DE1786278C3 - Vakuumverformbare, thermoplastische Verpackungsfolie - Google Patents
Vakuumverformbare, thermoplastische VerpackungsfolieInfo
- Publication number
- DE1786278C3 DE1786278C3 DE1786278A DE1786278A DE1786278C3 DE 1786278 C3 DE1786278 C3 DE 1786278C3 DE 1786278 A DE1786278 A DE 1786278A DE 1786278 A DE1786278 A DE 1786278A DE 1786278 C3 DE1786278 C3 DE 1786278C3
- Authority
- DE
- Germany
- Prior art keywords
- film
- copolymer
- weight
- ethylene
- surface layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920006280 packaging film Polymers 0.000 title claims description 10
- 239000012785 packaging film Substances 0.000 title claims description 10
- 229920001169 thermoplastic Polymers 0.000 title claims description 4
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 4
- 239000010410 layer Substances 0.000 claims description 28
- 229920001577 copolymer Polymers 0.000 claims description 20
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 18
- 239000005977 Ethylene Substances 0.000 claims description 18
- 229920000642 polymer Polymers 0.000 claims description 18
- 239000002344 surface layer Substances 0.000 claims description 15
- 238000002844 melting Methods 0.000 claims description 14
- 230000008018 melting Effects 0.000 claims description 14
- 238000001125 extrusion Methods 0.000 claims description 13
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 11
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 10
- 230000004888 barrier function Effects 0.000 claims description 7
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 7
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 7
- 239000012790 adhesive layer Substances 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims description 3
- 239000005038 ethylene vinyl acetate Substances 0.000 claims 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims 1
- 238000007789 sealing Methods 0.000 description 20
- 238000004806 packaging method and process Methods 0.000 description 9
- 229920006281 multilayer packaging film Polymers 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000011888 foil Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- 239000002131 composite material Substances 0.000 description 3
- 229920001038 ethylene copolymer Polymers 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920006254 polymer film Polymers 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229920000298 Cellophane Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- DHZSIQDUYCWNSB-UHFFFAOYSA-N chloroethene;1,1-dichloroethene Chemical compound ClC=C.ClC(Cl)=C DHZSIQDUYCWNSB-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- -1 polytetrafluoroethylene Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 238000007666 vacuum forming Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B27/00—Layered products comprising a layer of synthetic resin
Landscapes
- Laminated Bodies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US66943067A | 1967-09-21 | 1967-09-21 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1786278A1 DE1786278A1 (de) | 1972-02-17 |
| DE1786278B2 DE1786278B2 (de) | 1981-02-19 |
| DE1786278C3 true DE1786278C3 (de) | 1981-10-22 |
Family
ID=24686297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1786278A Expired DE1786278C3 (de) | 1967-09-21 | 1968-09-11 | Vakuumverformbare, thermoplastische Verpackungsfolie |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3558330A (enExample) |
| JP (1) | JPS5116477B1 (enExample) |
| BE (1) | BE721154A (enExample) |
| BR (1) | BR6802446D0 (enExample) |
| CH (1) | CH535812A (enExample) |
| DE (1) | DE1786278C3 (enExample) |
| DK (1) | DK137172B (enExample) |
| FR (1) | FR1579772A (enExample) |
| GB (1) | GB1238215A (enExample) |
| IT (1) | IT941515B (enExample) |
| NL (1) | NL159327B (enExample) |
| SE (1) | SE359107B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3912843A (en) * | 1970-06-29 | 1975-10-14 | Milprint Inc | Flexible packaging film |
| US3932693A (en) * | 1970-10-19 | 1976-01-13 | Continental Can Company, Inc. | Laminated packaging film having low vapor and gas permeability |
| US3711176A (en) * | 1971-01-14 | 1973-01-16 | Dow Chemical Co | Highly reflective thermoplastic bodies for infrared, visible or ultraviolet light |
| US3741253A (en) * | 1971-03-30 | 1973-06-26 | Grace W R & Co | Laminates of ethylene vinyl acetate polymers and polymers of vinylidene chloride |
| US3955040A (en) * | 1973-01-29 | 1976-05-04 | W. R. Grace & Co. | Polyamide film laminate with entrapped liquid |
| FR2415000A1 (fr) * | 1978-01-20 | 1979-08-17 | Ugine Kuhlmann | Materiau composite polyfluorure de vinylidene et polyurethane obtenu par coextrusion |
| US4207363A (en) * | 1978-03-29 | 1980-06-10 | Union Carbide Corporation | Flexible heat-shrinkable multilayer film for packaging primal meat |
| EP0032027B1 (en) | 1979-12-25 | 1983-07-13 | Kureha Kagaku Kogyo Kabushiki Kaisha | Heat-shrinkable laminate film and process for producing the same |
| US4296156A (en) * | 1979-12-26 | 1981-10-20 | Union Carbide Corporation | Multilayer film including a polyurethane |
| US4352844A (en) * | 1981-05-29 | 1982-10-05 | W. R. Grace & Co. | Thermoplastic film having improved handling and sealing characteristics and receptacle formed therefrom |
| JPS58212944A (ja) * | 1982-06-07 | 1983-12-10 | 出光石油化学株式会社 | 積層体 |
| US4448792A (en) * | 1982-07-26 | 1984-05-15 | W. R. Grace & Co., Cryovac Division | Pasteurizable and cook-in shrink bag constructed of a multilayer film |
| GB2139948B (en) * | 1983-05-18 | 1986-09-10 | British Cellophane Ltd | Multilayer packaging film |
| JPS60133081A (ja) * | 1983-12-21 | 1985-07-16 | Mitsui Petrochem Ind Ltd | 接着剤 |
| DE3431364A1 (de) * | 1984-08-25 | 1986-02-27 | Alkor GmbH Kunststoffe, 8000 München | Heisssiegelbare, flexible verbundfolie sowie verfahren zu deren herstellung |
| US4608302A (en) * | 1985-01-30 | 1986-08-26 | W. R. Grace & Co., Cryovac Div. | Oriented films from propylene copolymers and unplasticized saran |
| US4765999A (en) * | 1985-07-26 | 1988-08-23 | Presto Products, Incorporated | Polyester/copolyester coextruded packaging film |
| CA1296852C (en) * | 1985-10-11 | 1992-03-10 | Henry George Schirmer | High oxygen barrier coextruded film |
| US4705707A (en) * | 1985-12-17 | 1987-11-10 | Presto Products, Incorporated | Polyethylene/polyester nonoriented heat sealable moisture barrier film and bag |
| US4716061A (en) * | 1985-12-17 | 1987-12-29 | Presto Products, Incorporated | Polypropylene/polyester nonoriented heat sealable moisture barrier film and bag |
| US4946743A (en) * | 1987-06-26 | 1990-08-07 | Reynolds Consumer Products, Inc. | Nonoriented polyester films for lidding stock with modified heat seal layer |
| US5190711A (en) * | 1988-06-09 | 1993-03-02 | American National Can Company | Methods for processing polymers |
| US5089308A (en) * | 1987-12-31 | 1992-02-18 | American National Can Company | Coextruded film and methods comprising vinylidene chloride methyl acrylate copolymer |
| US5284687A (en) * | 1987-12-31 | 1994-02-08 | American National Can Company | Coextrustion apparatus, methods, and related films and packages |
| US4944972A (en) * | 1987-12-31 | 1990-07-31 | American National Can Company | Coextrusion apparatus, methods, and related films and packages |
| US4935271A (en) * | 1988-09-06 | 1990-06-19 | W. R. Grace & Co.-Conn. | Lettuce packaging film |
| EP0435788A3 (en) * | 1989-12-28 | 1992-05-27 | American National Can Company | Ma-pvdc formulations, films and structures which maintain high barrier properties after retorting |
| US5108844A (en) * | 1989-12-28 | 1992-04-28 | American National Can Company | Blended films, structures therefrom, and methods of making and using them |
| US5332586A (en) * | 1992-06-30 | 1994-07-26 | Adm Tronics Unlimited, Inc. | Paper pouch for flowable food products |
| US5470594A (en) * | 1992-06-30 | 1995-11-28 | Adm Tronics Unlimited, Inc. | Paper pouch for food products |
| FR2940886B1 (fr) * | 2009-01-13 | 2012-08-24 | Procedes Roland Pigeon | Utilisation d'une composition minerale liquide pour ameliorer la reponse adaptative des plantes a un changement des conditions d'environnement |
| USD704553S1 (en) | 2012-09-10 | 2014-05-13 | The Hillshire Brands Company | Packaging for food product |
| USD688942S1 (en) | 2012-09-10 | 2013-09-03 | The Hillshire Brands Company | Packaging for food product |
| USD712250S1 (en) | 2012-09-10 | 2014-09-02 | The Hillshire Brands Company | Packaging for food product |
| USD705051S1 (en) | 2012-09-18 | 2014-05-20 | The Hillshire Brands Company | Packaging for food product |
| DE102019111454A1 (de) * | 2019-05-03 | 2020-11-05 | Kuhne Anlagenbau Gmbh | Verfahren zur Herstellung einer mehrschichtigen Verbundfolie, mehrschichtige Verbundfolie und deren Verwendung |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2370419A (en) * | 1942-01-21 | 1945-02-27 | Ray Don | Gasproof container |
| BE563470A (enExample) * | 1956-12-22 | |||
| DE1161679B (de) * | 1960-08-17 | 1964-01-23 | Lissmann Alkor Werk | Verfahren zur Herstellung einer siegelfaehigen Verbundfolie |
| US3274004A (en) * | 1963-05-14 | 1966-09-20 | Curwood Inc | Laminated food package |
| DE1228398B (de) * | 1963-09-18 | 1966-11-10 | Union Verpackungs G M B H | Verfahren und Vorrichtung zur Herstellung einer aus einer Polypropylen-Schicht und einer Polyaethylen-Schicht bestehenden heisssiegelfaehigen Verbundfolie |
| US3321804A (en) * | 1964-10-14 | 1967-05-30 | Dow Chemical Co | Extrusion of wide thermoplastic film and sheet |
| FR1484153A (fr) * | 1965-07-01 | 1967-06-09 | Dow Chemical Co | Film d'emballage et procédé de fabrication de ce film |
-
1967
- 1967-09-21 US US669430A patent/US3558330A/en not_active Expired - Lifetime
-
1968
- 1968-08-27 NL NL6812199.A patent/NL159327B/xx not_active IP Right Cessation
- 1968-09-02 FR FR1579772D patent/FR1579772A/fr not_active Expired
- 1968-09-04 JP JP43063093A patent/JPS5116477B1/ja active Pending
- 1968-09-07 IT IT39620/68A patent/IT941515B/it active
- 1968-09-11 DE DE1786278A patent/DE1786278C3/de not_active Expired
- 1968-09-12 CH CH1361268A patent/CH535812A/de not_active IP Right Cessation
- 1968-09-16 SE SE12456/68A patent/SE359107B/xx unknown
- 1968-09-18 GB GB1238215D patent/GB1238215A/en not_active Expired
- 1968-09-19 BR BR202446/68A patent/BR6802446D0/pt unknown
- 1968-09-20 BE BE721154D patent/BE721154A/xx not_active IP Right Cessation
- 1968-09-20 DK DK455268AA patent/DK137172B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL6812199A (enExample) | 1969-03-25 |
| DE1786278B2 (de) | 1981-02-19 |
| DK137172C (enExample) | 1978-09-25 |
| BR6802446D0 (pt) | 1973-02-13 |
| FR1579772A (enExample) | 1969-08-29 |
| JPS5116477B1 (enExample) | 1976-05-24 |
| DE1786278A1 (de) | 1972-02-17 |
| DK137172B (da) | 1978-01-30 |
| SE359107B (enExample) | 1973-08-20 |
| IT941515B (it) | 1973-03-10 |
| NL159327B (nl) | 1979-02-15 |
| GB1238215A (enExample) | 1971-07-07 |
| CH535812A (de) | 1973-04-15 |
| BE721154A (enExample) | 1969-03-20 |
| US3558330A (en) | 1971-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1786278C3 (de) | Vakuumverformbare, thermoplastische Verpackungsfolie | |
| DE2760181C2 (enExample) | ||
| EP0004633B2 (de) | Verfahren zur Herstellung einer heissiegelbaren, opaken Kunststoffolie und ihre Verwendung | |
| DE3210580C2 (enExample) | ||
| DE3650769T2 (de) | Dreischichtkunststoffolien, Verfahren zu deren Herstellung, und daraus hergestellte Verpackungen | |
| DE3305198C2 (enExample) | ||
| DE69032570T2 (de) | Schrumpfbarer Film mit niedriger Schrumpfkraft | |
| DE69519810T2 (de) | Streckbarer Film aus Polyolefin | |
| DE3872140T2 (de) | Hdpe-filme mit unterschiedlicher biaxialer orientierung. | |
| DE69119166T2 (de) | Filme aus Polypropen- und Äthencopolymermischungen | |
| DE2341782C2 (de) | Polymerisatschichtstruktur | |
| DE2725310C2 (enExample) | ||
| DE69516362T2 (de) | Wärmeschrumpfbare, biaxial orientierte, ultradünne Folie und Verfahren zu ihrer Herstellung | |
| DE69229605T2 (de) | Orientierter trennbarer Film und Verfahren zu seiner Herstellung | |
| DE69716113T2 (de) | Biaxial orientierte folien aus fluorkunststoffen | |
| DE2637978A1 (de) | Heissiegelfaehige kunststoffolie und verfahren zu ihrer herstellung | |
| DE2351923B2 (de) | Heißsiegelfähige, orientierte Kunststoffolie | |
| DE69125319T2 (de) | Monoaxial orientiertes mehrlagiges verpackungsmaterial | |
| DE3110247A1 (de) | Verpackungsfolie aus fuenf schichten | |
| DE69214221T2 (de) | Gestreckter, laminierter Film | |
| DE1729068C3 (de) | Selbsttragende Haftfolie | |
| DE3436065A1 (de) | Opake polypropylenfolie mit lichtdurchlaessigen bereichen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3923464C2 (de) | Wärmeschrumpfbare Verbundfolie und ihre Verwendung für Verpackungsverfahren | |
| CH656349A5 (de) | Waermeversiegelbare mehrschichtige folie, verfahren zu deren herstellung und verwendung der folie zu verpackungszwecken. | |
| DE2128732A1 (de) | Einheitliche mehrschichtige Folie |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |