DE2207575C3 - Mittel zur Regulierung des Pflanzenwachstum - Google Patents
Mittel zur Regulierung des PflanzenwachstumInfo
- Publication number
- DE2207575C3 DE2207575C3 DE2207575A DE2207575A DE2207575C3 DE 2207575 C3 DE2207575 C3 DE 2207575C3 DE 2207575 A DE2207575 A DE 2207575A DE 2207575 A DE2207575 A DE 2207575A DE 2207575 C3 DE2207575 C3 DE 2207575C3
- Authority
- DE
- Germany
- Prior art keywords
- bromide
- dimethyl
- chloride
- vessel
- height
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000008635 plant growth Effects 0.000 title claims description 7
- 230000001105 regulatory effect Effects 0.000 title claims description 3
- 150000003839 salts Chemical class 0.000 claims description 14
- 239000004480 active ingredient Substances 0.000 description 27
- 241000196324 Embryophyta Species 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 244000098338 Triticum aestivum Species 0.000 description 14
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 14
- 235000021307 Triticum Nutrition 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 230000012010 growth Effects 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- 240000005979 Hordeum vulgare Species 0.000 description 7
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 244000075850 Avena orientalis Species 0.000 description 5
- 235000007238 Secale cereale Nutrition 0.000 description 5
- 244000082988 Secale cereale Species 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 235000013339 cereals Nutrition 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000003630 growth substance Substances 0.000 description 4
- 239000011022 opal Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000003337 fertilizer Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- -1 phosphorus-4- Substances 0.000 description 3
- 231100000208 phytotoxic Toxicity 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- HATXXVNYNPECAD-UHFFFAOYSA-N pyridazin-1-ium;bromide Chemical compound [Br-].C1=CC=[NH+]N=C1 HATXXVNYNPECAD-UHFFFAOYSA-N 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- HSLFNRPJGOMNHW-UHFFFAOYSA-M 1,1-dimethyldiazinan-1-ium;bromide Chemical compound [Br-].C[N+]1(C)CCCCN1 HSLFNRPJGOMNHW-UHFFFAOYSA-M 0.000 description 2
- NUKXHTILEMYWNF-UHFFFAOYSA-M 1,1-dimethylpiperidin-1-ium;bromide Chemical compound [Br-].C[N+]1(C)CCCCC1 NUKXHTILEMYWNF-UHFFFAOYSA-M 0.000 description 2
- VXUNBHPUGJFXIT-UHFFFAOYSA-M 1,1-dimethylpyrrolidin-1-ium;bromide Chemical compound [Br-].C[N+]1(C)CCCC1 VXUNBHPUGJFXIT-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 240000002024 Gossypium herbaceum Species 0.000 description 2
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- VEIWYFRREFUNRC-UHFFFAOYSA-N hydron;piperidine;chloride Chemical compound [Cl-].C1CC[NH2+]CC1 VEIWYFRREFUNRC-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- ROFVJSWBDQUQGW-UHFFFAOYSA-N piperidin-1-ium;bromide Chemical compound Br.C1CCNCC1 ROFVJSWBDQUQGW-UHFFFAOYSA-N 0.000 description 2
- 239000005648 plant growth regulator Substances 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000004904 shortening Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 description 1
- HSQOPVUSHBNOOL-UHFFFAOYSA-M 1,1-dimethylpiperidin-1-ium;iodide Chemical compound [I-].C[N+]1(C)CCCCC1 HSQOPVUSHBNOOL-UHFFFAOYSA-M 0.000 description 1
- FJEQTUWHWBFLAK-UHFFFAOYSA-M 1,1-dimethylpyrrolidin-1-ium;chloride Chemical compound [Cl-].C[N+]1(C)CCCC1 FJEQTUWHWBFLAK-UHFFFAOYSA-M 0.000 description 1
- QQABNECANJIWHJ-UHFFFAOYSA-M 1-(bromomethyl)-1-methylpiperidin-1-ium bromide Chemical compound [Br-].C[N+]1(CBr)CCCCC1 QQABNECANJIWHJ-UHFFFAOYSA-M 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical class CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- XHWWMUHZKYZEFT-UHFFFAOYSA-M CC(C)[N+]1(C)CCCCC1.[Br-] Chemical compound CC(C)[N+]1(C)CCCCC1.[Br-] XHWWMUHZKYZEFT-UHFFFAOYSA-M 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 240000002395 Euphorbia pulcherrima Species 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 235000005206 Hibiscus Nutrition 0.000 description 1
- 235000007185 Hibiscus lunariifolius Nutrition 0.000 description 1
- 244000284380 Hibiscus rosa sinensis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 208000020221 Short stature Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000004464 cereal grain Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NNCAWEWCFVZOGF-UHFFFAOYSA-N mepiquat Chemical compound C[N+]1(C)CCCCC1 NNCAWEWCFVZOGF-UHFFFAOYSA-N 0.000 description 1
- VHOVSQVSAAQANU-UHFFFAOYSA-M mepiquat chloride Chemical compound [Cl-].C[N+]1(C)CCCCC1 VHOVSQVSAAQANU-UHFFFAOYSA-M 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N methyl bromide Substances BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical group COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000000618 nitrogen fertilizer Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical class C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Hydrogenated Pyridines (AREA)
- Cultivation Of Plants (AREA)
- Pyrrole Compounds (AREA)
- Fertilizers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE795534A BE795534A (fr) | 1972-02-18 | Agents pour la regulation de la croissance des plantes, contenant comme principe actif un sel azote | |
| DE2207575A DE2207575C3 (de) | 1972-02-18 | 1972-02-18 | Mittel zur Regulierung des Pflanzenwachstum |
| US328645A US3905798A (en) | 1972-02-18 | 1973-02-01 | Plant growth regulators |
| IL41465A IL41465A (en) | 1972-02-18 | 1973-02-05 | Plant growth regulating compositions containing quaternary ammonium salts of azacyclic compounds |
| NLAANVRAGE7301819,A NL174797C (nl) | 1972-02-18 | 1973-02-08 | Werkwijze voor het reguleren van de groei van planten met behulp van een heterocyclische ammoniumverbinding. |
| IT48178/73A IT977290B (it) | 1972-02-18 | 1973-02-12 | Agenti per la regolazione della crescita di piante |
| SE7302088A SE382154B (sv) | 1972-02-18 | 1973-02-14 | Medel for minskning av plantors lengdtillvext innehallande som aktiv substans vissa salter av cykliska kvevehaltiga foreningar |
| CH219273A CH567353A5 (cg-RX-API-DMAC7.html) | 1972-02-18 | 1973-02-15 | |
| GB764073A GB1414259A (en) | 1972-02-18 | 1973-02-16 | Plant growth regulators |
| AT139373A AT321026B (de) | 1972-02-18 | 1973-02-16 | Mittel zur Regulierung des Pflanzenwachstums |
| DK84073AA DK130163B (da) | 1972-02-18 | 1973-02-16 | Middel til regulering af plantevækst. |
| DD168902A DD102558A5 (cg-RX-API-DMAC7.html) | 1972-02-18 | 1973-02-16 | |
| JP48018476A JPS5745203B2 (cg-RX-API-DMAC7.html) | 1972-02-18 | 1973-02-16 | |
| SU731882866A SU609452A3 (ru) | 1972-02-18 | 1973-02-16 | Регул тор раста растений |
| FR7305735A FR2172418B1 (cg-RX-API-DMAC7.html) | 1972-02-18 | 1973-02-19 | |
| KE2822A KE2822A (en) | 1972-02-18 | 1978-03-08 | Plant growth regulators |
| ES468159A ES468159A3 (es) | 1972-02-18 | 1978-03-22 | Procedimiento de obtencion de un agente regulador del creci-miento de plantas |
| GT197853154A GT197853154A (es) | 1972-02-18 | 1978-07-11 | Agentes reguladores del crecimiento de las plantas que con--tienen como sustancia activa una sal nitrogenada. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2207575A DE2207575C3 (de) | 1972-02-18 | 1972-02-18 | Mittel zur Regulierung des Pflanzenwachstum |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2207575A1 DE2207575A1 (de) | 1973-08-23 |
| DE2207575B2 DE2207575B2 (de) | 1978-07-13 |
| DE2207575C3 true DE2207575C3 (de) | 1979-03-15 |
Family
ID=5836292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2207575A Expired DE2207575C3 (de) | 1972-02-18 | 1972-02-18 | Mittel zur Regulierung des Pflanzenwachstum |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3905798A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5745203B2 (cg-RX-API-DMAC7.html) |
| AT (1) | AT321026B (cg-RX-API-DMAC7.html) |
| BE (1) | BE795534A (cg-RX-API-DMAC7.html) |
| CH (1) | CH567353A5 (cg-RX-API-DMAC7.html) |
| DD (1) | DD102558A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2207575C3 (cg-RX-API-DMAC7.html) |
| DK (1) | DK130163B (cg-RX-API-DMAC7.html) |
| ES (1) | ES468159A3 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2172418B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1414259A (cg-RX-API-DMAC7.html) |
| GT (1) | GT197853154A (cg-RX-API-DMAC7.html) |
| IL (1) | IL41465A (cg-RX-API-DMAC7.html) |
| IT (1) | IT977290B (cg-RX-API-DMAC7.html) |
| KE (1) | KE2822A (cg-RX-API-DMAC7.html) |
| NL (1) | NL174797C (cg-RX-API-DMAC7.html) |
| SE (1) | SE382154B (cg-RX-API-DMAC7.html) |
| SU (1) | SU609452A3 (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3007224A1 (de) | 1980-02-27 | 1981-09-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur regulierung des wachstums von pflanzen |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4047923A (en) * | 1973-06-19 | 1977-09-13 | Bayer Aktiengesellschaft | Heterocyclic sulfonium salt containing plant-growth regulant compositions |
| CH604491A5 (cg-RX-API-DMAC7.html) | 1973-12-14 | 1978-09-15 | Hoffmann La Roche | |
| US4139367A (en) * | 1973-12-14 | 1979-02-13 | Hoffmann-La Roche Inc. | Piperidine salts as plant growth regulants |
| DE2651984C2 (de) * | 1976-11-15 | 1983-01-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von N,N-Dimethylpiperidiniumchlorid oder N,N-Dimethylmorpholiniumchlorid |
| DE2704962A1 (de) * | 1977-02-07 | 1978-08-10 | Basf Ag | Mittel zur beeinflussung des pflanzenwachstums |
| JPS5457804U (cg-RX-API-DMAC7.html) * | 1977-09-30 | 1979-04-21 | ||
| DE2755940C2 (de) * | 1977-12-15 | 1986-01-02 | Basf Ag, 6700 Ludwigshafen | Mittel zur Regulierung des Pflanzenwachstums |
| DE2842220A1 (de) * | 1978-09-28 | 1980-04-17 | Bayer Ag | Mittel zur wuchshemmung bei getreide |
| CA1151890A (en) * | 1980-02-19 | 1983-08-16 | American Cyanamid Company | Method for dwarfing the stem of sunflowers and cotton |
| US4439224A (en) * | 1980-07-28 | 1984-03-27 | Wilbur-Ellis Company | Plant growth regulator and method for the use thereof |
| US4338118A (en) * | 1981-06-23 | 1982-07-06 | Eli Lilly And Company | Plant growth regulation |
| EP0167776B1 (de) * | 1984-06-05 | 1989-04-05 | Hoechst Aktiengesellschaft | Pflanzenwachstumsregulierende Mittel |
| JP2673211B2 (ja) * | 1988-05-19 | 1997-11-05 | クミアイ化学工業株式会社 | 植物生長調節組成物 |
| ES2071079T3 (es) | 1989-12-13 | 1995-06-16 | Ciba Geigy Ag | Productos de accion sinergetica y procedimiento para la regulacion del crecimiento vegetal. |
| DE4026530A1 (de) * | 1990-08-22 | 1992-02-27 | Basf Ag | Synergistische mittel zur regulierung des pflanzenwachstums |
| EP0535415A1 (en) * | 1991-10-04 | 1993-04-07 | Basf Corporation | Plant growth regulator compositions |
| EP0573177B1 (en) * | 1992-06-04 | 1999-03-31 | Micro-Flo Company | Mepiquat chloride |
| ZA938081B (en) * | 1992-10-30 | 1995-05-02 | Basf Corp | Granular water soluble or hygroscopic agricultural formulations and methods of making them |
| US5380350A (en) * | 1992-10-30 | 1995-01-10 | Basf Corporation | Methods of making granular water soluble or hygroscopic agricultural formulations |
| US5468720A (en) * | 1993-07-20 | 1995-11-21 | Basf Corporation | High concentrated, solid mepiquat chloride products and processes for making dry form solid mepiquat chloride powder and tablets |
| US5476833A (en) * | 1994-05-13 | 1995-12-19 | Fersch; Kenneth E. | Water dispersible agricultural chemical granules coated with thin PVA film to reduce/eliminate container residue |
| US6288009B1 (en) * | 1998-04-10 | 2001-09-11 | Basf Corporation | Plant growth regulator compositions |
| DE10060383A1 (de) * | 2000-12-05 | 2002-06-13 | Basf Ag | Mittel auf Basis einer homogenen Phase und deren Stabilisierung durch Ammoniumnitrat sowie Verwendung der Mittel als Bioregulatoren |
| WO2002083732A2 (de) * | 2001-04-12 | 2002-10-24 | Basf Aktiengesellschaft | Bioregulatorische wirkstoffkombination |
| PL219699B1 (pl) * | 2002-03-21 | 2015-06-30 | Basf Ag | Mieszanina grzybobójcza zawierająca protiokonazol i prochloraz, sposób zwalczania szkodliwych grzybów i środek grzybobójczy |
| CN1681389A (zh) * | 2002-08-19 | 2005-10-12 | 巴斯福股份公司 | 含羧酸的试剂及其在植物栽培中的用途 |
| MXPA06011518A (es) * | 2004-05-13 | 2007-01-16 | Basf Ag | Mezclas fungicidas. |
| US20080033173A1 (en) * | 2004-08-13 | 2008-02-07 | Basf Aktiengesellschaft | Method for the Production of Quaternary Ammonia Compounds at Atomospheric Pressure |
| EP2052612A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037629A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| CN102584681A (zh) * | 2011-01-12 | 2012-07-18 | 中国科学院过程工程研究所 | 一步法合成高纯度植物生长调节剂缩节胺 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH454926A (de) * | 1965-10-26 | 1968-04-30 | Lonza Ag | Stickstoffhaltiger Dünger |
| US3402039A (en) * | 1966-12-05 | 1968-09-17 | Dow Chemical Co | Piperazinium salts as plant stunting agents |
| DE2015416C3 (de) * | 1970-04-01 | 1979-07-12 | Basf Ag, 6700 Ludwigshafen | Mittel zur Regulierung des Pflanzenwachstums |
| US3804612A (en) * | 1971-05-17 | 1974-04-16 | Gulf Research Development Co | Combating nutsedge with 1-methyl-4-phenylpyridinium salts |
| US3802862A (en) * | 1972-03-23 | 1974-04-09 | Dow Chemical Co | 1-ethyl-1-methyl-4-(3-methyl-2-phenylvalercyl oxy)piperidinium bromide as a plant stunting agent |
-
0
- BE BE795534A patent/BE795534A/xx not_active IP Right Cessation
-
1972
- 1972-02-18 DE DE2207575A patent/DE2207575C3/de not_active Expired
-
1973
- 1973-02-01 US US328645A patent/US3905798A/en not_active Expired - Lifetime
- 1973-02-05 IL IL41465A patent/IL41465A/xx unknown
- 1973-02-08 NL NLAANVRAGE7301819,A patent/NL174797C/xx not_active IP Right Cessation
- 1973-02-12 IT IT48178/73A patent/IT977290B/it active
- 1973-02-14 SE SE7302088A patent/SE382154B/xx unknown
- 1973-02-15 CH CH219273A patent/CH567353A5/xx not_active IP Right Cessation
- 1973-02-16 AT AT139373A patent/AT321026B/de not_active IP Right Cessation
- 1973-02-16 JP JP48018476A patent/JPS5745203B2/ja not_active Expired
- 1973-02-16 SU SU731882866A patent/SU609452A3/ru active
- 1973-02-16 DD DD168902A patent/DD102558A5/xx unknown
- 1973-02-16 GB GB764073A patent/GB1414259A/en not_active Expired
- 1973-02-16 DK DK84073AA patent/DK130163B/da not_active IP Right Cessation
- 1973-02-19 FR FR7305735A patent/FR2172418B1/fr not_active Expired
-
1978
- 1978-03-08 KE KE2822A patent/KE2822A/xx unknown
- 1978-03-22 ES ES468159A patent/ES468159A3/es not_active Expired
- 1978-07-11 GT GT197853154A patent/GT197853154A/es unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3007224A1 (de) | 1980-02-27 | 1981-09-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur regulierung des wachstums von pflanzen |
Also Published As
| Publication number | Publication date |
|---|---|
| IT977290B (it) | 1974-09-10 |
| SU609452A3 (ru) | 1978-05-30 |
| SE382154B (sv) | 1976-01-19 |
| CH567353A5 (cg-RX-API-DMAC7.html) | 1975-10-15 |
| JPS5745203B2 (cg-RX-API-DMAC7.html) | 1982-09-27 |
| JPS4888230A (cg-RX-API-DMAC7.html) | 1973-11-19 |
| DE2207575A1 (de) | 1973-08-23 |
| GB1414259A (en) | 1975-11-19 |
| DK130163B (da) | 1975-01-06 |
| NL174797B (nl) | 1984-03-16 |
| KE2822A (en) | 1978-03-31 |
| DD102558A5 (cg-RX-API-DMAC7.html) | 1973-12-20 |
| IL41465A0 (en) | 1973-04-30 |
| NL174797C (nl) | 1984-08-16 |
| FR2172418B1 (cg-RX-API-DMAC7.html) | 1977-04-22 |
| IL41465A (en) | 1975-11-25 |
| FR2172418A1 (cg-RX-API-DMAC7.html) | 1973-09-28 |
| GT197853154A (es) | 1980-01-02 |
| NL7301819A (cg-RX-API-DMAC7.html) | 1973-08-21 |
| AT321026B (de) | 1975-03-10 |
| US3905798A (en) | 1975-09-16 |
| ES468159A3 (es) | 1979-09-01 |
| BE795534A (fr) | 1973-08-16 |
| DE2207575B2 (de) | 1978-07-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2207575C3 (de) | Mittel zur Regulierung des Pflanzenwachstum | |
| CH644371A5 (de) | In 2- und 4-stellung disubstituierte 5-thiazolcarbonsaeuren und deren funktionelle derivate. | |
| DE1695270B2 (de) | Mittel zur bekaempfung von pilzen bei pflanzen | |
| DE1913726B2 (de) | Mittel zur Bekämpfung von Pilzen auf Basis von Pyrazinderivaten | |
| CH646945A5 (de) | Phenylessigsaeurederivate, deren herstellung und diese enthaltendes pflanzenwachstumsregulierendes mittel. | |
| DE2708886A1 (de) | Neue n-substituierte-n'-chlorbenzoylhydrazin-verbindungen | |
| DE1135238B (de) | Mittel zur Hemmung des Pflanzenwachstums, insbesondere Unkrautvertilgungsmittel | |
| DD149935A5 (de) | Verfahren zur herstellung von racemen oder optisch aktivem 2-(propargyloxyimino)-1,7,7-trimethylbicyclo(2,2,1)heptan | |
| DD298723A5 (de) | Biozide mittel | |
| DE2153660C2 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE2217697C3 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE3035822A1 (de) | Akarizide mittel | |
| DE2417257A1 (de) | Pflanzenwuchsregler | |
| DE1542959C2 (cg-RX-API-DMAC7.html) | ||
| DE2013510C3 (de) | Verwendung von 6-Trifluormethyl-2,4- dinitro-1,3-phenylendiaminen als Herbizide | |
| DE2952483C2 (de) | O-Sulfamoylglykolsäureamid-Derivate und deren Verwendung in einem herbiziden Mittel | |
| DE1542745A1 (de) | Pflanzenwachstumsfoerderndes Mittel | |
| DE2031907A1 (de) | Fungizide Benzthiadiazolderivate, Ver fahren zu deren Herstellung und Präparate, die die Benzthiadiazolderivate als akti ven Bestandteil enthalten | |
| DE2635967A1 (de) | 2-cyanacetamid-derivate und ihre herstellung und anwendung | |
| DE2217697B2 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DD236868A5 (de) | Mittel zum protahieren der wirkungsdauer und zur erhoehung der selektivitaet von herbiziden zusammensetzungen | |
| DE2348022A1 (de) | Sulfonamid-zubereitungen fuer herbicide | |
| AT331078B (de) | Fungizide zusammensetzung | |
| DE1518411C3 (de) | N-Disubstituierte Aminoamidsäuren, Verfahren zu deren Herstellung und Verwendung dieser Verbindungen | |
| DE2362743C3 (de) | Z-Chlor-N-propargylacetanilide, Verfahren zu deren Herstellung und deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |