DE1882400U - Fluessigkeitsverteiler, insbesondere -zerstaeuber. - Google Patents
Fluessigkeitsverteiler, insbesondere -zerstaeuber.Info
- Publication number
- DE1882400U DE1882400U DET13761U DET0013761U DE1882400U DE 1882400 U DE1882400 U DE 1882400U DE T13761 U DET13761 U DE T13761U DE T0013761 U DET0013761 U DE T0013761U DE 1882400 U DE1882400 U DE 1882400U
- Authority
- DE
- Germany
- Prior art keywords
- liquid distributor
- liquid
- valve
- lever
- spring
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007788 liquid Substances 0.000 title claims description 45
- 238000013459 approach Methods 0.000 claims description 11
- 239000004033 plastic Substances 0.000 claims description 11
- 229920003023 plastic Polymers 0.000 claims description 11
- 230000033001 locomotion Effects 0.000 claims description 10
- -1 polyethylene Polymers 0.000 claims description 4
- 239000007921 spray Substances 0.000 claims description 4
- 238000005507 spraying Methods 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229910020175 SiOH Inorganic materials 0.000 claims description 2
- 230000005540 biological transmission Effects 0.000 claims description 2
- 230000036316 preload Effects 0.000 claims description 2
- 241000272184 Falconiformes Species 0.000 claims 1
- 235000010678 Paulownia tomentosa Nutrition 0.000 claims 1
- 240000002834 Paulownia tomentosa Species 0.000 claims 1
- 235000013601 eggs Nutrition 0.000 claims 1
- 238000005086 pumping Methods 0.000 claims 1
- 210000003128 head Anatomy 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 240000004093 Mitragyna parvifolia Species 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- FMFKNGWZEQOWNK-UHFFFAOYSA-N 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate Chemical compound CCCCOCC(C)OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl FMFKNGWZEQOWNK-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- 101100128278 Mus musculus Lins1 gene Proteins 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 210000004279 orbit Anatomy 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B11/00—Single-unit hand-held apparatus in which flow of contents is produced by the muscular force of the operator at the moment of use
- B05B11/0005—Components or details
- B05B11/0062—Outlet valves actuated by the pressure of the fluid to be sprayed
- B05B11/0064—Lift valves
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B1/00—Nozzles, spray heads or other outlets, with or without auxiliary devices such as valves, heating means
- B05B1/12—Nozzles, spray heads or other outlets, with or without auxiliary devices such as valves, heating means capable of producing different kinds of discharge, e.g. either jet or spray
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B11/00—Single-unit hand-held apparatus in which flow of contents is produced by the muscular force of the operator at the moment of use
- B05B11/01—Single-unit hand-held apparatus in which flow of contents is produced by the muscular force of the operator at the moment of use characterised by the means producing the flow
- B05B11/10—Pump arrangements for transferring the contents from the container to a pump chamber by a sucking effect and forcing the contents out through the dispensing nozzle
- B05B11/1001—Piston pumps
- B05B11/1009—Piston pumps actuated by a lever
- B05B11/1011—Piston pumps actuated by a lever without substantial movement of the nozzle in the direction of the pressure stroke
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B15/00—Details of spraying plant or spraying apparatus not otherwise provided for; Accessories
