DE2213958A1 - Substituierte 3-Benzylpyridine, ihre Herstellung und ihre Verwendung - Google Patents
Substituierte 3-Benzylpyridine, ihre Herstellung und ihre VerwendungInfo
- Publication number
- DE2213958A1 DE2213958A1 DE19722213958 DE2213958A DE2213958A1 DE 2213958 A1 DE2213958 A1 DE 2213958A1 DE 19722213958 DE19722213958 DE 19722213958 DE 2213958 A DE2213958 A DE 2213958A DE 2213958 A1 DE2213958 A1 DE 2213958A1
- Authority
- DE
- Germany
- Prior art keywords
- alpha
- substituted
- pyridine
- chlorobenzyl
- namely
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- UUCLVSDUMKMBSM-UHFFFAOYSA-N 3-benzylpyridine Chemical class C=1C=CN=CC=1CC1=CC=CC=C1 UUCLVSDUMKMBSM-UHFFFAOYSA-N 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 6
- -1 piperidino, morpholino, piperazino Chemical group 0.000 claims description 41
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 19
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 14
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 238000010992 reflux Methods 0.000 claims description 7
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- OKPPIDFMLVDJGU-UHFFFAOYSA-N 3-[chloro(phenyl)methyl]pyridine Chemical compound C=1C=CN=CC=1C(Cl)C1=CC=CC=C1 OKPPIDFMLVDJGU-UHFFFAOYSA-N 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 159000000000 sodium salts Chemical class 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 3
- CJTHEZOENCCEGH-UHFFFAOYSA-N 3-[chloro-(4-chlorophenyl)methyl]pyridine Chemical compound C=1C=CN=CC=1C(Cl)C1=CC=C(Cl)C=C1 CJTHEZOENCCEGH-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims description 2
- 239000000417 fungicide Substances 0.000 claims description 2
- 239000004009 herbicide Substances 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- AUYNWRLEXAPZAJ-UHFFFAOYSA-N piperazine;trihydrochloride Chemical compound Cl.Cl.Cl.C1CNCCN1 AUYNWRLEXAPZAJ-UHFFFAOYSA-N 0.000 claims 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims 1
- JHVNSRJPBXPZJU-UHFFFAOYSA-N 4-(trifluoromethoxy)benzenethiol Chemical compound FC(F)(F)OC1=CC=C(S)C=C1 JHVNSRJPBXPZJU-UHFFFAOYSA-N 0.000 claims 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 claims 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- PCFUWBOSXMKGIP-UHFFFAOYSA-N 2-benzylpyridine Chemical compound C=1C=CC=NC=1CC1=CC=CC=C1 PCFUWBOSXMKGIP-UHFFFAOYSA-N 0.000 description 2
- SGDVUDUIYAQCDF-UHFFFAOYSA-N 3-[chloro(phenyl)methyl]pyridine;hydrochloride Chemical compound Cl.C=1C=CN=CC=1C(Cl)C1=CC=CC=C1 SGDVUDUIYAQCDF-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000000843 anti-fungal effect Effects 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UOIQBJYBDZPVBB-UHFFFAOYSA-N 1-(4-chlorophenyl)-N-propyl-N-(pyridin-3-ylmethyl)propan-1-amine Chemical compound ClC1=CC=C(C=C1)C(CC)N(CCC)CC=1C=NC=CC=1 UOIQBJYBDZPVBB-UHFFFAOYSA-N 0.000 description 1
- 150000008092 2-benzylpyridines Chemical class 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- QGJAVGUBPSOFKS-UHFFFAOYSA-N morpholine;dihydrochloride Chemical compound Cl.Cl.C1COCCN1 QGJAVGUBPSOFKS-UHFFFAOYSA-N 0.000 description 1
- GCBOUAABYXKHIS-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)propan-1-amine Chemical compound CCCNCC1=CC=CN=C1 GCBOUAABYXKHIS-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000003918 potentiometric titration Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00126919A US3849423A (en) | 1971-03-22 | 1971-03-22 | 3-benzylpyridines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2213958A1 true DE2213958A1 (de) | 1972-09-28 |
Family
ID=22427373
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722213958 Pending DE2213958A1 (de) | 1971-03-22 | 1972-03-22 | Substituierte 3-Benzylpyridine, ihre Herstellung und ihre Verwendung |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3849423A (cg-RX-API-DMAC10.html) |
| AT (2) | AT318614B (cg-RX-API-DMAC10.html) |
| BE (1) | BE780967A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7201641D0 (cg-RX-API-DMAC10.html) |
| DD (1) | DD100252A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2213958A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES400963A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2130555A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1342558A (cg-RX-API-DMAC10.html) |
| HU (1) | HU165191B (cg-RX-API-DMAC10.html) |
| IE (1) | IE36127B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL38898A0 (cg-RX-API-DMAC10.html) |
| IT (1) | IT969393B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7203781A (cg-RX-API-DMAC10.html) |
| RO (1) | RO62699A (cg-RX-API-DMAC10.html) |
| SU (1) | SU453836A3 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA721446B (cg-RX-API-DMAC10.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3991068A (en) * | 1974-01-22 | 1976-11-09 | The Dow Chemical Company | Substituted pyridinylalkoxy-, pyridinylalkylsulfonyl- and pyridinylalkylthiophenylureas |
| US4021560A (en) * | 1975-08-11 | 1977-05-03 | American Home Products Corporation | 2-[(Dimethylamino)(3-pyridyl)methyl]cyclohexanol and related compounds |
| GB1540580A (en) * | 1975-09-02 | 1979-02-14 | Shell Int Research | Fungicidal isoxazolidines |
| US4138402A (en) * | 1976-08-26 | 1979-02-06 | Shell Oil Company | 3-Pyrid-3-ylisoxazolidine fungicides |
| FR2413877A1 (fr) * | 1978-01-06 | 1979-08-03 | Lilly Co Eli | Utilisation de derives de pyridine pour reguler la croissance de plantes aquatiques |
| US4407806A (en) * | 1981-11-23 | 1983-10-04 | Chevron Research Company | Fungicidal, herbicidal and plant growth regulating pyridyl-containing ethers |
| EP0148826A1 (en) * | 1983-07-13 | 1985-07-24 | Chevron Research And Technology Company | Fungicidal, herbicidal and plant growth regulating pyridyl-containing ethers |
| FR2561239B1 (fr) * | 1984-03-15 | 1986-09-05 | Rhone Poulenc Agrochimie | Arylthio-pyridinyl-alcanols |
| WO2003055850A1 (en) * | 2001-12-27 | 2003-07-10 | Daiichi Pharmaceutical Co., Ltd. | β-AMYLOID PROTEIN PRODUCTION/SECRETION INHIBITORS |
| EP1640366A4 (en) * | 2003-06-30 | 2009-05-13 | Daiichi Seiyaku Co | HETEROCYCLES METHYLSULFON DERIVATIVE |
| RU2697705C1 (ru) * | 2019-05-06 | 2019-08-19 | АО "Щелково Агрохим" | Способ получения N-(4-хлорбензил)пиридин-2-амина |
-
1971
- 1971-03-22 US US00126919A patent/US3849423A/en not_active Expired - Lifetime
-
1972
- 1972-02-29 IE IE246/72A patent/IE36127B1/xx unknown
- 1972-03-03 ZA ZA721446A patent/ZA721446B/xx unknown
- 1972-03-05 IL IL38898A patent/IL38898A0/xx unknown
- 1972-03-20 ES ES400963A patent/ES400963A1/es not_active Expired
- 1972-03-21 SU SU1763231A patent/SU453836A3/ru active
- 1972-03-21 AT AT241672A patent/AT318614B/de not_active IP Right Cessation
- 1972-03-21 BR BR721641A patent/BR7201641D0/pt unknown
- 1972-03-21 NL NL7203781A patent/NL7203781A/xx unknown
- 1972-03-21 AT AT569873A patent/AT317891B/de not_active IP Right Cessation
- 1972-03-21 GB GB1319772A patent/GB1342558A/en not_active Expired
- 1972-03-21 BE BE780967A patent/BE780967A/xx unknown
- 1972-03-21 RO RO7200078719A patent/RO62699A/ro unknown
- 1972-03-21 HU HUEI412A patent/HU165191B/hu unknown
- 1972-03-22 IT IT49159/72A patent/IT969393B/it active
- 1972-03-22 DD DD161727A patent/DD100252A5/xx unknown
- 1972-03-22 FR FR7210043A patent/FR2130555A1/fr not_active Withdrawn
- 1972-03-22 DE DE19722213958 patent/DE2213958A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2130555A1 (cg-RX-API-DMAC10.html) | 1972-11-03 |
| BE780967A (fr) | 1972-09-21 |
| NL7203781A (cg-RX-API-DMAC10.html) | 1972-09-26 |
| ZA721446B (en) | 1973-10-31 |
| SU453836A3 (ru) | 1974-12-15 |
| DD100252A5 (cg-RX-API-DMAC10.html) | 1973-09-12 |
| GB1342558A (en) | 1974-01-03 |
| IL38898A0 (en) | 1972-05-30 |
| US3849423A (en) | 1974-11-19 |
| BR7201641D0 (pt) | 1973-05-03 |
| AT318614B (de) | 1974-11-11 |
| ES400963A1 (es) | 1975-02-01 |
| IT969393B (it) | 1974-03-30 |
| AT317891B (de) | 1974-09-25 |
| IE36127B1 (en) | 1976-08-18 |
| HU165191B (cg-RX-API-DMAC10.html) | 1974-07-27 |
| IE36127L (en) | 1972-09-22 |
| RO62699A (fr) | 1978-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2612731C2 (de) | Verfahren zur Herstellung von N-substituierten Halogen-2-pyrrolidinonen | |
| DE2213958A1 (de) | Substituierte 3-Benzylpyridine, ihre Herstellung und ihre Verwendung | |
| EP0163260A1 (de) | Neue substituierte Pyrrolidinone, Verfahren zu ihrer Herstellung und Arzneimittel | |
| CH631870A5 (en) | Insecticide preparation | |
| DE2905650A1 (de) | Unkrautvernichtungsmittel | |
| DE2538179A1 (de) | 3-alkoxy-benzo-1,2,4-triazine, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide | |
| EP0072528B1 (de) | (Thio-) Harnstoffe, ein Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenschutzmittel | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE3025238C2 (cg-RX-API-DMAC10.html) | ||
| DE2136923A1 (de) | Substituierte benzthiazole, verfahren zu ihrer herstellung und ihre verwendung als fungizide und bakterizide | |
| EP0008071B1 (de) | 1-Iminomethylen-substituierte 2-(Phenoxy-alkyl)-2-imidazolinderivate, Verfahren zu ihrer Herstellung, Mittel, welche diese Derivate als aktive Komponente enthalten und ihre Verwendung zur Bekämpfung von Schädlingen | |
| CH644854A5 (de) | Salze von thiazolyliden-oxo-propionitrilen, insektizides mittel, enthaltend diese salze sowie verfahren zu ihrer herstellung. | |
| DE2637886A1 (de) | 3-pyridyl-oxy-alkancarbonsaeureamide | |
| CH644601A5 (de) | Thiazolyliden-oxo-propionitrile, insektizides mittel, enthaltend diese verbindungen sowie verfahren zu ihrer herstellung. | |
| EP0008565A1 (de) | Bis-(phenoxy-alkyl-2-imidazolin)-1,1'-sulfide, Verfahren zu ihrer Herstellung, Mittel welche diese Sulfide als aktive Komponente enthalten und deren Verwendung zur Bekämpfung von Schädlingen | |
| DE3019046A1 (de) | Triazolyl-vinyl-ketone und -carbinole, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DD201969A5 (de) | Fungizide mittel | |
| DE941908C (de) | Verfahren zur Herstellung von basischen AEthern | |
| DE2331185A1 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DE68910736T2 (de) | Fungizide heterozyklische Stickstoffverbindungen. | |
| EP0003975B1 (de) | Dichlormaleinsäurediamid-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2738902A1 (de) | Herbicides und algicides mittel | |
| EP0007066A1 (de) | 4-Alkyl- und 4-Allyl-merkapto-, sulfinyl- und sulfonyl-methyl-2-amino-6-N,N'-dimethylcarbamoyloxy-pyrimidine, Verfahren zu ihrer Herstellung, Mittel welche diese Pyrimidine enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| EP0014887B1 (de) | Spiro-Derivate von 3-(3,5-Dihalogenphenyl)-oxazolidin-2-thion-4-onen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DD209566A5 (de) | Fungizide zusammensetzungen |