DE2201899A1 - Verfahren zur Herstellung von 2,2,6-Trichlorcyclohexanon und -Masse - Google Patents
Verfahren zur Herstellung von 2,2,6-Trichlorcyclohexanon und -MasseInfo
- Publication number
- DE2201899A1 DE2201899A1 DE19722201899 DE2201899A DE2201899A1 DE 2201899 A1 DE2201899 A1 DE 2201899A1 DE 19722201899 DE19722201899 DE 19722201899 DE 2201899 A DE2201899 A DE 2201899A DE 2201899 A1 DE2201899 A1 DE 2201899A1
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- compound
- temperature
- reaction mixture
- moles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 33
- MGXYSOXDYQJDKF-UHFFFAOYSA-N 2,2,6-trichlorocyclohexan-1-one Chemical compound ClC1CCCC(Cl)(Cl)C1=O MGXYSOXDYQJDKF-UHFFFAOYSA-N 0.000 title claims description 28
- 238000002360 preparation method Methods 0.000 title claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 72
- 239000000460 chlorine Substances 0.000 claims description 72
- 229910052801 chlorine Inorganic materials 0.000 claims description 72
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 42
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 35
- 239000011541 reaction mixture Substances 0.000 claims description 18
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 14
- 239000007788 liquid Substances 0.000 claims description 13
- 229920006395 saturated elastomer Polymers 0.000 claims description 13
- -1 heteroaromatic amines Chemical class 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 150000004982 aromatic amines Chemical class 0.000 claims description 6
- 150000003139 primary aliphatic amines Chemical class 0.000 claims description 6
- 150000003839 salts Chemical group 0.000 claims description 6
- MNOLFQQEONPNAT-UHFFFAOYSA-N 2,6-dichlorocyclohexan-1-one Chemical compound ClC1CCCC(Cl)C1=O MNOLFQQEONPNAT-UHFFFAOYSA-N 0.000 claims description 5
- CCHNWURRBFGQCD-UHFFFAOYSA-N 2-chlorocyclohexan-1-one Chemical compound ClC1CCCCC1=O CCHNWURRBFGQCD-UHFFFAOYSA-N 0.000 claims description 5
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 4
- 235000013877 carbamide Nutrition 0.000 claims description 4
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- 150000008282 halocarbons Chemical class 0.000 claims description 4
- 150000003672 ureas Chemical class 0.000 claims description 4
- AGFDSLIZRUCCKJ-UHFFFAOYSA-N 2,2-dichlorocyclohexan-1-one Chemical compound ClC1(Cl)CCCCC1=O AGFDSLIZRUCCKJ-UHFFFAOYSA-N 0.000 claims description 3
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 claims description 3
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 claims description 3
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical group CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 claims description 3
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 claims description 3
- 150000003973 alkyl amines Chemical group 0.000 claims description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 20
- 229960000583 acetic acid Drugs 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 7
- QCAHVKJGHYVLIS-UHFFFAOYSA-N 2,2,6,6-tetrachlorocyclohexan-1-one Chemical compound ClC1(Cl)CCCC(Cl)(Cl)C1=O QCAHVKJGHYVLIS-UHFFFAOYSA-N 0.000 description 5
- 238000000197 pyrolysis Methods 0.000 description 5
