DE2143516C3 - Herstellung von Hydrazin aus Ammoniak und Wasserstoffperoxyd - Google Patents
Herstellung von Hydrazin aus Ammoniak und WasserstoffperoxydInfo
- Publication number
- DE2143516C3 DE2143516C3 DE2143516A DE2143516A DE2143516C3 DE 2143516 C3 DE2143516 C3 DE 2143516C3 DE 2143516 A DE2143516 A DE 2143516A DE 2143516 A DE2143516 A DE 2143516A DE 2143516 C3 DE2143516 C3 DE 2143516C3
- Authority
- DE
- Germany
- Prior art keywords
- ketazine
- hydrazine
- radicals
- ammonia
- nitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 title claims description 58
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 title claims description 56
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims description 42
- 229910021529 ammonia Inorganic materials 0.000 title claims description 29
- 238000004519 manufacturing process Methods 0.000 title claims description 9
- PFLUPZGCTVGDLV-UHFFFAOYSA-N acetone azine Chemical compound CC(C)=NN=C(C)C PFLUPZGCTVGDLV-UHFFFAOYSA-N 0.000 claims description 49
- 238000000034 method Methods 0.000 claims description 36
- 150000002825 nitriles Chemical class 0.000 claims description 29
- 150000002576 ketones Chemical class 0.000 claims description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 230000007062 hydrolysis Effects 0.000 claims description 21
- 238000006460 hydrolysis reaction Methods 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 150000003857 carboxamides Chemical class 0.000 claims description 13
- 238000004821 distillation Methods 0.000 claims description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 10
- -1 methoxy radicals Chemical class 0.000 claims description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 239000012429 reaction media Substances 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002015 acyclic group Chemical group 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000012808 vapor phase Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 63
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical group CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 33
- 239000000203 mixture Substances 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- 239000002253 acid Substances 0.000 description 20
- 239000007864 aqueous solution Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 13
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 12
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- 150000001408 amides Chemical class 0.000 description 10
- 150000002429 hydrazines Chemical class 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 150000003863 ammonium salts Chemical class 0.000 description 6
- 238000000926 separation method Methods 0.000 description 6
- 230000018044 dehydration Effects 0.000 description 5
- 238000006297 dehydration reaction Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 150000001447 alkali salts Chemical class 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 235000011007 phosphoric acid Nutrition 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- DIXBSCZRIZDQGC-UHFFFAOYSA-N diaziridine Chemical compound C1NN1 DIXBSCZRIZDQGC-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- VYTBPJNGNGMRFH-UHFFFAOYSA-N acetic acid;azane Chemical compound N.N.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O VYTBPJNGNGMRFH-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- WBUOVKBZJOIOAE-UHFFFAOYSA-N 3-chlorobenzonitrile Chemical compound ClC1=CC=CC(C#N)=C1 WBUOVKBZJOIOAE-UHFFFAOYSA-N 0.000 description 1
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JPNZKPRONVOMLL-UHFFFAOYSA-N azane;octadecanoic acid Chemical class [NH4+].CCCCCCCCCCCCCCCCCC([O-])=O JPNZKPRONVOMLL-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000011552 falling film Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical class OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical class CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000012493 hydrazine sulfate Substances 0.000 description 1
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical class Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000005474 octanoate group Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
- C07C251/88—Hydrazones having also the other nitrogen atom doubly-bound to a carbon atom, e.g. azines
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/16—Hydrazine; Salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Monitoring And Testing Of Nuclear Reactors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7100299A FR2120517A5 (enExample) | 1971-01-07 | 1971-01-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2143516A1 DE2143516A1 (de) | 1972-07-20 |
| DE2143516B2 DE2143516B2 (de) | 1973-01-18 |
| DE2143516C3 true DE2143516C3 (de) | 1978-06-01 |
Family
ID=9069902
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2143516A Expired DE2143516C3 (de) | 1971-01-07 | 1971-08-31 | Herstellung von Hydrazin aus Ammoniak und Wasserstoffperoxyd |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3869541A (enExample) |
| JP (1) | JPS5137638B1 (enExample) |
| AT (1) | AT323707B (enExample) |
| BE (1) | BE772721A (enExample) |
| BR (1) | BR7105598D0 (enExample) |
| CA (1) | CA973683A (enExample) |
| CH (1) | CH551380A (enExample) |
| CS (1) | CS154699B2 (enExample) |
| DE (1) | DE2143516C3 (enExample) |
| DK (1) | DK134543B (enExample) |
| ES (1) | ES395377A1 (enExample) |
| FR (1) | FR2120517A5 (enExample) |
| GB (1) | GB1358389A (enExample) |
| HU (1) | HU163574B (enExample) |
| LU (1) | LU63748A1 (enExample) |
| NL (1) | NL172318C (enExample) |
| NO (1) | NO133626C (enExample) |
| PL (1) | PL88918B1 (enExample) |
| RO (1) | RO76228A (enExample) |
| SE (1) | SE379735B (enExample) |
| YU (1) | YU36478B (enExample) |
| ZA (1) | ZA717625B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2436335A1 (de) * | 1974-07-27 | 1976-02-05 | Bayer Ag | Verfahren zur aufbereitung von syntheseloesungen bei der hydrazinherstellung |
| US4036936A (en) * | 1975-08-15 | 1977-07-19 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Process for preparing hydrazine hydrate |
| FR2323635A1 (fr) * | 1975-09-10 | 1977-04-08 | Ugine Kuhlmann | Procede de preparation de solutions concentrees d'hydrate d'hydrazine |
| FR2323634A1 (fr) * | 1975-09-10 | 1977-04-08 | Ugine Kuhlmann | Solutions concentrees d'hydrate d'hydrazine |
| JPS60171205A (ja) * | 1984-02-17 | 1985-09-04 | Mitsubishi Gas Chem Co Inc | ヒドラジンハロゲン化水素酸塩の製法 |
| JPS63295408A (ja) * | 1987-05-28 | 1988-12-01 | Mitsubishi Gas Chem Co Inc | 水加ヒドラジン水溶液の精製方法 |
| FR2647444B1 (enExample) * | 1989-05-24 | 1991-07-26 | Atochem | |
| ATE103272T1 (de) * | 1990-11-23 | 1994-04-15 | Atochem Elf Sa | Verfahren zur herstellung von azine. |
| FR2778659B1 (fr) * | 1998-05-14 | 2000-06-23 | Atochem Elf Sa | Procede de preparation d'hydrate d'hydrazine |
| CN104555953A (zh) * | 2014-10-11 | 2015-04-29 | 重庆锦杉科技有限公司 | 一种水合肼的制备方法 |
| CN107381523A (zh) * | 2017-09-07 | 2017-11-24 | 盐城顺恒化工有限公司 | 一种硫酸肼的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2415356A (en) * | 1940-12-21 | 1947-02-04 | Jasco Inc | Plasticizer and softener for perbunan and perbunan type rubbers |
| US2894032A (en) * | 1958-09-16 | 1959-07-07 | Grace W R & Co | Method of producing ketazines |
| NL136390B (enExample) * | 1961-02-08 |
-
1971
- 1971-01-07 FR FR7100299A patent/FR2120517A5/fr not_active Expired
- 1971-08-18 DK DK404371AA patent/DK134543B/da not_active IP Right Cessation
- 1971-08-18 PL PL1971150078A patent/PL88918B1/pl unknown
- 1971-08-19 CH CH1218371A patent/CH551380A/fr not_active IP Right Cessation
- 1971-08-20 NO NO3105/71A patent/NO133626C/no unknown
- 1971-08-20 LU LU63748D patent/LU63748A1/xx unknown
- 1971-08-20 SE SE7110614A patent/SE379735B/xx unknown
- 1971-08-26 BR BR5598/71A patent/BR7105598D0/pt unknown
- 1971-08-27 YU YU02201/71A patent/YU36478B/xx unknown
- 1971-08-31 DE DE2143516A patent/DE2143516C3/de not_active Expired
- 1971-09-01 NL NLAANVRAGE7112028,A patent/NL172318C/xx not_active IP Right Cessation
- 1971-09-06 GB GB4151771A patent/GB1358389A/en not_active Expired
- 1971-09-07 RO RO7168156A patent/RO76228A/ro unknown
- 1971-09-17 BE BE772721A patent/BE772721A/xx not_active IP Right Cessation
- 1971-09-23 ES ES395377A patent/ES395377A1/es not_active Expired
- 1971-09-23 CS CS677171A patent/CS154699B2/cs unknown
- 1971-10-12 AT AT881371A patent/AT323707B/de not_active IP Right Cessation
- 1971-11-12 ZA ZA717625A patent/ZA717625B/xx unknown
- 1971-12-29 HU HUKU456A patent/HU163574B/hu unknown
-
1972
- 1972-01-03 US US215173A patent/US3869541A/en not_active Expired - Lifetime
- 1972-01-06 CA CA131,850A patent/CA973683A/en not_active Expired
- 1972-01-07 JP JP724366A patent/JPS5137638B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| SE379735B (enExample) | 1975-10-20 |
| CA973683A (en) | 1975-09-02 |
| JPS5137638B1 (enExample) | 1976-10-16 |
| CH551380A (fr) | 1974-07-15 |
| LU63748A1 (enExample) | 1972-01-05 |
| AU3322971A (en) | 1973-03-15 |
| AT323707B (de) | 1975-07-25 |
| GB1358389A (en) | 1974-07-03 |
| ZA717625B (en) | 1972-08-30 |
| DE2143516B2 (de) | 1973-01-18 |
| PL88918B1 (enExample) | 1976-10-30 |
| NL7112028A (enExample) | 1972-07-11 |
| DK134543C (enExample) | 1977-05-09 |
| DE2143516A1 (de) | 1972-07-20 |
| YU220171A (en) | 1982-02-25 |
| HU163574B (enExample) | 1973-09-27 |
| NO133626B (enExample) | 1976-02-23 |
| NL172318B (nl) | 1983-03-16 |
| CS154699B2 (enExample) | 1974-04-30 |
| US3869541A (en) | 1975-03-04 |
| YU36478B (en) | 1984-02-29 |
| BE772721A (fr) | 1972-01-17 |
| DK134543B (da) | 1976-11-29 |
| FR2120517A5 (enExample) | 1972-08-18 |
| RO76228A (ro) | 1981-02-28 |
| BR7105598D0 (pt) | 1973-04-17 |
| NO133626C (enExample) | 1976-06-02 |
| ES395377A1 (es) | 1973-12-01 |
| NL172318C (nl) | 1983-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2143516C3 (de) | Herstellung von Hydrazin aus Ammoniak und Wasserstoffperoxyd | |
| DE2639010C2 (de) | Verfahren zur Herstellung von konzentrierten Hydrazinhydratlösungen | |
| DE69101481T3 (de) | Verfahren zur Herstellung von Azine. | |
| EP0003500B2 (de) | Verfahren zur Herstellung von 1,2,4-Triazol | |
| DE1693027C3 (de) | Verfahren zur Herstellung von ε-Caprolacton oder von Methyl-ε-caprolactonen | |
| DE2365131A1 (de) | Verfahren zur herstellung von p-nitrobenzoesaeure | |
| DE2517054A1 (de) | Verfahren zur herstellung von nicotinsaeureamid | |
| DE2548592C3 (de) | Verfahren zur Herstellung von Azodicarbonamid | |
| DE2436335A1 (de) | Verfahren zur aufbereitung von syntheseloesungen bei der hydrazinherstellung | |
| DE3787850T2 (de) | Verfahren zur Transhalogenierung eines Polyiodobenzols, besonders eines Di-iodo-benzols. | |
| DE765734C (de) | Verfahren zur Herstellung von Methacrylsaeureverbindungen | |
| DE69905880T2 (de) | Verfahren zur herstellung von hydrazinhydrat | |
| EP0042530A1 (de) | Verfahren zur Reinigung von Thionylchlorid | |
| DE2061501C3 (enExample) | ||
| DE3147533C2 (enExample) | ||
| EP0811602B1 (de) | Verfahren zur Herstellung von Aminomalonester-Salzen | |
| DE2260126C2 (de) | Verfahren zur Herstellung von reinem, stabilem Malonsäuredinitril | |
| EP0083105B1 (de) | Verfahren zur kontinuierlichen Herstellung von 3-Aminocrotonsäureamid | |
| DE2363536C3 (de) | Verfahren zur Herstellung von 2>2*-Anhydro-l-ß-Darabinofuranosyl- 5-fluorcytosin | |
| DE2638423C2 (de) | Verfahren zur Herstellung von in Wasser leicht löslichen Salzen der Äthylendiamintetraacetatoeisen(III)-säure | |
| DE1917033A1 (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE2645172A1 (de) | Verfahren zur herstellung von 4-nitroimidazolen | |
| DE2361932C3 (de) | Verfahren zur Abtrennung von Ketazinen aus Rohgemischen der Ketazinsynthese durch fraktionierte Destillation | |
| DE2223755C3 (de) | Verfahren zur Herstellung von Hydrazo-bis-acetonitrilen | |
| DE1231706B (de) | Verfahren zur Herstellung von Adenin und 4, 5-Dicyanimidazol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |