DE2123110A1 - Vulkanisierbare Mischung von fluorsubstituierten Elastomeren - Google Patents
Vulkanisierbare Mischung von fluorsubstituierten ElastomerenInfo
- Publication number
- DE2123110A1 DE2123110A1 DE19712123110 DE2123110A DE2123110A1 DE 2123110 A1 DE2123110 A1 DE 2123110A1 DE 19712123110 DE19712123110 DE 19712123110 DE 2123110 A DE2123110 A DE 2123110A DE 2123110 A1 DE2123110 A1 DE 2123110A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- vulcanization
- copolymer
- crosslinking agent
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims description 72
- 229920001971 elastomer Polymers 0.000 title claims description 35
- 239000000806 elastomer Substances 0.000 title claims description 33
- 238000004073 vulcanization Methods 0.000 claims description 84
- 239000003431 cross linking reagent Substances 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 29
- -1 amino compound Chemical class 0.000 claims description 24
- 229920001577 copolymer Polymers 0.000 claims description 23
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N 1,4-Benzenediol Natural products OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 claims description 13
- 150000002736 metal compounds Chemical class 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 9
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 6
- 229920001198 elastomeric copolymer Polymers 0.000 claims description 6
- 229910044991 metal oxide Inorganic materials 0.000 claims description 6
- 150000004706 metal oxides Chemical class 0.000 claims description 6
- 229930185605 Bisphenol Natural products 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- LLMLGZUZTFMXSA-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzenethiol Chemical compound SC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LLMLGZUZTFMXSA-UHFFFAOYSA-N 0.000 claims description 4
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical group C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 239000000470 constituent Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000000178 monomer Substances 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000004761 hexafluorosilicates Chemical class 0.000 claims description 3
- 150000004679 hydroxides Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 229910000000 metal hydroxide Inorganic materials 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- VERMEZLHWFHDLK-UHFFFAOYSA-N tetrahydroxybenzene Natural products OC1=CC=C(O)C(O)=C1O VERMEZLHWFHDLK-UHFFFAOYSA-N 0.000 claims description 3
- KKUKTXOBAWVSHC-UHFFFAOYSA-N Dimethylphosphate Chemical compound COP(O)(=O)OC KKUKTXOBAWVSHC-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 230000001588 bifunctional effect Effects 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims 2
- ZFVMWEVVKGLCIJ-UHFFFAOYSA-N bisphenol AF Chemical compound C1=CC(O)=CC=C1C(C(F)(F)F)(C(F)(F)F)C1=CC=C(O)C=C1 ZFVMWEVVKGLCIJ-UHFFFAOYSA-N 0.000 claims 2
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical group FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 claims 2
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 claims 1
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 claims 1
- 150000003457 sulfones Chemical class 0.000 claims 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N trihydroxybenzene Natural products OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 60
- 230000006835 compression Effects 0.000 description 26
- 238000007906 compression Methods 0.000 description 26
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000395 magnesium oxide Substances 0.000 description 9
- 238000012856 packing Methods 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 6
- 239000000920 calcium hydroxide Substances 0.000 description 6
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 6
- 229910052918 calcium silicate Inorganic materials 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000006187 pill Substances 0.000 description 6
- 239000004071 soot Substances 0.000 description 6
- 241001441571 Hiodontidae Species 0.000 description 5
- 239000000378 calcium silicate Substances 0.000 description 5
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- UMKARVFXJJITLN-UHFFFAOYSA-N lead;phosphorous acid Chemical compound [Pb].OP(O)O UMKARVFXJJITLN-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- SULYEHHGGXARJS-UHFFFAOYSA-N 2',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1O SULYEHHGGXARJS-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 2
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- XRWCZLNDTYXVOV-UHFFFAOYSA-L methyl(trioctyl)azanium;oxalate Chemical compound [O-]C(=O)C([O-])=O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XRWCZLNDTYXVOV-UHFFFAOYSA-L 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 150000001451 organic peroxides Chemical class 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VMJQVRWCDVLJSI-UHFFFAOYSA-M tetraheptylazanium;chloride Chemical compound [Cl-].CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC VMJQVRWCDVLJSI-UHFFFAOYSA-M 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- ATPFMBHTMKBVLS-VZEWWGGESA-N (z)-3-phenyl-n-[6-[[(e)-3-phenylprop-2-enylidene]amino]hexyl]prop-2-en-1-imine Chemical compound C=1C=CC=CC=1/C=C/C=NCCCCCCN=C\C=C/C1=CC=CC=C1 ATPFMBHTMKBVLS-VZEWWGGESA-N 0.000 description 1
- AVZICXRYXLCFCK-UHFFFAOYSA-M 1,1-dioxo-1,2-benzothiazol-3-olate;2-dodecylisoquinolin-2-ium Chemical compound C1=CC=C2C([O-])=NS(=O)(=O)C2=C1.C1=CC=CC2=C[N+](CCCCCCCCCCCC)=CC=C21 AVZICXRYXLCFCK-UHFFFAOYSA-M 0.000 description 1
- 125000004955 1,4-cyclohexylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:1])C([H])([H])C([H])([H])C1([H])[*:2] 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 1
- GKQHIYSTBXDYNQ-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+]1=CC=CC=C1 GKQHIYSTBXDYNQ-UHFFFAOYSA-M 0.000 description 1
- OTTSEOGVTHHRRN-UHFFFAOYSA-M 2,3,4,5,6-pentachlorobenzenethiolate;tetramethylazanium Chemical compound C[N+](C)(C)C.[S-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl OTTSEOGVTHHRRN-UHFFFAOYSA-M 0.000 description 1
- ZXDDPOHVAMWLBH-UHFFFAOYSA-N 2,4-Dihydroxybenzophenone Chemical compound OC1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 ZXDDPOHVAMWLBH-UHFFFAOYSA-N 0.000 description 1
- ZJSRWZBTWPNNPZ-UHFFFAOYSA-M 2-(2-methoxyethoxy)ethyl-trioctylazanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCOCCOC ZJSRWZBTWPNNPZ-UHFFFAOYSA-M 0.000 description 1
- WBXDKDRNXQVSGV-UHFFFAOYSA-M 2-dodecylisoquinolin-2-ium;chloride Chemical compound [Cl-].C1=CC=CC2=C[N+](CCCCCCCCCCCC)=CC=C21 WBXDKDRNXQVSGV-UHFFFAOYSA-M 0.000 description 1
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical class CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 description 1
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- WTFUTSCZYYCBAY-SXBRIOAWSA-N 6-[(E)-C-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C/C(=N/O)/C1=CC2=C(NC(O2)=O)C=C1 WTFUTSCZYYCBAY-SXBRIOAWSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OZLGRUXZXMRXGP-UHFFFAOYSA-N Fluo-3 Chemical compound CC1=CC=C(N(CC(O)=O)CC(O)=O)C(OCCOC=2C(=CC=C(C=2)C2=C3C=C(Cl)C(=O)C=C3OC3=CC(O)=C(Cl)C=C32)N(CC(O)=O)CC(O)=O)=C1 OZLGRUXZXMRXGP-UHFFFAOYSA-N 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 101100022176 Mus musculus Gstz1 gene Proteins 0.000 description 1
- 241001243925 Sia Species 0.000 description 1
- 241000219289 Silene Species 0.000 description 1
- 101150110390 Slc10a6 gene Proteins 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 150000001454 anthracenes Chemical class 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- GEHMWSIEKHOKJZ-UHFFFAOYSA-M benzyl(trioctyl)azanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CC1=CC=CC=C1 GEHMWSIEKHOKJZ-UHFFFAOYSA-M 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical compound C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical class NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000004979 cyclopentylene group Chemical group 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- UQLDLKMNUJERMK-UHFFFAOYSA-L di(octadecanoyloxy)lead Chemical compound [Pb+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O UQLDLKMNUJERMK-UHFFFAOYSA-L 0.000 description 1
- UTKUXSTWKJCLJX-UHFFFAOYSA-M dodecyl-dimethyl-(naphthalen-1-ylmethyl)azanium;chloride Chemical compound [Cl-].C1=CC=C2C(C[N+](C)(C)CCCCCCCCCCCC)=CC=CC2=C1 UTKUXSTWKJCLJX-UHFFFAOYSA-M 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 239000008141 laxative Substances 0.000 description 1
- 230000002475 laxative effect Effects 0.000 description 1
- XMFOQHDPRMAJNU-UHFFFAOYSA-N lead(ii,iv) oxide Chemical compound O1[Pb]O[Pb]11O[Pb]O1 XMFOQHDPRMAJNU-UHFFFAOYSA-N 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- ZPJMVXJOGCCDPH-UHFFFAOYSA-M methyl(trioctyl)azanium;acetate Chemical compound CC([O-])=O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC ZPJMVXJOGCCDPH-UHFFFAOYSA-M 0.000 description 1
- ZCTSZAYZQRJDQW-UHFFFAOYSA-L methyl(trioctyl)azanium;carbonate Chemical compound [O-]C([O-])=O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC ZCTSZAYZQRJDQW-UHFFFAOYSA-L 0.000 description 1
- CXQZICDPOGIULN-UHFFFAOYSA-M methyl(trioctyl)azanium;octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC CXQZICDPOGIULN-UHFFFAOYSA-M 0.000 description 1
- ZUZLIXGTXQBUDC-UHFFFAOYSA-N methyltrioctylammonium Chemical compound CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC ZUZLIXGTXQBUDC-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- HFQMFENZEKMIGB-UHFFFAOYSA-M octadecanoate;tetrabutylazanium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC.CCCCCCCCCCCCCCCCCC([O-])=O HFQMFENZEKMIGB-UHFFFAOYSA-M 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003129 oil well Substances 0.000 description 1
- KLAKIAVEMQMVBT-UHFFFAOYSA-N p-hydroxy-phenacyl alcohol Natural products OCC(=O)C1=CC=C(O)C=C1 KLAKIAVEMQMVBT-UHFFFAOYSA-N 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- RFPMGSKVEAUNMZ-UHFFFAOYSA-N pentylidene Chemical group [CH2+]CCC[CH-] RFPMGSKVEAUNMZ-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- DTIFFPXSSXFQCJ-UHFFFAOYSA-N tetrahexylazanium Chemical compound CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC DTIFFPXSSXFQCJ-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WFEXFNMTEBFLMM-UHFFFAOYSA-M trioctyl(propyl)azanium;chloride Chemical compound [Cl-].CCCCCCCC[N+](CCC)(CCCCCCCC)CCCCCCCC WFEXFNMTEBFLMM-UHFFFAOYSA-M 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3915070A | 1970-05-20 | 1970-05-20 | |
| US13047171A | 1971-04-01 | 1971-04-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2123110A1 true DE2123110A1 (de) | 1971-12-02 |
Family
ID=26715855
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712123110 Pending DE2123110A1 (de) | 1970-05-20 | 1971-05-10 | Vulkanisierbare Mischung von fluorsubstituierten Elastomeren |
Country Status (4)
| Country | Link |
|---|---|
| DE (1) | DE2123110A1 (https=) |
| FR (1) | FR2091806A5 (https=) |
| GB (1) | GB1356344A (https=) |
| NL (1) | NL155871B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3626355A1 (de) * | 1985-10-15 | 1987-04-16 | Nippon Mektron Kk | Fluorhaltige elastomer-zubereitung |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT968783B (it) * | 1972-10-09 | 1974-03-20 | Montedison Spa | Composizioni vulcanizzabili a base di copolimeri elastomerici del fluoruro di vinilidene rela tivo procedimento di vulcanizzazio ne e composizioni vulcanizzate cosi ottenute |
| US4287320A (en) * | 1974-08-01 | 1981-09-01 | Minnesota Mining And Manufacturing Company | Composition of fluoroelastomer and diorganosulfuroxide |
| IT1163159B (it) * | 1983-03-22 | 1987-04-08 | Montedison Spa | Composizioni vulcanizzabili di fluoroelastomeri in grado di fornire vulcanizzati aventi una elevata adesione sui metalli |
| US4489196A (en) * | 1983-04-26 | 1984-12-18 | E. I. Du Pont De Nemours And Company | Curable fluoropolymer composition |
| US5177148A (en) * | 1985-08-05 | 1993-01-05 | Ausimont S.P.A. | Covulacanizable compositions of fluorelastomers having an improved chemical stability |
| IT1188202B (it) * | 1985-11-15 | 1988-01-07 | Ausimont Spa | Composizioni elastomeriche vulcanizzabili di fluoroelastomeri |
| IT1209669B (it) * | 1985-11-15 | 1989-08-30 | Ausimont Spa | Composizioni vulcanizzabili fluoroelastomeri aventi migliorate caratteristiche di processabilita'e di stabilita' chimica. |
| US4957975A (en) * | 1988-03-14 | 1990-09-18 | E. I. Du Pont De Nemours And Company | Fluoroelastomer composition with low tendency to foul molds |
| US4925892A (en) * | 1988-04-27 | 1990-05-15 | E. I. Du Pont De Nemours And Company | Fluoroelastomer compositions containing a tetraalkylammonium halide and vulcanization accelerator |
| JP2813685B2 (ja) * | 1989-09-28 | 1998-10-22 | イー・アイ・デュポン・ドウ・ヌムール・アンド・カンパニー | フルオロエラストマー組成物およびその製造方法 |
| IT1282390B1 (it) * | 1996-05-02 | 1998-03-20 | Ausimont Spa | Composizioni vulcanizzabili di fluoroelastomeri |
| IT1306200B1 (it) | 1999-01-14 | 2001-05-30 | Ausimont Spa | Composizioni vulcanizzabili di fluoroelastomeri. |
| CN112608241B (zh) * | 2020-12-03 | 2023-06-30 | 江西理工大学 | 一种三辛基甲基草酸铵的制备方法 |
| EP4506415A4 (en) * | 2022-04-05 | 2026-03-18 | Daikin Ind Ltd | Composition for cross-linking of fluoro-reinforced rubber, and molded article |
| KR20250070604A (ko) * | 2022-09-20 | 2025-05-20 | 더 케무어스 컴퍼니 에프씨, 엘엘씨 | 플루오로엘라스토머를 위한 경화제로서의 플루오르화 레조르시놀 및 하이드로퀴논 유사체 |
| EP4590761A1 (en) | 2022-09-20 | 2025-07-30 | The Chemours Company FC, LLC | Non-fluorinated resorcinol and hydroquinone analogs as curing agents for fluoroelastomers |
-
1971
- 1971-05-10 DE DE19712123110 patent/DE2123110A1/de active Pending
- 1971-05-11 NL NL7106452A patent/NL155871B/xx not_active IP Right Cessation
- 1971-05-19 GB GB1583971A patent/GB1356344A/en not_active Expired
- 1971-05-19 FR FR7118215A patent/FR2091806A5/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3626355A1 (de) * | 1985-10-15 | 1987-04-16 | Nippon Mektron Kk | Fluorhaltige elastomer-zubereitung |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7106452A (https=) | 1971-11-23 |
| GB1356344A (en) | 1974-06-12 |
| NL155871B (nl) | 1978-02-15 |
| FR2091806A5 (https=) | 1972-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2123110A1 (de) | Vulkanisierbare Mischung von fluorsubstituierten Elastomeren | |
| DE2659972C2 (de) | Modifizierte fluorhaltige Copolymerisate | |
| DE69504266T2 (de) | Fluorhaltige Elastomerzusammensetzungen | |
| DE69823298T2 (de) | Verfahren zur Vernetzung von elastomeren Vinylidenfluoridcopolymeren | |
| DE69622560T2 (de) | Verbesserte scorch-sicherheit von härtbaren fluorelastomerzusammensetzungen | |
| DE1942675B2 (de) | Waermehaertbare, elastomere fluorpolymerisatmassen | |
| DE2155375C3 (de) | Mischungen von fluorierten Elastomeren | |
| DE1544992B2 (de) | Verfahren zur herstellung vernetzter polyaethylen- oder aethylenmischpolymerisate | |
| DE69205804T2 (de) | Vulkanisierbare Fluorkautschukzusammensetzung und Verfahren zu ihrer Herstellung. | |
| DE4333584B4 (de) | Zusammensetzung für einen fluorhaltigen Gummi niedriger Härte sowie daraus erhältlicher vulkanisierter, fluorhaltiger Gummi | |
| DE2440316C2 (de) | Vulkanisierbare Fluorelastomere | |
| DE964542C (de) | Vulkanisiermittel | |
| EP0253985B1 (de) | Stabilisierte Formmassen auf der Basis von Polyvinylchlorid oder Vinylchlorid-Copolymerisaten und Stabilisatorsystem | |
| DE3877251T2 (de) | Fluor enthaltendes a-b-blockkopolymer. | |
| DE2127958C3 (de) | Wärmehärtbare Formmassen auf der Basis von Vinylidenfluoridmischpolymerisaten | |
| DE1470984B2 (de) | Stabilisatormischung für Misch- oder Pfropfpolymerisate von Acrylnitril, Butadien und Styrol | |
| DE912862C (de) | Alterungsschutzmittel fuer Kautschuk, synthetische kautschukaehnliche Polymere oder Mischungen derselben | |
| DE2120228C3 (de) | Wärmevernetzbare Polymerisatmassen auf der Basis von Vinylidenfluoridmischpolymerisaten | |
| DE1295183B (de) | Vulkanisationsverfahren | |
| DE2856075A1 (de) | Vulkanisierbare fluorelastomermischungen und verfahren zu ihrer herstellung | |
| DE2128473C3 (de) | Heißvulkanisierbare Masse auf der Basis von Vinylidenfluorid-Mischpolymerisaten | |
| DE2112027A1 (de) | Eine dispergierbare Form von Magnesiumoxyd enthaltendes Chloroprenpolymeres | |
| DE2447278B2 (de) | Heißvulkanisierbare Fluorelastomer-Masse | |
| DE2128473B2 (de) | Heissvulkanisierbare masse auf der basis von vinylidenfluorid-mischpolymerisaten | |
| DE1793192A1 (de) | Neue Antioxydantien,ihre Verwendung in polymeren Massen und Verfahren zu ihrer Herstellung |