DE2141036C3 - Selbstverlöschende Polyamidformmassen - Google Patents
Selbstverlöschende PolyamidformmassenInfo
- Publication number
- DE2141036C3 DE2141036C3 DE2141036A DE2141036A DE2141036C3 DE 2141036 C3 DE2141036 C3 DE 2141036C3 DE 2141036 A DE2141036 A DE 2141036A DE 2141036 A DE2141036 A DE 2141036A DE 2141036 C3 DE2141036 C3 DE 2141036C3
- Authority
- DE
- Germany
- Prior art keywords
- flame
- polyamide
- test
- molding compounds
- zinc oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004952 Polyamide Substances 0.000 title claims description 37
- 229920002647 polyamide Polymers 0.000 title claims description 37
- 238000000465 moulding Methods 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 title claims description 11
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 40
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 20
- 239000011787 zinc oxide Substances 0.000 claims description 20
- 150000002896 organic halogen compounds Chemical class 0.000 claims description 6
- 239000010425 asbestos Substances 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- 229910052895 riebeckite Inorganic materials 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 238000010348 incorporation Methods 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 20
- 239000003365 glass fiber Substances 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 8
- 239000003063 flame retardant Substances 0.000 description 8
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- -1 aromatic halogen compounds Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 238000007706 flame test Methods 0.000 description 3
- 150000002366 halogen compounds Chemical class 0.000 description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 3
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- RTNLUFLDZOAXIC-UHFFFAOYSA-N 1,2,3,4,5,6,7,8-octachloronaphthalene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 RTNLUFLDZOAXIC-UHFFFAOYSA-N 0.000 description 1
- LJDGJCNHVGGOFW-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenoxy)benzene Chemical compound BrC1=CC=CC=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br LJDGJCNHVGGOFW-UHFFFAOYSA-N 0.000 description 1
- HPARLNRMYDSBNO-UHFFFAOYSA-N 1,4-benzodioxine Chemical compound C1=CC=C2OC=COC2=C1 HPARLNRMYDSBNO-UHFFFAOYSA-N 0.000 description 1
- GUOSQNAUYHMCRU-UHFFFAOYSA-N 11-Aminoundecanoic acid Chemical compound NCCCCCCCCCCC(O)=O GUOSQNAUYHMCRU-UHFFFAOYSA-N 0.000 description 1
- RLEQVGMLDNITBW-UHFFFAOYSA-N 2,4,4-trimethylhexanedioic acid Chemical compound OC(=O)C(C)CC(C)(C)CC(O)=O RLEQVGMLDNITBW-UHFFFAOYSA-N 0.000 description 1
- MVDKKZZVTWHVMC-UHFFFAOYSA-N 2-hexadecylpropanedioic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)=O MVDKKZZVTWHVMC-UHFFFAOYSA-N 0.000 description 1
- WZHHYIOUKQNLQM-UHFFFAOYSA-N 3,4,5,6-tetrachlorophthalic acid Chemical class OC(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O WZHHYIOUKQNLQM-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 241000907661 Pieris rapae Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 238000001792 White test Methods 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- QXDMQSPYEZFLGF-UHFFFAOYSA-L calcium oxalate Chemical compound [Ca+2].[O-]C(=O)C([O-])=O QXDMQSPYEZFLGF-UHFFFAOYSA-L 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 1
- VUNCWTMEJYMOOR-UHFFFAOYSA-N hexachlorocyclopentadiene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl VUNCWTMEJYMOOR-UHFFFAOYSA-N 0.000 description 1
- 229920006017 homo-polyamide Polymers 0.000 description 1
- WTFXARWRTYJXII-UHFFFAOYSA-N iron(2+);iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[Fe+2].[Fe+3].[Fe+3] WTFXARWRTYJXII-UHFFFAOYSA-N 0.000 description 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- OYFWLCJAPSAGCG-UHFFFAOYSA-N n'-methylhexane-1,6-diamine Chemical compound CNCCCCCCN OYFWLCJAPSAGCG-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2141036A DE2141036C3 (de) | 1971-08-17 | 1971-08-17 | Selbstverlöschende Polyamidformmassen |
| IT52188/72A IT965984B (it) | 1971-08-17 | 1972-08-14 | Masse poliammidiche da stampaggio autoestinguenti e procedimento per produrle |
| GB3793572A GB1406872A (en) | 1971-08-17 | 1972-08-15 | Polyamide moulding compositions |
| JP8121772A JPS5545577B2 (enExample) | 1971-08-17 | 1972-08-15 | |
| CH1216472A CH572507A5 (enExample) | 1971-08-17 | 1972-08-16 | |
| US00281299A US3810861A (en) | 1971-08-17 | 1972-08-17 | Self-extinguishing reinforced polyamide moulding compositions |
| NLAANVRAGE7211275,A NL172870C (nl) | 1971-08-17 | 1972-08-17 | Werkwijze ter bereiding van zelfdovende polyamidevormmassa's, alsmede gevormd voortbrengsel, vervaardigd onder toepassing daarvan. |
| FR7229489A FR2149528B1 (enExample) | 1971-08-17 | 1972-08-17 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2141036A DE2141036C3 (de) | 1971-08-17 | 1971-08-17 | Selbstverlöschende Polyamidformmassen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2141036A1 DE2141036A1 (de) | 1973-03-01 |
| DE2141036B2 DE2141036B2 (de) | 1976-08-26 |
| DE2141036C3 true DE2141036C3 (de) | 1983-12-01 |
Family
ID=5816889
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2141036A Expired DE2141036C3 (de) | 1971-08-17 | 1971-08-17 | Selbstverlöschende Polyamidformmassen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3810861A (enExample) |
| JP (1) | JPS5545577B2 (enExample) |
| CH (1) | CH572507A5 (enExample) |
| DE (1) | DE2141036C3 (enExample) |
| FR (1) | FR2149528B1 (enExample) |
| GB (1) | GB1406872A (enExample) |
| IT (1) | IT965984B (enExample) |
| NL (1) | NL172870C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2706827C2 (de) | 1976-02-20 | 1987-03-19 | Imperial Chemical Industries Ltd., London | Verstärkte Polyamidmasse |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4894750A (enExample) * | 1972-03-21 | 1973-12-06 | ||
| US3864302A (en) * | 1973-03-16 | 1975-02-04 | Du Pont | Flame resistant polyamides |
| US3983185A (en) * | 1973-07-30 | 1976-09-28 | Hooker Chemicals & Plastics Corporation | Halogen containing polyester resins having improved smoke-resistance |
| GB1585085A (en) * | 1976-06-21 | 1981-02-25 | Ici Ltd | Polyamide compositions |
| US4076682A (en) * | 1976-09-13 | 1978-02-28 | Basf Aktiengesellschaft | Flameproof nylon molding compositions |
| US4064298A (en) * | 1976-09-22 | 1977-12-20 | Allied Chemical Corporation | Flame-retardant polyamide fiber for use in carpets |
| DE2647310A1 (de) * | 1976-10-20 | 1978-04-27 | Bayer Ag | Verstaerktes polyhexamethylenisophthalamid |
| DE2703419B1 (de) * | 1977-01-28 | 1978-02-02 | Basf Ag | Flammwidrig ausgeruestete polyamid- formmassen |
| US4360616A (en) * | 1980-12-31 | 1982-11-23 | E. I. Du Pont De Nemours And Company | Flame-retardant polyamide compositions |
| CA1338392C (en) * | 1987-04-20 | 1996-06-11 | Mitsui Chemicals, Incorporated | Fire-retardant polyamide composition having good heat resistance |
| DE58908791D1 (de) * | 1988-07-13 | 1995-02-02 | Basf Ag | Flammgeschützte thermoplastische Formmassen auf der Basis teilaromatischer Copolyamide. |
| KR0163031B1 (ko) * | 1989-03-31 | 1999-01-15 | 오노 알버어스 | 난연성 중합체 조성물 |
| US5071894A (en) * | 1990-08-03 | 1991-12-10 | Stamicarbon B.V. | Flame retardant polyamides |
| US5278218A (en) * | 1990-12-10 | 1994-01-11 | Rhone-Poulenc Chimie | Zinc stannate/zinc hydroxystannate heat-stabilized chloropolymers |
| US5726231A (en) * | 1996-06-07 | 1998-03-10 | Tateho Chemical Industries Co., Ltd. | Flame retardant polyolefin compound having low smoking and toxicity |
| EP0985706B1 (en) * | 1998-03-25 | 2005-07-27 | Teijin Limited | Resin composition |
| CN105164181B (zh) | 2013-03-28 | 2018-09-04 | 德国登肯多夫纺织与纤维研究学院 | 阻燃聚酰胺、其制备方法及其用途 |
| SI3022274T1 (sl) | 2013-07-16 | 2019-10-30 | Deutsche Inst Fuer Textil Und Faserforschung Denkendorf | Postopek za proizvodnjo ognjevarnih kopoliamidov, tako pridobljene poliamidne preje in uporaba le-teh |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2326233A (en) * | 1943-08-10 | Fireproofing composition | ||
| US2926097A (en) * | 1944-11-03 | 1960-02-23 | Leatherman Martin | Fire resistant composition for fabrics |
| US2462803A (en) * | 1945-03-23 | 1949-02-22 | Kenneth S Campbell | Fireproofing compositions |
| US2610920A (en) * | 1948-11-01 | 1952-09-16 | Hopkinson Harry | Flameproofing composition |
| GB1090598A (en) * | 1964-08-17 | 1967-11-08 | Hooker Chemical Corp | Polymers and coatings rendered flame retardant by the addition of halogenated cyclopentadiene diels-alder adducts |
| US3418267A (en) * | 1965-09-01 | 1968-12-24 | Du Pont | Flame-resistant polyamides and process thereof |
| DE1694494B2 (de) * | 1967-03-01 | 1975-07-03 | Imperial Chemical Industries Ltd., London | Flammbeständige Nylonzusammensetzung |
| GB1208865A (en) * | 1967-03-01 | 1970-10-14 | Ici Ltd | Flame-resistant nylon compositions |
| CA923237A (en) * | 1967-11-09 | 1973-03-20 | M. Hedrick Ross | Flame resistant polyamides |
| US3524761A (en) * | 1968-04-25 | 1970-08-18 | Humphrey Chem Corp | Zinc ammonia borate complex |
| US3560441A (en) * | 1968-12-16 | 1971-02-02 | M & T Chemicals Inc | Antimony trioxide inorganic compound glass flame retardant compositions and methods for their preparation |
| DE2114235B2 (de) * | 1971-03-24 | 1975-04-17 | Bayer Ag, 5090 Leverkusen | Selbstverlöschende Polyamid-Formmassen |
-
1971
- 1971-08-17 DE DE2141036A patent/DE2141036C3/de not_active Expired
-
1972
- 1972-08-14 IT IT52188/72A patent/IT965984B/it active
- 1972-08-15 GB GB3793572A patent/GB1406872A/en not_active Expired
- 1972-08-15 JP JP8121772A patent/JPS5545577B2/ja not_active Expired
- 1972-08-16 CH CH1216472A patent/CH572507A5/xx not_active IP Right Cessation
- 1972-08-17 US US00281299A patent/US3810861A/en not_active Expired - Lifetime
- 1972-08-17 NL NLAANVRAGE7211275,A patent/NL172870C/xx not_active IP Right Cessation
- 1972-08-17 FR FR7229489A patent/FR2149528B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2706827C2 (de) | 1976-02-20 | 1987-03-19 | Imperial Chemical Industries Ltd., London | Verstärkte Polyamidmasse |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2141036A1 (de) | 1973-03-01 |
| JPS5545577B2 (enExample) | 1980-11-18 |
| CH572507A5 (enExample) | 1976-02-13 |
| US3810861A (en) | 1974-05-14 |
| FR2149528B1 (enExample) | 1978-08-04 |
| NL172870C (nl) | 1983-11-01 |
| IT965984B (it) | 1974-02-11 |
| NL172870B (nl) | 1983-06-01 |
| FR2149528A1 (enExample) | 1973-03-30 |
| JPS4829846A (enExample) | 1973-04-20 |
| NL7211275A (enExample) | 1973-02-20 |
| DE2141036B2 (de) | 1976-08-26 |
| GB1406872A (en) | 1975-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2141036C3 (de) | Selbstverlöschende Polyamidformmassen | |
| DE3874796T2 (de) | Brandgeschuetzte polyamidmischung mit guter hitzeresistenter eigenschaft. | |
| EP3655475B1 (de) | Flammhemmende graue polyamidzusammensetzungen und deren verwendung | |
| DE2745076C3 (de) | Massen auf Polyamidbasis | |
| DE102017212096A1 (de) | Flammhemmende schwarze Polyamidzusammensetzungen und deren Verwendung | |
| DE69317619T2 (de) | Flammhemmende Polyamid-Zusammensetzung | |
| DE69632529T2 (de) | Lichtstabilisierte polyamidzusammensetzungen | |
| DE69312116T3 (de) | Zusammensetzungen auf Basis von flammfesten Polyamiden | |
| DE2706827C2 (de) | Verstärkte Polyamidmasse | |
| DE102012004357A1 (de) | Flammschutzmittelzusammensetzung für thermoplastische Polymere bestehend aus porösem, amorphen Glaspulver und Melamincyanurat | |
| DE69313015T2 (de) | Flammhemmende thermoplastische Formassen und Herstellungsverfahren | |
| DE3808493A1 (de) | Aromatische polyamide als flammschutzmittel-synergisten mit antidripping-wirkung fuer aliphatische polyamidformmassen und ihre verwendung | |
| DE2703052A1 (de) | Stabilisierte, flammgeschuetzte, thermoplastische formmassen | |
| DE3208486C2 (de) | Flammfeste Polyamid-Formmasse und Verfahren zu ihrer Herstellung | |
| EP0605864B1 (de) | Schwerentflammbare Polyamidformmassen | |
| EP0413258A1 (de) | Flammfeste thermoplastische Formmassen auf der Basis von Polyamiden und Polyester-Elastomeren | |
| DE3722118C2 (enExample) | ||
| DE2150484C3 (de) | Selbstverlöschende Formmassen | |
| DE102017215775A1 (de) | Flammhemmende Polyamidzusammensetzungen mit hoher Wärmeformbeständigkeit und deren Verwendung | |
| DE2203704A1 (de) | Selbstverloeschende polyamid-formmassen | |
| DE2213801A1 (de) | Selbstverloeschende polyamid-formmassen | |
| DE3788953T2 (de) | Polyamid-Zusammensetzung. | |
| EP0006549B1 (de) | Stabilisierte, flammgeschützte, thermoplastische Formmassen | |
| DE2428758C3 (de) | Verfahren zur Herstellung selbstverlöschender thermoplastischer Formmassen | |
| DE2823552A1 (de) | Flammverzoegernde bzw. feuerhemmende harzmasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8226 | Change of the secondary classification |
Free format text: C08K 5/09 C08K 5/02 C08K 3/22 |
|
| 8281 | Inventor (new situation) |
Free format text: TACKE, PETER, DR. HERMANN, KARL HEINZ, DR., 4150 KREFELD, DE |
|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |