DE2250383C3 - Magnetisierbares Speichermedium - Google Patents
Magnetisierbares SpeichermediumInfo
- Publication number
- DE2250383C3 DE2250383C3 DE2250383A DE2250383A DE2250383C3 DE 2250383 C3 DE2250383 C3 DE 2250383C3 DE 2250383 A DE2250383 A DE 2250383A DE 2250383 A DE2250383 A DE 2250383A DE 2250383 C3 DE2250383 C3 DE 2250383C3
- Authority
- DE
- Germany
- Prior art keywords
- binder
- storage medium
- melamine
- magnetizable
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003860 storage Methods 0.000 title claims description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 25
- 239000011230 binding agent Substances 0.000 claims description 17
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 16
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 12
- 229920000877 Melamine resin Polymers 0.000 claims description 11
- 229920000728 polyester Polymers 0.000 claims description 10
- 239000006229 carbon black Substances 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- -1 aliphatic glycols Chemical class 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 6
- 229920001577 copolymer Polymers 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 239000007859 condensation product Substances 0.000 claims description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 claims description 4
- BNCADMBVWNPPIZ-UHFFFAOYSA-N 2-n,2-n,4-n,4-n,6-n,6-n-hexakis(methoxymethyl)-1,3,5-triazine-2,4,6-triamine Chemical compound COCN(COC)C1=NC(N(COC)COC)=NC(N(COC)COC)=N1 BNCADMBVWNPPIZ-UHFFFAOYSA-N 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 150000003460 sulfonic acids Chemical class 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims 2
- 239000010410 layer Substances 0.000 description 17
- 238000005299 abrasion Methods 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 238000000576 coating method Methods 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- XLLIQLLCWZCATF-UHFFFAOYSA-N 2-methoxyethyl acetate Chemical compound COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 229920002635 polyurethane Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000005266 casting Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000036632 reaction speed Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910001369 Brass Inorganic materials 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 230000007257 malfunction Effects 0.000 description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- QLUXVUVEVXYICG-UHFFFAOYSA-N 1,1-dichloroethene;prop-2-enenitrile Chemical compound C=CC#N.ClC(Cl)=C QLUXVUVEVXYICG-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- SHVCSCWHWMSGTE-UHFFFAOYSA-N 6-methyluracil Chemical group CC1=CC(=O)NC(=O)N1 SHVCSCWHWMSGTE-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000006233 lamp black Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- RZWWGOCLMSGROE-UHFFFAOYSA-N n-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide Chemical compound N1=C2N=C(C)C=C(C)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl RZWWGOCLMSGROE-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 230000003746 surface roughness Effects 0.000 description 1
- 238000010345 tape casting Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/62—Record carriers characterised by the selection of the material
- G11B5/68—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent
- G11B5/70—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/62—Record carriers characterised by the selection of the material
- G11B5/73—Base layers, i.e. all non-magnetic layers lying under a lowermost magnetic recording layer, e.g. including any non-magnetic layer in between a first magnetic recording layer and either an underlying substrate or a soft magnetic underlayer
- G11B5/735—Base layers, i.e. all non-magnetic layers lying under a lowermost magnetic recording layer, e.g. including any non-magnetic layer in between a first magnetic recording layer and either an underlying substrate or a soft magnetic underlayer characterised by the back layer
- G11B5/7356—Base layers, i.e. all non-magnetic layers lying under a lowermost magnetic recording layer, e.g. including any non-magnetic layer in between a first magnetic recording layer and either an underlying substrate or a soft magnetic underlayer characterised by the back layer comprising non-magnetic particles in the back layer, e.g. particles of TiO2, ZnO or SiO2
Landscapes
- Paints Or Removers (AREA)
- Laminated Bodies (AREA)
- Magnetic Record Carriers (AREA)
- Manufacturing Of Magnetic Record Carriers (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2250383A DE2250383C3 (de) | 1972-10-13 | 1972-10-13 | Magnetisierbares Speichermedium |
| BE1005401A BE805692A (nl) | 1972-10-13 | 1973-10-05 | Dragers voor magnetisch materiaal met roethoudende ruglaag |
| NL7313940A NL7313940A (enExample) | 1972-10-13 | 1973-10-10 | |
| IT53052/73A IT994392B (it) | 1972-10-13 | 1973-10-11 | Materiale di memoria magnetizzabile con sostrato contenente neroeumo |
| FR7336578A FR2203129B1 (enExample) | 1972-10-13 | 1973-10-12 | |
| GB4766173A GB1416946A (en) | 1972-10-13 | 1973-10-12 | Magnetic storage medium with a backing layer containing carbon black |
| JP48114386A JPS4974909A (enExample) | 1972-10-13 | 1973-10-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2250383A DE2250383C3 (de) | 1972-10-13 | 1972-10-13 | Magnetisierbares Speichermedium |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2250383A1 DE2250383A1 (de) | 1974-05-02 |
| DE2250383B2 DE2250383B2 (de) | 1977-10-27 |
| DE2250383C3 true DE2250383C3 (de) | 1978-06-15 |
Family
ID=5859013
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2250383A Expired DE2250383C3 (de) | 1972-10-13 | 1972-10-13 | Magnetisierbares Speichermedium |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS4974909A (enExample) |
| BE (1) | BE805692A (enExample) |
| DE (1) | DE2250383C3 (enExample) |
| FR (1) | FR2203129B1 (enExample) |
| GB (1) | GB1416946A (enExample) |
| IT (1) | IT994392B (enExample) |
| NL (1) | NL7313940A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2501372C2 (de) * | 1975-01-15 | 1983-10-27 | Basf Ag, 6700 Ludwigshafen | Flexible Schichtmagnetogrammträger mit Rückseitenbeschichtung und Verfahren zu ihrer Herstellung |
| JPS595429A (ja) * | 1982-06-30 | 1984-01-12 | Hitachi Maxell Ltd | 磁気記録媒体 |
| JPS6080124A (ja) * | 1983-10-07 | 1985-05-08 | Fuji Photo Film Co Ltd | 磁気記録媒体 |
| DE3405960A1 (de) * | 1984-02-18 | 1985-08-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von magnetischen aufzeichnungstraegern mit rueckschicht sowie danach hergestellte magnetische aufzeichnungstraeger |
| JPS60229235A (ja) * | 1984-04-27 | 1985-11-14 | Fuji Photo Film Co Ltd | 磁気記録媒体の製法 |
| JPS60238184A (ja) * | 1984-05-12 | 1985-11-27 | Fine Tec Kenkyusho:Kk | 高速で移動する長尺体の表面に液状体を連続的に塗布する方法 |
| JPS61104327A (ja) * | 1984-10-23 | 1986-05-22 | Konishiroku Photo Ind Co Ltd | 磁気記録媒体 |
| JPS61180924A (ja) * | 1984-12-28 | 1986-08-13 | Konishiroku Photo Ind Co Ltd | 磁気記録媒体 |
| KR900002972B1 (ko) * | 1985-05-29 | 1990-05-03 | 니뽕 빅터 가부시끼가이샤 | 자기 기록 매체 |
| KR900002991B1 (en) * | 1985-05-29 | 1990-05-04 | Victor Company Of Japan | Magnetic recording carrier |
| JPS61273734A (ja) * | 1985-05-30 | 1986-12-04 | Victor Co Of Japan Ltd | 磁気記録媒体 |
| KR900006305B1 (ko) * | 1985-07-22 | 1990-08-28 | 니뽕 빅터 가부시끼가이샤 | 자기 기록 매체 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3440091A (en) * | 1965-04-05 | 1969-04-22 | Eastman Kodak Co | Conductive magnetic tape support |
| US3617378A (en) * | 1969-09-29 | 1971-11-02 | Ibm | Magnetic recording media |
-
1972
- 1972-10-13 DE DE2250383A patent/DE2250383C3/de not_active Expired
-
1973
- 1973-10-05 BE BE1005401A patent/BE805692A/xx unknown
- 1973-10-10 NL NL7313940A patent/NL7313940A/xx not_active Application Discontinuation
- 1973-10-11 IT IT53052/73A patent/IT994392B/it active
- 1973-10-12 GB GB4766173A patent/GB1416946A/en not_active Expired
- 1973-10-12 FR FR7336578A patent/FR2203129B1/fr not_active Expired
- 1973-10-13 JP JP48114386A patent/JPS4974909A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2250383A1 (de) | 1974-05-02 |
| NL7313940A (enExample) | 1974-03-25 |
| FR2203129A1 (enExample) | 1974-05-10 |
| FR2203129B1 (enExample) | 1979-03-30 |
| GB1416946A (en) | 1975-12-10 |
| JPS4974909A (enExample) | 1974-07-19 |
| IT994392B (it) | 1975-10-20 |
| DE2250383B2 (de) | 1977-10-27 |
| BE805692A (nl) | 1974-04-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2250383C3 (de) | Magnetisierbares Speichermedium | |
| DE3132604C2 (de) | Magnetisches Aufzeichnungsmaterial | |
| DE2230970B2 (de) | Beschichtetes blattmaterial und band fuer magnetische aufzeichnungen | |
| DE69221519T2 (de) | Polyesterfilm | |
| DE3326002A1 (de) | Magnetisches aufzeichnungsmaterial mit einer haft- oder grundierschicht | |
| DE3850839T2 (de) | Biaxial orientierter Polyesterfilm. | |
| DE3029818A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE3343893A1 (de) | Magnetisches aufzeichnungsmaterial | |
| DE3433849A1 (de) | Magnetische aufzeichnungsmedien, umfassend ein reaktionsprodukt eines spezifischen fluorkunststoffes und eines polymeren aushaertmaterials als bindemittel in dessen magnetschicht | |
| DE69202110T2 (de) | Verfahren zur Herstellung eines Schleifbands. | |
| DE69721701T2 (de) | Verbundfilm | |
| EP0013556B1 (de) | Antistatisch beschichtete, biaxial gestreckte Polyesterfolie und Verfahren zur Herstellung derselben | |
| DE1546959C3 (de) | Verfahren zur Herstellung von magnetisierbaren Aufzeichnungsträgern | |
| DE2834760C3 (de) | Wärmehärtbare flüssige Masse | |
| DE3525169C2 (enExample) | ||
| DE602005002278T2 (de) | Magnetisches Aufzeichnungsband | |
| DE3423908A1 (de) | Magnetisches aufzeichnungsmaterial | |
| DE1283897B (de) | Magnetband | |
| DE69003708T2 (de) | Zusammensetzung des Bindemittels bei magnetischen Aufzeichnungsträgern. | |
| DE69806896T2 (de) | Biaxial orientierte polyesterfolie und magnetisches aufzeichnungsmedium die diese als basisfolie enthält | |
| DE2414803C3 (de) | Verfahren zur Herstellung eines magnetisierbaren Speichermediums | |
| EP0083011A2 (de) | Verfahren zur Herstellung magnetischer Aufzeichnungsträger | |
| DE2240984A1 (de) | Magnetische aufzeichnungsbauteile | |
| DE3334958C2 (de) | Magnetisches Aufzeichnungsmaterial | |
| DE1280931B (de) | Bindemittel fuer ferromagnetische Pulver bei der Herstellung von Magnetogrammtraegern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8320 | Willingness to grant licences declared (paragraph 23) |