Effects 0.000 claims description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 5
- 229940100198 alkylating agent Drugs 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 3
- 125000003435 aroyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 150000003585 thioureas Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 18
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims 2
- RJOGVCQIDQKGQC-UHFFFAOYSA-N n-carbamothioyl-n-phenylbenzamide Chemical compound C=1C=CC=CC=1N(C(=N)S)C(=O)C1=CC=CC=C1 RJOGVCQIDQKGQC-UHFFFAOYSA-N 0.000 claims 2
- 125000005228 aryl sulfonate group Chemical group 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 38
- 241001465754 Metazoa Species 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 244000045947 parasite Species 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000203 mixture Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 7
- UMGDCJDMYOKAJW-UHFFFAOYSA-N aminothiocarboxamide Natural products NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 7
- 239000007900 aqueous suspension Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 7
- 241001494479 Pecora Species 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000007903 gelatin capsule Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 241000282472 Canis lupus familiaris Species 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- NGOOFAMQPUEDJM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(=O)C1=CC=CC=C1 NGOOFAMQPUEDJM-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241001465677 Ancylostomatoidea Species 0.000 description 3
- 241000244188 Ascaris suum Species 0.000 description 3
- 241000338991 Heterakis spumosa Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 241001221734 Trichuris muris Species 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000002224 dissection Methods 0.000 description 3
- 235000013601 eggs Nutrition 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- HFWXSMIGWKLCME-UHFFFAOYSA-N methyl n-[(2-acetamido-5-benzoylphenyl)carbamothioyl]carbamate Chemical compound C1=C(NC(C)=O)C(NC(=S)NC(=O)OC)=CC(C(=O)C=2C=CC=CC=2)=C1 HFWXSMIGWKLCME-UHFFFAOYSA-N 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000010296 thiabendazole Nutrition 0.000 description 3
- 241000760148 Aspiculuris tetraptera Species 0.000 description 2
- 241000931177 Bunostomum trigonocephalum Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000876447 Cooperia curticei Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000243976 Haemonchus Species 0.000 description 2
- 241000243974 Haemonchus contortus Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- 241001673868 Oesophagostomum columbianum Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 241001480236 Strongyloides ratti Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000607216 Toxascaris Species 0.000 description 2
- 241000607143 Toxascaris leonina Species 0.000 description 2
- 241000243797 Trichostrongylus Species 0.000 description 2
- 241000571986 Uncinaria Species 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229940124339 anthelmintic agent Drugs 0.000 description 2
- 239000000921 anthelmintic agent Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- MMBDAJMDNVQFDV-UHFFFAOYSA-N methyl n-[amino(methylsulfanyl)methylidene]carbamate Chemical compound COC(=O)N=C(N)SC MMBDAJMDNVQFDV-UHFFFAOYSA-N 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000004308 thiabendazole Substances 0.000 description 2
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 2
- 229960004546 thiabendazole Drugs 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- 241000931178 Bunostomum Species 0.000 description 1
- 241000244203 Caenorhabditis elegans Species 0.000 description 1
- 241001126268 Cooperia Species 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000189163 Dipetalonema Species 0.000 description 1
- 239000004097 EU approved flavor enhancer Substances 0.000 description 1
- 241000498255 Enterobius vermicularis Species 0.000 description 1
- 241001517310 Eria Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000243994 Litomosoides carinii Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001126260 Nippostrongylus Species 0.000 description 1
- 241000862461 Oesophagostomum dentatum Species 0.000 description 1
- 241000718543 Ormosia krugii Species 0.000 description 1
- 241001364913 Pilaria Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000244173 Rhabditis Species 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241001126266 Strongyloidea Species 0.000 description 1
- 241000244030 Toxocara canis Species 0.000 description 1
- 241000243796 Trichostrongylus colubriformis Species 0.000 description 1
- 241000571980 Uncinaria stenocephala Species 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000036576 dermal application Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 206010014881 enterobiasis Diseases 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000019264 food flavour enhancer Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002541 isothioureas Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- CMGOBIRASMKVIA-UHFFFAOYSA-N methyl n-[[5-benzoyl-2-(butanoylamino)phenyl]carbamothioyl]carbamate Chemical compound C1=C(NC(=S)NC(=O)OC)C(NC(=O)CCC)=CC=C1C(=O)C1=CC=CC=C1 CMGOBIRASMKVIA-UHFFFAOYSA-N 0.000 description 1
- GWVIYFTYIHJPHR-UHFFFAOYSA-N methyl n-[[5-benzoyl-2-[(2-phenoxyacetyl)amino]phenyl]carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC(C(=O)C=2C=CC=CC=2)=CC=C1NC(=O)COC1=CC=CC=C1 GWVIYFTYIHJPHR-UHFFFAOYSA-N 0.000 description 1
- MKFSHVVOAIQUGS-UHFFFAOYSA-N methyl n-carbamothioylcarbamate Chemical compound COC(=O)NC(N)=S MKFSHVVOAIQUGS-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- SITHBLONMMHQJZ-UHFFFAOYSA-N propan-2-yl n-[(2-acetamido-5-benzoylphenyl)carbamothioyl]carbamate Chemical compound C1=C(NC(C)=O)C(NC(=S)NC(=O)OC(C)C)=CC(C(=O)C=2C=CC=CC=2)=C1 SITHBLONMMHQJZ-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/30—Isothioureas
- C07C335/38—Isothioureas containing any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Priority Applications (24)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2303048A DE2303048A1 (de) | 1973-01-23 | 1973-01-23 | Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel |
| CS224A CS171296B2 (OSRAM) | 1973-01-23 | 1974-01-14 | |
| US05/433,084 US3968314A (en) | 1973-01-23 | 1974-01-14 | Benzoylphenylisothioureas |
| RO7477278A RO66459A (ro) | 1973-01-23 | 1974-01-14 | Procedeu pentru prepararea benzoilfenilizotioureelor utilizate ca medicamente |
| IL7444043A IL44043A0 (en) | 1973-01-23 | 1974-01-21 | New benzoylphenylisothioureas,their production and pharmaceutical compositions containing them |
| SE7400755A SE387112B (sv) | 1973-01-23 | 1974-01-21 | Sett att framstella bensoylfenylisotiokarbamider |
| DK31074A DK134399C (da) | 1973-01-23 | 1974-01-21 | Analogifremgangsmade til fremstilling af benzoylphenylisothiourinstoffer |
| AR252008A AR199824A1 (es) | 1973-01-23 | 1974-01-21 | Procedimiento para la produccion de nuevas benzoilfenilisotioureas |
| LU69207A LU69207A1 (OSRAM) | 1973-01-23 | 1974-01-21 | |
| DD176108A DD114064A5 (OSRAM) | 1973-01-23 | 1974-01-21 | |
| BE140011A BE809972A (fr) | 1973-01-23 | 1974-01-21 | Nouvelles benzoylphenylisothiourees |
| JP49008653A JPS49108218A (OSRAM) | 1973-01-23 | 1974-01-21 | |
| IE00125/74A IE39040B1 (en) | 1973-01-23 | 1974-01-22 | New benzoylphenylisothioureas their production and their medicinal use |
| PL1974168275A PL90130B1 (OSRAM) | 1973-01-23 | 1974-01-22 | |
| ZA740456A ZA74456B (en) | 1973-01-23 | 1974-01-22 | New benzoylphenylisothioureas,their production and their medicinal use |
| NL7400850A NL7400850A (OSRAM) | 1973-01-23 | 1974-01-22 | |
| AU64740/74A AU476612B2 (en) | 1973-01-23 | 1974-01-22 | New benzoylphenylisothioureas, their production, and their medicinal use |
| ES422506A ES422506A1 (es) | 1973-01-23 | 1974-01-22 | Procedimiento para la obtencion de benzoilfenilisotioureas. |