- B05B15/30—Dip tubes
Landscapes
- Containers And Packaging Bodies Having A Special Means To Remove Contents (AREA)
- Nozzles (AREA)
- Closures For Containers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US85375A US3061202A (en) | 1961-01-27 | 1961-01-27 | Device for spraying or jetting liquids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1882400U true DE1882400U (de) | 1963-11-07 |
Family
ID=22191210
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DET13761U Expired DE1882400U (de) | 1961-01-27 | 1961-09-01 | Fluessigkeitsverteiler, insbesondere -zerstaeuber. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3061202A (https=) |
| CH (1) | CH375668A (https=) |
| DE (1) | DE1882400U (https=) |
| GB (1) | GB917135A (https=) |
| NL (1) | NL273959A (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2744654A1 (de) * | 1976-10-05 | 1978-04-06 | Creative Dispensing Systems | Vorrichtung und verfahren zum zerstaeuben einer fluessigkeit |
| EP0032541A3 (de) * | 1980-01-18 | 1981-09-16 | Karlheinz Kläger | Verstellbare Düse an einem handbetätigten Flüssigkeitszerstäuber |
| DE3443640A1 (de) * | 1984-11-29 | 1986-06-05 | Karlheinz 8902 Neusäß Kläger | Zerstaeuberduese eines fluessigkeitszerstaeubers |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT699939A (https=) * | 1962-06-25 | |||
| US3144867A (en) * | 1962-08-24 | 1964-08-18 | Trupp Garrison | Dental prophylactic |
| US3198439A (en) * | 1963-05-10 | 1965-08-03 | Vilbiss Co | Airless spray gun with variable output |
| US3405843A (en) * | 1966-11-23 | 1968-10-15 | Cornelius B. Watson Jr. | Container-dispenser for collapsible tubes |
| US3474938A (en) * | 1967-12-13 | 1969-10-28 | Cook Chem Co | Sprayer and dispenser mechanism |
| US3478935A (en) * | 1968-02-16 | 1969-11-18 | Texize Chem Inc | Dispensing device |
| US3650473A (en) * | 1970-03-13 | 1972-03-21 | Afa Corp | Liquid dispensing apparatus |
| US3685739A (en) * | 1970-08-07 | 1972-08-22 | Afa Corp | Liquid dispensing apparatus |
| US3904086A (en) * | 1970-12-15 | 1975-09-09 | Luigi Gino Losenno | Apparatus for heating and dispensing liquid shampoo |
| JPS5031286B2 (https=) * | 1971-09-08 | 1975-10-09 | ||
| US3768734A (en) * | 1972-04-26 | 1973-10-30 | Arrowhead Prod Corp | Manually operated sprayer |
| US3840157A (en) * | 1972-10-16 | 1974-10-08 | J Hellenkamp | Hand operated sprayer |
| JPS5222448B2 (https=) * | 1974-02-12 | 1977-06-17 | ||
| US3986644A (en) * | 1975-05-21 | 1976-10-19 | Diamond International Corporation | Dispensing pump |
| JPS5292907A (en) * | 1976-01-31 | 1977-08-04 | Canyon Corp | Sprayers |
| NZ182980A (en) * | 1976-02-09 | 1979-12-11 | Afa Corp | Liquid spryhand-pump with openable vent for liquid reservoir |
| USD243180S (en) | 1976-02-13 | 1977-01-25 | The Afa Corporation | Hand sprayer |
| USD244531S (en) | 1976-02-26 | 1977-05-31 | Colgate-Palmolive Company | Sprayer |
| USD247366S (en) | 1976-10-12 | 1978-02-28 | Drackett Co. | Spray pump |
| US4315582A (en) * | 1977-05-02 | 1982-02-16 | Leeds And Micallef | Universal sequential dispensing pump system free of external check valves and having venting capability |
| US4174056A (en) * | 1977-05-10 | 1979-11-13 | Ciba-Geigy Corporation | Pump type dispenser with continuous flow feature |
| US4273459A (en) * | 1978-11-13 | 1981-06-16 | Hardy Pierre J | Squeegee device for liquid dispensing bottle |
| US4225060A (en) * | 1978-12-29 | 1980-09-30 | Security Plastics, Inc. | Continuous pumping system |
| USD268204S (en) | 1980-07-31 | 1983-03-08 | Afa Consolidated Corporation | Sprayer nozzle or similar article |
| US4365751A (en) * | 1980-09-26 | 1982-12-28 | Yoshino Kogyosho Co., Ltd. | Trigger type liquid injector |
| US4516695A (en) * | 1981-02-09 | 1985-05-14 | The Afa Corporation | Child-resistant liquid dispenser sprayer or like apparatus |
| US4489890A (en) * | 1982-07-06 | 1984-12-25 | Universal Dispensing Systems, Inc. | Hand-operated pump |
| US4527741A (en) * | 1983-06-13 | 1985-07-09 | The Afa Corporation | Trigger pump sprayer |
| ES273524Y (es) * | 1983-07-14 | 1985-04-16 | Monturas Y Fornituras S.A. | Pistola proyectora de liquidos |
| US4669664A (en) * | 1984-04-09 | 1987-06-02 | Waynesboro Textiles, Inc. | Hand manipulatable sprayer |
| US4624413A (en) * | 1985-01-23 | 1986-11-25 | Corsette Douglas Frank | Trigger type sprayer |
| IL82096A0 (en) * | 1987-04-03 | 1987-10-30 | Greenberg Ilan | Variable-spray shower head |
| US4915263A (en) * | 1988-03-08 | 1990-04-10 | S. C. Johnson Son, Inc. | Trigger sprayer device |
| US4993214A (en) * | 1988-03-08 | 1991-02-19 | S. C. Johnson & Son, Inc. | Method of assembling a trigger sprayer device |
| US4940186A (en) * | 1988-10-18 | 1990-07-10 | Atsushi Tada | Manually operated trigger type dispenser, a spinner for use in the dispenser, and a flow-pattern switching mechanism for use in the dispenser |
| US5267692A (en) * | 1989-11-16 | 1993-12-07 | Afa Products Inc. | Adjustable nozzle assembly |
| US4991778A (en) * | 1989-11-16 | 1991-02-12 | Afa Products, Inc. | Adjustable nozzle assembly |
| US4989790A (en) * | 1989-12-26 | 1991-02-05 | Afa Products, Inc. | Nozzle cap, spring valve and body assembly |
| US5044471A (en) * | 1990-04-23 | 1991-09-03 | Lincoln | Grease gun cartridge adapter |
| US5385302A (en) * | 1990-10-25 | 1995-01-31 | Contico | Low cost trigger sprayer |
| US5368234A (en) * | 1991-12-13 | 1994-11-29 | Contico International, Inc. | Nozzle assembly for trigger sprayer |
| CA2106775C (en) * | 1992-01-31 | 1999-08-31 | Donald D. Foster | Liquid dispenser assembly with adaptor |
| KR950700128A (ko) * | 1992-02-07 | 1995-01-16 | 야곱스 코르넬리스 라서 | 각 패턴에 대해 자동조절되는 최적 펌프 행정으로 액체를 상이한 스프레이 패턴으로 스프레이하기 위해 복수 오리피스를 이용하는 스프레이 펌프 패키지(spray pump package employing multiple orifices for dispensing liquid in different spray patterns with automatically adjusted optimized pump stroke for each pattern) |
| US5318206A (en) * | 1992-02-24 | 1994-06-07 | Afa Products, Inc. | Trigger-piston connection |
| US5474210A (en) * | 1992-02-27 | 1995-12-12 | Pump Products, Inc. | Fluid dispensing device |
| US5382373A (en) * | 1992-10-30 | 1995-01-17 | Lord Corporation | Magnetorheological materials based on alloy particles |
| US5358179A (en) * | 1993-08-18 | 1994-10-25 | The Procter & Gamble Company | Atomization systems for high viscosity products |
| US5388766A (en) * | 1993-09-22 | 1995-02-14 | The Procter & Gamble Company | High pressure atomization systems for high viscosity products |
| USD351646S (en) | 1994-02-04 | 1994-10-18 | Contico International, Inc. | Trigger sprayer |
| FR2721285B1 (fr) * | 1994-06-20 | 1996-08-02 | Oreal | Pompe manuelle à précompression pour la pulvérisation d'un liquide et ensemble de distribution équipé d'une telle pompe. |
| US5590834A (en) * | 1994-07-22 | 1997-01-07 | Contico International, Inc. | One-piece trigger sprayer housing |
| US5522547A (en) * | 1994-10-31 | 1996-06-04 | Calmar Inc. | Sprayer having pressure build-up discharge |
| US5593094A (en) * | 1995-02-07 | 1997-01-14 | Calmar Inc. | Pump sprayer having variable discharge |
| DE19638602A1 (de) * | 1995-10-31 | 1997-05-15 | Fritz Meckenstock | Auslaßventil, insbesondere für eine handbetätigte Pumpe und handbetätigte Pumpe |
| US5718383A (en) * | 1996-02-29 | 1998-02-17 | Par Way Group | Viscous liquid spray dispensing systems |
| US5822968A (en) * | 1996-04-23 | 1998-10-20 | Savala; Rodney M. | Garden tool and sprayer |
| US6409103B1 (en) * | 2000-10-24 | 2002-06-25 | 360 Enterprises | 360° rotational directional nozzle for trigger sprayers |
| US6732958B2 (en) | 2000-10-24 | 2004-05-11 | 360 Enterprises | 360 degree rotational directional nozzle for trigger sprayers |
| US6540119B1 (en) * | 2001-01-30 | 2003-04-01 | Unger Marketing International, Llc | Spray bottle holder assembly |
| USD454787S1 (en) | 2001-07-12 | 2002-03-26 | Colgate Palmolive Company | Spray pump head |
| USD456262S1 (en) | 2001-07-17 | 2002-04-30 | Colgate Palmolive Company | Spray pump head |
| DE10200595A1 (de) | 2002-01-10 | 2003-07-31 | Aero Pump Gmbh | Betätigungskopf einer Saug-Druck-Pumpe zum Ausspritzen eines Produkts aus einem Behältnis |
| DE10200593A1 (de) | 2002-01-10 | 2003-07-31 | Aero Pump Gmbh | Betätigungskopf einer Saug-Druck-Pumpe zum Ausspritzen eines Produkts aus einem Behältnis |
| US7189134B2 (en) * | 2002-11-18 | 2007-03-13 | In Zone, Inc. | Interactive beverage bottle top |
| US6886718B2 (en) * | 2003-04-16 | 2005-05-03 | Continental Afa Dispensing Company | Ergonomic trigger for a trigger sprayer |
| USD508852S1 (en) * | 2004-11-24 | 2005-08-30 | Arminak & Associates, Inc. | Shroud |
| US7249692B2 (en) | 2004-11-29 | 2007-07-31 | Seaquistperfect Dispensing Foreign, Inc. | Dispenser with lock |
| USD525123S1 (en) | 2004-11-29 | 2006-07-18 | Seaquist Perfect Dispensing Foreign, Inc. | Trigger pump package |
| US20060113329A1 (en) * | 2004-11-29 | 2006-06-01 | Seaquisperfect Dispensing Foreign, Inc. | Dispenser with lock |
| USD533235S1 (en) | 2005-06-06 | 2006-12-05 | Mattel, Inc. | Squirt gun |
| USD536748S1 (en) | 2005-06-06 | 2007-02-13 | Mattel, Inc. | Squirt gun |
| USD533233S1 (en) | 2005-06-06 | 2006-12-05 | Mattel, Inc. | Squirt gun |
| USD533234S1 (en) | 2005-06-06 | 2006-12-05 | Mattel, Inc. | Squirt gun |
| US20070210106A1 (en) * | 2006-03-07 | 2007-09-13 | Continentalafa Dispensing Company | Trigger Sprayer with Piston Rod and Spring Tamper Evident Connection |
| USD570214S1 (en) | 2006-11-06 | 2008-06-03 | Continentalafa Dispensing Company | Trigger for a trigger sprayer |
| JP4925855B2 (ja) * | 2007-02-19 | 2012-05-09 | 花王株式会社 | トリガー式液体噴出器 |
| USD567083S1 (en) * | 2007-08-30 | 2008-04-22 | Meadwestvaco Corporation | Trigger sprayer shroud |
| FR2961189B1 (fr) * | 2010-06-14 | 2013-02-22 | Valois Sas | Tete de distribution de produit fluide. |
| US9550198B2 (en) | 2010-09-30 | 2017-01-24 | United Technologies Corporation | Ultraviolet angled spray nozzle |
| US9546346B2 (en) | 2011-04-07 | 2017-01-17 | The Dial Corporation | Use of polyethylene glycol to control the spray pattern of sprayable liquid abrasive cleansers |
| JP5755020B2 (ja) * | 2011-05-12 | 2015-07-29 | キャニヨン株式会社 | 容器の口部とキャップとのバヨネット型接続構造 |
| FR3024055B1 (fr) * | 2014-07-25 | 2021-07-02 | Aptar France Sas | Organe de distribution de produit fluide. |
| ES2817723T3 (es) * | 2016-05-24 | 2021-04-08 | Guala Dispensing Spa | Cabezal de gatillo remoto para dispensar un líquido y dispositivo dispensador |
| US11519394B2 (en) * | 2019-06-25 | 2022-12-06 | The Procter & Gamble Company | Buffered pump system |
| CN112916236B (zh) * | 2021-02-09 | 2025-06-20 | 沈利庆 | 斜活塞腔扣手式喷雾器 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US731033A (en) * | 1902-07-30 | 1903-06-16 | Alonzo O Freeman | Hand-sprayer. |
| FR820923A (fr) * | 1936-08-26 | 1937-11-22 | Perfectionnements aux pulvérisateurs de liquides | |
| US2583706A (en) * | 1948-01-05 | 1952-01-29 | Isaac S Prescott | Spray gun nozzle assembly |
| US2639945A (en) * | 1951-08-15 | 1953-05-26 | Allen H Rowlett | Car, floor, and wall washer |
| GB710583A (en) * | 1952-02-21 | 1954-06-16 | Jules Schneider | Spraying means for liquids |
| US2729506A (en) * | 1954-02-25 | 1956-01-03 | Z & W Machine Products Inc | Hand-actuated sprayer |
-
0
- NL NL273959D patent/NL273959A/xx unknown
-
1961
- 1961-01-27 US US85375A patent/US3061202A/en not_active Expired - Lifetime
- 1961-06-12 GB GB21063/61A patent/GB917135A/en not_active Expired
- 1961-06-13 CH CH687461A patent/CH375668A/fr unknown
- 1961-09-01 DE DET13761U patent/DE1882400U/de not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2744654A1 (de) * | 1976-10-05 | 1978-04-06 | Creative Dispensing Systems | Vorrichtung und verfahren zum zerstaeuben einer fluessigkeit |
| EP0032541A3 (de) * | 1980-01-18 | 1981-09-16 | Karlheinz Kläger | Verstellbare Düse an einem handbetätigten Flüssigkeitszerstäuber |
| DE3001687C2 (de) * | 1980-01-18 | 1981-09-17 | Kläger, Karlheinz, 8901 Neusäß | Verstellbare Düse an einem handbetätigten Flüssigkeitszerstäuber |
| DE3443640A1 (de) * | 1984-11-29 | 1986-06-05 | Karlheinz 8902 Neusäß Kläger | Zerstaeuberduese eines fluessigkeitszerstaeubers |
Also Published As
| Publication number | Publication date |
|---|---|
| NL273959A (https=) | |
| GB917135A (en) | 1963-01-30 |
| CH375668A (fr) | 1964-02-29 |
| US3061202A (en) | 1962-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1882400U (de) | Fluessigkeitsverteiler, insbesondere -zerstaeuber. | |
| DE2102252C3 (de) | Luftfreie Spritzpistole | |
| DE3104450C2 (de) | Flüssigkeitsinjektor der Drücker-Bauart | |
| DE3425478C2 (https=) | ||
| DE69025956T2 (de) | Verstellbare düsenanordnung | |
| DE69508734T2 (de) | Sprühvorrichtung mit veränderlicher Sprühstrahlform | |
| DE3250106C2 (de) | Sprühdüse, insbesondere zur Enteisung von Flugzeugen | |
| DE2737680C3 (de) | Spritzpistole | |
| DE2206402C3 (de) | Spritzvorrichtung zum Ausspritzen einer mit Zusatzflüssigkeit vermischten Trägerflüssigkeit | |
| DE2914413A1 (de) | Mischventil fuer zerstaeuberkapseln | |
| DE2555092A1 (de) | Injektionsvorrichtung | |
| DE19840721A1 (de) | Spender für Medien | |
| DE2619354A1 (de) | Luft-fluessigkeits-zerstaeubersystem mit einheitlichem aufbau | |
| DE2837355A1 (de) | Kolben-handpumpe zur zerstaeubung von fluessigkeiten | |
| DE2757522C2 (de) | Rund- oder Ringstrahldüse zum Erzeugen und Abstrahlen eines Nebels oder Aerosols zur Beschichtung von Gegenständen | |
| EP0641604B1 (de) | Zerstäubungsaufsatz für einen Flüssigkeitsbehälter | |
| DE3316113C2 (de) | Spritzpistole | |
| AT237790B (de) | Von Hand betätigbare Vorrichtung zum Sprühen oder Spritzen von Flüssigkeiten | |
| DE2042690A1 (de) | Pumpenzerstauber, insbesondere auf ein Gefäß aufsetzbare Zerstäuberpistole | |
| CH666631A5 (de) | Flammspritzbrenner zur herstellung von oberflaechenschichten auf werkstuecken. | |
| EP0482569B1 (de) | Pneumatisch gesteuerte Spritzpistole | |
| DE202011005437U1 (de) | Nebelbildende gesundheitsfördernde Reinigungsvorrichtung | |
| DE2215348C2 (de) | Sprüheinsatz | |
| DE102008049913A1 (de) | Luftpinsel | |
| DE327570C (de) | Zerstaeuber mit Druckluftbetrieb |