AT281786B - Verfahren zur Herstellung von sehr reinem (+)2,2'-(Äthylendiimino)-di-1-butanol-dihydrochlorid - Google Patents
Verfahren zur Herstellung von sehr reinem (+)2,2'-(Äthylendiimino)-di-1-butanol-dihydrochloridInfo
- Publication number
- AT281786B AT281786B AT1031368A AT1031368A AT281786B AT 281786 B AT281786 B AT 281786B AT 1031368 A AT1031368 A AT 1031368A AT 1031368 A AT1031368 A AT 1031368A AT 281786 B AT281786 B AT 281786B
- Authority
- AT
- Austria
- Prior art keywords
- ethylenediimino
- dihydrochloride
- butanol
- pure
- production
- Prior art date
Links
- AUAHHJJRFHRVPV-BZDVOYDHSA-N ethambutol dihydrochloride Chemical compound [Cl-].[Cl-].CC[C@@H](CO)[NH2+]CC[NH2+][C@@H](CC)CO AUAHHJJRFHRVPV-BZDVOYDHSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/14—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic the nitrogen atom of the amino group being further bound to hydrocarbon groups substituted by amino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18491/68A GB1198923A (en) | 1968-04-18 | 1968-04-18 | Process for the Preparation of the Dextrorotatory 2, 2', (Ethylenediimino)-di-1-butanoldihydrochloride |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT281786B true AT281786B (de) | 1970-06-10 |
Family
ID=10113339
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1031368A AT281786B (de) | 1968-04-18 | 1968-10-23 | Verfahren zur Herstellung von sehr reinem (+)2,2'-(Äthylendiimino)-di-1-butanol-dihydrochlorid |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3579587A (enExample) |
| AT (1) | AT281786B (enExample) |
| BE (1) | BE729463A (enExample) |
| BG (1) | BG20783A3 (enExample) |
| BR (1) | BR6907187D0 (enExample) |
| CH (1) | CH496654A (enExample) |
| CS (1) | CS158241B2 (enExample) |
| DE (2) | DE1768610B2 (enExample) |
| ES (1) | ES362444A1 (enExample) |
| GB (1) | GB1198923A (enExample) |
| IL (1) | IL31704A (enExample) |
| NL (1) | NL150427B (enExample) |
| OA (1) | OA03019A (enExample) |
| PL (1) | PL81001B1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5318006B2 (enExample) * | 1973-09-28 | 1978-06-13 | ||
| US3944616A (en) * | 1974-10-29 | 1976-03-16 | American Cyanamid Company | Purification of d,d'-2,2'(ethylenediimino)di-1-butanol dihydrochloride |
| US3944619A (en) * | 1976-02-20 | 1976-03-16 | American Cyanamid Company | Synthesis of d-2-amino-1-butanol |
| DE2933895A1 (de) * | 1979-08-22 | 1981-03-12 | Basf Ag, 6700 Ludwigshafen | Verfahren zur spaltung racemischer aepfelsaeure. |
| US7456222B2 (en) * | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| US20040033986A1 (en) * | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| US7652039B2 (en) * | 2002-05-17 | 2010-01-26 | Sequella, Inc. | Methods of use and compositions for the diagnosis and treatment of infectious disease |
| US7884097B2 (en) * | 2003-09-05 | 2011-02-08 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| US20090281054A1 (en) * | 2008-05-06 | 2009-11-12 | Venkata Reddy | Compositions and methods comprising capuramycin analogues |
| CN103772214B (zh) * | 2012-10-25 | 2016-04-20 | 北大方正集团有限公司 | 制备乙胺丁醇和盐酸乙胺丁醇的方法 |
-
1968
- 1968-04-18 GB GB18491/68A patent/GB1198923A/en not_active Expired
- 1968-06-06 DE DE19681768610 patent/DE1768610B2/de active Pending
- 1968-06-06 DE DE19681793779 patent/DE1793779A1/de active Pending
- 1968-10-23 AT AT1031368A patent/AT281786B/de active
- 1968-11-13 US US775536A patent/US3579587A/en not_active Expired - Lifetime
- 1968-11-26 CH CH1761868A patent/CH496654A/fr not_active IP Right Cessation
-
1969
- 1969-01-13 ES ES362444A patent/ES362444A1/es not_active Expired
- 1969-02-27 IL IL31704A patent/IL31704A/en unknown
- 1969-03-06 BE BE729463D patent/BE729463A/xx unknown
- 1969-03-13 NL NL696903892A patent/NL150427B/xx unknown
- 1969-03-14 BR BR207187/69A patent/BR6907187D0/pt unknown
- 1969-03-15 OA OA53546A patent/OA03019A/xx unknown
- 1969-03-17 BG BG011858A patent/BG20783A3/xx unknown
- 1969-03-21 CS CS204369A patent/CS158241B2/cs unknown
- 1969-04-17 PL PL1969132994A patent/PL81001B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1793779A1 (de) | 1975-01-09 |
| BG20783A3 (bg) | 1975-12-20 |
| NL6903892A (enExample) | 1969-10-21 |
| DE1768610B2 (de) | 1973-07-26 |
| PL81001B1 (enExample) | 1975-08-30 |
| CH496654A (fr) | 1970-09-30 |
| ES362444A1 (es) | 1970-09-01 |
| NL150427B (nl) | 1976-08-16 |
| CS158241B2 (enExample) | 1974-10-15 |
| BR6907187D0 (pt) | 1973-03-13 |
| IL31704A (en) | 1972-08-30 |
| GB1198923A (en) | 1970-07-15 |
| OA03019A (fr) | 1970-12-15 |
| BE729463A (enExample) | 1969-08-18 |
| DE1768610A1 (de) | 1971-11-11 |
| IL31704A0 (en) | 1969-04-30 |
| US3579587A (en) | 1971-05-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT299142B (de) | Verfahren zur Herstellung von 2,2-Dimethylpropandiol-(1,3) | |
| CH525183A (de) | Verfahren zur Herstellung von 3,4-Dihydronaphthalino-noxy-2-hydroxypropylaminen | |
| CH511204A (de) | Verfahren zur Herstellung von 4,4',4''-Trihydroxytriphenylmethylmethan | |
| CH526618A (de) | Verfahren zur Herstellung von 1,3,2-Oxazaboriniden | |
| AT281786B (de) | Verfahren zur Herstellung von sehr reinem (+)2,2'-(Äthylendiimino)-di-1-butanol-dihydrochlorid | |
| CH532611A (de) | Verfahren zur Herstellung von 4 ,a-1 -Demethyl-7-halogen-7-desoxy-lincomycinen | |
| AT300364B (de) | Verfahren zur Herstellung von linearen 3,3,3-Trifluorpropylmethylpolysiloxanen | |
| CH542801A (de) | Verfahren zur Herstellung von 1,1-Dihydroperfluoralkanolen | |
| CH531523A (de) | Verfahren zur Herstellung von 2,6-Dichlor-4-heterocyclyl-pyridin-3,5-dicarbonitrilen | |
| CH517055A (de) | Verfahren zur Herstellung von 3,5-Dimethylphenol | |
| CH529083A (de) | Verfahren zur Herstellung von Tricyclo-(4,3,1,13,8)-undecan-4-on | |
| AT287665B (de) | Verfahren zur Herstellung von 2,2-Dimethyl-3-hydroxypropanal | |
| CH527185A (de) | Verfahren zur Herstellung von 6,7-Dihydro-5H-pyrrolizinen | |
| CH517110A (de) | Verfahren zur Herstellung von 2,1,3-Benzothiadiazolen | |
| CH537378A (de) | Verfahren zur Herstellung von reinem 3'''- und 4'''-O-Methyldigoxin | |
| CH520143A (de) | Verfahren zur Herstellung von 4,5,6,7-Tetrahydrobenzimidazolen | |
| CH524556A (de) | Verfahren zur Herstellung von 2,3,6-Trimethylhydrochinon | |
| CH537968A (de) | Verfahren zur Herstellung von 2,2'-Diacylamino-1,1'-dianthrachinonylen | |
| CH504438A (de) | Verfahren zur Herstellung von 1,2,3,4,4a,5,6,10b-Octahydrobenz(h)isochinolin-6-on | |
| CH516564A (de) | Verfahren zur Herstellung von 4,5,6-Tri-chlorpyrimidinen | |
| CH515253A (de) | Verfahren zur Herstellung von 2,4-Diamino-6-alkylthio-s-triazinen | |
| AT309393B (de) | Verfahren zur Herstellung von reinem 2,2-Dimethylpropandiol-(1,3) | |
| CH535760A (de) | Verfahren zur Herstellung von 4,5,6,7-Tetrahydro-cyclopenta-1,3-dioxinonen-(4) | |
| CH517088A (de) | Verfahren zur Herstellung von 3B,14BB-Dihydroxy-carda-4,20(22)-dienoliden | |
| CH536854A (de) | Verfahren zur Herstellung von 6,7 Methylendioxycinnolin-3-carbonitrilen |