| AT52574*#A AT329075B (de) | 1973-01-23 | 1974-01-22 | Verfahren zur herstellung von neuen n1- (5-benzoyl -2- acylamidophenyl) -n3- alkoxycarbonyl - isothioharnstoffathern |
| FR7402275A FR2214482B1 (OSRAM) | 1973-01-23 | 1974-01-23 | |
| SU1990756A SU496727A3 (ru) | 1973-01-23 | 1974-01-23 | Способ получени замещенных бензоилфенилизотиомочевины |
| GB313674A GB1424946A (en) | 1973-01-23 | 1974-01-23 | Benzoylphenyl-isothioureas, their production and their medicinal use |
| HUBA3019A HU167556B (OSRAM) | 1973-01-23 | 1974-01-23 | |
| KE2657*UA KE2657A (en) | 1973-01-23 | 1976-09-03 | New benzoylphenylisothioureas, their production, and their medicinal use |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2303048A DE2303048A1 (de) | 1973-01-23 | 1973-01-23 | Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2303048A1 true DE2303048A1 (de) | 1974-07-25 |
Family
ID=5869656
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2303048A Pending DE2303048A1 (de) | 1973-01-23 | 1973-01-23 | Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3968314A (OSRAM) |
| JP (1) | JPS49108218A (OSRAM) |
| AR (1) | AR199824A1 (OSRAM) |
| AT (1) | AT329075B (OSRAM) |
| AU (1) | AU476612B2 (OSRAM) |
| BE (1) | BE809972A (OSRAM) |
| CS (1) | CS171296B2 (OSRAM) |
| DD (1) | DD114064A5 (OSRAM) |
| DE (1) | DE2303048A1 (OSRAM) |
| DK (1) | DK134399C (OSRAM) |
| ES (1) | ES422506A1 (OSRAM) |
| FR (1) | FR2214482B1 (OSRAM) |
| GB (1) | GB1424946A (OSRAM) |
| HU (1) | HU167556B (OSRAM) |
| IE (1) | IE39040B1 (OSRAM) |
| IL (1) | IL44043A0 (OSRAM) |
| KE (1) | KE2657A (OSRAM) |
| LU (1) | LU69207A1 (OSRAM) |
| NL (1) | NL7400850A (OSRAM) |
| PL (1) | PL90130B1 (OSRAM) |
| RO (1) | RO66459A (OSRAM) |
| SE (1) | SE387112B (OSRAM) |
| SU (1) | SU496727A3 (OSRAM) |
| ZA (1) | ZA74456B (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0145662B1 (de) * | 1983-12-08 | 1987-04-29 | Ciba-Geigy Ag | Isothioharnstoffe |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2025413A1 (de) * | 1970-05-25 | 1971-12-02 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Ureidophenylisothioharnstoffe, Verfahren zu ihrer Herstellung und ihre fungizide Verwendung |
| DE2025412A1 (de) * | 1970-05-25 | 1971-12-02 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Amidophenylisothiohamstoffe, Verfahren zu ihrer Herstellung und ihre fungizide Verwendung |
| US3711504A (en) * | 1970-07-06 | 1973-01-16 | Du Pont | Process for preparing alkyl 2-benzimidazolecarbamates |
| GB1340428A (en) * | 1971-04-13 | 1973-12-12 | Ici Ltd | Benzothiadiazine derivatives their preparation and veterinary and pharmaceutical compositions containing them |
-
1973
- 1973-01-23 DE DE2303048A patent/DE2303048A1/de active Pending
-
1974
- 1974-01-14 US US05/433,084 patent/US3968314A/en not_active Expired - Lifetime
- 1974-01-14 CS CS224A patent/CS171296B2/cs unknown
- 1974-01-14 RO RO7477278A patent/RO66459A/ro unknown
- 1974-01-21 DD DD176108A patent/DD114064A5/xx unknown
- 1974-01-21 BE BE140011A patent/BE809972A/xx unknown
- 1974-01-21 DK DK31074A patent/DK134399C/da active
- 1974-01-21 JP JP49008653A patent/JPS49108218A/ja active Pending
- 1974-01-21 AR AR252008A patent/AR199824A1/es active
- 1974-01-21 SE SE7400755A patent/SE387112B/xx unknown
- 1974-01-21 LU LU69207A patent/LU69207A1/xx unknown
- 1974-01-21 IL IL7444043A patent/IL44043A0/xx unknown
- 1974-01-22 PL PL1974168275A patent/PL90130B1/pl unknown
- 1974-01-22 ZA ZA740456A patent/ZA74456B/xx unknown
- 1974-01-22 ES ES422506A patent/ES422506A1/es not_active Expired
- 1974-01-22 NL NL7400850A patent/NL7400850A/xx unknown
- 1974-01-22 AU AU64740/74A patent/AU476612B2/en not_active Expired
- 1974-01-22 AT AT52574*#A patent/AT329075B/de not_active IP Right Cessation
- 1974-01-22 IE IE00125/74A patent/IE39040B1/xx unknown
- 1974-01-23 FR FR7402275A patent/FR2214482B1/fr not_active Expired
- 1974-01-23 GB GB313674A patent/GB1424946A/en not_active Expired
- 1974-01-23 SU SU1990756A patent/SU496727A3/ru active
- 1974-01-23 HU HUBA3019A patent/HU167556B/hu unknown
-
1976
- 1976-09-03 KE KE2657*UA patent/KE2657A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU496727A3 (ru) | 1975-12-25 |
| DD114064A5 (OSRAM) | 1975-07-12 |
| IE39040L (en) | 1974-07-23 |
| SE387112B (sv) | 1976-08-30 |
| FR2214482B1 (OSRAM) | 1978-01-06 |
| FR2214482A1 (OSRAM) | 1974-08-19 |
| BE809972A (fr) | 1974-07-22 |
| RO66459A (ro) | 1981-06-26 |
| LU69207A1 (OSRAM) | 1974-09-25 |
| ZA74456B (en) | 1974-12-24 |
| ATA52574A (de) | 1975-07-15 |
| PL90130B1 (OSRAM) | 1977-01-31 |
| IL44043A0 (en) | 1974-05-16 |
| AU6474074A (en) | 1975-07-24 |
| NL7400850A (OSRAM) | 1974-07-25 |
| KE2657A (en) | 1976-09-17 |
| AT329075B (de) | 1976-04-26 |
| IE39040B1 (en) | 1978-07-19 |
| CS171296B2 (OSRAM) | 1976-10-29 |
| AR199824A1 (es) | 1974-09-30 |
| GB1424946A (en) | 1976-02-11 |
| JPS49108218A (OSRAM) | 1974-10-15 |
| DK134399B (da) | 1976-11-01 |
| HU167556B (OSRAM) | 1975-11-28 |
| ES422506A1 (es) | 1976-04-16 |
| DK134399C (da) | 1977-03-28 |
| AU476612B2 (en) | 1976-09-30 |
| US3968314A (en) | 1976-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT339329B (de) | Verfahren zur herstellung von neuen n-(o-acylaminophenyl) -n'- acylisothioharnstoffathern | |
| DE2405732A1 (de) | Ekto- und endoparasitenmittel | |
| DE2304764A1 (de) | Benzoylphenylguanidine, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2016622A1 (en) | Anthelmintic benzimidazole deriv | |
| DE2303048A1 (de) | Benzoylphenylisothioharnstoffe, ein verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel | |
| DE3133887A1 (de) | 2-arylhydrazino-2-imidazoline, deren acylderivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von endo- und ektoparasiten | |
| DE2443297A1 (de) | Anthelminthisch wirksame basisch substituierte 2-carbalkoxy-amino-benzimidazolyl-5(6)-phenylaether und -ketone sowie verfahren zu ihrer herstellung | |
| EP0073393A1 (de) | 2-Arylhydrazino-2-thiazoline, Acylderivate derselben, 2-Arylazo-2-thiazoline, Herstellungsverfahren und ihre Verwendung zur Bekämpfung von Ekto- und Endoparasiten | |
| DE2531606A1 (de) | Substituierte 2-phenylimino-thiazoline, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide | |
| DE2250911A1 (de) | Phenylguanidin-derivate, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2346937A1 (de) | N'-(aminoacylaminophenyl)-acetamidine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0002723B1 (de) | Phosphonylureidobenzol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2630847A1 (de) | Methoxycarbonyl-phenyl-guanidine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0009174A1 (de) | Neue (5-(3,4-Dihydroisochinolin-1-yl)-1H-benzimidazol-2-yl)-carbaminsäurealkylester, Verfahren zu ihrer Herstellung, sie enthaltende Arzneimittel und Verfahren zur Herstellung von anthelmintisch wirksamen Mitteln | |
| EP0033825B1 (de) | 2-Cyano-vinyl-(thiono)(thiol)-phospor- bzw. -phosphonsäure-Derivate als endoparasitizide Mittel | |
| DE2252691A1 (de) | Amidophenylisothioharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2423679C3 (de) | Substituierte Phenylguanidine, ein Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2553270A1 (de) | Ektoparasitizide mittel enthaltend diphenylcarbodiimide | |
| EP0010242A1 (de) | 2-Benzimidazolylcarbamidsäureester, diese enthaltende Arzneimittel sowie Verfahren zur ihrer Herstellung | |
| DE2348381A1 (de) | Anthelmintica | |
| EP0150719B1 (de) | Substituierte Salicylsäureamide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2425704A1 (de) | Substituierte phenylmercapto-benzimidazole | |
| DE2423679B2 (de) | Substituierte phenylguanidine, ein verfahren zu ihrer herstellung sowie diese verbindungen enthaltende arzneimittel | |
| DE2609574A1 (de) | Monosubstituiertes piperazinderivat, verfahren zu seiner herstellung und es enthaltende arzneimittel | |
| DE2438120A1 (de) | Substituierte benzimidazolylcarbamidsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |