DE2200126A1 - Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonen - Google Patents
Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonenInfo
- Publication number
- DE2200126A1 DE2200126A1 DE19722200126 DE2200126A DE2200126A1 DE 2200126 A1 DE2200126 A1 DE 2200126A1 DE 19722200126 DE19722200126 DE 19722200126 DE 2200126 A DE2200126 A DE 2200126A DE 2200126 A1 DE2200126 A1 DE 2200126A1
- Authority
- DE
- Germany
- Prior art keywords
- tert
- methyl
- parts
- butyl
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 16
- CKGKXGQVRVAKEA-UHFFFAOYSA-N (2-methylphenyl)-phenylmethanone Chemical class CC1=CC=CC=C1C(=O)C1=CC=CC=C1 CKGKXGQVRVAKEA-UHFFFAOYSA-N 0.000 title claims description 13
- 229910052736 halogen Inorganic materials 0.000 title description 5
- 150000002367 halogens Chemical group 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 39
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 12
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 11
- 239000000460 chlorine Chemical group 0.000 claims description 11
- 239000000370 acceptor Substances 0.000 claims description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Chemical group 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- CJSMPLKHAWDLIF-UHFFFAOYSA-N C(C)(C)(C)C=1C(=C(C(=O)C2=CC=CC=C2)C=CC=1)C Chemical compound C(C)(C)(C)C=1C(=C(C(=O)C2=CC=CC=C2)C=CC=1)C CJSMPLKHAWDLIF-UHFFFAOYSA-N 0.000 claims 3
- 239000003795 chemical substances by application Substances 0.000 claims 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- -1 2-methyl-5-tert-butyl-2 ', 4'-dichlorobenzophenone Chemical compound 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000001103 potassium chloride Substances 0.000 description 5
- 235000011164 potassium chloride Nutrition 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- UOBZEBGRMJZFRG-UHFFFAOYSA-N (2-chlorophenyl)-(2-methylphenyl)methanone Chemical compound CC1=CC=CC=C1C(=O)C1=CC=CC=C1Cl UOBZEBGRMJZFRG-UHFFFAOYSA-N 0.000 description 3
- DCGHHUAWWYRNMF-UHFFFAOYSA-N CC(C)(C)C(C=C1)=CC(C)=C1C(C(C=CC=C1)=C1Cl)=O Chemical compound CC(C)(C)C(C=C1)=CC(C)=C1C(C(C=CC=C1)=C1Cl)=O DCGHHUAWWYRNMF-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000012965 benzophenone Substances 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 2
- UBWIIASXOOMQIG-UHFFFAOYSA-N CC1=C(Cl)C=C(C(C)(C)C)C=C1C(=O)C1=CC=CC=C1 Chemical compound CC1=C(Cl)C=C(C(C)(C)C)C=C1C(=O)C1=CC=CC=C1 UBWIIASXOOMQIG-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- UKYOWMFKBUBKOX-UHFFFAOYSA-N (1-chlorocyclohexa-2,4-dien-1-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1(Cl)CC=CC=C1 UKYOWMFKBUBKOX-UHFFFAOYSA-N 0.000 description 1
- RLUFBDIRFJGKLY-UHFFFAOYSA-N (2,3-dichlorophenyl)-phenylmethanone Chemical compound ClC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1Cl RLUFBDIRFJGKLY-UHFFFAOYSA-N 0.000 description 1
- VYWBHIJKBLGYQM-UHFFFAOYSA-N (3-chloro-2-methylphenyl)-phenylmethanone Chemical compound CC1=C(Cl)C=CC=C1C(=O)C1=CC=CC=C1 VYWBHIJKBLGYQM-UHFFFAOYSA-N 0.000 description 1
- FAVBMIOZZDHIMI-UHFFFAOYSA-N (3-tert-butylphenyl)-phenylmethanone Chemical class CC(C)(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 FAVBMIOZZDHIMI-UHFFFAOYSA-N 0.000 description 1
- WXPWZZHELZEVPO-UHFFFAOYSA-N (4-methylphenyl)-phenylmethanone Chemical class C1=CC(C)=CC=C1C(=O)C1=CC=CC=C1 WXPWZZHELZEVPO-UHFFFAOYSA-N 0.000 description 1
- MEILSOQVXNYFTC-UHFFFAOYSA-N (5-chloro-2-methylphenyl)-phenylmethanone Chemical class CC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 MEILSOQVXNYFTC-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 1
- QCWXDVFBZVHKLV-UHFFFAOYSA-N 1-tert-butyl-4-methylbenzene Chemical compound CC1=CC=C(C(C)(C)C)C=C1 QCWXDVFBZVHKLV-UHFFFAOYSA-N 0.000 description 1
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical compound CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 1
- GPHQXTFRTJKHPI-UHFFFAOYSA-N 4-tert-butyl-2-chloro-1-methylbenzene Chemical compound CC1=CC=C(C(C)(C)C)C=C1Cl GPHQXTFRTJKHPI-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- JHXKRIRFYBPWGE-UHFFFAOYSA-K bismuth chloride Chemical compound Cl[Bi](Cl)Cl JHXKRIRFYBPWGE-UHFFFAOYSA-K 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- UPWPDUACHOATKO-UHFFFAOYSA-K gallium trichloride Chemical compound Cl[Ga](Cl)Cl UPWPDUACHOATKO-UHFFFAOYSA-K 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 150000008379 phenol ethers Chemical class 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722200126 DE2200126A1 (de) | 1972-01-03 | 1972-01-03 | Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonen |
| CH1888372A CH575365A5 (enExample) | 1972-01-03 | 1972-12-27 | |
| JP408873A JPS4876850A (enExample) | 1972-01-03 | 1972-12-29 | |
| IT5516472A IT974425B (it) | 1972-01-03 | 1972-12-29 | Procedimento per la produzione di 2 metilbenzofenoni omogenei sostituiti da alogeno |
| GB15773A GB1406011A (en) | 1972-01-03 | 1973-01-02 | Production of uniform halosubstituted 2-methylbenzophenones |
| FR7300124A FR2167625B3 (enExample) | 1972-01-03 | 1973-01-03 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722200126 DE2200126A1 (de) | 1972-01-03 | 1972-01-03 | Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2200126A1 true DE2200126A1 (de) | 1973-07-12 |
Family
ID=5832250
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722200126 Pending DE2200126A1 (de) | 1972-01-03 | 1972-01-03 | Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonen |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS4876850A (enExample) |
| CH (1) | CH575365A5 (enExample) |
| DE (1) | DE2200126A1 (enExample) |
| FR (1) | FR2167625B3 (enExample) |
| GB (1) | GB1406011A (enExample) |
| IT (1) | IT974425B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0069598B1 (en) * | 1981-07-08 | 1984-12-19 | RAYCHEM CORPORATION (a California corporation) | Preparation of aromatic ketones |
-
1972
- 1972-01-03 DE DE19722200126 patent/DE2200126A1/de active Pending
- 1972-12-27 CH CH1888372A patent/CH575365A5/de not_active IP Right Cessation
- 1972-12-29 IT IT5516472A patent/IT974425B/it active
- 1972-12-29 JP JP408873A patent/JPS4876850A/ja active Pending
-
1973
- 1973-01-02 GB GB15773A patent/GB1406011A/en not_active Expired
- 1973-01-03 FR FR7300124A patent/FR2167625B3/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH575365A5 (enExample) | 1976-05-14 |
| GB1406011A (en) | 1975-09-10 |
| FR2167625A1 (enExample) | 1973-08-24 |
| JPS4876850A (enExample) | 1973-10-16 |
| FR2167625B3 (enExample) | 1976-01-09 |
| IT974425B (it) | 1974-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2337396A1 (de) | Verfahren zur herstellung aromatischer 1,3-diketone | |
| DE3622224A1 (de) | Verfahren zur herstellung von bromderivaten des diphenylethers | |
| DE2451037A1 (de) | Verfahren zur benzoylierung von aromaten | |
| DE876690C (de) | Verfahren zur Herstellung von Ketonen aus ªÏ-trihalogenmethylsubstituierten aromatischen Verbindungen | |
| DE3432095A1 (de) | Verfahren zur kernchlorierung von toluol | |
| EP0725066B1 (de) | Verfahren zur Herstellung von Cyclopropylalkylketonen und 4,5-Dihydroalkylfuranen | |
| DE2548384C3 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| DE2200126A1 (de) | Verfahren zur herstellung von einheitlichen durch halogen substituierten 2-methylbenzophenonen | |
| EP0779263A1 (de) | Neue Derivate des 2,3,6-Trifluorphenols und ein Verfahren zu ihrer Herstellung | |
| DE2644641C2 (de) | Verfahren zur Herstellung von bestimmten kernchlorierten Benzotrichloriden | |
| DE2130406C3 (de) | Verfahren zur Herstellung aromatischer Ketocarbonsäuren | |
| DE2549095C3 (de) | Verfahren zur Herstellung von in den Seitenketten fluorierten und chlorierten Xylolen | |
| DE2200070A1 (de) | Durch halogen substituierte 2-methylbenzophenone | |
| EP0226152B1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten 2-Benzyl-toluolen | |
| EP1100783B1 (de) | Verbessertes verfahren zur herstellung von 2-halogenpyridin-n-oxid | |
| DE3622235A1 (de) | Verfahren zum perbromieren von in loesung erhaltenen, nicht vollstaendig bromierten produkten | |
| DE2432219C3 (de) | Verfahren zur Herstellung von Trizyklo undekan | |
| DE2044832B2 (de) | Verfahren zur Herstellung aromatischer Aldehyde | |
| DE1078560B (de) | Verfahren zur Herstellung von Benzylacetophenon oder seinen kernsubstituierten Derivaten | |
| DE1139111B (de) | Verfahren zur Herstellung von Diarylketonen. | |
| EP0694513B1 (de) | Verfahren zur Herstellung von Chloraromaten | |
| DE2432218A1 (de) | Verfahren zur herstellung von 1-methyladamantan | |
| DE2201208A1 (de) | Verfahren zur herstellung von aromatischen ketonen | |
| DE965490C (de) | Verfahren zur Herstellung von aromatischen Sulfoniumverbindungen | |
| DE2209527C3 (de) | Verfahren zur Herstellung von 2-Hydroxy-4-alkoxy-benzophenonen |