DE1768610B2 - Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochlorid - Google Patents
Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochloridInfo
- Publication number
- DE1768610B2 DE1768610B2 DE19681768610 DE1768610A DE1768610B2 DE 1768610 B2 DE1768610 B2 DE 1768610B2 DE 19681768610 DE19681768610 DE 19681768610 DE 1768610 A DE1768610 A DE 1768610A DE 1768610 B2 DE1768610 B2 DE 1768610B2
- Authority
- DE
- Germany
- Prior art keywords
- butanol
- amino
- dihydrochloride
- pure
- ethylenediimine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 17
- CDSXYBLXNJGHHR-UHFFFAOYSA-N butan-1-ol dihydrochloride Chemical compound Cl.Cl.C(CCC)O.C(CCC)O CDSXYBLXNJGHHR-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical group CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 11
- 238000009835 boiling Methods 0.000 claims description 10
- 238000003756 stirring Methods 0.000 claims description 9
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 5
- JCBPETKZIGVZRE-BYPYZUCNSA-N (2s)-2-aminobutan-1-ol Chemical compound CC[C@H](N)CO JCBPETKZIGVZRE-BYPYZUCNSA-N 0.000 claims description 4
- 159000000007 calcium salts Chemical class 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- JCBPETKZIGVZRE-SCSAIBSYSA-N (2r)-2-aminobutan-1-ol Chemical compound CC[C@@H](N)CO JCBPETKZIGVZRE-SCSAIBSYSA-N 0.000 claims 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-M L-tartrate(1-) Chemical compound OC(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-M 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- BTANRVKWQNVYAZ-SCSAIBSYSA-N (2R)-butan-2-ol Chemical compound CC[C@@H](C)O BTANRVKWQNVYAZ-SCSAIBSYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-ZILXKATJSA-N (3R)-2,3-dihydroxybutanedioic acid Chemical compound OC([C@@H](O)C(O)=O)C(O)=O FEWJPZIEWOKRBE-ZILXKATJSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- AEUTYOVWOVBAKS-UWVGGRQHSA-N ethambutol Chemical compound CC[C@@H](CO)NCCN[C@@H](CC)CO AEUTYOVWOVBAKS-UWVGGRQHSA-N 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- ROKJEGPFCIJKBK-UHFFFAOYSA-N 2-chloro-2,3-dihydroxybutanedioic acid Chemical compound ClC(C(=O)O)(O)C(O)C(=O)O ROKJEGPFCIJKBK-UHFFFAOYSA-N 0.000 description 1
- UVRLVWTYHIFQPQ-UHFFFAOYSA-N 4-(2-aminobutoxy)-2,3-dihydroxy-4-oxobutanoic acid Chemical compound C(=O)(O)C(O)C(O)C(=O)OCC(CC)N UVRLVWTYHIFQPQ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 230000002365 anti-tubercular Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229960000285 ethambutol Drugs 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 231100000682 maximum tolerated dose Toxicity 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- XOJVVFBFDXDTEG-UHFFFAOYSA-N pristane Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)C XOJVVFBFDXDTEG-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/14—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic the nitrogen atom of the amino group being further bound to hydrocarbon groups substituted by amino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18491/68A GB1198923A (en) | 1968-04-18 | 1968-04-18 | Process for the Preparation of the Dextrorotatory 2, 2', (Ethylenediimino)-di-1-butanoldihydrochloride |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1768610A1 DE1768610A1 (de) | 1971-11-11 |
| DE1768610B2 true DE1768610B2 (de) | 1973-07-26 |
Family
ID=10113339
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681793779 Pending DE1793779A1 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartrat |
| DE19681768610 Pending DE1768610B2 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochlorid |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681793779 Pending DE1793779A1 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartrat |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3579587A (enExample) |
| AT (1) | AT281786B (enExample) |
| BE (1) | BE729463A (enExample) |
| BG (1) | BG20783A3 (enExample) |
| BR (1) | BR6907187D0 (enExample) |
| CH (1) | CH496654A (enExample) |
| CS (1) | CS158241B2 (enExample) |
| DE (2) | DE1793779A1 (enExample) |
| ES (1) | ES362444A1 (enExample) |
| GB (1) | GB1198923A (enExample) |
| IL (1) | IL31704A (enExample) |
| NL (1) | NL150427B (enExample) |
| OA (1) | OA03019A (enExample) |
| PL (1) | PL81001B1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5318006B2 (enExample) * | 1973-09-28 | 1978-06-13 | ||
| US3944616A (en) * | 1974-10-29 | 1976-03-16 | American Cyanamid Company | Purification of d,d'-2,2'(ethylenediimino)di-1-butanol dihydrochloride |
| US3944617A (en) * | 1976-02-20 | 1976-03-16 | American Cyanamid Company | Synthesis of dl-2-amino-1-butanol |
| DE2933895A1 (de) * | 1979-08-22 | 1981-03-12 | Basf Ag, 6700 Ludwigshafen | Verfahren zur spaltung racemischer aepfelsaeure. |
| US7456222B2 (en) | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| US20040033986A1 (en) * | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| CN101404986B (zh) | 2002-05-17 | 2011-09-28 | 赛奎拉公司 | 用于诊断和治疗感染性疾病的组合物和制药方法 |
| WO2005034857A2 (en) * | 2003-09-05 | 2005-04-21 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| WO2009136965A1 (en) * | 2008-05-06 | 2009-11-12 | Sequella, Inc. | Compositions and methods comprising capuramycin analogues |
| CN103772214B (zh) * | 2012-10-25 | 2016-04-20 | 北大方正集团有限公司 | 制备乙胺丁醇和盐酸乙胺丁醇的方法 |
-
1968
- 1968-04-18 GB GB18491/68A patent/GB1198923A/en not_active Expired
- 1968-06-06 DE DE19681793779 patent/DE1793779A1/de active Pending
- 1968-06-06 DE DE19681768610 patent/DE1768610B2/de active Pending
- 1968-10-23 AT AT1031368A patent/AT281786B/de active
- 1968-11-13 US US775536A patent/US3579587A/en not_active Expired - Lifetime
- 1968-11-26 CH CH1761868A patent/CH496654A/fr not_active IP Right Cessation
-
1969
- 1969-01-13 ES ES362444A patent/ES362444A1/es not_active Expired
- 1969-02-27 IL IL31704A patent/IL31704A/en unknown
- 1969-03-06 BE BE729463D patent/BE729463A/xx unknown
- 1969-03-13 NL NL696903892A patent/NL150427B/xx unknown
- 1969-03-14 BR BR207187/69A patent/BR6907187D0/pt unknown
- 1969-03-15 OA OA53546A patent/OA03019A/xx unknown
- 1969-03-17 BG BG011858A patent/BG20783A3/xx unknown
- 1969-03-21 CS CS204369A patent/CS158241B2/cs unknown
- 1969-04-17 PL PL1969132994A patent/PL81001B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES362444A1 (es) | 1970-09-01 |
| DE1793779A1 (de) | 1975-01-09 |
| BG20783A3 (bg) | 1975-12-20 |
| AT281786B (de) | 1970-06-10 |
| IL31704A (en) | 1972-08-30 |
| BR6907187D0 (pt) | 1973-03-13 |
| US3579587A (en) | 1971-05-18 |
| CS158241B2 (enExample) | 1974-10-15 |
| PL81001B1 (enExample) | 1975-08-30 |
| OA03019A (fr) | 1970-12-15 |
| BE729463A (enExample) | 1969-08-18 |
| NL150427B (nl) | 1976-08-16 |
| IL31704A0 (en) | 1969-04-30 |
| GB1198923A (en) | 1970-07-15 |
| DE1768610A1 (de) | 1971-11-11 |
| NL6903892A (enExample) | 1969-10-21 |
| CH496654A (fr) | 1970-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1958201C3 (de) | Substituierte 2- [N-(2,6-dichlorphenyl)-N-aUylamino] -imidazoline-^), deren Säureadditionssalze, Verfahren zu ihrer Herstellung und deren Verwendung bei der Bekämpfung von Schmerzzuständen | |
| DE2927672A1 (de) | Verfahren zur herstellung des d-kampferats von l-carnitinamid und des d-kampferats von d-carnitinamid | |
| DE1768610B2 (de) | Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochlorid | |
| EP0697406B1 (de) | Verfahren zur Herstellung von 4,6-Dichlor- oder 2,4,6-Trichlorpyrimidin aus 4,6-Dihydroxypyrimidin oder Barbitursäure | |
| CH626085A5 (enExample) | ||
| DE1768612A1 (de) | Verfahren zur Herstellung von sehr reinem,pharmazeutisch geeignetem rechtsdrehenden 2,2'-(AEthylendiimin)-di-1-butanoldihydrochlorid | |
| DE1770510C3 (de) | Verfahren zur Herstellung von Triglycidyl-isocyanurat | |
| DE2548470A1 (de) | Verfahren zur herstellung einer komplexverbindung aus di-(4-hydroxyphenyl)-2,2-propan und phenol | |
| DE2251097B2 (de) | Verfahren zur gewinnung eines gemisches von (+)-cis- und (+)-trans-chrysanthemummonocarbonsaeure | |
| DE2000030C3 (de) | 3-Alkoxy-und 3-Phenoxy-2-(diphenylhydroxy)methyl-propylamine und diese enthaltende Arzneimittel | |
| DE2717001A1 (de) | Arzneimittel mit antithrombotischer wirkung | |
| DE1620222C3 (de) | 3-Pyrrolidinyloxy-substituierte Diphenylessigsäurederivate und Verfahren zu deren Herstellung | |
| DE1925351A1 (de) | 3-Isopropylnorbornanamine und Verfahren zu ihrer Herstellung | |
| DE1958515C3 (enExample) | ||
| DE69001461T2 (de) | Stereoisomere. | |
| EP0166215B1 (de) | Verfahren zur Herstellung von racemischem Asocainol | |
| DE2229931A1 (de) | Verfahren zur herstellung von neuen o-substituierten phenylaethylguanidinen | |
| DE1468283C (enExample) | ||
| DE1958212B2 (de) | Substituierte 2- [N-(2-Chlorphenyl)-N-(cycloalkyl)amino] -imidazoline- (2), deren Säureadditionssalze, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE1643266C3 (de) | 1 Phenoxy 2 hydroxy 3 sek alkylamino propane, ein Verfahren zu ihrer Herstel lung und diese enthaltende Präparate | |
| DE2032097C (de) | Verfahren zur Abtrennung von (+)trans-Chrysanthemummonocarbonsäure aus (+)-trans-Chrysanthemummonocarbonsäure | |
| DE2132315A1 (de) | Derivate der Hydrofluorendicarbonsaeure und Verfahren zu ihrer Herstellung | |
| AT368484B (de) | Verfahren zur herstellung von neuen substituierten 3-(3'-amino-2'-hydroxypropoxyphenyl)acryls[urederivaten | |
| DE1543613C (de) | Verfahren zur Spaltung von dl Ephednn in dessen optisch aktive Komponenten | |
| AT309395B (de) | Verfahren zur Herstellung von (+)-2,2'-(Äthylendiimino)-di-1-butanol-dihydrochlorid |