DE2249523C3 - Überspannungs-Schutzeinrichtung - Google Patents
Überspannungs-SchutzeinrichtungInfo
- Publication number
- DE2249523C3 DE2249523C3 DE2249523A DE2249523A DE2249523C3 DE 2249523 C3 DE2249523 C3 DE 2249523C3 DE 2249523 A DE2249523 A DE 2249523A DE 2249523 A DE2249523 A DE 2249523A DE 2249523 C3 DE2249523 C3 DE 2249523C3
- Authority
- DE
- Germany
- Prior art keywords
- insulating housing
- electrode
- bore
- main
- discharge gap
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000011049 filling Methods 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000004020 conductor Substances 0.000 claims 1
- 238000004544 sputter deposition Methods 0.000 claims 1
- 230000015556 catabolic process Effects 0.000 description 16
- 239000000463 material Substances 0.000 description 13
- 239000007789 gas Substances 0.000 description 10
- 230000001681 protective effect Effects 0.000 description 7
- 239000007772 electrode material Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 238000005476 soldering Methods 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 238000005219 brazing Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000001012 protector Effects 0.000 description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- 229910001316 Ag alloy Inorganic materials 0.000 description 1
- 229910000881 Cu alloy Inorganic materials 0.000 description 1
- PCEXQRKSUSSDFT-UHFFFAOYSA-N [Mn].[Mo] Chemical compound [Mn].[Mo] PCEXQRKSUSSDFT-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000004323 axial length Effects 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000006023 eutectic alloy Substances 0.000 description 1
- 238000007667 floating Methods 0.000 description 1
- 230000035929 gnawing Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01T—SPARK GAPS; OVERVOLTAGE ARRESTERS USING SPARK GAPS; SPARKING PLUGS; CORONA DEVICES; GENERATING IONS TO BE INTRODUCED INTO NON-ENCLOSED GASES
- H01T1/00—Details of spark gaps
- H01T1/20—Means for starting arc or facilitating ignition of spark gap
Landscapes
- Emergency Protection Circuit Devices (AREA)
- Thermistors And Varistors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18820871A | 1971-10-12 | 1971-10-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2249523A1 DE2249523A1 (de) | 1973-04-26 |
| DE2249523B2 DE2249523B2 (de) | 1977-09-01 |
| DE2249523C3 true DE2249523C3 (de) | 1983-02-03 |
Family
ID=22692190
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2249523A Expired DE2249523C3 (de) | 1971-10-12 | 1972-10-10 | Überspannungs-Schutzeinrichtung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3702952A (OSRAM) |
| JP (1) | JPS5718305B2 (OSRAM) |
| BE (1) | BE789890A (OSRAM) |
| CA (1) | CA966191A (OSRAM) |
| CH (1) | CH549882A (OSRAM) |
| DE (1) | DE2249523C3 (OSRAM) |
| ES (1) | ES407786A1 (OSRAM) |
| FR (1) | FR2156255B1 (OSRAM) |
| GB (1) | GB1389338A (OSRAM) |
| IT (1) | IT966240B (OSRAM) |
| SE (1) | SE381775B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE365066B (OSRAM) * | 1972-03-13 | 1974-03-11 | Ericsson Telefon Ab L M | |
| US3898533A (en) * | 1974-03-11 | 1975-08-05 | Bell Telephone Labor Inc | Fail-safe surge protective device |
| DE2418261B2 (de) * | 1974-04-16 | 1976-05-13 | Siemens AG, 1000 Berlin und 8000 München | Funkenstreckenbauelement fuer zuendanlagen von brennkaftmaschinen |
| US4293887A (en) * | 1979-05-04 | 1981-10-06 | Northern Telecom Inc. | Surge arrester with improved impulse ratio |
| DE3100924A1 (de) * | 1981-01-14 | 1982-08-05 | Siemens AG, 1000 Berlin und 8000 München | "gasentladungs-ueberspannungsableiter" |
| DE3218948A1 (de) * | 1982-05-19 | 1983-11-24 | Krone Gmbh, 1000 Berlin | Ueberspannungsableiter |
| EP0242688B1 (de) * | 1986-04-22 | 1990-07-18 | Siemens Aktiengesellschaft | Überspannungsableiter |
| DE3768147D1 (de) * | 1986-06-18 | 1991-04-04 | Siemens Ag | Gasentladungs-uberspannungsableiter. |
| CA1312913C (en) * | 1986-12-15 | 1993-01-19 | Peter Bobert | Gas discharge over-voltage arrestor having a line of ignition |
| DE3642818A1 (de) * | 1986-12-15 | 1988-06-16 | Siemens Ag | Gasentladungsueberspannungsableiter mit zuendstrich |
| JPH0697628B2 (ja) * | 1989-07-12 | 1994-11-30 | 矢崎総業株式会社 | シリーズギャップ付点火装置 |
| DE4234077A1 (de) * | 1992-10-09 | 1994-04-14 | Bosch Gmbh Robert | Verbindungsteil einer Zündanlage |
| JP2725763B2 (ja) * | 1994-06-30 | 1998-03-11 | 矢崎総業株式会社 | 放電管及びシリーズギャップ付点火装置 |
| CN2253522Y (zh) * | 1996-04-09 | 1997-04-30 | 杜宇峰 | 高能量型电释放器 |
| RU2208280C1 (ru) * | 2001-11-08 | 2003-07-10 | Открытое акционерное общество "Научно-исследовательский институт газоразрядных приборов "Плазма" | Газонаполненный искровой разрядник |
| FR3017004B1 (fr) * | 2014-01-27 | 2017-10-06 | Citel | Eclateur a gaz |
| DE102015114846A1 (de) * | 2015-09-04 | 2017-03-09 | Epcos Ag | Funkenstreckenanordnung |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1070733B (OSRAM) * | ||||
| GB544264A (en) * | 1941-01-13 | 1942-04-03 | Lodge Plugs Ltd | Improvements relating to electric spark gaps |
| US2829295A (en) * | 1949-07-02 | 1958-04-01 | Philips Corp | Internally conductively coated lamp and method of manufacture |
| US2859373A (en) * | 1954-05-21 | 1958-11-04 | Gen Electric | Lightning arrester |
| US3388274A (en) * | 1966-04-05 | 1968-06-11 | Joslyn Mfg & Supply Co | Axial spark gap with a coaxial third electrode adjacent the main axial electrodes |
| US3454811A (en) * | 1967-04-18 | 1969-07-08 | Bell Telephone Labor Inc | Gas tube surge (overload) protection device |
| US3431452A (en) * | 1967-05-17 | 1969-03-04 | Us Air Force | High-power surge arrester |
| US3588576A (en) * | 1968-11-25 | 1971-06-28 | Joslyn Mfg & Supply Co | Spark-gap device having a thin conductive layer for stabilizing operation |
-
0
- BE BE789890D patent/BE789890A/xx not_active IP Right Cessation
-
1971
- 1971-10-12 US US188208A patent/US3702952A/en not_active Expired - Lifetime
-
1972
- 1972-05-26 CA CA143,159A patent/CA966191A/en not_active Expired
- 1972-10-04 SE SE7212800A patent/SE381775B/xx unknown
- 1972-10-06 IT IT53237/72A patent/IT966240B/it active
- 1972-10-06 GB GB4620172A patent/GB1389338A/en not_active Expired
- 1972-10-10 DE DE2249523A patent/DE2249523C3/de not_active Expired
- 1972-10-11 ES ES407786A patent/ES407786A1/es not_active Expired
- 1972-10-11 CH CH1483172A patent/CH549882A/xx not_active IP Right Cessation
- 1972-10-11 FR FR7235995A patent/FR2156255B1/fr not_active Expired
- 1972-10-12 JP JP10166072A patent/JPS5718305B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE789890A (fr) | 1973-02-01 |
| ES407786A1 (es) | 1975-11-01 |
| FR2156255B1 (OSRAM) | 1975-01-03 |
| CA966191A (en) | 1975-04-15 |
| JPS4846850A (OSRAM) | 1973-07-04 |
| US3702952A (en) | 1972-11-14 |
| DE2249523B2 (de) | 1977-09-01 |
| FR2156255A1 (OSRAM) | 1973-05-25 |
| JPS5718305B2 (OSRAM) | 1982-04-15 |
| DE2249523A1 (de) | 1973-04-26 |
| CH549882A (de) | 1974-05-31 |
| SE381775B (sv) | 1975-12-15 |
| IT966240B (it) | 1974-02-11 |
| GB1389338A (en) | 1975-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2249523C3 (de) | Überspannungs-Schutzeinrichtung | |
| EP0140005A2 (de) | Vorrichtung zur Erzeugung einer Plasmaquelle mit hoher Strahlungsintensität in Röntgenbereich | |
| DE3038780C2 (OSRAM) | ||
| EP0324817A1 (de) | Gaselektronischer schalter (pseudofunkenschalter) | |
| DE1763187B1 (de) | Ueberspannungs schutzeinrichtung | |
| DE2834088A1 (de) | Gasentladungsroehre, insbesondere ueberspannungsableiter | |
| DE3835921C2 (de) | Überspannungsableiter mit Luftfunkenstrecke | |
| DE1440263A1 (de) | Vorrichtung zum Herstellen von Bohrungen geringen Durchmessers mittels Elektroerosion | |
| DE2612408A1 (de) | Ueberspannungsableiter | |
| DE2118938C3 (de) | Impulsgenerator | |
| EP1692751B1 (de) | Überspannungsschutzeinrichtung | |
| DE2730225C3 (de) | Zündeinrichtung für eine Metalldampf-Entladungsröhre | |
| WO1982001792A1 (en) | Protection device against discharge overvoltages in a gas with concentric enclosing sleeve | |
| CH658551A5 (en) | Overvoltage suppressor | |
| EP0425736B1 (de) | Triggerbare Schaltfunkenstrecke | |
| DE3220980A1 (de) | Hochspannungs-koaxialschalter | |
| DE2217874A1 (de) | Stoßspannungsableiter | |
| EP0215034B1 (de) | Röntgenröhre mit einem die anode und die kathode umgebenden zylindrischen metallteil | |
| DE2032899A1 (de) | Vorrichtung mit einer Schutzfunkenstrecke | |
| DE2310960A1 (de) | Gasgefuellte entladungsroehre fuer ueberspannungsschutzzwecke | |
| DE2821000A1 (de) | Zweistufige triggerbare vakuumstufenstrecke | |
| DE1238540B (de) | Elektrischer Schalter | |
| DE2233830C3 (de) | Elektronische Hochspannungsschalteinrichtung zur Zuteilung von Hochspannungsimpulsen an wenigstens zwei Zündkerzen einer Brennkraftmaschine | |
| DE2713217A1 (de) | Steuerbare elektrische hochspannungsschalteinrichtung | |
| DE4331215A1 (de) | Baugruppe zur Ableitung elektrischer Überspannungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |