DE1909460A1 - Magnetisches Steuerrelais - Google Patents
Magnetisches SteuerrelaisInfo
- Publication number
- DE1909460A1 DE1909460A1 DE19691909460 DE1909460A DE1909460A1 DE 1909460 A1 DE1909460 A1 DE 1909460A1 DE 19691909460 DE19691909460 DE 19691909460 DE 1909460 A DE1909460 A DE 1909460A DE 1909460 A1 DE1909460 A1 DE 1909460A1
- Authority
- DE
- Germany
- Prior art keywords
- contact
- housing
- contacts
- movable contacts
- electromagnet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003086 colorant Substances 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 1
- LYKJEJVAXSGWAJ-UHFFFAOYSA-N compactone Natural products CC1(C)CCCC2(C)C1CC(=O)C3(O)CC(C)(CCC23)C=C LYKJEJVAXSGWAJ-UHFFFAOYSA-N 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H50/00—Details of electromagnetic relays
- H01H50/54—Contact arrangements
- H01H50/541—Auxiliary contact devices
- H01H50/545—Self-contained, easily replaceable microswitches
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP43055400A JPS4844312B1 (cg-RX-API-DMAC10.html) | 1968-08-05 | 1968-08-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1909460A1 true DE1909460A1 (de) | 1970-03-26 |
Family
ID=12997470
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691909460 Pending DE1909460A1 (de) | 1968-08-05 | 1969-02-25 | Magnetisches Steuerrelais |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3548349A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS4844312B1 (cg-RX-API-DMAC10.html) |
| DE (1) | DE1909460A1 (cg-RX-API-DMAC10.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0045683A1 (fr) * | 1980-08-01 | 1982-02-10 | Petercem S.A. | Dispositif de fixation d'accessoires sur la face avant d'un contacteur monobloc |
| EP0047355A3 (en) * | 1980-09-06 | 1982-09-22 | Square D Starkstrom Gmbh | Contact device for low-voltage switch gears, particularly contactors |
| EP0162952A1 (de) * | 1984-03-31 | 1985-12-04 | Square D Company (Deutschland) Gmbh | Schaltbrücke für elektrische Schaltgeräte, insbesondere für Schütze |
| EP0242570A1 (de) * | 1986-04-23 | 1987-10-28 | Siemens Aktiengesellschaft | Schütz mit zusätzlichem Schalterblock |
| EP0340571A1 (de) * | 1988-05-03 | 1989-11-08 | Siemens Aktiengesellschaft | Hilfsschalteraufsatzblock |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3639866A (en) * | 1970-10-12 | 1972-02-01 | Honeywell Inc | Constant actuating force arrangement for a relay and a relay-adder combination |
| US3651437A (en) * | 1971-03-19 | 1972-03-21 | Matsushita Electric Works Ltd | Electromagnetic contactor |
| FR2257141B1 (cg-RX-API-DMAC10.html) * | 1974-01-03 | 1978-03-10 | Telemecanique Electrique | |
| US4087770A (en) * | 1976-06-29 | 1978-05-02 | Allen-Bradley Company | Industrial relay |
| SG10201801656YA (en) * | 2018-02-28 | 2019-09-27 | Schneider Electric Asia Pte Ltd | A relay control device for a relay module |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2778903A (en) * | 1954-04-23 | 1957-01-22 | Jr Albert F Hopkins | Switch position indicators |
| US3099728A (en) * | 1958-06-11 | 1963-07-30 | Ward Leonard Electric Co | Electrical multipole control relays |
| US3161751A (en) * | 1962-05-17 | 1964-12-15 | Gen Electric | Reversible electrical contact structure |
| US3225170A (en) * | 1964-03-09 | 1965-12-21 | S & C Electric Co | Means for indicating the position of the contacts of a circuit interrupter |
| US3243544A (en) * | 1964-12-09 | 1966-03-29 | Allen Bradley Co | Convertible relay control station |
| US3409851A (en) * | 1966-11-03 | 1968-11-05 | Ward Leonard Electric Co | Multipole electromagnetic contactor |
| US3451018A (en) * | 1967-11-24 | 1969-06-17 | Ite Imperial Corp | Contactor electromagnet |
-
1968
- 1968-08-05 JP JP43055400A patent/JPS4844312B1/ja active Pending
-
1969
- 1969-02-19 US US800459A patent/US3548349A/en not_active Expired - Lifetime
- 1969-02-25 DE DE19691909460 patent/DE1909460A1/de active Pending
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0045683A1 (fr) * | 1980-08-01 | 1982-02-10 | Petercem S.A. | Dispositif de fixation d'accessoires sur la face avant d'un contacteur monobloc |
| EP0047355A3 (en) * | 1980-09-06 | 1982-09-22 | Square D Starkstrom Gmbh | Contact device for low-voltage switch gears, particularly contactors |
| EP0162952A1 (de) * | 1984-03-31 | 1985-12-04 | Square D Company (Deutschland) Gmbh | Schaltbrücke für elektrische Schaltgeräte, insbesondere für Schütze |
| EP0242570A1 (de) * | 1986-04-23 | 1987-10-28 | Siemens Aktiengesellschaft | Schütz mit zusätzlichem Schalterblock |
| EP0340571A1 (de) * | 1988-05-03 | 1989-11-08 | Siemens Aktiengesellschaft | Hilfsschalteraufsatzblock |
| US4956624A (en) * | 1988-05-03 | 1990-09-11 | Siemens Aktiengesellschaft | Auxiliary switch attachment block |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4844312B1 (cg-RX-API-DMAC10.html) | 1973-12-24 |
| US3548349A (en) | 1970-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2454967C3 (de) | Gepoltes elektromagnetisches Relais | |
| DE1129587B (de) | Elektrischer Schnappschalter mit zwei unter Zugfederspannung am Stoessel gehalterten Kontaktarmen | |
| DE1765184B2 (de) | Elektrische schaltvorrichtung | |
| DE2724939C3 (de) | Schaltgerät, insbesondere elektronisches, berührungslos arbeitendes Schaltgerät | |
| DE2407057B2 (de) | Elektromagnetisches Schaltgerät | |
| DE19939020B4 (de) | Elektromagnetisches Schaltschütz | |
| DE69707369T2 (de) | Elektromagnetischer Schalter | |
| DE1805038A1 (de) | Elektromagnetischer Haltemechanismus | |
| DE1909460A1 (de) | Magnetisches Steuerrelais | |
| EP0017129B1 (de) | Gepoltes Zungenkontaktrelais | |
| CH676895A5 (cg-RX-API-DMAC10.html) | ||
| DE1283326B (de) | Wandelbare Kontakteinheit | |
| EP0320686A2 (de) | Elektromagnetisches Schaltgerät | |
| DE2118633A1 (de) | Elektromagnetisches Relais | |
| DE1298608C2 (de) | Elektromagnetisches schuetz | |
| EP0000711A1 (de) | Schütz mit frei zugänglichen, in unterschiedlichen Ebenen angeordneten Leitungsanschlüssen | |
| DE1614837C3 (de) | Elektromagnetisches Schütz | |
| DE3242821C2 (de) | Staubdichter Blattfederkontakt-Schalter | |
| DE963170C (de) | Ansprechanzeiger fuer Apparate mit Schaltmagneten | |
| DE1008411B (de) | Kontaktvorrichtung fuer elektromagnetische Schalteinrichtungen | |
| DE69215348T2 (de) | Schaltgeräte für elektromagnetische und manuelle Betätigung | |
| DE69834897T2 (de) | Verwechslungsschutzanordnung für elektrische Schaltgeräte, insbesondere für Leistungsschalter und Differenzstromschutzschalter | |
| DE69202467T2 (de) | Gegenseitige Verriegelungsvorrichtung für elektromagnetische Schütze. | |
| DE102018107968B4 (de) | Zwangsgeführtes Relais | |
| DE10261473B4 (de) | Elektromagnetisches Relais |