- LKPFWCPZERQLFI-UHFFFAOYSA-N 2,4,6-trimethylpyridine;hydrochloride Chemical compound Cl.CC1=CC(C)=NC(C)=C1 LKPFWCPZERQLFI-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- HOLHYSJJBXSLMV-UHFFFAOYSA-N 2,6-dichlorophenol Chemical compound OC1=C(Cl)C=CC=C1Cl HOLHYSJJBXSLMV-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- 239000011280 coal tar Substances 0.000 description 2
- JHIVVAPYMSGYDF-PTQBSOBMSA-N cyclohexanone Chemical class O=[13C]1CCCCC1 JHIVVAPYMSGYDF-PTQBSOBMSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- UWHSPZZUAYSGTB-UHFFFAOYSA-N 1,1,3,3-tetraethylurea Chemical compound CCN(CC)C(=O)N(CC)CC UWHSPZZUAYSGTB-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- ZYDDJESVOHLOIS-UHFFFAOYSA-N 1,1,3-triethyl-3-methylurea Chemical compound CCN(C)C(=O)N(CC)CC ZYDDJESVOHLOIS-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- CJKFVHIAEZFRKY-UHFFFAOYSA-N 1,3-diethyl-1,3-dimethylurea Chemical compound CCN(C)C(=O)N(C)CC CJKFVHIAEZFRKY-UHFFFAOYSA-N 0.000 description 1
- GQBOTXZNGCOPRJ-UHFFFAOYSA-N 1-ethyl-1,3,3-trimethylurea Chemical compound CCN(C)C(=O)N(C)C GQBOTXZNGCOPRJ-UHFFFAOYSA-N 0.000 description 1
- SSHPBFPEXUHYSO-UHFFFAOYSA-N 2,2,3-trichlorocyclohexan-1-one Chemical compound ClC1CCCC(=O)C1(Cl)Cl SSHPBFPEXUHYSO-UHFFFAOYSA-N 0.000 description 1
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical class CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 1
- ZUYKJZQOPXDNOK-UHFFFAOYSA-N 2-(ethylamino)-2-thiophen-2-ylcyclohexan-1-one;hydrochloride Chemical class Cl.C=1C=CSC=1C1(NCC)CCCCC1=O ZUYKJZQOPXDNOK-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- DADSZOFTIIETSV-UHFFFAOYSA-N n,n-dichloroaniline Chemical compound ClN(Cl)C1=CC=CC=C1 DADSZOFTIIETSV-UHFFFAOYSA-N 0.000 description 1
- DKRWIHBHWSEXGO-UHFFFAOYSA-N n,n-dichloropropan-1-amine Chemical compound CCCN(Cl)Cl DKRWIHBHWSEXGO-UHFFFAOYSA-N 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- TYDFLVGVWMSQAC-UHFFFAOYSA-N n-chloro-n-ethylethanamine Chemical compound CCN(Cl)CC TYDFLVGVWMSQAC-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- GVPKNZSJQDDDGN-UHFFFAOYSA-N n-chloropropan-1-amine Chemical compound CCCNCl GVPKNZSJQDDDGN-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UMHSKYSHOIGDPE-UHFFFAOYSA-N pyridine;quinoline Chemical compound C1=CC=NC=C1.N1=CC=CC2=CC=CC=C21 UMHSKYSHOIGDPE-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000004992 toluidines Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US115773A US3894087A (en) | 1971-02-16 | 1971-02-16 | Method of producing 2,2,6-trichlorocyclo-hexanone and compositions thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2201899A1 true DE2201899A1 (de) | 1972-08-31 |
Family
ID=22363308
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722201899 Pending DE2201899A1 (de) | 1971-02-16 | 1972-01-13 | Verfahren zur Herstellung von 2,2,6-Trichlorcyclohexanon und -Masse |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3894087A (Direct) |
| BE (1) | BE777966A (Direct) |
| CA (1) | CA951328A (Direct) |
| DE (1) | DE2201899A1 (Direct) |
| FR (1) | FR2125281A1 (Direct) |
| GB (1) | GB1327649A (Direct) |
| IT (1) | IT948173B (Direct) |
| NL (1) | NL7200480A (Direct) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1084947A (en) * | 1975-11-29 | 1980-09-02 | John F. Harris | Process for preparing pyrogallol and its derivatives |
| US4166914A (en) * | 1976-08-12 | 1979-09-04 | Carl E. Van Winckel | Production of o-alkoxyphenols |
