DE1954084A1 - Verfahren zur Herstellung von Azonitrilen - Google Patents
Verfahren zur Herstellung von AzonitrilenInfo
- Publication number
- DE1954084A1 DE1954084A1 DE19691954084 DE1954084A DE1954084A1 DE 1954084 A1 DE1954084 A1 DE 1954084A1 DE 19691954084 DE19691954084 DE 19691954084 DE 1954084 A DE1954084 A DE 1954084A DE 1954084 A1 DE1954084 A1 DE 1954084A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- water
- ketone
- high molecular
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 4,4'-disubstituted 2,2'-azobis(2,4-dimethylvaleronitrile) Chemical class 0.000 title claims description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- 238000006243 chemical reaction Methods 0.000 claims abstract description 13
- 239000004372 Polyvinyl alcohol Substances 0.000 claims abstract description 7
- 239000012736 aqueous medium Substances 0.000 claims abstract description 7
- 229920002451 polyvinyl alcohol Polymers 0.000 claims abstract description 7
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 229920003086 cellulose ether Polymers 0.000 claims abstract 2
- 239000000080 wetting agent Substances 0.000 claims description 25
- 150000002576 ketones Chemical class 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 150000002605 large molecules Chemical class 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000005840 aryl radicals Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 claims description 2
- DBLJAFVPFHRQSP-UHFFFAOYSA-N aminoazanium;sulfate Chemical compound NN.NN.OS(O)(=O)=O DBLJAFVPFHRQSP-UHFFFAOYSA-N 0.000 claims description 2
- 229910000377 hydrazine sulfate Inorganic materials 0.000 claims description 2
- 239000012493 hydrazine sulfate Substances 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 abstract description 4
- 239000004094 surface-active agent Substances 0.000 abstract description 4
- 230000003647 oxidation Effects 0.000 abstract description 3
- 125000003118 aryl group Chemical group 0.000 abstract 1
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 5
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229920001400 block copolymer Polymers 0.000 description 3
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- GYAZFWRAWZSHCP-UHFFFAOYSA-N 2-[(2-cyano-4,4-dimethylpentan-2-yl)diazenyl]-2,4,4-trimethylpentanenitrile Chemical compound CC(C)(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)(C)C GYAZFWRAWZSHCP-UHFFFAOYSA-N 0.000 description 2
- PFLUPZGCTVGDLV-UHFFFAOYSA-N acetone azine Chemical compound CC(C)=NN=C(C)C PFLUPZGCTVGDLV-UHFFFAOYSA-N 0.000 description 2
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QOOQLKSEGVNYLA-UHFFFAOYSA-N 1-$l^{1}-oxidanylbutane Chemical compound CCCC[O] QOOQLKSEGVNYLA-UHFFFAOYSA-N 0.000 description 1
- KOKPBCHLPVDQTK-UHFFFAOYSA-N 4-methoxy-4-methylpentan-2-one Chemical compound COC(C)(C)CC(C)=O KOKPBCHLPVDQTK-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 108010013381 Porins Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- RNYJXPUAFDFIQJ-UHFFFAOYSA-N hydron;octadecan-1-amine;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[NH3+] RNYJXPUAFDFIQJ-UHFFFAOYSA-N 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002503 polyoxyethylene-polyoxypropylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 102000007739 porin activity proteins Human genes 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/63—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton
- C07C255/65—Carboxylic acid nitriles containing cyano groups and nitrogen atoms further bound to other hetero atoms, other than oxygen atoms of nitro or nitroso groups, bound to the same carbon skeleton with the nitrogen atoms further bound to nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5402069A JPS4842859B1 (cg-RX-API-DMAC10.html) | 1969-07-07 | 1969-07-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1954084A1 true DE1954084A1 (de) | 1971-01-14 |
Family
ID=12958888
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691954084 Withdrawn DE1954084A1 (de) | 1969-07-07 | 1969-10-28 | Verfahren zur Herstellung von Azonitrilen |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS4842859B1 (cg-RX-API-DMAC10.html) |
| BE (1) | BE740125A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1954084A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL6916107A (cg-RX-API-DMAC10.html) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5010177A (en) * | 1989-12-26 | 1991-04-23 | The B. F. Goodrich Company | Process for the preparation of an azonitrile dicarboxylic acid initiator in acetone having a low salt and low water content |
| US5010178A (en) * | 1989-12-26 | 1991-04-23 | The B. F. Goodrich Company | Process for the preparation of mixed azonitrile carboxylic acid initiators |
-
1969
- 1969-07-07 JP JP5402069A patent/JPS4842859B1/ja active Pending
- 1969-10-10 BE BE740125D patent/BE740125A/xx unknown
- 1969-10-24 NL NL6916107A patent/NL6916107A/xx unknown
- 1969-10-28 DE DE19691954084 patent/DE1954084A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| NL6916107A (cg-RX-API-DMAC10.html) | 1971-01-11 |
| BE740125A (cg-RX-API-DMAC10.html) | 1970-03-16 |
| JPS4842859B1 (cg-RX-API-DMAC10.html) | 1973-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE906934C (de) | Verfahren zur Reinigung von 1-Oxyaryl-2-carbonsaeureamiden | |
| DE3500577A1 (de) | Verfahren zur herstellung von 1,2-benzisothiazolonen | |
| DE1954084A1 (de) | Verfahren zur Herstellung von Azonitrilen | |
| DE2902978A1 (de) | Verfahren zur kontinuierlichen herstellung von isatosaeureanhydrid | |
| DE2153356C2 (de) | Verfahren zur Herstellung von α-Anilinopropionsäuren und/oder deren Derivaten | |
| DE1204665B (de) | Verfahren zur Herstellung von Trifluormethyl-phenylsulfonsaeure-trifluormethylphenylamiden | |
| DE1618207B2 (de) | Verfahren zur herstellung von alphachloracetessigsaeure-monoalkylamiden | |
| EP0004635A2 (de) | Verfahren zur kontinuierlichen Herstellung von Anthranilsäure | |
| DE1954084C (de) | Verfahren zur Herstellung von Azonitnlen | |
| EP0224849B1 (de) | Verfahren zur Herstellung von 4-Mercaptobenzonitrilen und neue 4-Mercaptobenzonitrile | |
| DD158643A5 (de) | Kontinuierliches verfahren zur herstellung von dichloracetamiden | |
| EP1519927B1 (de) | Verfahren zur herstellung von 3,4-dichlor-n-(2-cyano-phenyl)-5-isothiazol-carboxamid | |
| DE2453365A1 (de) | Verfahren zur herstellung von n-trimethylsilylacetamid | |
| DE2330241C3 (de) | Chlorthio-N-phthalimid, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE1695668A1 (de) | Verfahren zur Herstellung von 3-Isothiazolonen und 3-Hydroxyisothiazolen | |
| DE2060197C3 (de) | Verfahren zur Herstellung von 2-Aminobenzothiazol und dessen N-Alkylsubstitutionsprodukten | |
| DE3044904A1 (de) | Fluorierte anthranilsaeure und anthranilsaeurenitril sowie verfahren zu ihrer herstellung | |
| DE1543332A1 (de) | Verfahren zur Herstellung von Anthranilsaeureamiden | |
| AT216511B (de) | Verfahren zur Herstellung von 1,2,4-Benzothiadiazin-1,1-dioxydverbindungen | |
| DE867244C (de) | Verfahren zur Herstellung von Aminoaryloxyessigsaeureamiden | |
| DE3324844C1 (de) | 3,3-Bis-[2-carboxyethyl]-3-(hydroxy-ammonium)-propionsäurebetain sowie Verfahren zur Herstellung und dessen Verwendung | |
| DE2027202C3 (de) | 4-Amino-7-nitro-1 ^-benzisothiazole und Verfahren zu ihrer Herstellung | |
| DE69411093T2 (de) | Pyrazin-derivate | |
| DE2201162C3 (de) | Auraminfarbstoff, Verfahren zu seiner Herstellung und dessen Verwendung | |
| DE1695909C3 (de) | Verfahren zur Herstellung von 1-(5-Nitro-2-thiazolyl)-2-oxo-imidazolidinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |