DE1770987A1 - Disubstituierte und trisubstituierte Isocyanurate und Verfahren zum Herstellen derselben - Google Patents
Disubstituierte und trisubstituierte Isocyanurate und Verfahren zum Herstellen derselbenInfo
- Publication number
- DE1770987A1 DE1770987A1 DE19681770987 DE1770987A DE1770987A1 DE 1770987 A1 DE1770987 A1 DE 1770987A1 DE 19681770987 DE19681770987 DE 19681770987 DE 1770987 A DE1770987 A DE 1770987A DE 1770987 A1 DE1770987 A1 DE 1770987A1
- Authority
- DE
- Germany
- Prior art keywords
- metal
- uretedione
- berlin
- disubstituted
- aprotic solvent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 9
- 239000000010 aprotic solvent Substances 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000001913 cyanates Chemical class 0.000 claims description 2
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 claims description 2
- 101100286286 Dictyostelium discoideum ipi gene Proteins 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000000047 product Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 14
- 239000002253 acid Substances 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000011707 mineral Substances 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 5
- -1 diphenyl isocyanate Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001331845 Equus asinus x caballus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 241000656145 Thyrsites atun Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 244000144980 herd Species 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D229/00—Heterocyclic compounds containing rings of less than five members having two nitrogen atoms as the only ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68254567A | 1967-11-13 | 1967-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1770987A1 true DE1770987A1 (de) | 1972-02-10 |
Family
ID=24740163
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681770987 Pending DE1770987A1 (de) | 1967-11-13 | 1968-07-25 | Disubstituierte und trisubstituierte Isocyanurate und Verfahren zum Herstellen derselben |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE1770987A1 (enExample) |
| FR (1) | FR1582371A (enExample) |
| GB (1) | GB1258414A (enExample) |
-
1968
- 1968-07-25 DE DE19681770987 patent/DE1770987A1/de active Pending
- 1968-09-25 FR FR1582371D patent/FR1582371A/fr not_active Expired
- 1968-11-13 GB GB1258414D patent/GB1258414A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1258414A (enExample) | 1971-12-30 |
| FR1582371A (enExample) | 1969-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69002081T2 (de) | Verfahren zur Herstellung von aromatischen Harnstoffen. | |
| DE2360709A1 (de) | S-triazin-vorpolymerisaten | |
| DE1816521A1 (de) | Verfahren zum Herstellen von isocyanuratenthaltenden Polysiocyanatsalzen | |
| DE60128012T2 (de) | Verfahren und vorrichtung zur herstellung von hydrazodicarbonsäureamid unter verwendung von harnstoff als ausgangsmaterial | |
| DE2206366B2 (de) | Verfahren zur Herstellung von substituierten Diaminocarbonylderivaten | |
| DE2851707A1 (de) | Verfahren zur herstellung von phosphornitridchlorid-oligomeren | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| DE2212604A1 (de) | Verfahren zur Herstellung von 2-Halogenaethylphosphonsaeuren | |
| DE1770987A1 (de) | Disubstituierte und trisubstituierte Isocyanurate und Verfahren zum Herstellen derselben | |
| DE3504732A1 (de) | Verfahren zur herstellung eines gemisches von phosphornitridchlorid-oligomeren | |
| DE68916375T2 (de) | Verfahren zur Herstellung von 3-Iminonitrilen. | |
| EP0003052B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-chlormethylimidazol | |
| EP2297101A1 (de) | Verfahren zur herstellung von magnesiumamiden | |
| DE839794C (de) | Verfahren zur Herstellung eines ein saures Alkalicyanamid enthaltenden Produktes | |
| EP0307717B1 (de) | Verfahren zur Herstellung von Phoshanen | |
| DE960191C (de) | Verfahren zur Herstellung von stickstoffhaltigen Vinylaethern | |
| DE1114193B (de) | Verfahren zur Herstellung polyzyklischer Arylnatriumverbindungen | |
| DE1770986A1 (de) | Verfahren zum Herstellen von Isocyanursaeuren und deren Salzen | |
| DE2509262C3 (de) | Verfahren zum Herstellen eines 5-Alkyliden-2-norbornens durch Isomerisieren eines 5-Alkenyl-2-norbornens | |
| DE2031213A1 (enExample) | ||
| DE1568629C3 (de) | Verfahren zur Herstellung von organischen Isocyanaten | |
| DE2460288A1 (de) | Verfahren zur herstellung von tricyclohexylzinnderivaten | |
| DE2159655C3 (de) | Verfahren zur Herstellung von 2-(N-monosubstituierten Amino) -phenylketonen | |
| DE2427617A1 (de) | Verfahren zur herstellung von trineophylzinnhalogeniden | |
| DE1121607B (de) | Verfahren zur Herstellung von unreinem und reinem Bis-(tetrachloraethyl)-disulfid |