| US4219505A (en) * | 1977-05-11 | 1980-08-26 | Fisons Limited | Process for preparing tetrahalocyclohexanone |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2674572A (en) * | 1950-02-18 | 1954-04-06 | Henkel & Compagnie G M B H | Production of tetrachlorocyclohexanones |
| BE668177A (Direct) * | 1964-08-12 |
-
1971
- 1971-02-16 US US115773A patent/US3894087A/en not_active Expired - Lifetime
- 1971-12-29 GB GB6045471A patent/GB1327649A/en not_active Expired
- 1971-12-29 CA CA131,323,A patent/CA951328A/en not_active Expired
-
1972
- 1972-01-11 IT IT47652/72A patent/IT948173B/it active
- 1972-01-12 NL NL7200480A patent/NL7200480A/xx unknown
- 1972-01-13 BE BE777966A patent/BE777966A/xx unknown
- 1972-01-13 FR FR7201084A patent/FR2125281A1/fr not_active Withdrawn
- 1972-01-13 DE DE19722201899 patent/DE2201899A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1327649A (en) | 1973-08-22 |
| BE777966A (fr) | 1972-07-13 |
| IT948173B (it) | 1973-05-30 |
| US3894087A (en) | 1975-07-08 |
| FR2125281A1 (Direct) | 1972-09-29 |
| NL7200480A (Direct) | 1972-08-18 |
| AU3758272A (en) | 1973-07-05 |
| CA951328A (en) | 1974-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2429937C2 (Direct) | ||
| DE69205623T2 (de) | Verfahren zur Herstellung von Amid durch Oximumlagerung in flüssiger Phase. | |
| DE2313496C3 (de) | Verfahren zur Herstellung von m- und p- Phenylendiamin | |
| EP0352504B1 (de) | Verfahren zur gemeinschaftlichen Herstellung von 3-Dialkylaminopropionitrilen, Bis-(2-cyanoethyl)-ether und gewünschtenfalls Ethylencyanhydrin | |
| EP0135833B1 (de) | Verfahren zur Herstellung von 2-Amino-alkylpyridinen | |
| EP0037548B1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidon-4 | |
| EP0598338A1 (de) | Verfahren zur Herstellung von 1,3-Difluorbenzol | |
| DE1228246B (de) | Verfahren zur Herstellung von Derivaten des N-Acylvinylamins | |
| CH663204A5 (de) | Propannitrilderivate. | |
| DE2830009C2 (Direct) | ||
| DE2336403A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE1188577B (de) | Verfahren zur Herstellung von omega-Chlor bzw. omega-Bromtiglinaldehyd, deren AcetaleAcylaten | |
| DE2031900B2 (de) | Verfahren zur Herstellung von Isopren | |
| DE1568629C3 (de) | Verfahren zur Herstellung von organischen Isocyanaten | |
| DE2506029A1 (de) | Verfahren zur herstellung von maleinsaeurenitril | |
| DE739259C (de) | Verfahren zur Umlagerung von cyclischen Ketoximen in Lactame | |
| DE1418334B1 (de) | Verfahren zur Herstellung von 1,2,3,4,7,7-Hexachlorbicyclo[2,2,1]-2,5-heptadien aus Hexachlorcyclopentadien und Acetylen | |
| DE2062679B2 (de) | Verfahren zur herstellung von alphaaminocycloalkanonoximhydrochloriden | |
| DE1190932C2 (de) | Verfahren zur herstellung von terpenallyl-carbonsaeureestern | |
| DE1921662C3 (de) | Verfahren zur Reinigung von Malonsäuredinitril | |
| DE1090225B (de) | Verfahren zur Herstellung von p-Nitrodiphenylaminen | |
| DE2201897A1 (de) | Herstellung von o-Chlorphenolen | |
| DE2050562A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid | |
| DE2902541A1 (de) | Verbessertes verfahren zur herstellung aromatischer aldehyde und alkohole, insbesondere benzaldehyd, benzylalkohol und ihrer derivate | |
| DE3144765A1 (de) | Verfahren zur herstellung von chlorlactonen aus ungesaettigten carbonsaeuren |