DE2028781A1 - Hochdruck-Quecksilberdampf Jodid-Entladungslampe - Google Patents
Hochdruck-Quecksilberdampf Jodid-EntladungslampeInfo
- Publication number
- DE2028781A1 DE2028781A1 DE19702028781 DE2028781A DE2028781A1 DE 2028781 A1 DE2028781 A1 DE 2028781A1 DE 19702028781 DE19702028781 DE 19702028781 DE 2028781 A DE2028781 A DE 2028781A DE 2028781 A1 DE2028781 A1 DE 2028781A1
- Authority
- DE
- Germany
- Prior art keywords
- amount
- iodide
- lamp
- mercury
- discharge vessel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 title claims description 33
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 title claims description 8
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 40
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 claims description 23
- 229910052753 mercury Inorganic materials 0.000 claims description 22
- 239000010936 titanium Substances 0.000 claims description 19
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 16
- 229910052716 thallium Inorganic materials 0.000 claims description 16
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 14
- 229910052719 titanium Inorganic materials 0.000 claims description 14
- 235000009518 sodium iodide Nutrition 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 8
- 229910052744 lithium Inorganic materials 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 239000011630 iodine Substances 0.000 claims description 6
- 229910052756 noble gas Inorganic materials 0.000 claims description 6
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 claims description 3
- NLLZTRMHNHVXJJ-UHFFFAOYSA-J titanium tetraiodide Chemical compound I[Ti](I)(I)I NLLZTRMHNHVXJJ-UHFFFAOYSA-J 0.000 claims description 3
- 230000005855 radiation Effects 0.000 description 10
- 238000001228 spectrum Methods 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 150000004694 iodide salts Chemical class 0.000 description 5
- 238000009877 rendering Methods 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052754 neon Inorganic materials 0.000 description 2
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 2
- 208000034656 Contusions Diseases 0.000 description 1
- 102100021749 LIM and senescent cell antigen-like-containing domain protein 3 Human genes 0.000 description 1
- 101710104347 LIM and senescent cell antigen-like-containing domain protein 3 Proteins 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical compound [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- -1 rare earth iodides Chemical class 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000005341 toughened glass Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
- H01J61/22—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent vapour of an alkali metal
Landscapes
- Discharge Lamp (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6909891A NL6909891A (enExample) | 1969-06-27 | 1969-06-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2028781A1 true DE2028781A1 (de) | 1971-01-07 |
Family
ID=19807323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702028781 Pending DE2028781A1 (de) | 1969-06-27 | 1970-06-11 | Hochdruck-Quecksilberdampf Jodid-Entladungslampe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3639801A (enExample) |
| AT (1) | AT297848B (enExample) |
| BE (1) | BE752550A (enExample) |
| DE (1) | DE2028781A1 (enExample) |
| FR (1) | FR2051304A5 (enExample) |
| GB (1) | GB1272545A (enExample) |
| NL (1) | NL6909891A (enExample) |
| SE (1) | SE355106B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7203720A (enExample) * | 1972-03-20 | 1973-09-24 | ||
| NL7303079A (enExample) * | 1973-03-06 | 1974-09-10 | ||
| DE2456757C2 (de) * | 1974-11-30 | 1983-06-01 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Metallhalogenid-Hochdruckgasentladungslampe |
| US4605881A (en) * | 1984-11-29 | 1986-08-12 | General Electric Company | High pressure sodium iodide arc lamp with excess iodine |
| US4757236A (en) * | 1984-11-29 | 1988-07-12 | General Electric Company | High pressure metal halide arc lamp with xenon buffer gas |
| US5729090A (en) * | 1995-02-21 | 1998-03-17 | General Electric Company | Sodium halide discharge lamp |
| US6147453A (en) * | 1997-12-02 | 2000-11-14 | U.S. Philips Corporation | Metal-halide lamp with lithium and cerium iodide |
| KR20010042208A (ko) * | 1999-01-28 | 2001-05-25 | 롤페스 요하네스 게라투스 알베르투스 | 금속 할로겐화물 램프 |
| WO2006078831A2 (en) * | 2005-01-18 | 2006-07-27 | Musco Corporation | Altering chemicals and removing white oxide coating on high- intensity arc lamp for better performance |
| US20060178075A1 (en) * | 2005-01-18 | 2006-08-10 | Musco Corporation | Altering chemicals and removing white oxide coating on high-intensity arc lamp for better performance |
| EP1733691A1 (en) * | 2005-06-14 | 2006-12-20 | Koninklijke Philips Electronics N.V. | Apparatus for cosmetic skin rejuvenation treatment |
| WO2008048968A2 (en) * | 2006-10-16 | 2008-04-24 | Luxim Corporation | Electrodeless plasma lamp and fill |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3234421A (en) * | 1961-01-23 | 1966-02-08 | Gen Electric | Metallic halide electric discharge lamps |
| US3259777A (en) * | 1961-05-09 | 1966-07-05 | Gen Electric | Metal halide vapor discharge lamp with near molten tip electrodes |
| US3452238A (en) * | 1966-12-05 | 1969-06-24 | Westinghouse Electric Corp | Metal vapor discharge lamp |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
-
1969
- 1969-06-27 NL NL6909891A patent/NL6909891A/xx unknown
-
1970
- 1970-06-11 DE DE19702028781 patent/DE2028781A1/de active Pending
- 1970-06-24 SE SE08757/70A patent/SE355106B/xx unknown
- 1970-06-24 AT AT567970A patent/AT297848B/de not_active IP Right Cessation
- 1970-06-24 GB GB30682/70A patent/GB1272545A/en not_active Expired
- 1970-06-24 US US49279A patent/US3639801A/en not_active Expired - Lifetime
- 1970-06-25 BE BE752550D patent/BE752550A/xx unknown
- 1970-06-25 FR FR7023554A patent/FR2051304A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3639801A (en) | 1972-02-01 |
| AT297848B (de) | 1972-04-10 |
| GB1272545A (en) | 1972-05-03 |
| NL6909891A (enExample) | 1970-12-29 |
| BE752550A (fr) | 1970-12-28 |
| FR2051304A5 (enExample) | 1971-04-02 |
| SE355106B (enExample) | 1973-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE2617915A1 (de) | Lichtbogen-entladungseinrichtung | |
| EP2128888B1 (de) | Quecksilberfreie Metallhalogenid-Hochdruckentladungslampe | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2028781A1 (de) | Hochdruck-Quecksilberdampf Jodid-Entladungslampe | |
| DE69318671T2 (de) | Fluoreszente Lampen mit hoher Farbwiedergabe und Helligkeit | |
| DE68911587T2 (de) | Hochdruckmetallhalogenidentladungslampe. | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE3110812C2 (enExample) | ||
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE2139078A1 (de) | Hochdruck Quecksilberdampf Entladungs lampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE905414C (de) | Entladungslampe mit langgestreckter Glashuelle und je einer Elektrode an beiden Enden dieser Huelle | |
| DE1489527A1 (de) | Quecksilberhochdrucklampe | |
| DE1089479B (de) | Elektrische Edelgas-Hochdruck-Entladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2525408C3 (de) | Hochdruck-Edelgas-Entladungslampe | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE7016628U (de) | Wandstabilisierte hochdruck-quecksilberdampf-entladungslampe mit jodid. | |
| DE1764015A1 (de) | Hochdruckentladungslampe mit grosser Leistung und ausgezeichneter Farbwiedergabe | |
| DE2059577C3 (de) | Niederdruck-Natriumdampf-Entladungslampe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE2307631C3 (de) | Hochdruckquecksilberdampfentladungslampe |