DE19548289A1 - Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin - Google Patents
Verfahren zur gleichzeitigen Herstellung von Caprolactam und HexamethylendiaminInfo
- Publication number
- DE19548289A1 DE19548289A1 DE19548289A DE19548289A DE19548289A1 DE 19548289 A1 DE19548289 A1 DE 19548289A1 DE 19548289 A DE19548289 A DE 19548289A DE 19548289 A DE19548289 A DE 19548289A DE 19548289 A1 DE19548289 A1 DE 19548289A1
- Authority
- DE
- Germany
- Prior art keywords
- column
- range
- distillation
- adiponitrile
- aminocapronitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 title claims abstract description 122
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 title claims abstract description 60
- 238000000034 method Methods 0.000 title claims abstract description 38
- 230000008569 process Effects 0.000 title claims abstract description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 claims abstract description 74
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 122
- KBMSFJFLSXLIDJ-UHFFFAOYSA-N 6-aminohexanenitrile Chemical compound NCCCCCC#N KBMSFJFLSXLIDJ-UHFFFAOYSA-N 0.000 claims description 70
- 150000001875 compounds Chemical class 0.000 claims description 63
- 229910021529 ammonia Inorganic materials 0.000 claims description 61
- 238000004821 distillation Methods 0.000 claims description 61
- 239000000203 mixture Substances 0.000 claims description 43
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 31
- 229940126062 Compound A Drugs 0.000 claims description 10
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 claims description 10
- 238000000926 separation method Methods 0.000 claims description 9
- 238000009835 boiling Methods 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 claims 1
- 239000003054 catalyst Substances 0.000 description 61
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- 229910001868 water Inorganic materials 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 25
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 23
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 17
- 238000005984 hydrogenation reaction Methods 0.000 description 15
- 229910052759 nickel Inorganic materials 0.000 description 14
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 13
- 239000007791 liquid phase Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 229910017052 cobalt Inorganic materials 0.000 description 12
- 239000010941 cobalt Substances 0.000 description 12
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 12
- 235000012239 silicon dioxide Nutrition 0.000 description 12
- FHKPTEOFUHYQFY-UHFFFAOYSA-N 2-aminohexanenitrile Chemical compound CCCCC(N)C#N FHKPTEOFUHYQFY-UHFFFAOYSA-N 0.000 description 11
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 11
- 229910052703 rhodium Inorganic materials 0.000 description 11
- 239000010948 rhodium Substances 0.000 description 11
- 239000000377 silicon dioxide Substances 0.000 description 11
- 229910052742 iron Inorganic materials 0.000 description 10
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 10
- 229910052707 ruthenium Inorganic materials 0.000 description 10
- 239000004408 titanium dioxide Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 238000007363 ring formation reaction Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000000395 magnesium oxide Substances 0.000 description 7
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 7
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 150000002823 nitrates Chemical class 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 229910052725 zinc Inorganic materials 0.000 description 5
- 239000011701 zinc Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000003951 lactams Chemical class 0.000 description 4
- 239000011133 lead Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical group [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 150000004675 formic acid derivatives Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- 239000011787 zinc oxide Substances 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- UWHCKJMYHZGTIT-UHFFFAOYSA-N Tetraethylene glycol, Natural products OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 238000001354 calcination Methods 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- HSJPMRKMPBAUAU-UHFFFAOYSA-N cerium(3+);trinitrate Chemical compound [Ce+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O HSJPMRKMPBAUAU-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 150000001924 cycloalkanes Chemical class 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 239000002638 heterogeneous catalyst Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 150000002642 lithium compounds Chemical class 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 229910052762 osmium Inorganic materials 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052702 rhenium Inorganic materials 0.000 description 2
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 2
- -1 rhodium Magnesium oxide Chemical compound 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 150000004763 sulfides Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- SKJCKYVIQGBWTN-UHFFFAOYSA-N (4-hydroxyphenyl) methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=C(O)C=C1 SKJCKYVIQGBWTN-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- GWCFTYITFDWLAY-UHFFFAOYSA-N 1-ethylazepan-2-one Chemical compound CCN1CCCCCC1=O GWCFTYITFDWLAY-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- QVYYOKWPCQYKEY-UHFFFAOYSA-N [Fe].[Co] Chemical compound [Fe].[Co] QVYYOKWPCQYKEY-UHFFFAOYSA-N 0.000 description 1
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 125000005219 aminonitrile group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012018 catalyst precursor Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- RPYFZMPJOHSVLD-UHFFFAOYSA-N copper vanadium Chemical compound [V][V][Cu] RPYFZMPJOHSVLD-UHFFFAOYSA-N 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N cyclooctane Chemical compound C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 1
- FZFYOUJTOSBFPQ-UHFFFAOYSA-M dipotassium;hydroxide Chemical compound [OH-].[K+].[K+] FZFYOUJTOSBFPQ-UHFFFAOYSA-M 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- NJNQDCIAOXIFTB-UHFFFAOYSA-N ethyl 6-aminohexanoate Chemical compound CCOC(=O)CCCCCN NJNQDCIAOXIFTB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 150000002611 lead compounds Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 description 1
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 1
- 229910000484 niobium oxide Inorganic materials 0.000 description 1
- URLJKFSTXLNXLG-UHFFFAOYSA-N niobium(5+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Nb+5].[Nb+5] URLJKFSTXLNXLG-UHFFFAOYSA-N 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- 125000001190 organyl group Chemical group 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 1
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 1
- MMKQUGHLEMYQSG-UHFFFAOYSA-N oxygen(2-);praseodymium(3+) Chemical compound [O-2].[O-2].[O-2].[Pr+3].[Pr+3] MMKQUGHLEMYQSG-UHFFFAOYSA-N 0.000 description 1
- 238000002161 passivation Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910003447 praseodymium oxide Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- RLJWTAURUFQFJP-UHFFFAOYSA-N propan-2-ol;titanium Chemical compound [Ti].CC(C)O.CC(C)O.CC(C)O.CC(C)O RLJWTAURUFQFJP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229910001954 samarium oxide Inorganic materials 0.000 description 1
- 229940075630 samarium oxide Drugs 0.000 description 1
- FKTOIHSPIPYAPE-UHFFFAOYSA-N samarium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[Sm+3].[Sm+3] FKTOIHSPIPYAPE-UHFFFAOYSA-N 0.000 description 1
- MFIWAIVSOUGHLI-UHFFFAOYSA-N selenium;tin Chemical compound [Sn]=[Se] MFIWAIVSOUGHLI-UHFFFAOYSA-N 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- VFWRGKJLLYDFBY-UHFFFAOYSA-N silver;hydrate Chemical compound O.[Ag].[Ag] VFWRGKJLLYDFBY-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 229910052566 spinel group Inorganic materials 0.000 description 1
- 150000004772 tellurides Chemical class 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- ITRNXVSDJBHYNJ-UHFFFAOYSA-N tungsten disulfide Chemical compound S=[W]=S ITRNXVSDJBHYNJ-UHFFFAOYSA-N 0.000 description 1
- 229910001930 tungsten oxide Inorganic materials 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
- IPCAPQRVQMIMAN-UHFFFAOYSA-L zirconyl chloride Chemical compound Cl[Zr](Cl)=O IPCAPQRVQMIMAN-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D201/00—Preparation, separation, purification or stabilisation of unsubstituted lactams
- C07D201/02—Preparation of lactams
- C07D201/08—Preparation of lactams from carboxylic acids or derivatives thereof, e.g. hydroxy carboxylic acids, lactones or nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/44—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of carboxylic acids or esters thereof in presence of ammonia or amines, or by reduction of nitriles, carboxylic acid amides, imines or imino-ethers
- C07C209/48—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of carboxylic acids or esters thereof in presence of ammonia or amines, or by reduction of nitriles, carboxylic acid amides, imines or imino-ethers by reduction of nitriles
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Polyamides (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19548289A DE19548289A1 (de) | 1995-12-22 | 1995-12-22 | Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin |
| PCT/EP1996/005521 WO1997023454A1 (de) | 1995-12-22 | 1996-12-11 | Verfahren zur gleichzeitigen herstellung von caprolactam und hexamethylendiamin |
| CA002237727A CA2237727C (en) | 1995-12-22 | 1996-12-11 | Simultaneously preparing caprolactam and hexamethylenediamine |
| ES96943913T ES2149514T3 (es) | 1995-12-22 | 1996-12-11 | Procedimiento para la obtencion simultanea de capro-lactama y hexametilendiamina. |
| TR1998/01153T TR199801153T2 (xx) | 1995-12-22 | 1996-12-11 | Kaprolaktam ve heksametilendiamini e�zamanl� elde etme usul�. |
| US09/091,130 US6147208A (en) | 1995-12-22 | 1996-12-11 | Process for simultaneously preparing caprolactam and hexamethylene diamine |
| AU13696/97A AU1369697A (en) | 1995-12-22 | 1996-12-11 | Process for simultaneously preparing caprolactam and hexamethylene diamine |
| CN96199220A CN1082947C (zh) | 1995-12-22 | 1996-12-11 | 己二腈起始同时制备己内酰胺和1,6-己二胺的方法 |
| DE59605731T DE59605731D1 (de) | 1995-12-22 | 1996-12-11 | Verfahren zur gleichzeitigen herstellung von caprolactam und hexamethylendiamin |
| JP09523263A JP2000502660A (ja) | 1995-12-22 | 1996-12-11 | カプロラクタムとヘキサメチレンジアミンの同時製造方法 |
| BR9612107A BR9612107A (pt) | 1995-12-22 | 1996-12-11 | Processos para a preparação e separação simultânea de caprolactama e hexametileno-diamina a partir de adiponitrila e para a separação simultânea de 6-amino-capronitrila e hexametileno-diamina por destilação de uma mistura |
| CZ981843A CZ184398A3 (cs) | 1995-12-22 | 1996-12-11 | Postup výroby kaprolaktamu současně s hexametyléndiaminem |
| CNB011326352A CN1237048C (zh) | 1995-12-22 | 1996-12-11 | 蒸馏分离主要含6-氨基己腈和1,6-己二胺的混合物的方法 |
| EP96943913A EP0876341B1 (de) | 1995-12-22 | 1996-12-11 | Verfahren zur gleichzeitigen herstellung von caprolactam und hexamethylendiamin |
| KR10-1998-0704754A KR100453675B1 (ko) | 1995-12-22 | 1996-12-11 | 카프롤락탐및헥사메틸렌디아민의병산방법 |
| MYPI96005354A MY114039A (en) | 1995-12-22 | 1996-12-19 | Simultaneous preparation of caprolactam and hexamethylenediamine |
| MX9803952A MX9803952A (es) | 1995-12-22 | 1998-05-19 | Preparacion simultanea de caprolactama y hexametilendiamina. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19548289A DE19548289A1 (de) | 1995-12-22 | 1995-12-22 | Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19548289A1 true DE19548289A1 (de) | 1997-06-26 |
Family
ID=7781117
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19548289A Withdrawn DE19548289A1 (de) | 1995-12-22 | 1995-12-22 | Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin |
| DE59605731T Expired - Lifetime DE59605731D1 (de) | 1995-12-22 | 1996-12-11 | Verfahren zur gleichzeitigen herstellung von caprolactam und hexamethylendiamin |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE59605731T Expired - Lifetime DE59605731D1 (de) | 1995-12-22 | 1996-12-11 | Verfahren zur gleichzeitigen herstellung von caprolactam und hexamethylendiamin |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US6147208A (enExample) |
| EP (1) | EP0876341B1 (enExample) |
| JP (1) | JP2000502660A (enExample) |
| KR (1) | KR100453675B1 (enExample) |
| CN (2) | CN1082947C (enExample) |
| AU (1) | AU1369697A (enExample) |
| BR (1) | BR9612107A (enExample) |
| CA (1) | CA2237727C (enExample) |
| CZ (1) | CZ184398A3 (enExample) |
| DE (2) | DE19548289A1 (enExample) |
| ES (1) | ES2149514T3 (enExample) |
| MX (1) | MX9803952A (enExample) |
| MY (1) | MY114039A (enExample) |
| TR (1) | TR199801153T2 (enExample) |
| WO (1) | WO1997023454A1 (enExample) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998011051A1 (de) * | 1996-09-10 | 1998-03-19 | Basf Aktiengesellschaft | Verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| WO2000003972A1 (de) * | 1998-07-17 | 2000-01-27 | Basf Aktiengesellschaft | Verbessertes verfahren zur herstellung von hexamethylendiamin |
| FR2781476A1 (fr) * | 1998-07-22 | 2000-01-28 | Rhone Poulenc Fibres | Procede de distillation d'ammoniac contenu dans un melange comprenant du caprolactame |
| WO2000005191A1 (de) * | 1998-07-20 | 2000-02-03 | Basf Aktiengesellschaft | Verbessertes verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| WO2000012459A1 (de) * | 1998-08-28 | 2000-03-09 | Basf Aktiengesellschaft | Verbessertes verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| US6139693A (en) * | 1997-02-07 | 2000-10-31 | Basf Aktiengesellschaft Ludwigshafen | Method for obtaining hexamethylene diamine from mixtures containing hexamethylene diamine |
| US6169199B1 (en) | 1997-02-07 | 2001-01-02 | Basf Aktiengesellschaft | Method for separating 6-aminocaproic acid nitrile from mixtures containing 6-aminocaproic acid nitrile and an imine |
| US6204408B1 (en) | 1997-02-07 | 2001-03-20 | Basf Aktiengesellschaft | Method for separating 6-aminocapronitrile from mixtures containing 6-aminocapronitrile and an imine |
| US6252115B1 (en) | 1997-02-07 | 2001-06-26 | Basf Aktiengesellschaft | Method for separating an imine from a mixture containing an amine and an imine |
| US6300497B1 (en) | 1998-03-20 | 2001-10-09 | Basf Ag | Method for separating an azepine derivative from a mixture containing an amine and an azepine derivative |
| WO2001090065A1 (fr) * | 2000-05-26 | 2001-11-29 | Rhodia Polyamide Intermediates | Procede de purification de lactames |
| WO2001094308A1 (de) * | 2000-06-05 | 2001-12-13 | Basf Aktiengesellschaft | Verfahren zur abtrennung von ammoniak aus lösungen, die caprolactam und ammoniak enthalten |
| US6346641B1 (en) | 1998-07-20 | 2002-02-12 | Basf Aktiengesellschaft | Method for simultaneous production of 6-aminocapronitrile and hexamethylenediamine |
| WO2001070665A3 (en) * | 2000-01-21 | 2002-04-11 | Du Pont | Separation of the products of polyamide ammonolysis |
| WO2015038679A1 (en) * | 2013-09-13 | 2015-03-19 | Invista Technologies S.A R.L. | Catalyst preparation and hydrogenation process |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19923894A1 (de) * | 1999-05-25 | 2000-11-30 | Basf Ag | Verfahren zur Herstellung von Polyamiden |
| DE10021201A1 (de) | 2000-05-03 | 2001-11-08 | Basf Ag | Verfahren zur Herstellung cyclischer Lactame |
| DE10029187A1 (de) * | 2000-06-19 | 2001-12-20 | Basf Ag | Verfahren zur Abtrennung von 6-Aminocapronitril aus Gemischen, die 6-Aminocapronitril, Adipodinitril und Hexamethylendiamin enthalten |
| DE10033544A1 (de) * | 2000-07-11 | 2002-01-24 | Basf Ag | Kontinuierliches Verfahren zur Herstellung von Polyamiden aus Aminonitrilen |
| DE10033518A1 (de) * | 2000-07-11 | 2002-01-24 | Basf Ag | Verfahren zur Abtrennung von Ammoniak |
| DE10059716A1 (de) | 2000-11-30 | 2002-06-06 | Basf Ag | Verfahren zur Reduzierung des Gehalts an einem ungesättigten Amin in einer Mischung enthaltend ein Amin und ein Nitril |
| JP2005509022A (ja) * | 2001-11-16 | 2005-04-07 | ビーエーエスエフ アクチェンゲゼルシャフト | 水溶液からアミンを単離する方法 |
| DE10223827A1 (de) * | 2002-05-28 | 2003-12-11 | Basf Ag | Verfahren zur Reduzierung des Gehalts an einem ungesättigten Amin in einer Mischung enthaltend ein Aminonitril, ein Diamin, ein Dinitril oder deren Gemische |
| DE10319159A1 (de) * | 2003-04-29 | 2004-11-18 | Basf Ag | Verfahren zur destillativen Gewinnung von hochreinem Triethylendiamin (TEDA) |
| FR2892118B1 (fr) | 2005-10-18 | 2010-12-10 | Rhodia Recherches & Tech | Procede de fabrication d'hexamethylene diamine et d'aminocapronitrile. |
| FR2902425B1 (fr) * | 2006-06-20 | 2008-07-18 | Rhodia Recherches & Tech | Procede de fabrication de diamines primaires |
| ATE459607T1 (de) * | 2006-09-28 | 2010-03-15 | Basf Se | Verfahren zur kontinuierlichen destillativen auftrennung von gemischen enthaltend morpholin (mo), monoaminodiglykol (adg), ammoniak und wasser |
| US8669397B2 (en) | 2009-06-13 | 2014-03-11 | Rennovia, Inc. | Production of adipic acid and derivatives from carbohydrate-containing materials |
| EP2440514B1 (en) | 2009-06-13 | 2018-08-22 | Archer-Daniels-Midland Company | Production of adipic acid and derivatives from carbohydrate-containing materials |
| BRPI1010708B1 (pt) | 2009-06-13 | 2018-04-03 | Rennovia, Inc. | "processos para preparar um produto de ácido adípico, e ácido adípico ou derivado do mesmo" |
| CN102803194B (zh) | 2009-06-13 | 2016-01-20 | 莱诺维亚公司 | 由含碳水化合物的物质生产戊二酸和衍生物 |
| US8669393B2 (en) * | 2010-03-05 | 2014-03-11 | Rennovia, Inc. | Adipic acid compositions |
| WO2011109051A1 (en) | 2010-03-05 | 2011-09-09 | Rennovia, Inc. | Adipic acid composition |
| US9770705B2 (en) | 2010-06-11 | 2017-09-26 | Rennovia Inc. | Oxidation catalysts |
| WO2013090031A2 (en) | 2011-12-14 | 2013-06-20 | Rennovia, Inc. | Water concentration reduction process |
| US8884036B2 (en) | 2011-12-30 | 2014-11-11 | E I Du Pont De Nemours And Company | Production of hydroxymethylfurfural from levoglucosenone |
| US8962894B2 (en) | 2011-12-30 | 2015-02-24 | E I Du Pont De Nemours And Company | Process for preparing 1, 6-hexanediol |
| US8865940B2 (en) | 2011-12-30 | 2014-10-21 | E I Du Pont De Nemours And Company | Process for preparing 1,6-hexanediol |
| CN104024197A (zh) | 2011-12-30 | 2014-09-03 | 纳幕尔杜邦公司 | 己二醇的制备方法 |
| US8889912B2 (en) | 2011-12-30 | 2014-11-18 | E I Du Pont De Nemours And Company | Process for preparing 1,6-hexanediol |
| BR112014015994A2 (pt) | 2011-12-30 | 2018-05-22 | Du Pont | processo. |
| WO2013126250A1 (en) * | 2012-02-23 | 2013-08-29 | Rennovia, Inc. | Production of caprolactam from adipic acid |
| DE102012006946A1 (de) | 2012-04-10 | 2013-10-10 | Stratley Ag | Verfahren zur Herstellung von Caprolactam |
| US9018423B2 (en) | 2012-04-27 | 2015-04-28 | E I Du Pont De Nemours And Company | Production of alpha, omega-diols |
| US8846985B2 (en) | 2012-04-27 | 2014-09-30 | E I Du Pont De Nemours And Company | Production of alpha, omega-diols |
| US8859826B2 (en) | 2012-04-27 | 2014-10-14 | E I Du Pont De Nemours And Company | Production of alpha, omega-diols |
| KR20200128087A (ko) * | 2018-02-27 | 2020-11-11 | 바스프 에스이 | 헥사메틸렌디아민의 정제 방법 |
| CN113072463B (zh) * | 2021-04-14 | 2023-11-28 | 江苏扬农化工集团有限公司 | 一种从己内酰胺氨化液的脱水物料中回收6-氨基己腈的方法 |
| WO2025119889A1 (en) | 2023-12-07 | 2025-06-12 | Basf Se | Process for manufacturing an aliphatic diamine |
| CN119241367B (zh) * | 2024-10-14 | 2025-06-27 | 北京道思克能源设备有限公司 | 一种甲基戊二腈加氢生产甲基戊二胺及甲基哌啶的方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2208598A (en) * | 1938-09-24 | 1940-07-23 | Du Pont | Aliphatic amino-nitriles and process of producing them |
| US2257814A (en) * | 1940-05-02 | 1941-10-07 | Du Pont | Preparation of omega-amino nitriles |
| US2357484A (en) * | 1941-09-12 | 1944-09-05 | Du Pont | Process for producing compounds containing an n-substituted amide group |
| US2301964A (en) * | 1941-09-12 | 1942-11-17 | Du Pont | Method of preparing lactams |
| DE848654C (de) * | 1950-08-19 | 1952-09-08 | Basf Ag | Verfahren zur Herstellung von partiellen Hydrierungsprodukten des Adipinsaeuredinitrils |
| DE954416C (de) * | 1952-11-04 | 1956-12-20 | Basf Ag | Verfahren zur Herstellung von Aminonitrilen und Diaminen |
| US2762835A (en) * | 1953-03-12 | 1956-09-11 | Celanese Corp | Preparation of amino nitriles |
| JPS4821958B1 (enExample) * | 1969-01-28 | 1973-07-02 | ||
| BE792649A (fr) * | 1971-12-13 | 1973-06-12 | Rhone Poulenc Sa | Catalyseur a base de nickel raney au fer |
| JPS4919250A (enExample) * | 1972-06-16 | 1974-02-20 | ||
| EP0150295A3 (en) * | 1983-12-19 | 1988-03-30 | Allied Corporation | Selective production of n-substituted amides by use of cu(o)/metallic oxides catalyst compositions |
| US4601859A (en) * | 1984-05-04 | 1986-07-22 | Allied Corporation | Selective hydrogenation of aliphatic dinitriles to omega-aminonitriles in ammonia with supported, finely dispersed rhodium-containing catalyst |
| US5151543A (en) * | 1991-05-31 | 1992-09-29 | E. I. Du Pont De Nemours And Company | Selective low pressure hydrogenation of a dinitrile to an aminonitrile |
| DE4235466A1 (de) * | 1992-10-21 | 1994-04-28 | Bayer Ag | Verfahren zur Herstellung von (cyclo)aliphatischen Aminonitrilen |
| DE4319134A1 (de) * | 1993-06-09 | 1994-12-15 | Basf Ag | Verfahren zur Herstellung von Caprolactam |
-
1995
- 1995-12-22 DE DE19548289A patent/DE19548289A1/de not_active Withdrawn
-
1996
- 1996-12-11 JP JP09523263A patent/JP2000502660A/ja not_active Withdrawn
- 1996-12-11 KR KR10-1998-0704754A patent/KR100453675B1/ko not_active Expired - Fee Related
- 1996-12-11 CA CA002237727A patent/CA2237727C/en not_active Expired - Fee Related
- 1996-12-11 CN CN96199220A patent/CN1082947C/zh not_active Expired - Lifetime
- 1996-12-11 US US09/091,130 patent/US6147208A/en not_active Expired - Lifetime
- 1996-12-11 CN CNB011326352A patent/CN1237048C/zh not_active Expired - Lifetime
- 1996-12-11 AU AU13696/97A patent/AU1369697A/en not_active Abandoned
- 1996-12-11 WO PCT/EP1996/005521 patent/WO1997023454A1/de not_active Ceased
- 1996-12-11 EP EP96943913A patent/EP0876341B1/de not_active Expired - Lifetime
- 1996-12-11 DE DE59605731T patent/DE59605731D1/de not_active Expired - Lifetime
- 1996-12-11 BR BR9612107A patent/BR9612107A/pt not_active IP Right Cessation
- 1996-12-11 CZ CZ981843A patent/CZ184398A3/cs unknown
- 1996-12-11 ES ES96943913T patent/ES2149514T3/es not_active Expired - Lifetime
- 1996-12-11 TR TR1998/01153T patent/TR199801153T2/xx unknown
- 1996-12-19 MY MYPI96005354A patent/MY114039A/en unknown
-
1998
- 1998-05-19 MX MX9803952A patent/MX9803952A/es not_active IP Right Cessation
Cited By (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1998011051A1 (de) * | 1996-09-10 | 1998-03-19 | Basf Aktiengesellschaft | Verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| US6147247A (en) * | 1996-09-10 | 2000-11-14 | Basf Aktiengesellschaft | Process for simultaneously preparing 6-aminocapronitrile and hexamethylene diamine |
| US6169199B1 (en) | 1997-02-07 | 2001-01-02 | Basf Aktiengesellschaft | Method for separating 6-aminocaproic acid nitrile from mixtures containing 6-aminocaproic acid nitrile and an imine |
| US6252115B1 (en) | 1997-02-07 | 2001-06-26 | Basf Aktiengesellschaft | Method for separating an imine from a mixture containing an amine and an imine |
| US6204408B1 (en) | 1997-02-07 | 2001-03-20 | Basf Aktiengesellschaft | Method for separating 6-aminocapronitrile from mixtures containing 6-aminocapronitrile and an imine |
| US6139693A (en) * | 1997-02-07 | 2000-10-31 | Basf Aktiengesellschaft Ludwigshafen | Method for obtaining hexamethylene diamine from mixtures containing hexamethylene diamine |
| US6300497B1 (en) | 1998-03-20 | 2001-10-09 | Basf Ag | Method for separating an azepine derivative from a mixture containing an amine and an azepine derivative |
| WO2000003972A1 (de) * | 1998-07-17 | 2000-01-27 | Basf Aktiengesellschaft | Verbessertes verfahren zur herstellung von hexamethylendiamin |
| US6346641B1 (en) | 1998-07-20 | 2002-02-12 | Basf Aktiengesellschaft | Method for simultaneous production of 6-aminocapronitrile and hexamethylenediamine |
| WO2000005191A1 (de) * | 1998-07-20 | 2000-02-03 | Basf Aktiengesellschaft | Verbessertes verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| US6482297B1 (en) | 1998-07-22 | 2002-11-19 | Rhodia Fiber & Resin Intermediates | Method for distilling ammonia |
| WO2000005173A1 (fr) * | 1998-07-22 | 2000-02-03 | Rhodia Fiber And Resin Intermediates | Procede de distillation d'ammoniac |
| FR2781476A1 (fr) * | 1998-07-22 | 2000-01-28 | Rhone Poulenc Fibres | Procede de distillation d'ammoniac contenu dans un melange comprenant du caprolactame |
| US6462220B1 (en) | 1998-08-28 | 2002-10-08 | Basf Aktiengesellschaft | Method for simultaneous preparation of 6-aminocapronitrile and hexamethylene diamine |
| WO2000012459A1 (de) * | 1998-08-28 | 2000-03-09 | Basf Aktiengesellschaft | Verbessertes verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin |
| WO2001070665A3 (en) * | 2000-01-21 | 2002-04-11 | Du Pont | Separation of the products of polyamide ammonolysis |
| WO2001090065A1 (fr) * | 2000-05-26 | 2001-11-29 | Rhodia Polyamide Intermediates | Procede de purification de lactames |
| FR2809395A1 (fr) * | 2000-05-26 | 2001-11-30 | Rhodia Polyamide Intermediates | Procede de purification de lactames |
| EP1903032A1 (fr) * | 2000-05-26 | 2008-03-26 | Rhodia Polyamide Intermediates | Procédé de purification de lactames |
| US7384518B2 (en) | 2000-05-26 | 2008-06-10 | Rhodia Polyamide Intermediates | Method for purifying lactams |
| US8231765B2 (en) | 2000-05-26 | 2012-07-31 | Rhodia Polyamide Intermediates | Process for the purification of lactams |
| WO2001094308A1 (de) * | 2000-06-05 | 2001-12-13 | Basf Aktiengesellschaft | Verfahren zur abtrennung von ammoniak aus lösungen, die caprolactam und ammoniak enthalten |
| WO2015038679A1 (en) * | 2013-09-13 | 2015-03-19 | Invista Technologies S.A R.L. | Catalyst preparation and hydrogenation process |
Also Published As
| Publication number | Publication date |
|---|---|
| BR9612107A (pt) | 1999-02-23 |
| WO1997023454A1 (de) | 1997-07-03 |
| EP0876341A1 (de) | 1998-11-11 |
| CA2237727A1 (en) | 1997-07-03 |
| MX9803952A (es) | 1998-09-30 |
| DE59605731D1 (de) | 2000-09-14 |
| MY114039A (en) | 2002-07-31 |
| CN1082947C (zh) | 2002-04-17 |
| KR100453675B1 (ko) | 2005-01-15 |
| ES2149514T3 (es) | 2000-11-01 |
| JP2000502660A (ja) | 2000-03-07 |
| TR199801153T2 (xx) | 1998-10-21 |
| KR19990076645A (ko) | 1999-10-15 |
| CN1375489A (zh) | 2002-10-23 |
| CA2237727C (en) | 2004-02-24 |
| CZ184398A3 (cs) | 1998-09-16 |
| CN1237048C (zh) | 2006-01-18 |
| AU1369697A (en) | 1997-07-17 |
| CN1205691A (zh) | 1999-01-20 |
| EP0876341B1 (de) | 2000-08-09 |
| US6147208A (en) | 2000-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19548289A1 (de) | Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin | |
| EP0801643B1 (de) | Verfahren zur kontinuierlichen reinigung von aus 6-aminocapronitril hergestelltem roh-caprolactam | |
| DE19500222A1 (de) | Verfahren zur gleichzeitigen Herstellung von Caprolactam und Hexamethylendiamin | |
| DE69621491T2 (de) | Verfahren zur Herstellung von Epsilon-Caprolactam | |
| EP0912508B1 (de) | Verfahren zur herstellung von caprolactam aus 6-aminocapronitril | |
| EP2961731B1 (de) | Verfahren zur herstellung von eda unter verwendung von so2-freier blausäure | |
| EP0794943B1 (de) | Verfahren zur herstellung von caprolactam | |
| EP0927157B1 (de) | Verfahren zur gleichzeitigen herstellung von 6-aminocapronitril und hexamethylendiamin | |
| DE19636765A1 (de) | Verfahren zur gleichzeitigen Herstellung von 6-Aminocapronitril und Hexamethylendiamin | |
| US5717090A (en) | Simultaneous preparation of caprolactam and hexamethylenediamine | |
| EP1565435B1 (de) | Verfahren zur reinigung von caprolactam | |
| EP1562896B1 (de) | Verfahren zur reinigung von caprolactam | |
| MXPA97004864A (en) | Process for the continuous purification of capillactama impura prepared from 6-amicapronitr |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |