DE1901333A1 - Photoemitter - Google Patents
PhotoemitterInfo
- Publication number
- DE1901333A1 DE1901333A1 DE19691901333 DE1901333A DE1901333A1 DE 1901333 A1 DE1901333 A1 DE 1901333A1 DE 19691901333 DE19691901333 DE 19691901333 DE 1901333 A DE1901333 A DE 1901333A DE 1901333 A1 DE1901333 A1 DE 1901333A1
- Authority
- DE
- Germany
- Prior art keywords
- photoemitter
- carrier
- semiconducting
- layer
- cesium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004065 semiconductor Substances 0.000 claims description 19
- 229910001942 caesium oxide Inorganic materials 0.000 claims description 17
- 229910045601 alloy Inorganic materials 0.000 claims description 16
- 239000000956 alloy Substances 0.000 claims description 16
- KOPBYBDAPCDYFK-UHFFFAOYSA-N caesium oxide Chemical compound [O-2].[Cs+].[Cs+] KOPBYBDAPCDYFK-UHFFFAOYSA-N 0.000 claims description 16
- 229910052783 alkali metal Inorganic materials 0.000 claims description 13
- 150000001340 alkali metals Chemical class 0.000 claims description 13
- 229910052792 caesium Inorganic materials 0.000 claims description 12
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 12
- 230000005855 radiation Effects 0.000 claims description 12
- 229910000673 Indium arsenide Inorganic materials 0.000 claims description 10
- RPQDHPTXJYYUPQ-UHFFFAOYSA-N indium arsenide Chemical compound [In]#[As] RPQDHPTXJYYUPQ-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 239000000370 acceptor Substances 0.000 claims description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 239000002019 doping agent Substances 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 239000004020 conductor Substances 0.000 claims description 4
- 230000000737 periodic effect Effects 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- 229910005542 GaSb Inorganic materials 0.000 claims description 2
- 229910052790 beryllium Inorganic materials 0.000 claims description 2
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 3
- 239000010410 layer Substances 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 12
- 230000003287 optical effect Effects 0.000 description 11
- JBRZTFJDHDCESZ-UHFFFAOYSA-N AsGa Chemical compound [As]#[Ga] JBRZTFJDHDCESZ-UHFFFAOYSA-N 0.000 description 9
- 229910001218 Gallium arsenide Inorganic materials 0.000 description 9
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000002356 single layer Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000010587 phase diagram Methods 0.000 description 2
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GPXJNWSHGFTCBW-UHFFFAOYSA-N Indium phosphide Chemical compound [In]#P GPXJNWSHGFTCBW-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000013590 bulk material Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- AKUNKIJLSDQFLS-UHFFFAOYSA-M dicesium;hydroxide Chemical compound [OH-].[Cs+].[Cs+] AKUNKIJLSDQFLS-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J1/00—Details of electrodes, of magnetic control means, of screens, or of the mounting or spacing thereof, common to two or more basic types of discharge tubes or lamps
- H01J1/02—Main electrodes
- H01J1/34—Photo-emissive cathodes
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J2201/00—Electrodes common to discharge tubes
- H01J2201/34—Photoemissive electrodes
- H01J2201/342—Cathodes
- H01J2201/3421—Composition of the emitting surface
- H01J2201/3423—Semiconductors, e.g. GaAs, NEA emitters
Landscapes
- Common Detailed Techniques For Electron Tubes Or Discharge Tubes (AREA)
- Image-Pickup Tubes, Image-Amplification Tubes, And Storage Tubes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US69894168A | 1968-01-18 | 1968-01-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1901333A1 true DE1901333A1 (de) | 1969-08-28 |
| DE1901333B2 DE1901333B2 (enExample) | 1970-10-29 |
Family
ID=24807262
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691901333 Pending DE1901333A1 (de) | 1968-01-18 | 1969-01-11 | Photoemitter |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3644770A (enExample) |
| DE (1) | DE1901333A1 (enExample) |
| FR (1) | FR2000358A1 (enExample) |
| GB (1) | GB1258917A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1024513A4 (en) * | 1997-09-24 | 2000-09-20 | Hamamatsu Photonics Kk | SEMICONDUCTOR PHOTOELECTRIC SURFACE |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3769536A (en) * | 1972-01-28 | 1973-10-30 | Varian Associates | Iii-v photocathode bonded to a foreign transparent substrate |
| US3982261A (en) * | 1972-09-22 | 1976-09-21 | Varian Associates | Epitaxial indium-gallium-arsenide phosphide layer on lattice-matched indium-phosphide substrate and devices |
| US3958143A (en) * | 1973-01-15 | 1976-05-18 | Varian Associates | Long-wavelength photoemission cathode |
| US3986065A (en) * | 1974-10-24 | 1976-10-12 | Rca Corporation | Insulating nitride compounds as electron emitters |
| US4206002A (en) * | 1976-10-19 | 1980-06-03 | University Of Pittsburgh | Graded band gap multi-junction solar energy cell |
| US4704635A (en) * | 1984-12-18 | 1987-11-03 | Sol Nudelman | Large capacity, large area video imaging sensor |
| US5304815A (en) * | 1986-09-11 | 1994-04-19 | Canon Kabushiki Kaisha | Electron emission elements |
| JPS63291337A (ja) * | 1987-05-22 | 1988-11-29 | Sharp Corp | フオトカソ−ド |
| US4929867A (en) * | 1988-06-03 | 1990-05-29 | Varian Associates, Inc. | Two stage light converting vacuum tube |
| US7540978B2 (en) * | 2004-08-05 | 2009-06-02 | Novaled Ag | Use of an organic matrix material for producing an organic semiconductor material, organic semiconductor material and electronic component |
| DE602004006275T2 (de) * | 2004-10-07 | 2007-12-20 | Novaled Ag | Verfahren zur Dotierung von einem Halbleitermaterial mit Cäsium |
| EP1727221B1 (de) * | 2005-05-27 | 2010-04-14 | Novaled AG | Transparente organische Leuchtdiode |
| EP1729346A1 (de) * | 2005-06-01 | 2006-12-06 | Novaled AG | Lichtemittierendes Bauteil mit einer Elektrodenanordnung |
| EP1739765A1 (de) * | 2005-07-01 | 2007-01-03 | Novaled AG | Organische Leuchtdiode und Anordnung mit mehreren organischen Leuchtdioden |
| EP1780816B1 (en) | 2005-11-01 | 2020-07-01 | Novaled GmbH | A method for producing an electronic device with a layer structure and an electronic device |
| EP1939320B1 (de) * | 2005-12-07 | 2013-08-21 | Novaled AG | Verfahren zum Abscheiden eines Aufdampfmaterials |
| TWI353677B (en) | 2006-03-21 | 2011-12-01 | Novaled Ag | Method for preparing doped organic semiconductor m |
| EP2608872B1 (en) | 2010-08-23 | 2019-07-31 | Exogenesis Corporation | Method and apparatus for neutral beam processing based on gas cluster ion beam technology |
| WO2017065857A1 (en) * | 2015-10-14 | 2017-04-20 | Exogenesis Corporation | Method for ultra-shallow etching using neutral beam processing based on gas cluster ion beam technology |
| FR3106118B1 (fr) | 2020-01-15 | 2021-12-10 | Psa Automobiles Sa | Elément de carrosserie comportant des moyens de fixation d’équipement simplifiés, et véhicule comportant un tel élément de carrosserie. |
-
1968
- 1968-01-18 US US698941A patent/US3644770A/en not_active Expired - Lifetime
- 1968-12-18 GB GB1258917D patent/GB1258917A/en not_active Expired
-
1969
- 1969-01-11 DE DE19691901333 patent/DE1901333A1/de active Pending
- 1969-01-15 FR FR6900496A patent/FR2000358A1/fr active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1024513A4 (en) * | 1997-09-24 | 2000-09-20 | Hamamatsu Photonics Kk | SEMICONDUCTOR PHOTOELECTRIC SURFACE |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1901333B2 (enExample) | 1970-10-29 |
| US3644770A (en) | 1972-02-22 |
| FR2000358A1 (enExample) | 1969-09-05 |
| GB1258917A (enExample) | 1971-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1901333A1 (de) | Photoemitter | |
| DE3854333T2 (de) | Infrarot-Detektor. | |
| DE69128750T2 (de) | Lichtempfindliches Bauelement | |
| US3958143A (en) | Long-wavelength photoemission cathode | |
| DE2624348A1 (de) | Heterouebergang-pn-diodenphotodetektor | |
| DE3316027C2 (de) | Photodetektor und Verfahren zu seiner Herstellung | |
| DE69120849T2 (de) | Lawinenphotodiode | |
| DE69218157T2 (de) | Lawinenfotodiode | |
| DE69300145T2 (de) | Fotoelektronen emittierende Struktur und Elektronenröhre und Fotodetektorvorrichtung zur Verwendung der Fotoelektronen emittierenden Struktur. | |
| DE69007461T2 (de) | Oberflächenemittierender Halbleiterlaser mit lateralem Elektrodenkontakt. | |
| DE69128751T2 (de) | Lichtempfindliches Bauelement | |
| DE68922117T2 (de) | Halbleiterphotodiode. | |
| JPH0821727B2 (ja) | アバランシェフォトダイオード | |
| DE3215083A1 (de) | Majoritaetsladungstraeger-photodetektor | |
| DE3688490T2 (de) | Lumineszentes halbleiterelement. | |
| DE3917936A1 (de) | Lichtelektrisches element | |
| DE69119995T2 (de) | Photodiode | |
| DE2848925A1 (de) | Lawinen-photodiode mit heterouebergang | |
| DE69527261T2 (de) | Photovervielfacher mit einer aus Halbleitermaterial bestehender Photokathode | |
| DE3441922C2 (de) | Fotokathode für den Infrarotbereich | |
| DE68918987T2 (de) | Heteroübergang-Lawinen-Photodiode vom planaren Typ. | |
| DE69807103T2 (de) | Halbleitende photoelektrische oberfläche | |
| DE1614212A1 (de) | Szintillationsdetektor | |
| DE2101941A1 (de) | Mehrschichtige III V Photokathode mit einer besonders guten aktiven Schicht | |
| DE69303738T2 (de) | Photoelektrischer Detektor mit Quantentöpfen und verbesserter Detectivität |